Compare commits
2797 commits
Author | SHA1 | Date | |
---|---|---|---|
fcc90d25ac | |||
e150453801 | |||
e2582ffec5 | |||
a6508154cb | |||
7348eec671 | |||
4221fa50dd | |||
e0ebd43e7a | |||
c7ee9de9eb | |||
950db697a0 | |||
358b3b75a5 | |||
7e559a01b3 | |||
23bdde245a | |||
2c269b640b | |||
![]() |
f1c8ffedda | ||
![]() |
aace6033c5 | ||
![]() |
7171c7fb06 | ||
![]() |
993f066f2c | ||
![]() |
980031f524 | ||
![]() |
bcaf0d08bc | ||
![]() |
ac439c949b | ||
![]() |
20b3f87dbe | ||
![]() |
9e55717041 | ||
![]() |
772b6610cb | ||
![]() |
3f27f626df | ||
![]() |
29743e70b7 | ||
![]() |
54220601ed | ||
![]() |
9a6f8970ae | ||
![]() |
28f90ad6b5 | ||
![]() |
535317e4f7 | ||
![]() |
072db39233 | ||
![]() |
c6365f2631 | ||
![]() |
d520f64fee | ||
![]() |
2308d2e240 | ||
![]() |
0b4efae392 | ||
![]() |
0b646d2d18 | ||
![]() |
a4d81a6e3c | ||
![]() |
5e742eab17 | ||
![]() |
b9b8bbd2ea | ||
![]() |
8df52bf2a2 | ||
![]() |
55f45ae8a0 | ||
![]() |
2219cf8198 | ||
![]() |
9be2f63475 | ||
![]() |
812d8d2349 | ||
![]() |
20dcdd8b86 | ||
![]() |
bc399182ba | ||
![]() |
71d63f6b93 | ||
![]() |
0b6cfaa9c5 | ||
![]() |
b81914fbf5 | ||
![]() |
b30f066c41 | ||
![]() |
2e20fc5b75 | ||
![]() |
ca05e68890 | ||
![]() |
7a9d5772db | ||
![]() |
dffd951369 | ||
![]() |
d67eb2f1cc | ||
![]() |
3a9bf69aa7 | ||
![]() |
d1f4c0f150 | ||
![]() |
b7991b5dc6 | ||
![]() |
c1a2c9cc70 | ||
![]() |
37f760959d | ||
![]() |
cea3e4b927 | ||
![]() |
29531c83c4 | ||
![]() |
4c3e3aeb6a | ||
![]() |
c176d97870 | ||
![]() |
7d6f75bb05 | ||
![]() |
7b40c527c8 | ||
![]() |
f292850d05 | ||
![]() |
8d5427e92f | ||
![]() |
b8131c8393 | ||
![]() |
e52a83751e | ||
![]() |
ffa724ef37 | ||
![]() |
1d00fe994a | ||
![]() |
71abbe06da | ||
![]() |
f755460242 | ||
![]() |
2ffc067097 | ||
![]() |
b6a8e508bf | ||
![]() |
1def26a35b | ||
![]() |
07871188aa | ||
![]() |
c8dc60cb68 | ||
![]() |
526c84dfa6 | ||
![]() |
21f90f3f32 | ||
![]() |
83586ef90f | ||
![]() |
59bd58aca7 | ||
![]() |
1ec1eba496 | ||
![]() |
d29b840343 | ||
![]() |
b762a0782a | ||
![]() |
15ab0c9592 | ||
![]() |
41945c5e37 | ||
![]() |
f5661fe349 | ||
![]() |
0eeeb4bd35 | ||
![]() |
1d56a4c0d0 | ||
![]() |
b642c98d40 | ||
![]() |
0fb3c0f3d2 | ||
![]() |
b7955a5871 | ||
![]() |
290f8fd51e | ||
![]() |
ec36df4a34 | ||
![]() |
c95e42bf82 | ||
![]() |
5e82fe3946 | ||
![]() |
f4c8176d83 | ||
![]() |
9da2a148c6 | ||
![]() |
2a0b6da2f9 | ||
![]() |
f7641218cb | ||
![]() |
1b78bd617c | ||
![]() |
09612b1921 | ||
![]() |
bbd98e7b2f | ||
![]() |
da0f6bd5e1 | ||
![]() |
bbc2c584ec | ||
![]() |
7f0c571a44 | ||
![]() |
53040dc6be | ||
![]() |
1cacfab2a6 | ||
![]() |
bab09e3fe7 | ||
![]() |
dd176a5e9e | ||
![]() |
a6ce5eb21d | ||
![]() |
b53479f8e4 | ||
![]() |
1f752530d2 | ||
![]() |
2c46fde742 | ||
![]() |
d57efba381 | ||
![]() |
f2fce2e305 | ||
![]() |
b5f0ecb165 | ||
![]() |
7e683dfc4a | ||
![]() |
0b8315fc78 | ||
![]() |
ffd694e7b7 | ||
![]() |
80dc4eb7a9 | ||
![]() |
518c108c88 | ||
![]() |
bd1993f440 | ||
![]() |
91ea9021d7 | ||
![]() |
2903b376b5 | ||
![]() |
9d2684046f | ||
![]() |
3b92bb3a9e | ||
![]() |
5ec899cf08 | ||
![]() |
458c95696a | ||
![]() |
08a89c490a | ||
![]() |
a9495b6a70 | ||
![]() |
1bba6d9947 | ||
![]() |
f4f79f170a | ||
![]() |
9c466796da | ||
![]() |
e88b8fc9bc | ||
![]() |
3aafe578f0 | ||
![]() |
af0f84762c | ||
![]() |
be6eb5f815 | ||
![]() |
57fdacdb83 | ||
![]() |
ece29d7b6c | ||
![]() |
5e1c0a5187 | ||
![]() |
25e62fe6ef | ||
![]() |
d70bac74f0 | ||
![]() |
fd1ec01128 | ||
![]() |
0b4629ea29 | ||
![]() |
27214cc62f | ||
![]() |
d2d0206b45 | ||
![]() |
eede274529 | ||
![]() |
ee781ec489 | ||
![]() |
ca660f4087 | ||
![]() |
ce156d6278 | ||
![]() |
e531f98079 | ||
![]() |
09ce2d5a40 | ||
![]() |
ae8212069c | ||
![]() |
4eb5866379 | ||
![]() |
a86a33445e | ||
![]() |
12f8b7bdf7 | ||
![]() |
2f2ebd0f07 | ||
![]() |
2917463bb6 | ||
![]() |
16bf13787d | ||
![]() |
b7d26b6b8c | ||
![]() |
19e65f5bb9 | ||
![]() |
735327e46b | ||
![]() |
2988ff3ee9 | ||
![]() |
431a4d7433 | ||
![]() |
58be7e9d5b | ||
![]() |
ddec77c37f | ||
![]() |
89d7009a18 | ||
![]() |
793a15883e | ||
![]() |
76897c24de | ||
![]() |
5e11a2ecf6 | ||
![]() |
e23193b730 | ||
![]() |
9146cdc835 | ||
![]() |
1f38894f02 | ||
![]() |
d72d6f8c7c | ||
![]() |
aab4dec27e | ||
![]() |
db67630363 | ||
![]() |
c887412825 | ||
![]() |
2feb07e1d3 | ||
![]() |
6f8b825b0b | ||
![]() |
cad50c9149 | ||
![]() |
d6939e52b4 | ||
![]() |
3f7de5872e | ||
![]() |
1dc632174e | ||
![]() |
eff5341335 | ||
![]() |
83e4d95741 | ||
![]() |
9b6447c4cb | ||
![]() |
ec5ed490d9 | ||
![]() |
d17bd35909 | ||
![]() |
3b7cc19faa | ||
![]() |
067ca5bd43 | ||
![]() |
525a28f3fe | ||
![]() |
a0cd8835e0 | ||
![]() |
231ca0363a | ||
![]() |
88e7d86087 | ||
![]() |
0212e52b66 | ||
![]() |
da4450b574 | ||
![]() |
ab4dbbedf0 | ||
![]() |
6e741f6156 | ||
![]() |
fb0c538a2b | ||
![]() |
f9cb6cb59b | ||
![]() |
1402d437b5 | ||
![]() |
dd58c640fa | ||
![]() |
2c2727bf66 | ||
![]() |
b8ace1eb98 | ||
![]() |
7c3d5b46f3 | ||
![]() |
a849d8452b | ||
![]() |
610e1666c0 | ||
![]() |
94d7836321 | ||
![]() |
0491d8517c | ||
![]() |
f6f2a53a0c | ||
![]() |
ce290f5f8b | ||
![]() |
d9911cf23d | ||
![]() |
1afc70e788 | ||
![]() |
c189273471 | ||
![]() |
22aceb4d67 | ||
![]() |
da6ccf4425 | ||
![]() |
d02bf0e5c7 | ||
![]() |
10aac388f0 | ||
![]() |
00e2af1561 | ||
![]() |
6a7c06d26e | ||
![]() |
efe477d0db | ||
![]() |
e17ef2edd8 | ||
![]() |
30a8b8e5e4 | ||
![]() |
2498da3909 | ||
![]() |
2791e1c385 | ||
![]() |
0303014acb | ||
![]() |
9243edf7af | ||
![]() |
ab523719a6 | ||
![]() |
b27987f1d1 | ||
![]() |
30238528fe | ||
![]() |
29c9ea1a2b | ||
![]() |
58f9588261 | ||
![]() |
3dc8deef67 | ||
![]() |
fa25857680 | ||
![]() |
254df6d6f2 | ||
![]() |
40edde2694 | ||
![]() |
9258237b85 | ||
![]() |
1bf28eb286 | ||
![]() |
77eeb63b62 | ||
![]() |
43db60bbee | ||
![]() |
6b1c313efd | ||
![]() |
d05458c7fb | ||
![]() |
b87b1a3801 | ||
![]() |
ba519334d1 | ||
![]() |
3ac131cb51 | ||
![]() |
9b88f01378 | ||
![]() |
49cd050272 | ||
![]() |
0d8928bdf5 | ||
![]() |
54b75dbe1a | ||
![]() |
b98d651144 | ||
![]() |
9a841ba5e2 | ||
![]() |
4ccdf99a43 | ||
![]() |
f8ab8d462c | ||
![]() |
fb9bc01939 | ||
![]() |
ec61444b3d | ||
![]() |
66304a418e | ||
![]() |
6bb6c16bc7 | ||
![]() |
c43deb1307 | ||
![]() |
b65b514270 | ||
![]() |
9b65e18261 | ||
![]() |
b40423fc2d | ||
![]() |
28fb3f44a7 | ||
![]() |
d607ab2981 | ||
![]() |
9cd648f78f | ||
![]() |
703d583f6f | ||
![]() |
f0d694cfe5 | ||
![]() |
3d319cbd09 | ||
![]() |
e4c4259674 | ||
![]() |
15fedf5976 | ||
![]() |
68384a00dc | ||
![]() |
e9ddd6dc36 | ||
![]() |
6ce65badeb | ||
![]() |
9ee6521d6a | ||
![]() |
72f48fa963 | ||
![]() |
b3784dcc4a | ||
![]() |
34878f9293 | ||
![]() |
adaa39f572 | ||
![]() |
1d5a0630ef | ||
![]() |
855fa7e1e2 | ||
![]() |
f2f023e7b3 | ||
![]() |
33251e880e | ||
![]() |
358816d9e7 | ||
![]() |
362d545f34 | ||
![]() |
fb81a8302c | ||
![]() |
e7a44d9979 | ||
![]() |
2eaeb1891d | ||
![]() |
5aa8d1f9a3 | ||
![]() |
098ed5b1cf | ||
![]() |
890ec64f3c | ||
![]() |
ba32422059 | ||
![]() |
8b3a9c9dad | ||
![]() |
2a22e8939c | ||
![]() |
6bee65780c | ||
![]() |
e030dc841d | ||
![]() |
25a27af29c | ||
![]() |
daf68cad01 | ||
![]() |
ab57fb3f0f | ||
![]() |
f43259fbc1 | ||
![]() |
bfe6b5bc25 | ||
![]() |
23e6eef604 | ||
![]() |
d2aa91502a | ||
![]() |
4f6ee1fb22 | ||
![]() |
ddafa9ed97 | ||
![]() |
0ca3b31b2e | ||
![]() |
9f984241c4 | ||
![]() |
d6fa83cd87 | ||
![]() |
8781e34c98 | ||
![]() |
49da9776e7 | ||
![]() |
36b9e00dc9 | ||
![]() |
5cb643a32a | ||
![]() |
1fa6e35663 | ||
![]() |
e82f0f37d8 | ||
![]() |
7fa39d42e2 | ||
![]() |
a95cc2b9e8 | ||
![]() |
e7b8b6e818 | ||
![]() |
5a7deadba2 | ||
![]() |
9065f42195 | ||
![]() |
b37981e83f | ||
![]() |
0d9c5a078b | ||
![]() |
c35c0f8b61 | ||
![]() |
8b4b3de336 | ||
![]() |
85d62a8e38 | ||
![]() |
52c8f3e12c | ||
![]() |
d0d568b3a5 | ||
![]() |
666c16b74e | ||
![]() |
2f115c0717 | ||
![]() |
d4089fbc6e | ||
![]() |
ba521abf4f | ||
![]() |
c036932ce4 | ||
![]() |
96ba039299 | ||
![]() |
1103b09a76 | ||
![]() |
cd7c1bba21 | ||
![]() |
1973614840 | ||
![]() |
cbbd77c49c | ||
![]() |
aa500351ed | ||
![]() |
de8751b86c | ||
![]() |
a1b05540be | ||
![]() |
e0dc858451 | ||
![]() |
1889f7d269 | ||
![]() |
cdc857065b | ||
![]() |
dfdb7a9b59 | ||
![]() |
4363b7c5d7 | ||
![]() |
27fce173ce | ||
![]() |
0b7d2f5aed | ||
![]() |
25c48a97c5 | ||
![]() |
a40add8f41 | ||
![]() |
3bdc7175a3 | ||
![]() |
90e35ee3db | ||
![]() |
90630fe852 | ||
![]() |
b6618c8ee5 | ||
![]() |
98fc82acfd | ||
![]() |
91e7001963 | ||
![]() |
d154986128 | ||
![]() |
3e4bbf7092 | ||
![]() |
faeb2cb7e2 | ||
![]() |
35131c8732 | ||
![]() |
2a9d5f74ce | ||
![]() |
f4cb1cb097 | ||
![]() |
e23998a88b | ||
![]() |
e39581695f | ||
![]() |
dd9e41f651 | ||
![]() |
97e7026cc9 | ||
![]() |
853cc871f7 | ||
![]() |
fc96fb40fb | ||
![]() |
172fe6c49c | ||
![]() |
9fa592c5d6 | ||
![]() |
bbffe1dc82 | ||
![]() |
55a115e57a | ||
![]() |
7ab3d2b635 | ||
![]() |
51d7c10bc5 | ||
![]() |
b13fc99e95 | ||
![]() |
b231c194a4 | ||
![]() |
b5da5a46de | ||
![]() |
8522123cd3 | ||
![]() |
bae6bc2133 | ||
![]() |
2f70ce2d5c | ||
![]() |
7ac505f1f4 | ||
![]() |
f47e45a928 | ||
![]() |
a9ab59eb92 | ||
![]() |
a0075f6f78 | ||
![]() |
8b07289452 | ||
![]() |
c1f2f84c7f | ||
![]() |
da13254caa | ||
![]() |
fe4a178d43 | ||
![]() |
1fc17658ff | ||
![]() |
a5c1cba81b | ||
![]() |
4809cf039e | ||
![]() |
a812181466 | ||
![]() |
441a6e5e0c | ||
![]() |
b5c68831b5 | ||
![]() |
cf1ef23996 | ||
![]() |
70cc754f3e | ||
![]() |
72dda3771e | ||
![]() |
4247804707 | ||
![]() |
e308108bf7 | ||
![]() |
f708cb0b25 | ||
![]() |
1f3877b7cb | ||
![]() |
72e4daafc1 | ||
![]() |
549976dcfb | ||
![]() |
756b4b9d18 | ||
![]() |
f70772fabc | ||
![]() |
ec8a8d5ddc | ||
![]() |
6d79766b24 | ||
![]() |
421266e70c | ||
![]() |
d87de1dc4f | ||
![]() |
dc99828b66 | ||
![]() |
5e8ea67773 | ||
![]() |
0d30247353 | ||
![]() |
aaf6f05820 | ||
![]() |
954a2b78be | ||
![]() |
230a54cb99 | ||
![]() |
13565d1c45 | ||
![]() |
919d8d109f | ||
![]() |
659f5a8fe1 | ||
![]() |
f86cc83996 | ||
![]() |
7525aaaa87 | ||
![]() |
115e95b9a8 | ||
![]() |
5940778189 | ||
![]() |
1a15d70568 | ||
![]() |
d66dd5f199 | ||
![]() |
507a9ffc71 | ||
![]() |
cd82f8927b | ||
![]() |
cddec51582 | ||
![]() |
78deb5d09a | ||
![]() |
4328b9e385 | ||
![]() |
44112a3a4b | ||
![]() |
9efe767654 | ||
![]() |
edb5393cdc | ||
![]() |
6d7754cf2a | ||
![]() |
4beca7af20 | ||
![]() |
a201072a9d | ||
![]() |
07b1d0841e | ||
![]() |
eccb855d09 | ||
![]() |
2f4877a264 | ||
![]() |
d84b98041f | ||
![]() |
2ae2cdc4bd | ||
![]() |
d1d781966f | ||
![]() |
53cf771c81 | ||
![]() |
d45ee34b0c | ||
![]() |
e1a64de205 | ||
![]() |
b30f6cdf3a | ||
![]() |
3dfab8e42d | ||
![]() |
7bae01f03c | ||
![]() |
f3dddf0e40 | ||
![]() |
0b7791070f | ||
![]() |
4125be7e8d | ||
![]() |
746e13d134 | ||
![]() |
b7ccc6ea07 | ||
![]() |
a6bc3fb793 | ||
![]() |
9f7e70f240 | ||
![]() |
0ee6725188 | ||
![]() |
f572757f00 | ||
![]() |
abcf1e1895 | ||
![]() |
a9e9474f5c | ||
![]() |
a11be5a1e1 | ||
![]() |
e23b2f8711 | ||
![]() |
032d37194f | ||
![]() |
3e56950872 | ||
![]() |
5a2612acab | ||
![]() |
bda05aed86 | ||
![]() |
91ac1a9031 | ||
![]() |
53e8c15267 | ||
![]() |
d329b2945c | ||
![]() |
abca0115a6 | ||
![]() |
3d6cc8a490 | ||
![]() |
836fc0bf5b | ||
![]() |
510b8383a4 | ||
![]() |
8b15f1304f | ||
![]() |
6274e33a8c | ||
![]() |
1f97d4f5e5 | ||
![]() |
b566549d15 | ||
![]() |
4d8c8b199c | ||
![]() |
d1d69e9488 | ||
![]() |
a01fd62899 | ||
![]() |
70956a2c47 | ||
![]() |
e894d1d1f4 | ||
![]() |
cc7b9ccb86 | ||
![]() |
a807a0f50c | ||
![]() |
99065548ff | ||
![]() |
df897aef13 | ||
![]() |
1cfc275eae | ||
![]() |
3968e40a0b | ||
![]() |
ac6106ca69 | ||
![]() |
eed73eca81 | ||
![]() |
608da824d9 | ||
![]() |
03fc301dec | ||
![]() |
1cad8b2481 | ||
![]() |
e930199f83 | ||
![]() |
60044d5cdf | ||
![]() |
e793ba6630 | ||
![]() |
67ec6f7773 | ||
![]() |
ddb8e3656f | ||
![]() |
e49e0edc57 | ||
![]() |
e255c35e86 | ||
![]() |
48daa042d1 | ||
![]() |
64c58a3cf8 | ||
![]() |
a9fbf48053 | ||
![]() |
ccb4661b39 | ||
![]() |
c5344d2df6 | ||
![]() |
669e50e406 | ||
![]() |
7221400b88 | ||
![]() |
6e50288bd4 | ||
![]() |
84de5e09a2 | ||
![]() |
f717bc47e5 | ||
![]() |
f732e04f49 | ||
![]() |
ecf46fa6fe | ||
![]() |
b1ec1b8817 | ||
![]() |
bd7e6f9f8a | ||
![]() |
75caface6b | ||
![]() |
de373a683b | ||
![]() |
5ab47aeead | ||
![]() |
62aa0c5965 | ||
![]() |
625982d639 | ||
![]() |
9f65de2ba6 | ||
![]() |
f4267737c3 | ||
![]() |
74678882ee | ||
![]() |
4e2125d613 | ||
![]() |
12e4779093 | ||
![]() |
844c629a6a | ||
![]() |
a40b44b6e3 | ||
![]() |
bc8b5a8d32 | ||
![]() |
8be7dac33b | ||
![]() |
b2aea57da6 | ||
![]() |
a007606863 | ||
![]() |
90075b3b65 | ||
![]() |
4ecea891b3 | ||
![]() |
845b5cda1a | ||
![]() |
f2915afda4 | ||
![]() |
d504da19c5 | ||
![]() |
ec7b0cdda1 | ||
![]() |
9f0cfc68c1 | ||
![]() |
1f3b5a49c4 | ||
![]() |
a84bcf688b | ||
![]() |
4729785b05 | ||
![]() |
6b6e358dbe | ||
![]() |
58f9b3ce2a | ||
![]() |
8742a03e18 | ||
![]() |
1be26b7f33 | ||
![]() |
08a75f6e9f | ||
![]() |
8cc6def93e | ||
![]() |
70ee784818 | ||
![]() |
8932b51216 | ||
![]() |
69bda79baf | ||
![]() |
214f3d9b1e | ||
![]() |
58354e7adf | ||
![]() |
aa5e44efb5 | ||
![]() |
9572fbf584 | ||
![]() |
b6cb119e89 | ||
![]() |
12eeb5df97 | ||
![]() |
d77de76c97 | ||
![]() |
105dab7a3d | ||
![]() |
ba2b4bf12c | ||
![]() |
b1489c56e2 | ||
![]() |
c601d46970 | ||
![]() |
51cad13f5a | ||
![]() |
17ae06f9c1 | ||
![]() |
5a03f5c23e | ||
![]() |
bf1726a52b | ||
![]() |
c1f72e0d11 | ||
![]() |
c2227b306b | ||
![]() |
961cf803f2 | ||
![]() |
eab3b75ae5 | ||
![]() |
92538b87ad | ||
![]() |
5f4d393db3 | ||
![]() |
edd5d49e36 | ||
![]() |
0d52d554e7 | ||
![]() |
f1a8b8df7f | ||
![]() |
9e1b83cbbe | ||
![]() |
40ae14bd7a | ||
![]() |
e2b91dca23 | ||
![]() |
3fde80f991 | ||
![]() |
afd5c3a5fd | ||
![]() |
cfdb492349 | ||
![]() |
816e652357 | ||
![]() |
027d44e04a | ||
![]() |
c38dc8b842 | ||
![]() |
0d97ff2936 | ||
![]() |
9b59b44609 | ||
![]() |
6f02e1b18e | ||
![]() |
488126b92c | ||
![]() |
4318f03bd6 | ||
![]() |
13ac33bb27 | ||
![]() |
93b03c9562 | ||
![]() |
e1685231c2 | ||
![]() |
90cb25446b | ||
![]() |
fd2b290fd0 | ||
![]() |
b4816c6289 | ||
![]() |
0d9a502801 | ||
![]() |
b840ae7513 | ||
![]() |
29767dfcfb | ||
![]() |
dd3f91cf0c | ||
![]() |
ae38e09d1b | ||
![]() |
de13e48aa5 | ||
![]() |
05bb3849a2 | ||
![]() |
af405cfd10 | ||
![]() |
8d880fc9dd | ||
![]() |
c18367739f | ||
![]() |
26a6a4d991 | ||
![]() |
93bce57888 | ||
![]() |
5f6b389556 | ||
![]() |
d90cab40a6 | ||
![]() |
c002d3d182 | ||
![]() |
85947878c4 | ||
![]() |
a991dc0684 | ||
![]() |
29817653ed | ||
![]() |
f5f973dc3a | ||
![]() |
f49b4d1b8b | ||
![]() |
82656f263d | ||
![]() |
f942716bf9 | ||
![]() |
dcc7819466 | ||
![]() |
8fcef1fb4d | ||
![]() |
2f5e01c9e9 | ||
![]() |
50d1bbbe4d | ||
![]() |
62bdf82627 | ||
![]() |
2ed63b1c1a | ||
![]() |
026d98551c | ||
![]() |
f913ed8332 | ||
![]() |
2863ff7a5c | ||
![]() |
4993b349ef | ||
![]() |
eb31fa9ab7 | ||
![]() |
18f8577005 | ||
![]() |
6ab3898f27 | ||
![]() |
efb8f8f315 | ||
![]() |
e96f8844e2 | ||
![]() |
45b8d9fb84 | ||
![]() |
2f8411ba2f | ||
![]() |
714c0a6cfd | ||
![]() |
9125d7ef74 | ||
![]() |
1ce67953df | ||
![]() |
e19adf8907 | ||
![]() |
9ee46107d2 | ||
![]() |
2ebe0401c3 | ||
![]() |
5aa982c95f | ||
![]() |
46c7ef42de | ||
![]() |
a9c4d37819 | ||
![]() |
e8f235e4f7 | ||
![]() |
ad311e9e7e | ||
![]() |
01af73502a | ||
![]() |
a81e121ffd | ||
![]() |
cf7e3c2302 | ||
![]() |
743a2ccd07 | ||
![]() |
e77650c997 | ||
![]() |
d1fc5d5c38 | ||
![]() |
2fa62acbbd | ||
![]() |
ad4ec41e15 | ||
![]() |
539f4a5c31 | ||
![]() |
7b2faf90f2 | ||
![]() |
ac57ddbb16 | ||
![]() |
b434fa108d | ||
![]() |
f1496c771e | ||
![]() |
f611a5a521 | ||
![]() |
81aa0ae109 | ||
![]() |
5736faf24c | ||
![]() |
c87c50bfb9 | ||
![]() |
10162b378a | ||
![]() |
e879102768 | ||
![]() |
de4667cc71 | ||
![]() |
8fc3a71e0f | ||
![]() |
2d2c94e4d7 | ||
![]() |
21669b5f4a | ||
![]() |
ad5dec3dc6 | ||
![]() |
32fc0415da | ||
![]() |
5f70a524e9 | ||
![]() |
9263dd4ddb | ||
![]() |
f17ff59ba6 | ||
![]() |
15fb7f45b8 | ||
![]() |
f71eadd409 | ||
![]() |
49122d940d | ||
![]() |
eb1351d108 | ||
![]() |
b67df1328b | ||
![]() |
976a5836a9 | ||
![]() |
2ebae17839 | ||
![]() |
eddbfcab36 | ||
![]() |
320aaab4b3 | ||
![]() |
f0880785a9 | ||
![]() |
9faaea881d | ||
![]() |
01e5eee981 | ||
![]() |
94a0a57cfe | ||
![]() |
265c7ad76f | ||
![]() |
36a902398a | ||
![]() |
506de0383f | ||
![]() |
9b67010f2c | ||
![]() |
f7f8f8dabf | ||
![]() |
01182ef752 | ||
![]() |
8410419717 | ||
![]() |
5f7fa33eb2 | ||
![]() |
a1d88a5e6b | ||
![]() |
a3723e4879 | ||
![]() |
b7f3a67cd0 | ||
![]() |
c880065da8 | ||
![]() |
86af4baef5 | ||
![]() |
8cdfe4a22c | ||
![]() |
d6f05684be | ||
![]() |
17251b2c88 | ||
![]() |
64acfbcb4e | ||
![]() |
55a3f9669b | ||
![]() |
884f136e99 | ||
![]() |
dc6bd4d4a7 | ||
![]() |
1e5b7e7ee7 | ||
![]() |
c874d97507 | ||
![]() |
3f61c9ee18 | ||
![]() |
eece358e20 | ||
![]() |
2b1fd9e986 | ||
![]() |
79e4e596e8 | ||
![]() |
23dea7bced | ||
![]() |
e4c2336659 | ||
![]() |
98fa6eea05 | ||
![]() |
9b21d52206 | ||
![]() |
00548a259b | ||
![]() |
f4bc280da7 | ||
![]() |
68ed5942e6 | ||
![]() |
9d2bcff96b | ||
![]() |
39d53617bd | ||
![]() |
cfdaa1e927 | ||
![]() |
aef679c030 | ||
![]() |
dec0ebba30 | ||
![]() |
e82e27acd7 | ||
![]() |
23358d9c5d | ||
![]() |
80989cc84f | ||
![]() |
d8bd4bd847 | ||
![]() |
f18f24962e | ||
![]() |
0753e956f9 | ||
![]() |
83f9a3faa7 | ||
![]() |
cac005f993 | ||
![]() |
fb7368993c | ||
![]() |
38f88407ff | ||
![]() |
d842a3d8e0 | ||
![]() |
2163522e7c | ||
![]() |
225e13f43b | ||
![]() |
fa1cf353b8 | ||
![]() |
4746b6fae9 | ||
![]() |
2c7f2c0fcd | ||
![]() |
b8389c72bb | ||
![]() |
dfa4178204 | ||
![]() |
2b7ebedb22 | ||
![]() |
33ffd7e855 | ||
![]() |
b11f9f62b7 | ||
![]() |
c6765fd9a9 | ||
![]() |
8c201dced7 | ||
![]() |
71851e1a05 | ||
![]() |
db62bd20b3 | ||
![]() |
31b213610f | ||
![]() |
d0881cbd09 | ||
![]() |
7e4bd851f1 | ||
![]() |
ab80aedb63 | ||
![]() |
c7537e7994 | ||
![]() |
9f763b46eb | ||
![]() |
d21826c70d | ||
![]() |
a061e362c3 | ||
![]() |
7e852c1836 | ||
![]() |
a01982ae55 | ||
![]() |
884f960d3b | ||
![]() |
0c6bfcbee6 | ||
![]() |
03639d73fa | ||
![]() |
cfc92ac9e7 | ||
![]() |
dc90abcf09 | ||
![]() |
b985124bef | ||
![]() |
b653351f71 | ||
![]() |
0a0b471a03 | ||
![]() |
c389ebabd0 | ||
![]() |
8264a69cec | ||
![]() |
cd466a64e5 | ||
![]() |
b04c1054fc | ||
![]() |
3befdc09e3 | ||
![]() |
9fe9983bf9 | ||
![]() |
ed54092268 | ||
![]() |
50dafc91d4 | ||
![]() |
d409e1d088 | ||
![]() |
64c8768314 | ||
![]() |
c5bd40793b | ||
![]() |
8a6fdb5ea5 | ||
![]() |
6fbc79fe5e | ||
![]() |
7ccd9ad896 | ||
![]() |
ef9dc9ff6d | ||
![]() |
ed0a1f2740 | ||
![]() |
871ea84f96 | ||
![]() |
e427e50d67 | ||
![]() |
99a5615e91 | ||
![]() |
c8201de2ff | ||
![]() |
3c54960612 | ||
![]() |
5045df0b57 | ||
![]() |
f388f84b07 | ||
![]() |
f8f6b76657 | ||
![]() |
cb6c25f829 | ||
![]() |
05a3e3f805 | ||
![]() |
273fa7eb55 | ||
![]() |
2278082a4d | ||
![]() |
d5d9c644a2 | ||
![]() |
1a51f3d854 | ||
![]() |
f80d3cd530 | ||
![]() |
cea06c9673 | ||
![]() |
22176e89dd | ||
![]() |
2b220459c7 | ||
![]() |
c1b2b7e177 | ||
![]() |
6ac07e1255 | ||
![]() |
1509b6fce5 | ||
![]() |
ebe2013849 | ||
![]() |
cceb66e500 | ||
![]() |
36a5f2ab49 | ||
![]() |
9c54a4ada1 | ||
![]() |
2e3823364c | ||
![]() |
ec71f532a1 | ||
![]() |
4030904d40 | ||
![]() |
9f62c280de | ||
![]() |
94fa0380ba | ||
![]() |
b3bdee60bb | ||
![]() |
434633924a | ||
![]() |
88aeaf31c2 | ||
![]() |
604420c7d4 | ||
![]() |
b64f6c7884 | ||
![]() |
db9b3617a4 | ||
![]() |
42888c0983 | ||
![]() |
9abbc001b3 | ||
![]() |
4741ee0a7b | ||
![]() |
de5a8fae7c | ||
![]() |
a63d7e9b64 | ||
![]() |
194f49c561 | ||
![]() |
922b550c17 | ||
![]() |
7f0305fb7a | ||
![]() |
d4801f58e3 | ||
![]() |
e4392cd00a | ||
![]() |
163c65600d | ||
![]() |
3c740549e2 | ||
![]() |
3178894e4f | ||
![]() |
deed2111fb | ||
![]() |
3e8924e7cc | ||
![]() |
fec259629e | ||
![]() |
3b64950a38 | ||
![]() |
be533922a2 | ||
![]() |
38e6441b61 | ||
![]() |
c2b2d11141 | ||
![]() |
22c33b58c7 | ||
![]() |
9b101963e5 | ||
![]() |
620447f029 | ||
![]() |
733e7ee00c | ||
![]() |
3877346b3a | ||
![]() |
e67cde4255 | ||
![]() |
e46f4bf01e | ||
![]() |
f7a019ed83 | ||
![]() |
2950827c63 | ||
![]() |
b37f63a231 | ||
![]() |
365e4a4194 | ||
![]() |
c43a4edec7 | ||
![]() |
b5a519d132 | ||
![]() |
35728e20be | ||
![]() |
960d6279a9 | ||
![]() |
9ea103c0eb | ||
![]() |
12e4b0a139 | ||
![]() |
731c2168b0 | ||
![]() |
ef045607d9 | ||
![]() |
bb4e98af8d | ||
![]() |
6ea8a02b57 | ||
![]() |
187fea6d1b | ||
![]() |
36ba6f1463 | ||
![]() |
f005ef4d52 | ||
![]() |
6a0a4627b4 | ||
![]() |
2dbba970b9 | ||
![]() |
bcedc58d9f | ||
![]() |
78500770d9 | ||
![]() |
488696cb39 | ||
![]() |
6dfda20116 | ||
![]() |
e50356d276 | ||
![]() |
7b2fef5f09 | ||
![]() |
87cced1637 | ||
![]() |
2ce242ba42 | ||
![]() |
bdbbe990dd | ||
![]() |
2ca93a07e9 | ||
![]() |
0a113611e8 | ||
![]() |
e93063a344 | ||
![]() |
18cec49a86 | ||
![]() |
db3f215ebe | ||
![]() |
8470126918 | ||
![]() |
9566a882b5 | ||
![]() |
7d72a43ecd | ||
![]() |
8afc376636 | ||
![]() |
89da6ae501 | ||
![]() |
d23e5d169a | ||
![]() |
9de35a6e8b | ||
![]() |
d8de36b5ac | ||
![]() |
2fde1db83c | ||
![]() |
5fb99c54c9 | ||
![]() |
ed55fbca9e | ||
![]() |
2375733d0f | ||
![]() |
065f845707 | ||
![]() |
839c4e0c28 | ||
![]() |
a20eb468df | ||
![]() |
303eba6bca | ||
![]() |
bc51a868ce | ||
![]() |
f2c73acd3b | ||
![]() |
2f5de67ee7 | ||
![]() |
db3ea2e34a | ||
![]() |
2388ab88b6 | ||
![]() |
e49a31df6a | ||
![]() |
d5a9aa6925 | ||
![]() |
409a49ba20 | ||
![]() |
4c29a667cb | ||
![]() |
8d70107b5d | ||
![]() |
51aeb50d39 | ||
![]() |
0e8f383c14 | ||
![]() |
ca5e2c1ff9 | ||
![]() |
a6d5b262f9 | ||
![]() |
5952df82ff | ||
![]() |
8f1f8abf42 | ||
![]() |
3edbe96968 | ||
![]() |
d6aeb1d10f | ||
![]() |
5334cf1871 | ||
![]() |
a999b996fb | ||
![]() |
903afc111e | ||
![]() |
3413d7c6f6 | ||
![]() |
fe4c3d4942 | ||
![]() |
6352a6dc9a | ||
![]() |
172dbba8aa | ||
![]() |
1152fba067 | ||
![]() |
d74025318e | ||
![]() |
dd2631d27c | ||
![]() |
d52a186e12 | ||
![]() |
7d3f2e6bdf | ||
![]() |
8776cd19dd | ||
![]() |
9c31e92c01 | ||
![]() |
cd9004b32b | ||
![]() |
ba8faacbd0 | ||
![]() |
927470db72 | ||
![]() |
4ff0450632 | ||
![]() |
862198cf82 | ||
![]() |
3726a2685a | ||
![]() |
17810d9cae | ||
![]() |
92a52133de | ||
![]() |
9589606fb5 | ||
![]() |
ad7b347e16 | ||
![]() |
f33d7b7f90 | ||
![]() |
36d4f0a5f7 | ||
![]() |
0dc344b821 | ||
![]() |
25f39f4173 | ||
![]() |
e656f769b1 | ||
![]() |
28238c6fb5 | ||
![]() |
e77ca93d80 | ||
![]() |
da3aaafbcd | ||
![]() |
10628eeb91 | ||
![]() |
20aa6a3fbb | ||
![]() |
e9edf205d9 | ||
![]() |
6397a93f97 | ||
![]() |
9c5f3a3b64 | ||
![]() |
5e0253927c | ||
![]() |
d16290cb70 | ||
![]() |
c6df827311 | ||
![]() |
496e03a3ec | ||
![]() |
7e0e881017 | ||
![]() |
11cda10ca5 | ||
![]() |
a289216eac | ||
![]() |
c79ecab719 | ||
![]() |
4fb226ad98 | ||
![]() |
a28d9b9748 | ||
![]() |
6b466bb90f | ||
![]() |
cb6499522e | ||
![]() |
78a9ba5084 | ||
![]() |
cff4942769 | ||
![]() |
e3b1be5835 | ||
![]() |
983a06abe3 | ||
![]() |
75319c0d6a | ||
![]() |
18c3c57930 | ||
![]() |
c371db3534 | ||
![]() |
a49aa77ec0 | ||
![]() |
129455a31f | ||
![]() |
10a801aa10 | ||
![]() |
aea7f01047 | ||
![]() |
56c5c4e540 | ||
![]() |
d48a92c88d | ||
![]() |
aa37fc3add | ||
![]() |
1bb41b21af | ||
![]() |
4e25e87bfb | ||
![]() |
80b9593651 | ||
![]() |
edef084121 | ||
![]() |
fc32542f55 | ||
![]() |
efcfd787af | ||
![]() |
700b5f0b91 | ||
![]() |
dfc88193b2 | ||
![]() |
b4d5d70e4c | ||
![]() |
1bad1cd3e7 | ||
![]() |
f0b6b62791 | ||
![]() |
ae1e9dba0f | ||
![]() |
777a7afd46 | ||
![]() |
ab3a66542d | ||
![]() |
c72d99794e | ||
![]() |
fc5b931007 | ||
![]() |
cdae4bf8da | ||
![]() |
71d8d5a70d | ||
![]() |
322335f4ab | ||
![]() |
0904cda2c6 | ||
![]() |
fad8b44be2 | ||
![]() |
da910b1414 | ||
![]() |
6037519fbe | ||
![]() |
7e15f75d44 | ||
![]() |
25ecade1e6 | ||
![]() |
69161b7037 | ||
![]() |
4e892d09ec | ||
![]() |
e284370c4b | ||
![]() |
01b78d7513 | ||
![]() |
b9fa324bb4 | ||
![]() |
0a42ec77b2 | ||
![]() |
a9e64e931e | ||
![]() |
caa13f5a75 | ||
![]() |
9d5adf7793 | ||
![]() |
8f4b223125 | ||
![]() |
e38cfda076 | ||
![]() |
511e185f33 | ||
![]() |
7c4e9b56c7 | ||
![]() |
d18bade951 | ||
![]() |
c4e872c94c | ||
![]() |
57f3b942e5 | ||
![]() |
37d4ef751c | ||
![]() |
b5effaa01b | ||
![]() |
66a15fb9a1 | ||
![]() |
33abeb1aca | ||
![]() |
128657810b | ||
![]() |
f5d24133f7 | ||
![]() |
a28a801a62 | ||
![]() |
738d5d94e0 | ||
![]() |
3fae9e6270 | ||
![]() |
691a5e84f9 | ||
![]() |
18625efa87 | ||
![]() |
d99f2541df | ||
![]() |
72177aef0a | ||
![]() |
a3195267c9 | ||
![]() |
8104657ae9 | ||
![]() |
78fb38e072 | ||
![]() |
206d51f59b | ||
![]() |
2e0bc63e20 | ||
![]() |
031d97aea3 | ||
![]() |
59a9d2cf86 | ||
![]() |
ee961edf94 | ||
![]() |
7b485d5ad2 | ||
![]() |
ec2600ddf7 | ||
![]() |
63fef16c37 | ||
![]() |
74fecf553e | ||
![]() |
587a4daf7a | ||
![]() |
2290d9f990 | ||
![]() |
3553f23eab | ||
![]() |
0c5992ad75 | ||
![]() |
8ae1b87a1e | ||
![]() |
4d404cb20b | ||
![]() |
5b697cdf26 | ||
![]() |
ceceb3f030 | ||
![]() |
66fd2ff5e6 | ||
![]() |
7f06b3e53b | ||
![]() |
e990be3570 | ||
![]() |
57e22c9ff5 | ||
![]() |
b6bd095d8e | ||
![]() |
778578292f | ||
![]() |
8744ee74b3 | ||
![]() |
47bfcc23cb | ||
![]() |
962d31c4c2 | ||
![]() |
6093be43c9 | ||
![]() |
753daa55e8 | ||
![]() |
09227fa30a | ||
![]() |
4e3aa1af83 | ||
![]() |
a6d97538af | ||
![]() |
85ef73dcb9 | ||
![]() |
0ead06106c | ||
![]() |
86a42064ea | ||
![]() |
9584fb57b0 | ||
![]() |
e852613567 | ||
![]() |
065ad9e422 | ||
![]() |
f1c2fd399e | ||
![]() |
8cc54b6106 | ||
![]() |
072f5da69d | ||
![]() |
025cabd1ad | ||
![]() |
b261e8bb9b | ||
![]() |
a36f775752 | ||
![]() |
091b479a02 | ||
![]() |
9c75d7b560 | ||
![]() |
ceb70eec4c | ||
![]() |
ea180ca107 | ||
![]() |
1117893900 | ||
![]() |
b22e7fd077 | ||
![]() |
d677cb1bc8 | ||
![]() |
15fc82fc34 | ||
![]() |
4716545b7e | ||
![]() |
16a4fe1a4f | ||
![]() |
8a08b3f7c7 | ||
![]() |
999bb29499 | ||
![]() |
1575cad447 | ||
![]() |
cdcb106f2d | ||
![]() |
af14216eea | ||
![]() |
b9c5f6a869 | ||
![]() |
7e071a7daf | ||
![]() |
db3cd4ec6e | ||
![]() |
ae27c110ab | ||
![]() |
f83fc18ebc | ||
![]() |
23fb5e09d1 | ||
![]() |
fe7612c885 | ||
![]() |
517dd4ad9e | ||
![]() |
e672e9670f | ||
![]() |
0b25469f33 | ||
![]() |
765b7b4957 | ||
![]() |
9eeb921915 | ||
![]() |
9045505153 | ||
![]() |
eb221417e5 | ||
![]() |
cabe422508 | ||
![]() |
8579b89002 | ||
![]() |
0545099a2b | ||
![]() |
94fc5c1859 | ||
![]() |
6af5157b4e | ||
![]() |
dc28b1337d | ||
![]() |
2ce7c93aeb | ||
![]() |
88b3279e63 | ||
![]() |
ab61778d35 | ||
![]() |
f89dc88c0e | ||
![]() |
ad110c2ce2 | ||
![]() |
5e0ba81b21 | ||
![]() |
a0bb481a43 | ||
![]() |
3aac855fa1 | ||
![]() |
94883c1433 | ||
![]() |
7b7eee92cd | ||
![]() |
c2d76966a3 | ||
![]() |
82dfce6f81 | ||
![]() |
1b0d6581db | ||
![]() |
819ae22b0e | ||
![]() |
33af2e6fa1 | ||
![]() |
4396c4c628 | ||
![]() |
daa5126c21 | ||
![]() |
494b1384c4 | ||
![]() |
c0db03bc28 | ||
![]() |
408bffb775 | ||
![]() |
a6f608e8cc | ||
![]() |
e97b8a9f7e | ||
![]() |
31dff0d353 | ||
![]() |
30f95e2f08 | ||
![]() |
099b6915f4 | ||
![]() |
da6c782ac3 | ||
![]() |
e99c001673 | ||
![]() |
c7d587b4cb | ||
![]() |
ff348a2aa0 | ||
![]() |
bc7ccb6a9f | ||
![]() |
40d36f9808 | ||
![]() |
f49fdebd98 | ||
![]() |
ca57bd3572 | ||
![]() |
6f62f141d2 | ||
![]() |
197d3de74a | ||
![]() |
1244659064 | ||
![]() |
16bc3076ad | ||
![]() |
1fbe429a08 | ||
![]() |
340a177a29 | ||
![]() |
2f676774e9 | ||
![]() |
a2032a7be2 | ||
![]() |
f549858c5d | ||
![]() |
9d02180c92 | ||
![]() |
e906c01e64 | ||
![]() |
be92075abb | ||
![]() |
10e34b83ed | ||
![]() |
ae76ceea04 | ||
![]() |
6f60387f30 | ||
![]() |
60222c4977 | ||
![]() |
ff588b6a5c | ||
![]() |
871dd35a3a | ||
![]() |
f687078bbf | ||
![]() |
6fc666e221 | ||
![]() |
095afcde24 | ||
![]() |
1353f6ed3c | ||
![]() |
a7c6380a3a | ||
![]() |
5a4abbb163 | ||
![]() |
092f1cda0c | ||
![]() |
cc4b2278e7 | ||
![]() |
282185c5af | ||
![]() |
95da490f9a | ||
![]() |
760fbc57bc | ||
![]() |
47f6c941ec | ||
![]() |
4229798c7b | ||
![]() |
8aff5d519d | ||
![]() |
bb0666b77d | ||
![]() |
dbd00291b3 | ||
![]() |
c1f9190613 | ||
![]() |
ce354d5bc3 | ||
![]() |
b9037111a4 | ||
![]() |
03dad82663 | ||
![]() |
e8828efae3 | ||
![]() |
b8f1b7bd84 | ||
![]() |
0fa888efaf | ||
![]() |
f385aab44a | ||
![]() |
a7b91b5b31 | ||
![]() |
901dacf038 | ||
![]() |
426ba0ea34 | ||
![]() |
3a10a4bcb7 | ||
![]() |
6e15d59a84 | ||
![]() |
f1fd003dca | ||
![]() |
1ceb1e4434 | ||
![]() |
5f9d311cdb | ||
![]() |
7630f504b0 | ||
![]() |
e7871380a9 | ||
![]() |
85166d5beb | ||
![]() |
90cc8e5370 | ||
![]() |
a12318246f | ||
![]() |
eb28fc2e3c | ||
![]() |
fec7c3b3ee | ||
![]() |
23d38604c4 | ||
![]() |
67c1adcc75 | ||
![]() |
3990854d42 | ||
![]() |
5d875bc731 | ||
![]() |
ddb05afe6b | ||
![]() |
43bbc2a29e | ||
![]() |
7a5ba0503a | ||
![]() |
28e9085249 | ||
![]() |
5ff57ae7d2 | ||
![]() |
df8778f85d | ||
![]() |
2be1d12116 | ||
![]() |
eb76d868ca | ||
![]() |
b34d88d704 | ||
![]() |
0758ca09e6 | ||
![]() |
1bdb845032 | ||
![]() |
4d33e3dcbe | ||
![]() |
b0fa559760 | ||
![]() |
8a378317c0 | ||
![]() |
a6b7056f2a | ||
![]() |
9fef4c2601 | ||
![]() |
209b4b4de3 | ||
![]() |
7651efff9d | ||
![]() |
7b5e2d17f3 | ||
![]() |
4dfc29768c | ||
![]() |
2d87ce5c29 | ||
![]() |
2d0a922cff | ||
![]() |
a553a26644 | ||
![]() |
4a383709bd | ||
![]() |
8d16a5f110 | ||
![]() |
8b044dbb22 | ||
![]() |
93b752f436 | ||
![]() |
87374d5647 | ||
![]() |
ab33b49218 | ||
![]() |
52fbe73893 | ||
![]() |
232a02b944 | ||
![]() |
53fc1508f3 | ||
![]() |
1b33c8a2b7 | ||
![]() |
dd6c9cc8ce | ||
![]() |
d61fa7b6b9 | ||
![]() |
22aa55c24b | ||
![]() |
80589cde2f | ||
![]() |
1463c09385 | ||
![]() |
e3cad91be0 | ||
![]() |
aeace0c7cf | ||
![]() |
20492410ad | ||
![]() |
66bc775e14 | ||
![]() |
3e796e9164 | ||
![]() |
ffb33d00c8 | ||
![]() |
7fabef6004 | ||
![]() |
ce969306f7 | ||
![]() |
a919bfb6c5 | ||
![]() |
b9b5a0e79b | ||
![]() |
284078ff71 | ||
![]() |
5e339bb7ea | ||
![]() |
c611eb3787 | ||
![]() |
d933dd2723 | ||
![]() |
25a019cc12 | ||
![]() |
9b40096bb7 | ||
![]() |
2fa7857daf | ||
![]() |
0237d8c31a | ||
![]() |
9b6113a4c8 | ||
![]() |
def8ea7c15 | ||
![]() |
d7c145ce39 | ||
![]() |
e7fb1559f5 | ||
![]() |
6386b34516 | ||
![]() |
48864ab611 | ||
![]() |
8e4079224f | ||
![]() |
d4aef9ceac | ||
![]() |
1884edb334 | ||
![]() |
711e526822 | ||
![]() |
272b0fd071 | ||
![]() |
a7f4b2e6ef | ||
![]() |
e0dff55ffa | ||
![]() |
b2e2b2e85e | ||
![]() |
bbfffd45fc | ||
![]() |
ed705ff867 | ||
![]() |
03a569d9a3 | ||
![]() |
a6c89d7998 | ||
![]() |
ad6562558d | ||
![]() |
82074a37ba | ||
![]() |
ab517d1199 | ||
![]() |
7c6c2f7ded | ||
![]() |
65ac7e0c15 | ||
![]() |
a52b5ec380 | ||
![]() |
12310da09e | ||
![]() |
8095f2c9ea | ||
![]() |
3ece3303db | ||
![]() |
9fe1d4c596 | ||
![]() |
0dc9793772 | ||
![]() |
ec5ff8a788 | ||
![]() |
3b6b1aa5b6 | ||
![]() |
57cb787b30 | ||
![]() |
fbd12c7dfc | ||
![]() |
e6a92c5667 | ||
![]() |
9365dd7b1a | ||
![]() |
af8bd246a9 | ||
![]() |
87d8322b85 | ||
![]() |
b229b409b0 | ||
![]() |
d0a7a241b4 | ||
![]() |
8af247a7f6 | ||
![]() |
d295cf04af | ||
![]() |
2188e91fae | ||
![]() |
884b1e02a7 | ||
![]() |
7e0713e22b | ||
![]() |
25c1ae3c41 | ||
![]() |
177286533d | ||
![]() |
83c354b983 | ||
![]() |
1ce60821bd | ||
![]() |
97bdc3f785 | ||
![]() |
82e730c18e | ||
![]() |
4474f30718 | ||
![]() |
fa700d53ad | ||
![]() |
d671b18215 | ||
![]() |
8169160b57 | ||
![]() |
560575e53f | ||
![]() |
54f1a52ed0 | ||
![]() |
c2ea1be83f | ||
![]() |
4d742bacb1 | ||
![]() |
fe584f193f | ||
![]() |
897bb177bc | ||
![]() |
445862d48d | ||
![]() |
c3079fe899 | ||
![]() |
3cf4c0f8e4 | ||
![]() |
a881b310bc | ||
![]() |
ac133ce830 | ||
![]() |
cf32d4235e | ||
![]() |
5836099746 | ||
![]() |
a10de791a1 | ||
![]() |
90af8f91b8 | ||
![]() |
8884d28306 | ||
![]() |
4addedef6e | ||
![]() |
8eee4a1cf0 | ||
![]() |
fb156d2e29 | ||
![]() |
35aab87fdc | ||
![]() |
5cdd09020d | ||
![]() |
2e561f1a4a | ||
![]() |
a1d6403b1b | ||
![]() |
b2bda5e31d | ||
![]() |
add4337d11 | ||
![]() |
31941c00bf | ||
![]() |
d1a35a4d58 | ||
![]() |
949b9d64bf | ||
![]() |
00615bea97 | ||
![]() |
91db10b10c | ||
![]() |
eede391be8 | ||
![]() |
544f05a5a8 | ||
![]() |
661d536e9d | ||
![]() |
60fe7cf29c | ||
![]() |
2d75409757 | ||
![]() |
c48371ca2a | ||
![]() |
6c5377fadc | ||
![]() |
4cf61a92cf | ||
![]() |
2332cae09b | ||
![]() |
ee65d08d81 | ||
![]() |
e19119194d | ||
![]() |
e4e0d81f6e | ||
![]() |
70c5e36ccb | ||
![]() |
7532dc5117 | ||
![]() |
059b24fac7 | ||
![]() |
97e1700cf9 | ||
![]() |
241747b967 | ||
![]() |
a933fc836f | ||
![]() |
492546d0f6 | ||
![]() |
ba790823ed | ||
![]() |
637c249c36 | ||
![]() |
abfe8bc648 | ||
![]() |
216807503a | ||
![]() |
89bb0aa56d | ||
![]() |
26d7ab080f | ||
![]() |
9ad64ba5e1 | ||
![]() |
793022b92f | ||
![]() |
ff904d840f | ||
![]() |
34623a7307 | ||
![]() |
89f0336af9 | ||
![]() |
1420a33649 | ||
![]() |
a23eb3f32d | ||
![]() |
eaf929474f | ||
![]() |
f58b065316 | ||
![]() |
e462e41ae1 | ||
![]() |
5969515f25 | ||
![]() |
cc2308c399 | ||
![]() |
85403dfa5e | ||
![]() |
8f69b07ee2 | ||
![]() |
562d7b48bc | ||
![]() |
63350469d0 | ||
![]() |
f93fd7aefa | ||
![]() |
0128690da8 | ||
![]() |
9b76e23354 | ||
![]() |
e3bf7f2bb2 | ||
![]() |
0209957def | ||
![]() |
1cdb11c88c | ||
![]() |
8e9c66c0ea | ||
![]() |
fe80028c07 | ||
![]() |
329e75ee82 | ||
![]() |
801c56f06e | ||
![]() |
a2b7f882bc | ||
![]() |
ff2e39f67a | ||
![]() |
708641a8f1 | ||
![]() |
fac00e6ecd | ||
![]() |
e1e3301fc1 | ||
![]() |
1a18147971 | ||
![]() |
719e7c8441 | ||
![]() |
3ad19d05e5 | ||
![]() |
fb7a572519 | ||
![]() |
b3867d9c89 | ||
![]() |
797a65e9c8 | ||
![]() |
40b4596df4 | ||
![]() |
5e27ceedce | ||
![]() |
a927827e33 | ||
![]() |
d1d64ec96c | ||
![]() |
480d878db8 | ||
![]() |
475ab3013f | ||
![]() |
b55ecc3898 | ||
![]() |
a327dfab7c | ||
![]() |
649ac12cdd | ||
![]() |
dde6195f38 | ||
![]() |
0035a4129a | ||
![]() |
523ea6e0df | ||
![]() |
59167278d4 | ||
![]() |
f480c046f6 | ||
![]() |
af99ca7905 | ||
![]() |
850b6f71dd | ||
![]() |
ca602ff845 | ||
![]() |
ce629c91bb | ||
![]() |
a3cbb24892 | ||
![]() |
db7d021133 | ||
![]() |
5e9264bbef | ||
![]() |
758d5e6f4c | ||
![]() |
4d8e29c892 | ||
![]() |
fd1342c605 | ||
![]() |
e548b72323 | ||
![]() |
ad859d4bef | ||
![]() |
483a47ed43 | ||
![]() |
9c026c1dd9 | ||
![]() |
6a0bcdaa82 | ||
![]() |
cc833c52b6 | ||
![]() |
a801672821 | ||
![]() |
20f3d001c4 | ||
![]() |
058677adec | ||
![]() |
95dd8d83dc | ||
![]() |
8ff590e43f | ||
![]() |
42eb72422d | ||
![]() |
ac5139b7c4 | ||
![]() |
3250347df1 | ||
![]() |
2d8d4659b3 | ||
![]() |
efbc6df199 | ||
![]() |
3ae47ba1e5 | ||
![]() |
a204e78e3a | ||
![]() |
0220e401cd | ||
![]() |
2ad0223e9a | ||
![]() |
04ba14fcd7 | ||
![]() |
e5d5850327 | ||
![]() |
c87a452471 | ||
![]() |
3cd5fa7f4a | ||
![]() |
ee3d32d60a | ||
![]() |
d80844c1ed | ||
![]() |
9af7e38219 | ||
![]() |
dc1f613bc2 | ||
![]() |
e0d1e39824 | ||
![]() |
bcb4bda7e6 | ||
![]() |
37a05155e5 | ||
![]() |
18b9f43eaa | ||
![]() |
20c31cbb07 | ||
![]() |
5b05f9426f | ||
![]() |
9dc9bd162f | ||
![]() |
c79b63e270 | ||
![]() |
2d699b3e43 | ||
![]() |
24cc4b4272 | ||
![]() |
746db72046 | ||
![]() |
77fa2a78d4 | ||
![]() |
af11511d24 | ||
![]() |
6709d97abc | ||
![]() |
4b4faae009 | ||
![]() |
f37a9963f6 | ||
![]() |
2d29245037 | ||
![]() |
d146514c39 | ||
![]() |
149ae4b71c | ||
![]() |
711ed947a3 | ||
![]() |
37a60592f6 | ||
![]() |
3ac8ca90ce | ||
![]() |
cc5d0ed3c6 | ||
![]() |
652e951f89 | ||
![]() |
dd2b634ed2 | ||
![]() |
32cfe58601 | ||
![]() |
e6da1152ca | ||
![]() |
3eb929aa13 | ||
![]() |
7df5838bc0 | ||
![]() |
f8d9b0803c | ||
![]() |
cf613ab34a | ||
![]() |
cebe2f8adc | ||
![]() |
bd19d7c231 | ||
![]() |
1283a794df | ||
![]() |
fdcf23f65f | ||
![]() |
24516b81cb | ||
![]() |
527bc04998 | ||
![]() |
72177e8ab5 | ||
![]() |
d2d632092b | ||
![]() |
7a0f975b31 | ||
![]() |
026dc6309c | ||
![]() |
5af26a57f6 | ||
![]() |
922cbe4451 | ||
![]() |
43472c7eb6 | ||
![]() |
1b7612ffb0 | ||
![]() |
7d8c57170f | ||
![]() |
32b98ae818 | ||
![]() |
7f8271e215 | ||
![]() |
58362ae858 | ||
![]() |
7a01cb8873 | ||
![]() |
374f20ff1a | ||
![]() |
9620fc5a83 | ||
![]() |
cfa9c95814 | ||
![]() |
96185d17bd | ||
![]() |
b5028ab2d0 | ||
![]() |
a038f2a98d | ||
![]() |
7924502b65 | ||
![]() |
aac0e7d35c | ||
![]() |
dca890f169 | ||
![]() |
d0e7f7dda2 | ||
![]() |
b4ea1489a7 | ||
![]() |
ca31af196f | ||
![]() |
163134326a | ||
![]() |
4371574403 | ||
![]() |
7d158e58b5 | ||
![]() |
808e737202 | ||
![]() |
c32f47ba95 | ||
![]() |
493785591c | ||
![]() |
9a2a6bbc9f | ||
![]() |
6bd049e0bb | ||
![]() |
8ea379bbff | ||
![]() |
dfeb14e7a8 | ||
![]() |
cf8072e402 | ||
![]() |
e0ce7e8505 | ||
![]() |
d196044d11 | ||
![]() |
0798102ba5 | ||
![]() |
4c3112b85b | ||
![]() |
925e5e0731 | ||
![]() |
3819dd9469 | ||
![]() |
0dfe52a42d | ||
![]() |
ca64d52021 | ||
![]() |
793d80f092 | ||
![]() |
4f2f192783 | ||
![]() |
6577b3752f | ||
![]() |
66bf11e893 | ||
![]() |
aac9bad7ec | ||
![]() |
bea671987c | ||
![]() |
e943a1cd44 | ||
![]() |
c1a2bb978c | ||
![]() |
c7c3dea6b2 | ||
![]() |
bb11263bad | ||
![]() |
e5f0831369 | ||
![]() |
6463df7224 | ||
![]() |
dc81e5b5c5 | ||
![]() |
31df41283c | ||
![]() |
abea50427e | ||
![]() |
a8a79ee326 | ||
![]() |
8683e2a4c2 | ||
![]() |
3bb0c8468b | ||
![]() |
b5f9c8e358 | ||
![]() |
2139fea3d0 | ||
![]() |
b13cae11fa | ||
![]() |
2ac2a98727 | ||
![]() |
5f2dd31485 | ||
![]() |
f0224144b7 | ||
![]() |
3a6ced388a | ||
![]() |
4c3b189108 | ||
![]() |
cc96d9877b | ||
![]() |
f2b5e2302a | ||
![]() |
d9f6a7201e | ||
![]() |
d2c4791611 | ||
![]() |
0fbc8c9247 | ||
![]() |
e9fc9ccbf7 | ||
![]() |
71a9010579 | ||
![]() |
0e7835e2d9 | ||
![]() |
069eac1cf6 | ||
![]() |
dc4531f545 | ||
![]() |
6a58f5f5d3 | ||
![]() |
12b567d3d2 | ||
![]() |
2532fcbea2 | ||
![]() |
0704717ec5 | ||
![]() |
242e14e8a9 | ||
![]() |
35bef2c3dd | ||
![]() |
65f41480eb | ||
![]() |
aaabde5c5a | ||
![]() |
89ffbd6efc | ||
![]() |
2a4832f9b9 | ||
![]() |
c14ecd2948 | ||
![]() |
febe651e31 | ||
![]() |
af07b433ad | ||
![]() |
13802c49a8 | ||
![]() |
eaeda6ca36 | ||
![]() |
af4be59fe0 | ||
![]() |
917d5ab3fa | ||
![]() |
cd019fb05b | ||
![]() |
e04e67774e | ||
![]() |
51e1a85f0b | ||
![]() |
297ca3fe11 | ||
![]() |
1570871884 | ||
![]() |
a721ec4a43 | ||
![]() |
ad9c193061 | ||
![]() |
3223a77cb1 | ||
![]() |
e57010cd3d | ||
![]() |
0ea4b98b1f | ||
![]() |
eb57ebe62b | ||
![]() |
72796d1e04 | ||
![]() |
970b5871e5 | ||
![]() |
8ac0bb2334 | ||
![]() |
ff3e83b1c5 | ||
![]() |
60157abd46 | ||
![]() |
907a356bea | ||
![]() |
7994c7d770 | ||
![]() |
4fe885995f | ||
![]() |
da4f2b2081 | ||
![]() |
9b00e829b8 | ||
![]() |
964671fcbf | ||
![]() |
edd48ef667 | ||
![]() |
413e9b0f1e | ||
![]() |
59cae7d207 | ||
![]() |
9a61f55f76 | ||
![]() |
136d181363 | ||
![]() |
d8b9ae9ff1 | ||
![]() |
d72f61a98d | ||
![]() |
12b0ac1037 | ||
![]() |
1db6d642e7 | ||
![]() |
cd0703ba12 | ||
![]() |
0f5999c8d8 | ||
![]() |
11cc9a752a | ||
![]() |
0483f47b26 | ||
![]() |
2605f5ab79 | ||
![]() |
2100f0461d | ||
![]() |
0e46b25f6e | ||
![]() |
c55830e533 | ||
![]() |
113c0af49d | ||
![]() |
df00dd600a | ||
![]() |
86617e410f | ||
![]() |
815cdbdd0a | ||
![]() |
a2277feb10 | ||
![]() |
6d929dd95a | ||
![]() |
7b43164831 | ||
![]() |
c145d077cd | ||
![]() |
a79bf3f055 | ||
![]() |
77eead761e | ||
![]() |
cd8d70de0e | ||
![]() |
5f8dc20312 | ||
![]() |
2b70ed1407 | ||
![]() |
fc830f60e8 | ||
![]() |
c3f4a3d9ea | ||
![]() |
6c5cc95e51 | ||
![]() |
877e6088e2 | ||
![]() |
c96ab426a4 | ||
![]() |
5e028ce547 | ||
![]() |
da16f25cf2 | ||
![]() |
c9cf59762a | ||
![]() |
c95008703c | ||
![]() |
a6f80e07e0 | ||
![]() |
5faced8d22 | ||
![]() |
4a35620820 | ||
![]() |
76839c48cf | ||
![]() |
6925c460c5 | ||
![]() |
6a8f64a9e8 | ||
![]() |
f1dc773bfd | ||
![]() |
d00449465f | ||
![]() |
77f26f01d4 | ||
![]() |
b633c91b66 | ||
![]() |
132b2b9ec7 | ||
![]() |
b875540397 | ||
![]() |
201f7cc21e | ||
![]() |
6e7ee99b47 | ||
![]() |
99f1e000bf | ||
![]() |
35875b7826 | ||
![]() |
e9533727db | ||
![]() |
842882e766 | ||
![]() |
09e18b064d | ||
![]() |
0e4b33be96 | ||
![]() |
91c1c1c5c8 | ||
![]() |
09a383f89c | ||
![]() |
133ca622a0 | ||
![]() |
0fbe3380cd | ||
![]() |
8f07f27a61 | ||
![]() |
bbd462c85a | ||
![]() |
234fd8b2e1 | ||
![]() |
02649709aa | ||
![]() |
910e82a795 | ||
![]() |
3fc8254219 | ||
![]() |
4c5b01f287 | ||
![]() |
03c8d3409a | ||
![]() |
7dce154cc3 | ||
![]() |
8947a4d14f | ||
![]() |
3895734c32 | ||
![]() |
a96c5712ab | ||
![]() |
7b5ac7eba4 | ||
![]() |
6c029382d9 | ||
![]() |
31ae68f96e | ||
![]() |
8cbabfbb95 | ||
![]() |
675660e130 | ||
![]() |
3e1409afc5 | ||
![]() |
c14cf3022c | ||
![]() |
b7c710cddd | ||
![]() |
bed9ad76f9 | ||
![]() |
d9fecd8eb5 | ||
![]() |
d256e2014a | ||
![]() |
0715bd6321 | ||
![]() |
337422a619 | ||
![]() |
6a98dcc169 | ||
![]() |
d42c2fabb9 | ||
![]() |
a096ce565e | ||
![]() |
a9b740dcaa | ||
![]() |
3514c4050e | ||
![]() |
afdd294c60 | ||
![]() |
bd09acd0fd | ||
![]() |
c520dc23ba | ||
![]() |
c70dedd94f | ||
![]() |
0877cfc3c9 | ||
![]() |
8dcec94aec | ||
![]() |
4afbb350ce | ||
![]() |
99f69c13d2 | ||
![]() |
93a44d83d2 | ||
![]() |
86695c9dc7 | ||
![]() |
e153e530a8 | ||
![]() |
e99f225def | ||
![]() |
7f94e3fc77 | ||
![]() |
8af3d53a3c | ||
![]() |
bcfb4f257d | ||
![]() |
a857d31776 | ||
![]() |
ebc22d845a | ||
![]() |
847136b69c | ||
![]() |
4a35c231f8 | ||
![]() |
8ff69e8eda | ||
![]() |
2e92f561d8 | ||
![]() |
0c96062618 | ||
![]() |
6536926f3c | ||
![]() |
39b1a78b89 | ||
![]() |
15f7018aab | ||
![]() |
9606b08c89 | ||
![]() |
b311c6be7d | ||
![]() |
65bcd8da2a | ||
![]() |
85e67a974a | ||
![]() |
4afe8e900e | ||
![]() |
c525b16581 | ||
![]() |
0de34bfec1 | ||
![]() |
9fe585bede | ||
![]() |
3b65b06a3d | ||
![]() |
fa52ff5545 | ||
![]() |
c0219938e3 | ||
![]() |
ec8ce36bd5 | ||
![]() |
6c228a59f2 | ||
![]() |
1e0f707a6d | ||
![]() |
acda689b15 | ||
![]() |
3dd70926b9 | ||
![]() |
adf377c41d | ||
![]() |
9a35a31261 | ||
![]() |
f0a3607fb7 | ||
![]() |
b451f4af55 | ||
![]() |
18c30fcb05 | ||
![]() |
b14a4987d2 | ||
![]() |
700813fa57 | ||
![]() |
c812519931 | ||
![]() |
fbeb48a021 | ||
![]() |
43f366d955 | ||
![]() |
ace18e86ff | ||
![]() |
08f86a3a7f | ||
![]() |
47669a23bc | ||
![]() |
4d1fa4f2d6 | ||
![]() |
c8e689712a | ||
![]() |
59d3a18b3f | ||
![]() |
3199b4ee6c | ||
![]() |
fdc687ed45 | ||
![]() |
ff9700e23a | ||
![]() |
f0a5265a65 | ||
![]() |
64f81e3396 | ||
![]() |
c16349d5c3 | ||
![]() |
fe413ba2f5 | ||
![]() |
0d2f6e060f | ||
![]() |
a972fb7359 | ||
![]() |
99cd9f9450 | ||
![]() |
1165fa8cdb | ||
![]() |
ab1ff48527 | ||
![]() |
1a6f9c2159 | ||
![]() |
4c42ccc7d7 | ||
![]() |
cb4e9e9eda | ||
![]() |
192c3c201d | ||
![]() |
2185182eee | ||
![]() |
79be69f8c1 | ||
![]() |
c874e879c1 | ||
![]() |
ed53bd487b | ||
![]() |
c41a7303df | ||
![]() |
c1c37aad85 | ||
![]() |
7aa5c8e724 | ||
![]() |
56974ce30f | ||
![]() |
de46dfc4a2 | ||
![]() |
47efc88228 | ||
![]() |
19c734683b | ||
![]() |
d97f95fb92 | ||
![]() |
14778757d9 | ||
![]() |
300efe4877 | ||
![]() |
3d3ace1c2a | ||
![]() |
7c0d9c4f93 | ||
![]() |
9081985b08 | ||
![]() |
5cfe69d24b | ||
![]() |
937c2920ac | ||
![]() |
fd700e06f4 | ||
![]() |
e6dff16550 | ||
![]() |
f2c06042cd | ||
![]() |
a49d107a82 | ||
![]() |
b0af78f3b2 | ||
![]() |
dade379dcf | ||
![]() |
f3ac3ca25e | ||
![]() |
243c69b231 | ||
![]() |
fda7230bce | ||
![]() |
287464362e | ||
![]() |
222e909686 | ||
![]() |
1b1d37b9df | ||
![]() |
5a25ffe6e4 | ||
![]() |
6d846ab0db | ||
![]() |
47c2742878 | ||
![]() |
69eb54abf6 | ||
![]() |
1bb0330ab5 | ||
![]() |
c64fca852c | ||
![]() |
01fcd3175f | ||
![]() |
c04c0e29bb | ||
![]() |
9daf1dea31 | ||
![]() |
4a175c76f9 | ||
![]() |
4d3ff6ed20 | ||
![]() |
6e1f925944 | ||
![]() |
e756ae3c8f | ||
![]() |
b07365b487 | ||
![]() |
f1b6f8a3e4 | ||
![]() |
ad3b660bc0 | ||
![]() |
dd773d4e5e | ||
![]() |
61df7745c6 | ||
![]() |
aeaef04fac | ||
![]() |
8c2287a1e8 | ||
![]() |
fa825da404 | ||
![]() |
839f6affe2 | ||
![]() |
0d7492f6be | ||
![]() |
c09437880f | ||
![]() |
069ccab0ae | ||
![]() |
b8274d92db | ||
![]() |
4499a872d8 | ||
![]() |
94d7e01bd5 | ||
![]() |
993ce9289d | ||
![]() |
c8d6361c36 | ||
![]() |
8c610e2142 | ||
![]() |
bb0e2fb9e9 | ||
![]() |
e9e4d65c78 | ||
![]() |
ddc8bd2028 | ||
![]() |
bf9fff6065 | ||
![]() |
744347c269 | ||
![]() |
d087071fc9 | ||
![]() |
a4d6c6694a | ||
![]() |
ff3ee351d1 | ||
![]() |
b14e8daa1a | ||
![]() |
3a53ffcc23 | ||
![]() |
2abe589ef6 | ||
![]() |
f81e4fac79 | ||
![]() |
a4b27115ac | ||
![]() |
43a210cac4 | ||
![]() |
355a49e463 | ||
![]() |
975aa0a3cc | ||
![]() |
a99b8c6aaf | ||
![]() |
8a968a1f89 | ||
![]() |
c7eeaffec9 | ||
![]() |
cc79fe76fd | ||
![]() |
4cadeb8e5d | ||
![]() |
76a19ebe5b | ||
![]() |
b5613ec6dc | ||
![]() |
26137ec81e | ||
![]() |
0e67c62c86 | ||
![]() |
90bf4edf0d | ||
![]() |
d51fe8483a | ||
![]() |
3ddde1a1ca | ||
![]() |
48e28a1ba4 | ||
![]() |
558e127caa | ||
![]() |
63807e71fd | ||
![]() |
f684c38958 | ||
![]() |
4b2abf791c | ||
![]() |
a8b83d9fe1 | ||
![]() |
4ce695d933 | ||
![]() |
44aa54f247 | ||
![]() |
25e5739b34 | ||
![]() |
33e1bd567d | ||
![]() |
f727c87b56 | ||
![]() |
3775c53df3 | ||
![]() |
e715794f04 | ||
![]() |
796170100f | ||
![]() |
f25e4fab28 | ||
![]() |
c44c6c79f9 | ||
![]() |
3f6d5daa1e | ||
![]() |
7224be9de2 | ||
![]() |
2b6d88105c | ||
![]() |
d7e19865de | ||
![]() |
643d29ba57 | ||
![]() |
4b6038c50c | ||
![]() |
f10a80333b | ||
![]() |
0a80e01d0b | ||
![]() |
93a3da2335 | ||
![]() |
96c5bd0b69 | ||
![]() |
1ee76878d9 | ||
![]() |
6749604210 | ||
![]() |
e097f526bb | ||
![]() |
ea0aff1a3e | ||
![]() |
40ab3cda9c | ||
![]() |
c24098a117 | ||
![]() |
5c28f10921 | ||
![]() |
1c07508f39 | ||
![]() |
e5472a6fae | ||
![]() |
e06f8c16df | ||
![]() |
a1d7059c0b | ||
![]() |
bbe2efa4b3 | ||
![]() |
1fb121fb6d | ||
![]() |
6be4964221 | ||
![]() |
5907973d42 | ||
![]() |
a37b0229a0 | ||
![]() |
d7c8b80da5 | ||
![]() |
5998941741 | ||
![]() |
5bd4f84389 | ||
![]() |
8a47ab2dde | ||
![]() |
dda790b5c4 | ||
![]() |
b829cd260c | ||
![]() |
7b1947914e | ||
![]() |
6c3722737d | ||
![]() |
eea3f671af | ||
![]() |
f4f435c682 | ||
![]() |
b16a81cf6e | ||
![]() |
be6a1d916f | ||
![]() |
ef7b2ddbdd | ||
![]() |
d3471c945b | ||
![]() |
47b2c603ef | ||
![]() |
9a48a60d28 | ||
![]() |
678c966113 | ||
![]() |
d5d04b7dac | ||
![]() |
0f0b32d797 | ||
![]() |
fbf3ee5cd1 | ||
![]() |
40e957fff2 | ||
![]() |
3c8d16a368 | ||
![]() |
dfe0f49655 | ||
![]() |
a125e381a9 | ||
![]() |
93d0cfcfeb | ||
![]() |
6ea4d9c413 | ||
![]() |
e6301f0d06 | ||
![]() |
f61cf318ae | ||
![]() |
13db4861e1 | ||
![]() |
684363bcde | ||
![]() |
a8db5db308 | ||
![]() |
4a198ce473 | ||
![]() |
e9976635ba | ||
![]() |
079680d72e | ||
![]() |
4c3dc6362c | ||
![]() |
98428bf8c2 | ||
![]() |
73eec8f112 | ||
![]() |
789512de55 | ||
![]() |
070d4fc43e | ||
![]() |
fadf540422 | ||
![]() |
3cb803ffe3 | ||
![]() |
6ef217c546 | ||
![]() |
118f22c164 | ||
![]() |
b2b4e1bfbc | ||
![]() |
9d6cc86e60 | ||
![]() |
a3ca6abb7a | ||
![]() |
35158204c5 | ||
![]() |
4c4cefde6d | ||
![]() |
ff9554adc1 | ||
![]() |
303c741a10 | ||
![]() |
6b2ba3a285 | ||
![]() |
06bedf6cb4 | ||
![]() |
a5f04b6c7f | ||
![]() |
364257fe05 | ||
![]() |
0d00bd746e | ||
![]() |
5c86ab38a4 | ||
![]() |
cb67a23d0a | ||
![]() |
25c8edd81c | ||
![]() |
798a9893e9 | ||
![]() |
f8d26b4f8f | ||
![]() |
2c1985bef3 | ||
![]() |
4a5f1ce19a | ||
![]() |
efb1a73e88 | ||
![]() |
ea54ca6c11 | ||
![]() |
1016b46243 | ||
![]() |
a66ea53743 | ||
![]() |
95fb78f645 | ||
![]() |
6d68b56c56 | ||
![]() |
fcfc8b56bb | ||
![]() |
e1ff4578e9 | ||
![]() |
e45dfd7351 | ||
![]() |
4a92b05b57 | ||
![]() |
a0cd1f4cd0 | ||
![]() |
23c38e33d4 | ||
![]() |
80158ffa95 | ||
![]() |
97345c9710 | ||
![]() |
fdb76fc56c | ||
![]() |
df43abf9d3 | ||
![]() |
6ae703dfd9 | ||
![]() |
ec70d85638 | ||
![]() |
2bdcc4fe47 | ||
![]() |
c26af4758b | ||
![]() |
511ba61b1c | ||
![]() |
bf189bb704 | ||
![]() |
49017fda39 | ||
![]() |
53917e9bf5 | ||
![]() |
503d508a86 | ||
![]() |
8ee20e52f8 | ||
![]() |
05b8ed7153 | ||
![]() |
24547b4fc5 | ||
![]() |
18ad664acb | ||
![]() |
d60679adfd | ||
![]() |
9ace36c459 | ||
![]() |
e9c9772c58 | ||
![]() |
d20d22ffb6 | ||
![]() |
a139d9c844 | ||
![]() |
13bba63382 | ||
![]() |
8d6ecc3ec7 | ||
![]() |
3cef591719 | ||
![]() |
34a3aa0e3d | ||
![]() |
1938884656 | ||
![]() |
30ed84fd1d | ||
![]() |
b67414bb84 | ||
![]() |
5b9e97b4eb | ||
![]() |
c869516449 | ||
![]() |
7fab472fc4 | ||
![]() |
f755aefbfa | ||
![]() |
43122381f5 | ||
![]() |
d0b1cb527e | ||
![]() |
c78d6f2104 | ||
![]() |
eac2c2ddb2 | ||
![]() |
9b1efc3e45 | ||
![]() |
512084194d | ||
![]() |
8bb09f5739 | ||
![]() |
0a68ff6dd0 | ||
![]() |
e18e2492af | ||
![]() |
5d04de936b | ||
![]() |
9a85bd0edb | ||
![]() |
20b97a88c0 | ||
![]() |
eafe3737dc | ||
![]() |
9f743daf07 | ||
![]() |
291ec3aa04 | ||
![]() |
84f25ae91e | ||
![]() |
5516a11012 | ||
![]() |
316ed83047 | ||
![]() |
75bddc8777 | ||
![]() |
d096909a95 | ||
![]() |
15c47fb593 | ||
![]() |
d337defb09 | ||
![]() |
3760c3239f | ||
![]() |
4a9b528c47 | ||
![]() |
60334229d5 | ||
![]() |
40c7e34014 | ||
![]() |
75bea75dce | ||
![]() |
d5efc51d61 | ||
![]() |
3789e4b3bd | ||
![]() |
ef7466e0d5 | ||
![]() |
006a7096ed | ||
![]() |
b7a026a7e8 | ||
![]() |
a2965d83af | ||
![]() |
05481f7828 | ||
![]() |
b1c77afc81 | ||
![]() |
a5df9a2b3d | ||
![]() |
0f5d668f86 | ||
![]() |
4b3e1c7b1b | ||
![]() |
4b97b403d3 | ||
![]() |
145e7f5529 | ||
![]() |
19080924d5 | ||
![]() |
6a57e51f6b | ||
![]() |
e916d4f71f | ||
![]() |
b0b551af82 | ||
![]() |
37a8bfd6f5 | ||
![]() |
489619c337 | ||
![]() |
bd43884a1d | ||
![]() |
d693c00c47 | ||
![]() |
caec354092 | ||
![]() |
d2629e8925 | ||
![]() |
a45ce2ced2 | ||
![]() |
4af971b83c | ||
![]() |
6cfc72c875 | ||
![]() |
10c30cd21a | ||
![]() |
13ec46b145 | ||
![]() |
05bb8a2df0 | ||
![]() |
2f048b45c9 | ||
![]() |
38d0ef8542 | ||
![]() |
d67a2e60fe | ||
![]() |
22c71d832e | ||
![]() |
84fc3e7d50 | ||
![]() |
5ec11cf5b8 | ||
![]() |
933ee88172 | ||
![]() |
d18302314d | ||
![]() |
eb78d79bb3 | ||
![]() |
90e1baef50 | ||
![]() |
d028679077 | ||
![]() |
0c57183a2d | ||
![]() |
4b9394fe6b | ||
![]() |
595f857aa1 | ||
![]() |
ede9bfb17a | ||
![]() |
91bb71dc29 | ||
![]() |
318e8645b2 | ||
![]() |
5a96672d79 | ||
![]() |
1d744d4c26 | ||
![]() |
8945dd75aa | ||
![]() |
4413a61513 | ||
![]() |
1dd42e1ab2 | ||
![]() |
1dc21d846e | ||
![]() |
0e0b125d99 | ||
![]() |
051cb71956 | ||
![]() |
98fc4608da | ||
![]() |
5bdacc70e5 | ||
![]() |
d659e62fda | ||
![]() |
7bf509097f | ||
![]() |
b333b3f083 | ||
![]() |
6277e0e372 | ||
![]() |
10f594c774 | ||
![]() |
c53170fe84 | ||
![]() |
1e42fe9de5 | ||
![]() |
c064bb275f | ||
![]() |
1fb9ef4d58 | ||
![]() |
0ea0ca240a | ||
![]() |
512e74c493 | ||
![]() |
c9d40abe96 | ||
![]() |
2ed34dda15 | ||
![]() |
5151e2dd96 | ||
![]() |
a637ba1e6b | ||
![]() |
3e9fdbacad | ||
![]() |
8d534691ac | ||
![]() |
c7496d7018 | ||
![]() |
d61d9cc574 | ||
![]() |
6a643411a4 | ||
![]() |
d369693f9f | ||
![]() |
b4d1666bdf | ||
![]() |
2f2b36c91d | ||
![]() |
10a8babed7 | ||
![]() |
86117944e4 | ||
![]() |
841dda903f | ||
![]() |
6907fbe844 | ||
![]() |
bef7a2af36 | ||
![]() |
8192b19858 | ||
![]() |
fe35986432 | ||
![]() |
358ac1592b | ||
![]() |
e100e0ea72 | ||
![]() |
61fa77b752 | ||
![]() |
3bc0ba73ee | ||
![]() |
6022ef9be3 | ||
![]() |
c1eaf28812 | ||
![]() |
0eb394fb86 | ||
![]() |
291128b96f | ||
![]() |
c88e1cca68 | ||
![]() |
b5083d32db | ||
![]() |
a76a7dd54c | ||
![]() |
0ba1d65b11 | ||
![]() |
1fa56aa683 | ||
![]() |
103f006cc0 | ||
![]() |
9913586155 | ||
![]() |
3a982f6e38 | ||
![]() |
23ce2fb33c | ||
![]() |
36f786f0eb | ||
![]() |
c56eadc49b | ||
![]() |
508359a939 | ||
![]() |
acaa83c31a | ||
![]() |
ea0dc1ea19 | ||
![]() |
f05d50bce3 | ||
![]() |
b7319fd152 | ||
![]() |
93aa96a339 | ||
![]() |
875f520710 | ||
![]() |
02528aecc7 | ||
![]() |
993d8c3b4e | ||
![]() |
25e61cc8d5 | ||
![]() |
d773043429 | ||
![]() |
3b54ab3e0b | ||
![]() |
d9e5eff23d | ||
![]() |
4fa9ab3c6e | ||
![]() |
0375d66b91 | ||
![]() |
4ad958b9d2 | ||
![]() |
de788423e1 | ||
![]() |
6b7631013d | ||
![]() |
5c66eb5f4f | ||
![]() |
81db564e34 | ||
![]() |
46501b7caa | ||
![]() |
3e8d6a27f1 | ||
![]() |
4806d7e5fe | ||
![]() |
342c7c3854 | ||
![]() |
4a36ab827c | ||
![]() |
fded97d586 | ||
![]() |
de6275003e | ||
![]() |
f7e549b5fd | ||
![]() |
e27debd452 | ||
![]() |
e3afb2c52a | ||
![]() |
fed42d4898 | ||
![]() |
b33c2fd0d0 | ||
![]() |
a9b60b3d4a | ||
![]() |
20e654ddea | ||
![]() |
bdbb8e2a7d | ||
![]() |
37b9a81344 | ||
![]() |
21014c5013 | ||
![]() |
9daefed9b3 | ||
![]() |
23a94ebfad | ||
![]() |
d1980aeed8 | ||
![]() |
fec8ba28e2 | ||
![]() |
9b61b05155 | ||
![]() |
ad35481234 | ||
![]() |
31ae5eacd5 | ||
![]() |
22ef6aad7b | ||
![]() |
e4a518c444 | ||
![]() |
b8fdce378f | ||
![]() |
0c41395cfc | ||
![]() |
f43b6db427 | ||
![]() |
5222f44904 | ||
![]() |
1123cbb728 | ||
![]() |
2131ea65cb | ||
![]() |
fc8391c6d1 | ||
![]() |
f086a2aa38 | ||
![]() |
92c1b165fb | ||
![]() |
3df1407073 | ||
![]() |
05c33a4b34 | ||
![]() |
2bd107056c | ||
![]() |
b9da7e1b12 | ||
![]() |
f1eba6a404 | ||
![]() |
0e13e5606a | ||
![]() |
c6b2f831e5 | ||
![]() |
f26f42427f | ||
![]() |
ed9f8a269c | ||
![]() |
fe2905e9df | ||
![]() |
7e28619e9d | ||
![]() |
e277a19f71 | ||
![]() |
78941ec8d9 | ||
![]() |
4aa8f43a7e | ||
![]() |
40a8761feb | ||
![]() |
aa97a36167 | ||
![]() |
daa304c613 | ||
![]() |
67e7ba023a | ||
![]() |
af956c6c42 | ||
![]() |
1bbf6c0940 | ||
![]() |
8d1bd2adcd | ||
![]() |
ff8f1ee435 | ||
![]() |
fd15865d0b | ||
![]() |
5a9fedbb9a | ||
![]() |
79e71ec4ab | ||
![]() |
0ed3429cf7 | ||
![]() |
fd0760ed07 | ||
![]() |
9e065541b9 | ||
![]() |
f36c1fbc3f | ||
![]() |
94ba18eaee | ||
![]() |
362173ef10 | ||
![]() |
3f2c57c89f | ||
![]() |
e05a58bdee | ||
![]() |
f17d7355e0 | ||
![]() |
29e023096b | ||
![]() |
7650064b64 | ||
![]() |
d50d3678ec | ||
![]() |
848b727b11 | ||
![]() |
5e49c2709b | ||
![]() |
6c1d67c966 | ||
![]() |
66807a801b | ||
![]() |
c1f05bf014 | ||
![]() |
d458d699e6 | ||
![]() |
6c309705a0 | ||
![]() |
27d5a92fee | ||
![]() |
878486cdab | ||
![]() |
ed5455089e | ||
![]() |
d7863c2572 | ||
![]() |
4a610ba2e6 | ||
![]() |
255485296c | ||
![]() |
99688c1c77 | ||
![]() |
fb3105c099 | ||
![]() |
c3637bc416 | ||
![]() |
8c26b632fe | ||
![]() |
0b9fe2dfe7 | ||
![]() |
3b0292029d | ||
![]() |
3a91ab6bec | ||
![]() |
66f1ed0e41 | ||
![]() |
acd8c97afc | ||
![]() |
be49ca6967 | ||
![]() |
2939b53467 | ||
![]() |
6fb78c5dde | ||
![]() |
5b2f4127ea | ||
![]() |
c5fef6b954 | ||
![]() |
84db66a60c | ||
![]() |
db0eee707a | ||
![]() |
06b5f6c97c | ||
![]() |
a6a7d22ec1 | ||
![]() |
f0d8f79676 | ||
![]() |
4d0223e305 | ||
![]() |
528c0f9622 | ||
![]() |
56392ccdd0 | ||
![]() |
d4b2cf9943 | ||
![]() |
950af8b5e0 | ||
![]() |
21740ea2fd | ||
![]() |
5e879a2d92 | ||
![]() |
6ef5677dc5 | ||
![]() |
ac451757b4 | ||
![]() |
a348755be2 | ||
![]() |
a24076f0ce | ||
![]() |
e0f7ba827f | ||
![]() |
cefadc7c27 | ||
![]() |
de6401c5db | ||
![]() |
e43f713a66 | ||
![]() |
8d77111b06 | ||
![]() |
f6712a6686 | ||
![]() |
6af9440ed7 | ||
![]() |
d145ce5f6d | ||
![]() |
634a93061b | ||
![]() |
6b3e645c12 | ||
![]() |
fba7c5f978 | ||
![]() |
5db7d3776a | ||
![]() |
34bdd2ac84 | ||
![]() |
87ba8026e5 | ||
![]() |
c2968fbe52 | ||
![]() |
117e52df23 | ||
![]() |
4e09b757c3 | ||
![]() |
012a06d8a6 | ||
![]() |
d8b45db331 | ||
![]() |
a34a42d2b2 | ||
![]() |
3cc8adba86 | ||
![]() |
eccce1cabb | ||
![]() |
d3e67ccbcd | ||
![]() |
45f19517d3 | ||
![]() |
259d123876 | ||
![]() |
0853fac66a | ||
![]() |
6fc517269f | ||
![]() |
0e57152888 | ||
![]() |
935a6b2a68 | ||
![]() |
68bd3047c4 | ||
![]() |
aa6e540abd | ||
![]() |
9caf0e2e1f | ||
![]() |
8039af1c06 | ||
![]() |
699536b1ab | ||
![]() |
16ab8b6ffa | ||
![]() |
477a34cfa7 | ||
![]() |
147c65afe6 | ||
![]() |
2983ff7ba0 | ||
![]() |
ed6f2f27cc | ||
![]() |
9dd6f8ef7d | ||
![]() |
053fc4eb55 | ||
![]() |
44663fe548 | ||
![]() |
c88d060fe0 | ||
![]() |
469f9cf015 | ||
![]() |
3dfdb26502 | ||
![]() |
9149902c78 | ||
![]() |
b464db5722 | ||
![]() |
8cadec9a16 | ||
![]() |
00a0e6fb11 | ||
![]() |
9a0a280d7d | ||
![]() |
ad5444d270 | ||
![]() |
3cc789dda9 | ||
![]() |
ac5a6c011b | ||
![]() |
6febd01e76 | ||
![]() |
4c2f1aa4ed | ||
![]() |
944e896196 | ||
![]() |
4ffd0df7c1 | ||
![]() |
2ffb930f7f | ||
![]() |
8d0dfd631b | ||
![]() |
350e901c2a | ||
![]() |
1342d67746 | ||
![]() |
b9d699df84 | ||
![]() |
6b01a7e888 | ||
![]() |
49f241a4b9 | ||
![]() |
eeba784c32 | ||
![]() |
0ccb6883f8 | ||
![]() |
da10c6503c | ||
![]() |
b66af5903b | ||
![]() |
440a88aa0f | ||
![]() |
ee1065bfdb | ||
![]() |
076d3d8189 | ||
![]() |
c1e2c5551c | ||
![]() |
edbf7e6723 | ||
![]() |
88a8922833 | ||
![]() |
0c653b5ee3 | ||
![]() |
f92123c398 | ||
![]() |
ea8e52377c | ||
![]() |
8387129eda | ||
![]() |
93b3a5dab6 | ||
![]() |
eb1bb02dc5 | ||
![]() |
baeb9a558e | ||
![]() |
8428790001 | ||
![]() |
7c46f10dd1 | ||
![]() |
b1b4e7e4ef | ||
![]() |
51ff56eb4f | ||
![]() |
df9141ec4e | ||
![]() |
e608c0b428 | ||
![]() |
bac82f47d8 | ||
![]() |
44ff02b7af | ||
![]() |
cc6fa7058b | ||
![]() |
ae3f79e522 | ||
![]() |
3688979b8f | ||
![]() |
cac9de3cc7 | ||
![]() |
2923585bd3 | ||
![]() |
8b46c1e3f0 | ||
![]() |
46c8887c3e | ||
![]() |
db645fb393 | ||
![]() |
5bc4a1618b | ||
![]() |
dc5ad6ce82 | ||
![]() |
1866d8dd07 | ||
![]() |
d1224ac879 | ||
![]() |
a1249a21c2 | ||
![]() |
c583e9734c | ||
![]() |
75b48fdaae | ||
![]() |
9ece43ce57 | ||
![]() |
a557ec614a | ||
![]() |
6c0f243655 | ||
![]() |
d03de66b64 | ||
![]() |
ccdf821583 | ||
![]() |
54bfafdbfe | ||
![]() |
57c2a7981f | ||
![]() |
62dca3d0b0 | ||
![]() |
6d27d0cfba | ||
![]() |
218ac221e5 | ||
![]() |
a4095b30f7 | ||
![]() |
c9eeabecba | ||
![]() |
961e0e801d | ||
![]() |
37a21d93a1 | ||
![]() |
ecf7acc800 | ||
![]() |
b0e8f7d985 | ||
![]() |
210508480e | ||
![]() |
db25a5bfd0 | ||
![]() |
e5ffe3025b | ||
![]() |
cd7922f204 | ||
![]() |
805a1afa3f | ||
![]() |
9ed501a8cc | ||
![]() |
b515331e48 | ||
![]() |
177d9d2e3d | ||
![]() |
4ee30feb0f | ||
![]() |
a5d1eece71 | ||
![]() |
e6144ea08b | ||
![]() |
497c80161d | ||
![]() |
c869238678 | ||
![]() |
7f567dec3a | ||
![]() |
8c8d539266 | ||
![]() |
8ea769d0e5 | ||
![]() |
7443b31a93 | ||
![]() |
8c211df633 | ||
![]() |
eb45b9f8d9 | ||
![]() |
d550efbf8f | ||
![]() |
e9322628cb | ||
![]() |
42982a69ea | ||
![]() |
fde5398455 | ||
![]() |
79b1502920 | ||
![]() |
bce6662eae | ||
![]() |
69f04beb6d | ||
![]() |
85f108d10e | ||
![]() |
652f51d484 | ||
![]() |
6ec0ddb94e | ||
![]() |
802f4bfd6b | ||
![]() |
5765533491 | ||
![]() |
aeccf5c5f6 | ||
![]() |
90f0fcfea6 | ||
![]() |
91bb38573b | ||
![]() |
52e9717288 | ||
![]() |
bd45833395 | ||
![]() |
c7c241fe7a | ||
![]() |
73f73e0236 | ||
![]() |
021848524a | ||
![]() |
2c2df9f01e | ||
![]() |
f2a60f683c | ||
![]() |
630ffe0cf8 | ||
![]() |
3d79f9fd7d | ||
![]() |
0a165c5b93 | ||
![]() |
2a2ff721c1 | ||
![]() |
d75fe88c44 | ||
![]() |
37a788a141 | ||
![]() |
e1a9da0716 | ||
![]() |
ff7341d272 | ||
![]() |
046a70c5f6 | ||
![]() |
a8a4e362a0 | ||
![]() |
6ca69802f5 | ||
![]() |
1b059c5293 | ||
![]() |
b529a005d8 | ||
![]() |
12dd6ae6b0 | ||
![]() |
e93e1b91a9 | ||
![]() |
5c1008a0df | ||
![]() |
135e98cde1 | ||
![]() |
79634d402e | ||
![]() |
cb2234cef5 | ||
![]() |
cfb6cf5ab4 | ||
![]() |
0a16cc2ded | ||
![]() |
a0d9b5ddf4 | ||
![]() |
2ab00bfd78 | ||
![]() |
f411dcde24 | ||
![]() |
585db147ac | ||
![]() |
17d99e16b9 | ||
![]() |
b0821e8011 | ||
![]() |
ee35cc6f22 | ||
![]() |
189bc1faa8 | ||
![]() |
d9ff59afda | ||
![]() |
f636b98cb3 | ||
![]() |
33e345f4ae | ||
![]() |
cb8db266cd | ||
![]() |
cdaf36f346 | ||
![]() |
d0b78babd2 | ||
![]() |
66769ab34b | ||
![]() |
dd04459748 | ||
![]() |
2cbacd6187 | ||
![]() |
1c27efc8f1 | ||
![]() |
4191e50456 | ||
![]() |
d30e5e2b02 | ||
![]() |
4191a56bfb | ||
![]() |
ec438ead51 | ||
![]() |
cff757fe9e | ||
![]() |
a65235c0fd | ||
![]() |
ec275b2fe0 | ||
![]() |
91b395118e | ||
![]() |
e2bfb31cb2 | ||
![]() |
a3b2fbadb7 | ||
![]() |
4760295d6a | ||
![]() |
035a7b2096 | ||
![]() |
c35bfa3e4e | ||
![]() |
00a3b8fc33 | ||
![]() |
9e9a5f9a6a | ||
![]() |
9ad8e5b546 | ||
![]() |
44dec830e5 | ||
![]() |
5b4718fac4 | ||
![]() |
22236e2909 | ||
![]() |
9387ef7116 | ||
![]() |
2219315ccc | ||
![]() |
7c62b6f7a7 | ||
![]() |
7730080afc | ||
![]() |
6cc509f5b4 | ||
![]() |
22d9981c2e | ||
![]() |
8137d715df | ||
![]() |
dfc5e0f50e | ||
![]() |
4ab41ba82e | ||
![]() |
38afb35b65 | ||
![]() |
e78d1ac3c1 | ||
![]() |
533b491124 | ||
![]() |
7cee515187 | ||
![]() |
0737faa034 | ||
![]() |
88fe195615 | ||
![]() |
410ee8eb65 | ||
![]() |
63290154eb | ||
![]() |
ab16ffc823 | ||
![]() |
868b184069 | ||
![]() |
7b4f7d758e | ||
![]() |
aded59d7ff | ||
![]() |
737b2e578a | ||
![]() |
33931b4bf2 | ||
![]() |
97c5e97ccb | ||
![]() |
1e8c9f709b | ||
![]() |
c74bce2fdb | ||
![]() |
d35dc5582e | ||
![]() |
46aa7d5824 | ||
![]() |
34ea572c0b | ||
![]() |
5f8e26a8ec | ||
![]() |
e821b2a025 | ||
![]() |
9beb32cea2 | ||
![]() |
024f09dbd4 | ||
![]() |
beadc08002 | ||
![]() |
19cd6336f9 | ||
![]() |
34e81dc50a | ||
![]() |
e0650d26cf | ||
![]() |
8d62960548 | ||
![]() |
2cbe1b0049 | ||
![]() |
8eab3c5b36 | ||
![]() |
eac59ba5c8 | ||
![]() |
d20601c359 | ||
![]() |
efdbc3c5b5 | ||
![]() |
580f817dd9 | ||
![]() |
e5c5a071f2 | ||
![]() |
eaad87c704 | ||
![]() |
1453d33123 | ||
![]() |
b2b3a633d0 | ||
![]() |
e8dfe92be3 | ||
![]() |
37de777b2a | ||
![]() |
62d1918892 | ||
![]() |
f32cf3342c | ||
![]() |
96e5c42795 | ||
![]() |
b8c6e95b73 | ||
![]() |
8044039d78 | ||
![]() |
440cfd0d72 | ||
![]() |
04d1e303be | ||
![]() |
eefc3b33d7 | ||
![]() |
96421ee1e5 | ||
![]() |
3d18460d23 | ||
![]() |
a428bebda9 | ||
![]() |
18af33c9bb | ||
![]() |
80e9a9cf1c | ||
![]() |
a542cd70da | ||
![]() |
dd7c2a0763 | ||
![]() |
07e7c5c4a0 | ||
![]() |
bbcba05fdd | ||
![]() |
7af29a243b | ||
![]() |
5e45d68bef | ||
![]() |
c7af97f301 | ||
![]() |
0675be8835 | ||
![]() |
8291c4d273 | ||
![]() |
f9d1d34763 | ||
![]() |
c996bf47ea | ||
![]() |
dfd43b55aa | ||
![]() |
f021df446c | ||
![]() |
f4aa83788b | ||
![]() |
e334564520 | ||
![]() |
0e0ebe9251 | ||
![]() |
4147752672 | ||
![]() |
935752c786 | ||
![]() |
e2cdb4387a | ||
![]() |
3dce9d9ed3 | ||
![]() |
99ed897bf4 | ||
![]() |
c750ea2355 | ||
![]() |
e3ca3c9370 | ||
![]() |
bfa398bee1 | ||
![]() |
485c96fec1 | ||
![]() |
acb4a77032 | ||
![]() |
365a48110c | ||
![]() |
ce0195bd51 | ||
![]() |
3097f46aa1 | ||
![]() |
d9a5b4a0f5 | ||
![]() |
8d35955d03 | ||
![]() |
c00f7e2144 | ||
![]() |
66d3b7b4af | ||
![]() |
a68bf572cc | ||
![]() |
fb140f24c1 | ||
![]() |
c3c77ed586 | ||
![]() |
568a625500 | ||
![]() |
85e6e7e08a | ||
![]() |
22b8643def | ||
![]() |
b2020686f5 | ||
![]() |
aa4051a7cd | ||
![]() |
50d6f1f95a | ||
![]() |
582aabc1a3 | ||
![]() |
46d0e96321 | ||
![]() |
dd22c04573 | ||
![]() |
067cd60e20 | ||
![]() |
e78777f8e1 | ||
![]() |
ec0865b03f | ||
![]() |
6ed37743a5 | ||
![]() |
1767cef701 | ||
![]() |
b2fe300f02 | ||
![]() |
061aa889a6 | ||
![]() |
80903bde38 | ||
![]() |
2cc0bb1995 | ||
![]() |
8d3846b2f2 | ||
![]() |
e58ca10e25 | ||
![]() |
42b97d1e1a | ||
![]() |
9f14d01c22 | ||
![]() |
c0cb3d70ff | ||
![]() |
163c8945ed | ||
![]() |
36aaa4d70c | ||
![]() |
f17617c659 | ||
![]() |
873104d573 | ||
![]() |
927eb3b38c | ||
![]() |
abd47ae7ae | ||
![]() |
1e8a4534d5 | ||
![]() |
587871e87c | ||
![]() |
908ca52b08 | ||
![]() |
ef720e3a59 | ||
![]() |
09ba419ee3 | ||
![]() |
86cfc59d33 | ||
![]() |
789bdef190 | ||
![]() |
bb12c5107c | ||
![]() |
8041c085f6 | ||
![]() |
c20fdf4450 | ||
![]() |
4902fab187 | ||
![]() |
7d79727c2e | ||
![]() |
dfba168504 | ||
![]() |
2762230691 | ||
![]() |
20bae8e54b | ||
![]() |
332fadd42e | ||
![]() |
c3fb86e391 | ||
![]() |
84ebf5d929 | ||
![]() |
7a777964a7 | ||
![]() |
984072467e | ||
![]() |
b793998814 | ||
![]() |
6da013bf6c | ||
![]() |
16eeb501ca | ||
![]() |
64afab821f | ||
![]() |
d27759ac2d | ||
![]() |
a7d8cfcdbb | ||
![]() |
277d98ae2c | ||
![]() |
70a34615a3 | ||
![]() |
f06fff983e | ||
![]() |
11a63ab2ef | ||
![]() |
9cf5c9385d | ||
![]() |
6decabb369 | ||
![]() |
df3623b663 | ||
![]() |
366b1c9073 | ||
![]() |
ac733ae6ea | ||
![]() |
43ce0fb44f | ||
![]() |
40d2251844 | ||
![]() |
4c189f2fcc | ||
![]() |
3d7acbbe1d | ||
![]() |
9c205d7da5 | ||
![]() |
6ea88808b2 | ||
![]() |
f541a94351 | ||
![]() |
1325e507fb | ||
![]() |
3861d46ce3 | ||
![]() |
a8c8447297 | ||
![]() |
455f991857 | ||
![]() |
2cba0ade84 | ||
![]() |
152db68606 | ||
![]() |
dae827a45b | ||
![]() |
d874fccfd1 | ||
![]() |
04735dfb4f | ||
![]() |
46293546b6 | ||
![]() |
7ccb38b5ab | ||
![]() |
5f04ac9cb4 | ||
![]() |
c7855f2ca5 | ||
![]() |
aea4379fe4 | ||
![]() |
c320ab2feb | ||
![]() |
3f335315ab | ||
![]() |
17d0ee64c2 | ||
![]() |
d89a21e2b0 | ||
![]() |
2bbe6c8346 | ||
![]() |
b26036f366 | ||
![]() |
d67350b93b | ||
![]() |
f11210fa2b | ||
![]() |
ff7fd94b57 | ||
![]() |
1ee822d715 | ||
![]() |
8bcb2f750a | ||
![]() |
2bd2839107 | ||
![]() |
a51d4e54db | ||
![]() |
52342a7612 | ||
![]() |
401cba23b7 | ||
![]() |
512405f01f | ||
![]() |
8c599f368e | ||
![]() |
855153f121 | ||
![]() |
cddb05d8fc | ||
![]() |
14f67746bf | ||
![]() |
f8e98a5817 | ||
![]() |
46b49ab987 | ||
![]() |
7442b933fd | ||
![]() |
c95e2dbb06 | ||
![]() |
f338a03c97 | ||
![]() |
8d002f76d2 | ||
![]() |
827cc592b4 | ||
![]() |
6281593084 | ||
![]() |
791f3beffc | ||
![]() |
6186700a66 | ||
![]() |
47ce0fd448 | ||
![]() |
8a945f8baf | ||
![]() |
e283288a26 | ||
![]() |
52747ea6bd | ||
![]() |
7cb4664018 | ||
![]() |
3361adf08a | ||
![]() |
3bcec30a4c | ||
![]() |
e1384c2ab1 | ||
![]() |
8d78fad621 | ||
![]() |
c497604a30 | ||
![]() |
3564ab0e1c | ||
![]() |
9ff6df83e5 | ||
![]() |
f6d9f7a913 | ||
![]() |
b76f568d7d | ||
![]() |
45d4329630 | ||
![]() |
f74c93e3e7 | ||
![]() |
ee606275ad | ||
![]() |
2448d71edd | ||
![]() |
7dbdaf1f8a | ||
![]() |
34bc59f96f | ||
![]() |
e3de40bdfe | ||
![]() |
2db9d31386 | ||
![]() |
639644375d | ||
![]() |
c038d74302 | ||
![]() |
63e336d4bb | ||
![]() |
0d144ff58b | ||
![]() |
bbfa15845a | ||
![]() |
3477637c74 | ||
![]() |
98ca378302 | ||
![]() |
860f990a2e | ||
![]() |
422b7681f4 | ||
![]() |
e945ebe325 | ||
![]() |
178b9f2bcb | ||
![]() |
d83990bb58 | ||
![]() |
0469ddea7a | ||
![]() |
b309df005c | ||
![]() |
ec4e52fa1a | ||
![]() |
0516d44842 | ||
![]() |
56910ea4c1 | ||
![]() |
cbf3a9e939 | ||
![]() |
4639d4a7db | ||
![]() |
0e42efd32b | ||
![]() |
7d0bb80a90 | ||
![]() |
c0a28716f5 | ||
![]() |
852bafdfa0 | ||
![]() |
55f96c4730 | ||
![]() |
4360d263e4 | ||
![]() |
4b5e415147 | ||
![]() |
24d89db025 | ||
![]() |
bf09071e1d | ||
![]() |
d51b9d2ad7 | ||
![]() |
41e09271a2 | ||
![]() |
46a43981df | ||
![]() |
0ad2113b81 | ||
![]() |
1d9489169b | ||
![]() |
4f2bf5431d | ||
![]() |
3c3300a541 | ||
![]() |
a3e7556a06 | ||
![]() |
18f4b4ff5c | ||
![]() |
fcffe0f79d | ||
![]() |
773a0c769d | ||
![]() |
e5b0fe7198 | ||
![]() |
fbd73a48c4 | ||
![]() |
d7f5211fc4 | ||
![]() |
77880abb87 | ||
![]() |
7a14b42345 | ||
![]() |
33a9516042 | ||
![]() |
c40a993273 | ||
![]() |
b28dc0702e | ||
![]() |
158755377b | ||
![]() |
e80f8b31c1 | ||
![]() |
4101e056e4 | ||
![]() |
2dc539c357 | ||
![]() |
2df51bfef8 | ||
![]() |
820841d4e0 | ||
![]() |
e91f18f344 | ||
![]() |
9335381560 | ||
![]() |
3fcc105b78 | ||
![]() |
2714d3c03c | ||
![]() |
e14b5a89c3 | ||
![]() |
430a1416c6 | ||
![]() |
4cb4d9b14c | ||
![]() |
f46e20c119 |
551 changed files with 84980 additions and 21322 deletions
3
.gitignore
vendored
3
.gitignore
vendored
|
@ -1,5 +1,8 @@
|
||||||
|
*~
|
||||||
|
*.pyc
|
||||||
.coverage
|
.coverage
|
||||||
.tox/
|
.tox/
|
||||||
|
dist/
|
||||||
docs/_build/
|
docs/_build/
|
||||||
htmlcov/
|
htmlcov/
|
||||||
Tailbone.egg-info/
|
Tailbone.egg-info/
|
||||||
|
|
689
CHANGELOG.md
Normal file
689
CHANGELOG.md
Normal file
|
@ -0,0 +1,689 @@
|
||||||
|
|
||||||
|
# Changelog
|
||||||
|
All notable changes to Tailbone will be documented in this file.
|
||||||
|
|
||||||
|
The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/)
|
||||||
|
and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html).
|
||||||
|
|
||||||
|
## v0.22.8 (2025-05-20)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- add startup hack for tempmon DB model
|
||||||
|
|
||||||
|
## v0.22.7 (2025-02-19)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- stop using old config for logo image url on login page
|
||||||
|
- fix warning msg for deprecated Grid param
|
||||||
|
|
||||||
|
## v0.22.6 (2025-02-01)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- register vue3 form component for products -> make batch
|
||||||
|
|
||||||
|
## v0.22.5 (2024-12-16)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- whoops this is latest rattail
|
||||||
|
- require newer rattail lib
|
||||||
|
- require newer wuttaweb
|
||||||
|
- let caller request safe HTML literal for rendered grid table
|
||||||
|
|
||||||
|
## v0.22.4 (2024-11-22)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid error in product search for duplicated key
|
||||||
|
- use vmodel for confirm password widget input
|
||||||
|
|
||||||
|
## v0.22.3 (2024-11-19)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid error for trainwreck query when not a customer
|
||||||
|
|
||||||
|
## v0.22.2 (2024-11-18)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- use local/custom enum for continuum operations
|
||||||
|
- add basic master view for Product Costs
|
||||||
|
- show continuum operation type when viewing version history
|
||||||
|
- always define `app` attr for ViewSupplement
|
||||||
|
- avoid deprecated import
|
||||||
|
|
||||||
|
## v0.22.1 (2024-11-02)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix submit button for running problem report
|
||||||
|
- avoid deprecated grid method
|
||||||
|
|
||||||
|
## v0.22.0 (2024-10-22)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- add support for new ordering batch from parsed file
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid deprecated method to suggest username
|
||||||
|
|
||||||
|
## v0.21.11 (2024-10-03)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- custom method for adding grid action
|
||||||
|
- become/stop root should redirect to previous url
|
||||||
|
|
||||||
|
## v0.21.10 (2024-09-15)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- update project repo links, kallithea -> forgejo
|
||||||
|
- use better icon for submit button on login page
|
||||||
|
- wrap notes text for batch view
|
||||||
|
- expose datasync consumer batch size via configure page
|
||||||
|
|
||||||
|
## v0.21.9 (2024-08-28)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- render custom attrs in form component tag
|
||||||
|
|
||||||
|
## v0.21.8 (2024-08-28)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- ignore session kwarg for `MasterView.make_row_grid()`
|
||||||
|
|
||||||
|
## v0.21.7 (2024-08-28)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid error when form value cannot be obtained
|
||||||
|
|
||||||
|
## v0.21.6 (2024-08-28)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid error when grid value cannot be obtained
|
||||||
|
|
||||||
|
## v0.21.5 (2024-08-28)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- set empty string for "-new-" file configure option
|
||||||
|
|
||||||
|
## v0.21.4 (2024-08-26)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- handle differing email profile keys for appinfo/configure
|
||||||
|
|
||||||
|
## v0.21.3 (2024-08-26)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- show non-standard config values for app info configure email
|
||||||
|
|
||||||
|
## v0.21.2 (2024-08-26)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- refactor waterpark base template to use wutta feedback component
|
||||||
|
- fix input/output file upload feature for configure pages, per oruga
|
||||||
|
- tweak how grid data translates to Vue template context
|
||||||
|
- merge filters into main grid template
|
||||||
|
- add basic wutta view for users
|
||||||
|
- some fixes for wutta people view
|
||||||
|
- various fixes for waterpark theme
|
||||||
|
- avoid deprecated `component` form kwarg
|
||||||
|
|
||||||
|
## v0.21.1 (2024-08-22)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- misc. bugfixes per recent changes
|
||||||
|
|
||||||
|
## v0.21.0 (2024-08-22)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- move "most" filtering logic for grid class to wuttaweb
|
||||||
|
- inherit from wuttaweb templates for home, login pages
|
||||||
|
- inherit from wuttaweb for AppInfoView, appinfo/configure template
|
||||||
|
- add "has output file templates" config option for master view
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- change grid reset-view param name to match wuttaweb
|
||||||
|
- move "searchable columns" grid feature to wuttaweb
|
||||||
|
- use wuttaweb to get/render csrf token
|
||||||
|
- inherit from wuttaweb for appinfo/index template
|
||||||
|
- prefer wuttaweb config for "home redirect to login" feature
|
||||||
|
- fix master/index template rendering for waterpark theme
|
||||||
|
- fix spacing for navbar logo/title in waterpark theme
|
||||||
|
|
||||||
|
## v0.20.1 (2024-08-20)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix default filter verbs logic for workorder status
|
||||||
|
|
||||||
|
## v0.20.0 (2024-08-20)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- add new 'waterpark' theme, based on wuttaweb w/ vue2 + buefy
|
||||||
|
- refactor templates to simplify base/page/form structure
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid deprecated reference to app db engine
|
||||||
|
|
||||||
|
## v0.19.3 (2024-08-19)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- add pager stats to all grid vue data (fixes view history)
|
||||||
|
|
||||||
|
## v0.19.2 (2024-08-19)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- sort on frontend for appinfo package listing grid
|
||||||
|
- prefer attr over key lookup when getting model values
|
||||||
|
- replace all occurrences of `component_studly` => `vue_component`
|
||||||
|
|
||||||
|
## v0.19.1 (2024-08-19)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix broken user auth for web API app
|
||||||
|
|
||||||
|
## v0.19.0 (2024-08-18)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- move multi-column grid sorting logic to wuttaweb
|
||||||
|
- move single-column grid sorting logic to wuttaweb
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix misc. errors in grid template per wuttaweb
|
||||||
|
- fix broken permission directives in web api startup
|
||||||
|
|
||||||
|
## v0.18.0 (2024-08-16)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- move "basic" grid pagination logic to wuttaweb
|
||||||
|
- inherit from wutta base class for Grid
|
||||||
|
- inherit most logic from wuttaweb, for GridAction
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid route error in user view, when using wutta people view
|
||||||
|
- fix some more wutta compat for base template
|
||||||
|
|
||||||
|
## v0.17.0 (2024-08-15)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- use wuttaweb for `get_liburl()` logic
|
||||||
|
|
||||||
|
## v0.16.1 (2024-08-15)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- improve wutta People view a bit
|
||||||
|
- update references to `get_class_hierarchy()`
|
||||||
|
- tweak template for `people/view_profile` per wutta compat
|
||||||
|
|
||||||
|
## v0.16.0 (2024-08-15)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- add first wutta-based master, for PersonView
|
||||||
|
- refactor forms/grids/views/templates per wuttaweb compat
|
||||||
|
|
||||||
|
## v0.15.6 (2024-08-13)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid `before_render` subscriber hook for web API
|
||||||
|
- simplify verbiage for batch execution panel
|
||||||
|
|
||||||
|
## v0.15.5 (2024-08-09)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- assign convenience attrs for all views (config, app, enum, model)
|
||||||
|
|
||||||
|
## v0.15.4 (2024-08-09)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid bug when checking current theme
|
||||||
|
|
||||||
|
## v0.15.3 (2024-08-08)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix timepicker `parseTime()` when value is null
|
||||||
|
|
||||||
|
## v0.15.2 (2024-08-06)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- use auth handler, avoid legacy calls for role/perm checks
|
||||||
|
|
||||||
|
## v0.15.1 (2024-08-05)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- move magic `b` template context var to wuttaweb
|
||||||
|
|
||||||
|
## v0.15.0 (2024-08-05)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- move more subscriber logic to wuttaweb
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- use wuttaweb logic for `util.get_form_data()`
|
||||||
|
|
||||||
|
## v0.14.5 (2024-08-03)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- use auth handler instead of deprecated auth functions
|
||||||
|
- avoid duplicate `partial` param when grid reloads data
|
||||||
|
|
||||||
|
## v0.14.4 (2024-07-18)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix more settings persistence bug(s) for datasync/configure
|
||||||
|
- fix modals for luigi tasks page, per oruga
|
||||||
|
|
||||||
|
## v0.14.3 (2024-07-17)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix auto-collapse title for viewing trainwreck txn
|
||||||
|
- allow auto-collapse of header when viewing trainwreck txn
|
||||||
|
|
||||||
|
## v0.14.2 (2024-07-15)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- add null menu handler, for use with API apps
|
||||||
|
|
||||||
|
## v0.14.1 (2024-07-14)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- update usage of auth handler, per rattail changes
|
||||||
|
- fix model reference in menu handler
|
||||||
|
- fix bug when making "integration" menus
|
||||||
|
|
||||||
|
## v0.14.0 (2024-07-14)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- move core menu logic to wuttaweb
|
||||||
|
|
||||||
|
## v0.13.2 (2024-07-13)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix logic bug for datasync/config settings save
|
||||||
|
|
||||||
|
## v0.13.1 (2024-07-13)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix settings persistence bug(s) for datasync/configure page
|
||||||
|
|
||||||
|
## v0.13.0 (2024-07-12)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- begin integrating WuttaWeb as upstream dependency
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- cast enum as list to satisfy deform widget
|
||||||
|
|
||||||
|
## v0.12.1 (2024-07-11)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- refactor `config.get_model()` => `app.model`
|
||||||
|
|
||||||
|
## v0.12.0 (2024-07-09)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- drop python 3.6 support, use pyproject.toml (again)
|
||||||
|
|
||||||
|
## v0.11.10 (2024-07-05)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- make the Members tab optional, for profile view
|
||||||
|
|
||||||
|
## v0.11.9 (2024-07-05)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- do not show flash message when changing app theme
|
||||||
|
|
||||||
|
- improve collapse panels for butterball theme
|
||||||
|
|
||||||
|
- expand input for butterball theme
|
||||||
|
|
||||||
|
- add xref button to customer profile, for trainwreck txn view
|
||||||
|
|
||||||
|
- add optional Transactions tab for profile view
|
||||||
|
|
||||||
|
## v0.11.8 (2024-07-04)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix grid action icons for datasync/configure, per oruga
|
||||||
|
|
||||||
|
- allow view supplements to add extra links for profile employee tab
|
||||||
|
|
||||||
|
- leverage import handler method to determine command/subcommand
|
||||||
|
|
||||||
|
- add tool to make user account from profile view
|
||||||
|
|
||||||
|
## v0.11.7 (2024-07-04)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- add stacklevel to deprecation warnings
|
||||||
|
|
||||||
|
- require zope.sqlalchemy >= 1.5
|
||||||
|
|
||||||
|
- include edit profile email/phone dialogs only if user has perms
|
||||||
|
|
||||||
|
- allow view supplements to add to profile member context
|
||||||
|
|
||||||
|
- cast enum as list to satisfy deform widget
|
||||||
|
|
||||||
|
- expand POD image URL setting input
|
||||||
|
|
||||||
|
## v0.11.6 (2024-07-01)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- set explicit referrer when changing dbkey
|
||||||
|
|
||||||
|
- remove references, dependency for `six` package
|
||||||
|
|
||||||
|
## v0.11.5 (2024-06-30)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- allow comma in numeric filter input
|
||||||
|
|
||||||
|
- add custom url prefix if needed, for fanstatic
|
||||||
|
|
||||||
|
- use vue 3.4.31 and oruga 0.8.12 by default
|
||||||
|
|
||||||
|
## v0.11.4 (2024-06-30)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- start/stop being root should submit POST instead of GET
|
||||||
|
|
||||||
|
- require vendor when making new ordering batch via api
|
||||||
|
|
||||||
|
- don't escape each address for email attempts grid
|
||||||
|
|
||||||
|
## v0.11.3 (2024-06-28)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- add link to "resolved by" user for pending products
|
||||||
|
|
||||||
|
- handle error when merging 2 records fails
|
||||||
|
|
||||||
|
## v0.11.2 (2024-06-18)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- hide certain custorder settings if not applicable
|
||||||
|
|
||||||
|
- use different logic for buefy/oruga for product lookup keydown
|
||||||
|
|
||||||
|
- product records should be touchable
|
||||||
|
|
||||||
|
- show flash error message if resolve pending product fails
|
||||||
|
|
||||||
|
## v0.11.1 (2024-06-14)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- revert back to setup.py + setup.cfg
|
||||||
|
|
||||||
|
## v0.11.0 (2024-06-10)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- switch from setup.cfg to pyproject.toml + hatchling
|
||||||
|
|
||||||
|
## v0.10.16 (2024-06-10)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- standardize how app, package versions are determined
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- avoid deprecated config methods for app/node title
|
||||||
|
|
||||||
|
## v0.10.15 (2024-06-07)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- do *not* Use `pkg_resources` to determine package versions
|
||||||
|
|
||||||
|
## v0.10.14 (2024-06-06)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- use `pkg_resources` to determine package versions
|
||||||
|
|
||||||
|
## v0.10.13 (2024-06-06)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- remove old/unused scaffold for use with `pcreate`
|
||||||
|
|
||||||
|
- add 'fanstatic' support for sake of libcache assets
|
||||||
|
|
||||||
|
## v0.10.12 (2024-06-04)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- require pyramid 2.x; remove 1.x-style auth policies
|
||||||
|
|
||||||
|
- remove version cap for deform
|
||||||
|
|
||||||
|
- set explicit referrer when changing app theme
|
||||||
|
|
||||||
|
- add `<b-tooltip>` component shim
|
||||||
|
|
||||||
|
- include extra styles from `base_meta` template for butterball
|
||||||
|
|
||||||
|
- include butterball theme by default for new apps
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix product lookup component, per butterball
|
||||||
|
|
||||||
|
## v0.10.11 (2024-06-03)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- fix vue3 refresh bugs for various views
|
||||||
|
|
||||||
|
- fix grid bug for tempmon appliance view, per oruga
|
||||||
|
|
||||||
|
- fix ordering worksheet generator, per butterball
|
||||||
|
|
||||||
|
- fix inventory worksheet generator, per butterball
|
||||||
|
|
||||||
|
## v0.10.10 (2024-06-03)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- more butterball fixes for "view profile" template
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix focus for `<b-select>` shim component
|
||||||
|
|
||||||
|
## v0.10.9 (2024-06-03)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- let master view control context menu items for page
|
||||||
|
|
||||||
|
- fix the "new custorder" page for butterball
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix panel style for PO vs. Invoice breakdown in receiving batch
|
||||||
|
|
||||||
|
## v0.10.8 (2024-06-02)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- add styling for checked grid rows, per oruga/butterball
|
||||||
|
|
||||||
|
- fix product view template for oruga/butterball
|
||||||
|
|
||||||
|
- allow per-user custom styles for butterball
|
||||||
|
|
||||||
|
- use oruga 0.8.9 by default
|
||||||
|
|
||||||
|
## v0.10.7 (2024-06-01)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- add setting to allow decimal quantities for receiving
|
||||||
|
|
||||||
|
- log error if registry has no rattail config
|
||||||
|
|
||||||
|
- add column filters for import/export main grid
|
||||||
|
|
||||||
|
- escape all unsafe html for grid data
|
||||||
|
|
||||||
|
- add speedbumps for delete, set preferred email/phone in profile view
|
||||||
|
|
||||||
|
- fix file upload widget for oruga
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix overflow when instance header title is too long (butterball)
|
||||||
|
|
||||||
|
## v0.10.6 (2024-05-29)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- add way to flag organic products within lookup dialog
|
||||||
|
|
||||||
|
- expose db picker for butterball theme
|
||||||
|
|
||||||
|
- expose quickie lookup for butterball theme
|
||||||
|
|
||||||
|
- fix basic problems with people profile view, per butterball
|
||||||
|
|
||||||
|
## v0.10.5 (2024-05-29)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- add `<tailbone-timepicker>` component for oruga
|
||||||
|
|
||||||
|
## v0.10.4 (2024-05-12)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix styles for grid actions, per butterball
|
||||||
|
|
||||||
|
## v0.10.3 (2024-05-10)
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix bug with grid date filters
|
||||||
|
|
||||||
|
## v0.10.2 (2024-05-08)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- remove version restriction for pyramid_beaker dependency
|
||||||
|
|
||||||
|
- rename some attrs etc. for buefy components used with oruga
|
||||||
|
|
||||||
|
- fix "tools" helper for receiving batch view, per oruga
|
||||||
|
|
||||||
|
- more data type fixes for ``<tailbone-datepicker>``
|
||||||
|
|
||||||
|
- fix "view receiving row" page, per oruga
|
||||||
|
|
||||||
|
- tweak styles for grid action links, per butterball
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix employees grid when viewing department (per oruga)
|
||||||
|
|
||||||
|
- fix login "enter" key behavior, per oruga
|
||||||
|
|
||||||
|
- fix button text for autocomplete
|
||||||
|
|
||||||
|
## v0.10.1 (2024-04-28)
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- sort list of available themes
|
||||||
|
|
||||||
|
- update various icon names for oruga compatibility
|
||||||
|
|
||||||
|
- show "View This" button when cloning a record
|
||||||
|
|
||||||
|
- stop including 'falafel' as available theme
|
||||||
|
|
||||||
|
### Fix
|
||||||
|
|
||||||
|
- fix vertical alignment in main menu bar, for butterball
|
||||||
|
|
||||||
|
- fix upgrade execution logic/UI per oruga
|
||||||
|
|
||||||
|
## v0.10.0 (2024-04-28)
|
||||||
|
|
||||||
|
This version bump is to reflect adding support for Vue 3 + Oruga via
|
||||||
|
the 'butterball' theme. There is likely more work to be done for that
|
||||||
|
yet, but it mostly works at this point.
|
||||||
|
|
||||||
|
### Feat
|
||||||
|
|
||||||
|
- misc. template and view logic tweaks (applicable to all themes) for
|
||||||
|
better patterns, consistency etc.
|
||||||
|
|
||||||
|
- add initial support for Vue 3 + Oruga, via "butterball" theme
|
||||||
|
|
||||||
|
|
||||||
|
## Older Releases
|
||||||
|
|
||||||
|
Please see `docs/OLDCHANGES.rst` for older release notes.
|
2295
CHANGES.rst
2295
CHANGES.rst
File diff suppressed because it is too large
Load diff
|
@ -3,6 +3,7 @@ include *.txt
|
||||||
include *.rst
|
include *.rst
|
||||||
include *.py
|
include *.py
|
||||||
|
|
||||||
|
include tailbone/static/robots.txt
|
||||||
recursive-include tailbone/static *.js
|
recursive-include tailbone/static *.js
|
||||||
recursive-include tailbone/static *.css
|
recursive-include tailbone/static *.css
|
||||||
recursive-include tailbone/static *.png
|
recursive-include tailbone/static *.png
|
||||||
|
@ -10,5 +11,8 @@ recursive-include tailbone/static *.jpg
|
||||||
recursive-include tailbone/static *.gif
|
recursive-include tailbone/static *.gif
|
||||||
recursive-include tailbone/static *.ico
|
recursive-include tailbone/static *.ico
|
||||||
|
|
||||||
|
recursive-include tailbone/static/files *
|
||||||
|
|
||||||
recursive-include tailbone/templates *.mako
|
recursive-include tailbone/templates *.mako
|
||||||
|
recursive-include tailbone/templates *.pt
|
||||||
recursive-include tailbone/reports *.mako
|
recursive-include tailbone/reports *.mako
|
||||||
|
|
|
@ -1,10 +1,8 @@
|
||||||
|
|
||||||
Tailbone
|
# Tailbone
|
||||||
========
|
|
||||||
|
|
||||||
Tailbone is an extensible web application based on Rattail. It provides a
|
Tailbone is an extensible web application based on Rattail. It provides a
|
||||||
"back-office network environment" (BONE) for use in managing retail data.
|
"back-office network environment" (BONE) for use in managing retail data.
|
||||||
|
|
||||||
Please see Rattail's `home page`_ for more information.
|
Please see Rattail's [home page](http://rattailproject.org/) for more
|
||||||
|
information.
|
||||||
.. _home page: http://rattailproject.org/
|
|
7539
docs/OLDCHANGES.rst
Normal file
7539
docs/OLDCHANGES.rst
Normal file
File diff suppressed because it is too large
Load diff
15
docs/api/api/batch/core.rst
Normal file
15
docs/api/api/batch/core.rst
Normal file
|
@ -0,0 +1,15 @@
|
||||||
|
|
||||||
|
``tailbone.api.batch.core``
|
||||||
|
===========================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.api.batch.core
|
||||||
|
|
||||||
|
.. autoclass:: APIBatchMixin
|
||||||
|
|
||||||
|
.. autoclass:: APIBatchView
|
||||||
|
|
||||||
|
.. autoclass:: APIBatchRowView
|
||||||
|
|
||||||
|
.. autoattribute:: editable
|
||||||
|
|
||||||
|
.. autoattribute:: supports_quick_entry
|
41
docs/api/api/batch/ordering.rst
Normal file
41
docs/api/api/batch/ordering.rst
Normal file
|
@ -0,0 +1,41 @@
|
||||||
|
|
||||||
|
``tailbone.api.batch.ordering``
|
||||||
|
===============================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.api.batch.ordering
|
||||||
|
|
||||||
|
.. autoclass:: OrderingBatchViews
|
||||||
|
|
||||||
|
.. autoattribute:: collection_url_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: object_url_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: model_class
|
||||||
|
|
||||||
|
.. autoattribute:: route_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: permission_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: default_handler_spec
|
||||||
|
|
||||||
|
.. automethod:: base_query
|
||||||
|
|
||||||
|
.. automethod:: create_object
|
||||||
|
|
||||||
|
.. autoclass:: OrderingBatchRowViews
|
||||||
|
|
||||||
|
.. autoattribute:: collection_url_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: object_url_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: model_class
|
||||||
|
|
||||||
|
.. autoattribute:: route_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: permission_prefix
|
||||||
|
|
||||||
|
.. autoattribute:: default_handler_spec
|
||||||
|
|
||||||
|
.. autoattribute:: supports_quick_entry
|
||||||
|
|
||||||
|
.. automethod:: update_object
|
6
docs/api/db.rst
Normal file
6
docs/api/db.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.db``
|
||||||
|
===============
|
||||||
|
|
||||||
|
.. automodule:: tailbone.db
|
||||||
|
:members:
|
6
docs/api/diffs.rst
Normal file
6
docs/api/diffs.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.diffs``
|
||||||
|
==================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.diffs
|
||||||
|
:members:
|
9
docs/api/forms.rst
Normal file
9
docs/api/forms.rst
Normal file
|
@ -0,0 +1,9 @@
|
||||||
|
|
||||||
|
``tailbone.forms``
|
||||||
|
==================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.forms
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. autoclass:: tailbone.forms.Form
|
||||||
|
:members:
|
6
docs/api/forms.widgets.rst
Normal file
6
docs/api/forms.widgets.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.forms.widgets``
|
||||||
|
==========================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.forms.widgets
|
||||||
|
:members:
|
6
docs/api/grids.core.rst
Normal file
6
docs/api/grids.core.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.grids.core``
|
||||||
|
=======================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.grids.core
|
||||||
|
:members:
|
6
docs/api/progress.rst
Normal file
6
docs/api/progress.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.progress``
|
||||||
|
=====================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.progress
|
||||||
|
:members:
|
|
@ -3,5 +3,4 @@
|
||||||
========================
|
========================
|
||||||
|
|
||||||
.. automodule:: tailbone.subscribers
|
.. automodule:: tailbone.subscribers
|
||||||
|
:members:
|
||||||
.. autofunction:: add_rattail_config_attribute_to_request
|
|
||||||
|
|
6
docs/api/util.rst
Normal file
6
docs/api/util.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.util``
|
||||||
|
=================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.util
|
||||||
|
:members:
|
10
docs/api/views/batch.vendorcatalog.rst
Normal file
10
docs/api/views/batch.vendorcatalog.rst
Normal file
|
@ -0,0 +1,10 @@
|
||||||
|
|
||||||
|
``tailbone.views.batch.vendorcatalog``
|
||||||
|
======================================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.views.batch.vendorcatalog
|
||||||
|
|
||||||
|
.. autoclass:: VendorCatalogsView
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. autofunction:: includeme
|
6
docs/api/views/core.rst
Normal file
6
docs/api/views/core.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.views.core``
|
||||||
|
=======================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.views.core
|
||||||
|
:members:
|
|
@ -1,4 +1,3 @@
|
||||||
.. -*- coding: utf-8 -*-
|
|
||||||
|
|
||||||
``tailbone.views.master``
|
``tailbone.views.master``
|
||||||
=========================
|
=========================
|
||||||
|
@ -69,10 +68,59 @@ override when defining your subclass.
|
||||||
Factory callable to be used when creating new grid instances; defaults to
|
Factory callable to be used when creating new grid instances; defaults to
|
||||||
:class:`tailbone.grids.Grid`.
|
:class:`tailbone.grids.Grid`.
|
||||||
|
|
||||||
.. Methods to Override
|
.. attribute:: MasterView.results_downloadable_csv
|
||||||
.. -------------------
|
|
||||||
..
|
Flag indicating whether the view should allow CSV download of grid data,
|
||||||
.. The following is a list of methods which you can override when defining your
|
i.e. primary search results.
|
||||||
.. subclass.
|
|
||||||
..
|
.. attribute:: MasterView.help_url
|
||||||
.. .. automethod:: MasterView.get_settings
|
|
||||||
|
If set, this defines the "default" help URL for all views provided by the
|
||||||
|
master. Default value for this is simply ``None`` which would mean the
|
||||||
|
Help button is not shown at all. Note that the master may choose to
|
||||||
|
override this for certain views, if so that should be done within
|
||||||
|
:meth:`get_help_url()`.
|
||||||
|
|
||||||
|
.. attribute:: MasterView.version_diff_factory
|
||||||
|
|
||||||
|
Optional factory to use for version diff objects. By default
|
||||||
|
this is *not set* but a subclass is free to set it. See also
|
||||||
|
:meth:`get_version_diff_factory()`.
|
||||||
|
|
||||||
|
|
||||||
|
Methods to Override
|
||||||
|
-------------------
|
||||||
|
|
||||||
|
The following is a list of methods which you can override when defining your
|
||||||
|
subclass.
|
||||||
|
|
||||||
|
.. automethod:: MasterView.editable_instance
|
||||||
|
|
||||||
|
.. .. automethod:: MasterView.get_settings
|
||||||
|
|
||||||
|
.. automethod:: MasterView.get_csv_fields
|
||||||
|
|
||||||
|
.. automethod:: MasterView.get_csv_row
|
||||||
|
|
||||||
|
.. automethod:: MasterView.get_help_url
|
||||||
|
|
||||||
|
.. automethod:: MasterView.get_model_key
|
||||||
|
|
||||||
|
.. automethod:: MasterView.get_version_diff_enums
|
||||||
|
|
||||||
|
.. automethod:: MasterView.get_version_diff_factory
|
||||||
|
|
||||||
|
.. automethod:: MasterView.make_version_diff
|
||||||
|
|
||||||
|
.. automethod:: MasterView.title_for_version
|
||||||
|
|
||||||
|
|
||||||
|
Support Methods
|
||||||
|
---------------
|
||||||
|
|
||||||
|
The following is a list of methods you should (probably) not need to
|
||||||
|
override, but may find useful:
|
||||||
|
|
||||||
|
.. automethod:: MasterView.default_edit_url
|
||||||
|
|
||||||
|
.. automethod:: MasterView.get_action_route_kwargs
|
||||||
|
|
6
docs/api/views/members.rst
Normal file
6
docs/api/views/members.rst
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
|
||||||
|
``tailbone.views.members``
|
||||||
|
==========================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.views.members
|
||||||
|
:members:
|
9
docs/api/views/purchasing.batch.rst
Normal file
9
docs/api/views/purchasing.batch.rst
Normal file
|
@ -0,0 +1,9 @@
|
||||||
|
|
||||||
|
``tailbone.views.purchasing.batch``
|
||||||
|
===================================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.views.purchasing.batch
|
||||||
|
|
||||||
|
.. autoclass:: PurchasingBatchView
|
||||||
|
|
||||||
|
.. automethod:: save_edit_row_form
|
15
docs/api/views/purchasing.ordering.rst
Normal file
15
docs/api/views/purchasing.ordering.rst
Normal file
|
@ -0,0 +1,15 @@
|
||||||
|
|
||||||
|
``tailbone.views.purchasing.ordering``
|
||||||
|
======================================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.views.purchasing.ordering
|
||||||
|
|
||||||
|
.. autoclass:: OrderingBatchView
|
||||||
|
|
||||||
|
.. autoattribute:: model_class
|
||||||
|
|
||||||
|
.. autoattribute:: default_handler_spec
|
||||||
|
|
||||||
|
.. automethod:: configure_row_form
|
||||||
|
|
||||||
|
.. automethod:: worksheet_update
|
|
@ -1,10 +0,0 @@
|
||||||
|
|
||||||
``tailbone.views.vendors.catalogs``
|
|
||||||
===================================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.views.vendors.catalogs
|
|
||||||
|
|
||||||
.. autoclass:: VendorCatalogsView
|
|
||||||
:members:
|
|
||||||
|
|
||||||
.. autofunction:: includeme
|
|
8
docs/changelog.rst
Normal file
8
docs/changelog.rst
Normal file
|
@ -0,0 +1,8 @@
|
||||||
|
|
||||||
|
Changelog Archive
|
||||||
|
=================
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 1
|
||||||
|
|
||||||
|
OLDCHANGES
|
65
docs/concepts/batches.rst
Normal file
65
docs/concepts/batches.rst
Normal file
|
@ -0,0 +1,65 @@
|
||||||
|
|
||||||
|
Data Batches
|
||||||
|
============
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
Data "batches" are one of the most powerful features of Rattail / Tailbone.
|
||||||
|
However each "batch type" is different, and they usually require custom
|
||||||
|
development. In all cases they require a Rattail-based app database, for
|
||||||
|
storage.
|
||||||
|
|
||||||
|
|
||||||
|
General Overview
|
||||||
|
----------------
|
||||||
|
|
||||||
|
You can think of data batches as a sort of "temporary spreadsheet" feature.
|
||||||
|
When a batch is created, it is usually populated with rows, from some data
|
||||||
|
source. The user(s) may then manipulate the batch data as needed, with the
|
||||||
|
final goal being to "execute" the batch. What execution specifically means
|
||||||
|
will depend on context, e.g. type of batch, but generally it will "commit" the
|
||||||
|
"pending changes" which are represented by the batch.
|
||||||
|
|
||||||
|
Note that when a batch is executed, it becomes read-only ("frozen in time") and
|
||||||
|
at that point may be considered part of an audit trail of sorts. The utility
|
||||||
|
of this may vary depending on the nature of the batch data.
|
||||||
|
|
||||||
|
Beyond that it's difficult to describe batches very well at this level,
|
||||||
|
precisely because they're all different.
|
||||||
|
|
||||||
|
..
|
||||||
|
This graphic tries to show how batches are created and executed over time.
|
||||||
|
Note that each batch type is free to target a different system(s) upon
|
||||||
|
execution.
|
||||||
|
|
||||||
|
TODO: need graphic
|
||||||
|
|
||||||
|
|
||||||
|
Batch Tables
|
||||||
|
------------
|
||||||
|
|
||||||
|
In most cases the table(s) underlying a particular batch type, have a "static"
|
||||||
|
schema and must be defined as ORM classes, e.g. within the ``poser.db.model``
|
||||||
|
package.
|
||||||
|
|
||||||
|
In some rare cases the batch data (row) table may be dynamic; however the batch
|
||||||
|
header table must still be defined.
|
||||||
|
|
||||||
|
|
||||||
|
Batch Handlers
|
||||||
|
--------------
|
||||||
|
|
||||||
|
Once the batch table(s) are present, the next puzzle piece is the batch
|
||||||
|
handler. Again there is generally (at least) one handler defined for each
|
||||||
|
batch type.
|
||||||
|
|
||||||
|
The batch "handler" is considered part of the data layer and provides logic for
|
||||||
|
populating the batch, executing it etc.
|
||||||
|
|
||||||
|
|
||||||
|
Batch Views
|
||||||
|
-----------
|
||||||
|
|
||||||
|
This discussion would not be complete without mentioning the web views for the
|
||||||
|
batch. Again each batch type will require a custom view(s) although these
|
||||||
|
"usually" are simple wrappers as most logic is provided by the base view.
|
115
docs/concepts/config.rst
Normal file
115
docs/concepts/config.rst
Normal file
|
@ -0,0 +1,115 @@
|
||||||
|
|
||||||
|
Configuration
|
||||||
|
=============
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
Configuration for an app can come from two sources: configuration file(s), and
|
||||||
|
the Settings table in the database.
|
||||||
|
|
||||||
|
|
||||||
|
Config File Inheritance
|
||||||
|
-----------------------
|
||||||
|
|
||||||
|
An important thing to understand regarding Rattail config files, is that one
|
||||||
|
file may "include" another file(s), which in turn may "include" others etc.
|
||||||
|
Invocation of the app will often require only a single config file to be
|
||||||
|
specified, since that file may include others as needed.
|
||||||
|
|
||||||
|
For example ``web.conf`` will typically include ``rattail.conf`` but the web
|
||||||
|
app need only be invoked with ``web.conf`` - config from both files will inform
|
||||||
|
the app's behavior.
|
||||||
|
|
||||||
|
|
||||||
|
Typical Config Files
|
||||||
|
--------------------
|
||||||
|
|
||||||
|
A typical Poser (Rattail-based) app will have at the very least, one file named
|
||||||
|
``rattail.conf`` - this is considered the most fundamental config file. It
|
||||||
|
will usually define database connections, logging config, and any other "core"
|
||||||
|
things which would be required for any invocation of the app, regardless of the
|
||||||
|
environment (e.g. console vs. web).
|
||||||
|
|
||||||
|
Note that even ``rattail.conf`` is free to include other files. This may be
|
||||||
|
useful for instance, if you have a single site-wide config file which is shared
|
||||||
|
among all Rattail apps.
|
||||||
|
|
||||||
|
There is no *strict* requirement for having a ``rattail.conf`` file, but these
|
||||||
|
docs will assume its presence. Here are some other typical files, which the
|
||||||
|
docs also may reference occasionally:
|
||||||
|
|
||||||
|
**web.conf** - This is the "core" config file for the web app, although it
|
||||||
|
still includes the ``rattail.conf`` file. In production (running on Apache
|
||||||
|
etc.) it is specified within the WSGI module which is responsible for
|
||||||
|
instantiating the web app. When running the development server, it is
|
||||||
|
specified via command line.
|
||||||
|
|
||||||
|
**quiet.conf** - This is a slight wrapper around ``rattail.conf`` for the sake
|
||||||
|
of a "quieter" console, when running app commands via console. It may be used
|
||||||
|
in place of ``rattail.conf`` - i.e. you would specify ``-c quiet.conf`` when
|
||||||
|
running the command. The only function of this wrapper is to set the level to
|
||||||
|
INFO for the console logging handler. In practice this hides DEBUG logging
|
||||||
|
messages which are shown by default when using ``rattail.conf`` as the app
|
||||||
|
config file.
|
||||||
|
|
||||||
|
**cron.conf** - Another wrapper around ``rattail.conf`` which suppresses
|
||||||
|
logging even further. The idea is that this config file would be used by cron
|
||||||
|
jobs; that way the only actual output is warnings and errors, hence cron would
|
||||||
|
not send email unless something actually went wrong. It may be used in place
|
||||||
|
of ``rattail.conf`` - i.e. you would specify ``-c cron.conf`` when running the
|
||||||
|
command. The only function of this wrapper is to set the level to WARNING for
|
||||||
|
the console logging handler.
|
||||||
|
|
||||||
|
**ignore-changes.conf** - This file is only relevant if your ``rattail.conf``
|
||||||
|
says to "record changes" when write activity occurs in the database(s). Note
|
||||||
|
that this file does *not* include ``rattail.conf`` because it is meant to be
|
||||||
|
supplemental only. For instance on the command line, you would need to specify
|
||||||
|
two config files, first ``rattail.conf`` or a suitable alternative, but then
|
||||||
|
``ignore-changes.conf`` also. If specified, this file will cause changes to be
|
||||||
|
ignored, i.e. **not recorded** when write activity occurs.
|
||||||
|
|
||||||
|
**without-versioning.conf** - This file is only relevant if your
|
||||||
|
``rattail.conf`` says to enable "data versioning" when write activity occurs in
|
||||||
|
the database(s). Note that this file does *not* include ``rattail.conf``
|
||||||
|
because it is meant to be supplemental only. For instance on the command line,
|
||||||
|
you would need to specify two config files, first ``rattail.conf`` or a
|
||||||
|
suitable alternative, but then ``without-versioning.conf`` also. If specified,
|
||||||
|
this file will disable the data versioning system entirely. Note that if
|
||||||
|
versioning is undesirable for a given app run, this is the only way to
|
||||||
|
effectively disable it; once loaded that feature cannot be disabled.
|
||||||
|
|
||||||
|
|
||||||
|
Settings from Database
|
||||||
|
----------------------
|
||||||
|
|
||||||
|
The other (often more convenient) source of app configuration is the Settings
|
||||||
|
table within the app database. Whether or not this table is a valid source for
|
||||||
|
app configuration, ultimately depends on what the config file(s) has to say
|
||||||
|
about it.
|
||||||
|
|
||||||
|
Assuming the config file(s) defines a database connection and declares it a
|
||||||
|
valid source for config values, then the Settings table may contribute to the
|
||||||
|
running app config. The nice thing about this is that these settings are
|
||||||
|
checked in real-time. So whereas changing a config file will require an app
|
||||||
|
restart, any edits to the settings table should take effect immediately.
|
||||||
|
|
||||||
|
Usually the settings table will *override* values found in the config file.
|
||||||
|
This behavior also is configurable to some extent, and in some cases a config
|
||||||
|
value may *only* come from a config file and never the settings table.
|
||||||
|
|
||||||
|
An example may help here. If the config file contained the following value:
|
||||||
|
|
||||||
|
.. code-block:: ini
|
||||||
|
|
||||||
|
[poser]
|
||||||
|
foo = bar
|
||||||
|
|
||||||
|
Then you could create a new Setting in the database with the following fields:
|
||||||
|
|
||||||
|
* **name** = poser.foo
|
||||||
|
* **value** = baz
|
||||||
|
|
||||||
|
Assuming typical setup, i.e. where settings table may override config file, the
|
||||||
|
app would consider 'baz' to be the config value. So basically the setting name
|
||||||
|
must correspond to a combination of the config file "section" name, then a dot,
|
||||||
|
then the "option" name.
|
7
docs/concepts/console.rst
Normal file
7
docs/concepts/console.rst
Normal file
|
@ -0,0 +1,7 @@
|
||||||
|
|
||||||
|
Console Commands
|
||||||
|
================
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
TODO
|
45
docs/concepts/schema.rst
Normal file
45
docs/concepts/schema.rst
Normal file
|
@ -0,0 +1,45 @@
|
||||||
|
|
||||||
|
Database Schema
|
||||||
|
===============
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
Rattail provides a "core" schema which is assumed to be the foundation of any
|
||||||
|
Poser app database.
|
||||||
|
|
||||||
|
|
||||||
|
Core Tables
|
||||||
|
-----------
|
||||||
|
|
||||||
|
All tables which are considered part of the Rattail "core" schema, are defined
|
||||||
|
as ORM classes within the ``rattail.db.model`` package.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
The Rattail project has its roots in retail grocery-type stores, and its
|
||||||
|
schema reflects that to a large degree. In practice however the software
|
||||||
|
may be used to support a wide variety of apps. The next section describes
|
||||||
|
that a bit more.
|
||||||
|
|
||||||
|
|
||||||
|
Customizing the Schema
|
||||||
|
----------------------
|
||||||
|
|
||||||
|
Almost certainly a custom app will need some of the core tables, but just as
|
||||||
|
certainly, it will *not* need others. And to make things even more
|
||||||
|
interesting, it may need some tables but also need to "supplement" them
|
||||||
|
somehow, to track additional data for each record etc.
|
||||||
|
|
||||||
|
Any table in the core schema which is *not* needed, may simply be ignored,
|
||||||
|
i.e. hidden from the app UI etc.
|
||||||
|
|
||||||
|
Any table which is "missing" from core schema, from the custom app's
|
||||||
|
perspective, should be added as a custom table.
|
||||||
|
|
||||||
|
Also, any table which is "present but missing columns" from the app's
|
||||||
|
perspective, will require a custom table. In this case each record in the
|
||||||
|
custom table will "tie back to" the core table record. The custom record will
|
||||||
|
then supply any additional data for the core record.
|
||||||
|
|
||||||
|
Defining custom tables, and associated tasks, are documented in
|
||||||
|
:doc:`../schemachange`.
|
272
docs/conf.py
272
docs/conf.py
|
@ -1,36 +1,21 @@
|
||||||
# -*- coding: utf-8 -*-
|
# Configuration file for the Sphinx documentation builder.
|
||||||
#
|
#
|
||||||
# Tailbone documentation build configuration file, created by
|
# For the full list of built-in configuration values, see the documentation:
|
||||||
# sphinx-quickstart on Sat Feb 15 23:15:27 2014.
|
# https://www.sphinx-doc.org/en/master/usage/configuration.html
|
||||||
#
|
|
||||||
# This file is exec()d with the current directory set to its
|
|
||||||
# containing dir.
|
|
||||||
#
|
|
||||||
# Note that not all possible configuration values are present in this
|
|
||||||
# autogenerated file.
|
|
||||||
#
|
|
||||||
# All configuration values have a default; values that are commented out
|
|
||||||
# serve to show the default.
|
|
||||||
|
|
||||||
import sys
|
# -- Project information -----------------------------------------------------
|
||||||
import os
|
# https://www.sphinx-doc.org/en/master/usage/configuration.html#project-information
|
||||||
|
|
||||||
exec(open(os.path.join(os.pardir, 'tailbone', '_version.py')).read())
|
from importlib.metadata import version as get_version
|
||||||
|
|
||||||
|
project = 'Tailbone'
|
||||||
|
copyright = '2010 - 2024, Lance Edgar'
|
||||||
|
author = 'Lance Edgar'
|
||||||
|
release = get_version('Tailbone')
|
||||||
|
|
||||||
# If extensions (or modules to document with autodoc) are in another directory,
|
# -- General configuration ---------------------------------------------------
|
||||||
# add these directories to sys.path here. If the directory is relative to the
|
# https://www.sphinx-doc.org/en/master/usage/configuration.html#general-configuration
|
||||||
# documentation root, use os.path.abspath to make it absolute, like shown here.
|
|
||||||
#sys.path.insert(0, os.path.abspath('.'))
|
|
||||||
|
|
||||||
# -- General configuration ------------------------------------------------
|
|
||||||
|
|
||||||
# If your documentation needs a minimal Sphinx version, state it here.
|
|
||||||
#needs_sphinx = '1.0'
|
|
||||||
|
|
||||||
# Add any Sphinx extension module names here, as strings. They can be
|
|
||||||
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom
|
|
||||||
# ones.
|
|
||||||
extensions = [
|
extensions = [
|
||||||
'sphinx.ext.autodoc',
|
'sphinx.ext.autodoc',
|
||||||
'sphinx.ext.todo',
|
'sphinx.ext.todo',
|
||||||
|
@ -38,235 +23,30 @@ extensions = [
|
||||||
'sphinx.ext.viewcode',
|
'sphinx.ext.viewcode',
|
||||||
]
|
]
|
||||||
|
|
||||||
|
templates_path = ['_templates']
|
||||||
|
exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store']
|
||||||
|
|
||||||
intersphinx_mapping = {
|
intersphinx_mapping = {
|
||||||
# TODO: Add this back, when the FA site is back online...
|
'rattail': ('https://docs.wuttaproject.org/rattail/', None),
|
||||||
#'formalchemy': ('http://docs.formalchemy.org/formalchemy/', None),
|
|
||||||
'webhelpers2': ('https://webhelpers2.readthedocs.io/en/latest/', None),
|
'webhelpers2': ('https://webhelpers2.readthedocs.io/en/latest/', None),
|
||||||
|
'wuttaweb': ('https://docs.wuttaproject.org/wuttaweb/', None),
|
||||||
|
'wuttjamaican': ('https://docs.wuttaproject.org/wuttjamaican/', None),
|
||||||
}
|
}
|
||||||
|
|
||||||
# Add any paths that contain templates here, relative to this directory.
|
# allow todo entries to show up
|
||||||
templates_path = ['_templates']
|
todo_include_todos = True
|
||||||
|
|
||||||
# The suffix of source filenames.
|
|
||||||
source_suffix = '.rst'
|
|
||||||
|
|
||||||
# The encoding of source files.
|
|
||||||
#source_encoding = 'utf-8-sig'
|
|
||||||
|
|
||||||
# The master toctree document.
|
|
||||||
master_doc = 'index'
|
|
||||||
|
|
||||||
# General information about the project.
|
|
||||||
project = u'Tailbone'
|
|
||||||
copyright = u'2015, Lance Edgar'
|
|
||||||
|
|
||||||
# The version info for the project you're documenting, acts as replacement for
|
|
||||||
# |version| and |release|, also used in various other places throughout the
|
|
||||||
# built documents.
|
|
||||||
#
|
|
||||||
# The short X.Y version.
|
|
||||||
version = '0.3'
|
|
||||||
# The full version, including alpha/beta/rc tags.
|
|
||||||
release = __version__
|
|
||||||
|
|
||||||
# The language for content autogenerated by Sphinx. Refer to documentation
|
|
||||||
# for a list of supported languages.
|
|
||||||
#language = None
|
|
||||||
|
|
||||||
# There are two options for replacing |today|: either, you set today to some
|
|
||||||
# non-false value, then it is used:
|
|
||||||
#today = ''
|
|
||||||
# Else, today_fmt is used as the format for a strftime call.
|
|
||||||
#today_fmt = '%B %d, %Y'
|
|
||||||
|
|
||||||
# List of patterns, relative to source directory, that match files and
|
|
||||||
# directories to ignore when looking for source files.
|
|
||||||
exclude_patterns = ['_build']
|
|
||||||
|
|
||||||
# The reST default role (used for this markup: `text`) to use for all
|
|
||||||
# documents.
|
|
||||||
#default_role = None
|
|
||||||
|
|
||||||
# If true, '()' will be appended to :func: etc. cross-reference text.
|
|
||||||
#add_function_parentheses = True
|
|
||||||
|
|
||||||
# If true, the current module name will be prepended to all description
|
|
||||||
# unit titles (such as .. function::).
|
|
||||||
#add_module_names = True
|
|
||||||
|
|
||||||
# If true, sectionauthor and moduleauthor directives will be shown in the
|
|
||||||
# output. They are ignored by default.
|
|
||||||
#show_authors = False
|
|
||||||
|
|
||||||
# The name of the Pygments (syntax highlighting) style to use.
|
|
||||||
pygments_style = 'sphinx'
|
|
||||||
|
|
||||||
# A list of ignored prefixes for module index sorting.
|
|
||||||
#modindex_common_prefix = []
|
|
||||||
|
|
||||||
# If true, keep warnings as "system message" paragraphs in the built documents.
|
|
||||||
#keep_warnings = False
|
|
||||||
|
|
||||||
|
|
||||||
# -- Options for HTML output ----------------------------------------------
|
# -- Options for HTML output -------------------------------------------------
|
||||||
|
# https://www.sphinx-doc.org/en/master/usage/configuration.html#options-for-html-output
|
||||||
|
|
||||||
# The theme to use for HTML and HTML Help pages. See the documentation for
|
html_theme = 'furo'
|
||||||
# a list of builtin themes.
|
html_static_path = ['_static']
|
||||||
html_theme = 'classic'
|
|
||||||
|
|
||||||
# Theme options are theme-specific and customize the look and feel of a theme
|
|
||||||
# further. For a list of options available for each theme, see the
|
|
||||||
# documentation.
|
|
||||||
#html_theme_options = {}
|
|
||||||
|
|
||||||
# Add any paths that contain custom themes here, relative to this directory.
|
|
||||||
#html_theme_path = []
|
|
||||||
|
|
||||||
# The name for this set of Sphinx documents. If None, it defaults to
|
|
||||||
# "<project> v<release> documentation".
|
|
||||||
#html_title = None
|
|
||||||
|
|
||||||
# A shorter title for the navigation bar. Default is the same as html_title.
|
|
||||||
#html_short_title = None
|
|
||||||
|
|
||||||
# The name of an image file (relative to this directory) to place at the top
|
# The name of an image file (relative to this directory) to place at the top
|
||||||
# of the sidebar.
|
# of the sidebar.
|
||||||
#html_logo = None
|
#html_logo = None
|
||||||
|
#html_logo = 'images/rattail_avatar.png'
|
||||||
# The name of an image file (within the static path) to use as favicon of the
|
|
||||||
# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32
|
|
||||||
# pixels large.
|
|
||||||
#html_favicon = None
|
|
||||||
|
|
||||||
# Add any paths that contain custom static files (such as style sheets) here,
|
|
||||||
# relative to this directory. They are copied after the builtin static files,
|
|
||||||
# so a file named "default.css" will overwrite the builtin "default.css".
|
|
||||||
html_static_path = ['_static']
|
|
||||||
|
|
||||||
# Add any extra paths that contain custom files (such as robots.txt or
|
|
||||||
# .htaccess) here, relative to this directory. These files are copied
|
|
||||||
# directly to the root of the documentation.
|
|
||||||
#html_extra_path = []
|
|
||||||
|
|
||||||
# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
|
|
||||||
# using the given strftime format.
|
|
||||||
#html_last_updated_fmt = '%b %d, %Y'
|
|
||||||
|
|
||||||
# If true, SmartyPants will be used to convert quotes and dashes to
|
|
||||||
# typographically correct entities.
|
|
||||||
#html_use_smartypants = True
|
|
||||||
|
|
||||||
# Custom sidebar templates, maps document names to template names.
|
|
||||||
#html_sidebars = {}
|
|
||||||
|
|
||||||
# Additional templates that should be rendered to pages, maps page names to
|
|
||||||
# template names.
|
|
||||||
#html_additional_pages = {}
|
|
||||||
|
|
||||||
# If false, no module index is generated.
|
|
||||||
#html_domain_indices = True
|
|
||||||
|
|
||||||
# If false, no index is generated.
|
|
||||||
#html_use_index = True
|
|
||||||
|
|
||||||
# If true, the index is split into individual pages for each letter.
|
|
||||||
#html_split_index = False
|
|
||||||
|
|
||||||
# If true, links to the reST sources are added to the pages.
|
|
||||||
#html_show_sourcelink = True
|
|
||||||
|
|
||||||
# If true, "Created using Sphinx" is shown in the HTML footer. Default is True.
|
|
||||||
#html_show_sphinx = True
|
|
||||||
|
|
||||||
# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True.
|
|
||||||
#html_show_copyright = True
|
|
||||||
|
|
||||||
# If true, an OpenSearch description file will be output, and all pages will
|
|
||||||
# contain a <link> tag referring to it. The value of this option must be the
|
|
||||||
# base URL from which the finished HTML is served.
|
|
||||||
#html_use_opensearch = ''
|
|
||||||
|
|
||||||
# This is the file name suffix for HTML files (e.g. ".xhtml").
|
|
||||||
#html_file_suffix = None
|
|
||||||
|
|
||||||
# Output file base name for HTML help builder.
|
# Output file base name for HTML help builder.
|
||||||
htmlhelp_basename = 'Tailbonedoc'
|
#htmlhelp_basename = 'Tailbonedoc'
|
||||||
|
|
||||||
|
|
||||||
# -- Options for LaTeX output ---------------------------------------------
|
|
||||||
|
|
||||||
latex_elements = {
|
|
||||||
# The paper size ('letterpaper' or 'a4paper').
|
|
||||||
#'papersize': 'letterpaper',
|
|
||||||
|
|
||||||
# The font size ('10pt', '11pt' or '12pt').
|
|
||||||
#'pointsize': '10pt',
|
|
||||||
|
|
||||||
# Additional stuff for the LaTeX preamble.
|
|
||||||
#'preamble': '',
|
|
||||||
}
|
|
||||||
|
|
||||||
# Grouping the document tree into LaTeX files. List of tuples
|
|
||||||
# (source start file, target name, title,
|
|
||||||
# author, documentclass [howto, manual, or own class]).
|
|
||||||
latex_documents = [
|
|
||||||
('index', 'Tailbone.tex', u'Tailbone Documentation',
|
|
||||||
u'Lance Edgar', 'manual'),
|
|
||||||
]
|
|
||||||
|
|
||||||
# The name of an image file (relative to this directory) to place at the top of
|
|
||||||
# the title page.
|
|
||||||
#latex_logo = None
|
|
||||||
|
|
||||||
# For "manual" documents, if this is true, then toplevel headings are parts,
|
|
||||||
# not chapters.
|
|
||||||
#latex_use_parts = False
|
|
||||||
|
|
||||||
# If true, show page references after internal links.
|
|
||||||
#latex_show_pagerefs = False
|
|
||||||
|
|
||||||
# If true, show URL addresses after external links.
|
|
||||||
#latex_show_urls = False
|
|
||||||
|
|
||||||
# Documents to append as an appendix to all manuals.
|
|
||||||
#latex_appendices = []
|
|
||||||
|
|
||||||
# If false, no module index is generated.
|
|
||||||
#latex_domain_indices = True
|
|
||||||
|
|
||||||
|
|
||||||
# -- Options for manual page output ---------------------------------------
|
|
||||||
|
|
||||||
# One entry per manual page. List of tuples
|
|
||||||
# (source start file, name, description, authors, manual section).
|
|
||||||
man_pages = [
|
|
||||||
('index', 'tailbone', u'Tailbone Documentation',
|
|
||||||
[u'Lance Edgar'], 1)
|
|
||||||
]
|
|
||||||
|
|
||||||
# If true, show URL addresses after external links.
|
|
||||||
#man_show_urls = False
|
|
||||||
|
|
||||||
|
|
||||||
# -- Options for Texinfo output -------------------------------------------
|
|
||||||
|
|
||||||
# Grouping the document tree into Texinfo files. List of tuples
|
|
||||||
# (source start file, target name, title, author,
|
|
||||||
# dir menu entry, description, category)
|
|
||||||
texinfo_documents = [
|
|
||||||
('index', 'Tailbone', u'Tailbone Documentation',
|
|
||||||
u'Lance Edgar', 'Tailbone', 'One line description of project.',
|
|
||||||
'Miscellaneous'),
|
|
||||||
]
|
|
||||||
|
|
||||||
# Documents to append as an appendix to all manuals.
|
|
||||||
#texinfo_appendices = []
|
|
||||||
|
|
||||||
# If false, no module index is generated.
|
|
||||||
#texinfo_domain_indices = True
|
|
||||||
|
|
||||||
# How to display URL addresses: 'footnote', 'no', or 'inline'.
|
|
||||||
#texinfo_show_urls = 'footnote'
|
|
||||||
|
|
||||||
# If true, do not generate a @detailmenu in the "Top" node's menu.
|
|
||||||
#texinfo_no_detailmenu = False
|
|
||||||
|
|
78
docs/devenv.rst
Normal file
78
docs/devenv.rst
Normal file
|
@ -0,0 +1,78 @@
|
||||||
|
|
||||||
|
Development Environment
|
||||||
|
=======================
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
Base System
|
||||||
|
-----------
|
||||||
|
|
||||||
|
Development for Tailbone in particular is assumed to occur on a Linux machine.
|
||||||
|
This is because it's assumed that the web app would run on Linux. It should be
|
||||||
|
possible (presumably) to do either on Windows or Mac but that is not officially
|
||||||
|
supported.
|
||||||
|
|
||||||
|
Furthermore it is assumed the Linux flavor in use is either Debian or Ubuntu,
|
||||||
|
or a similar alternative. Presumably any Linux would work although some
|
||||||
|
details may differ from what's shown here.
|
||||||
|
|
||||||
|
Prerequisites
|
||||||
|
-------------
|
||||||
|
|
||||||
|
Python
|
||||||
|
^^^^^^
|
||||||
|
|
||||||
|
The only supported Python is 2.7. Of course that should already be present on
|
||||||
|
Linux.
|
||||||
|
|
||||||
|
It usually is required at some point to compile C code for certain Python
|
||||||
|
extension modules. In practice this means you probably want the Python header
|
||||||
|
files as well:
|
||||||
|
|
||||||
|
.. code-block:: sh
|
||||||
|
|
||||||
|
sudo apt-get install python-dev
|
||||||
|
|
||||||
|
pip
|
||||||
|
^^^
|
||||||
|
|
||||||
|
The only supported Python package manager is ``pip``. This can be installed a
|
||||||
|
few ways, one of which is:
|
||||||
|
|
||||||
|
.. code-block:: sh
|
||||||
|
|
||||||
|
sudo apt-get install python-pip
|
||||||
|
|
||||||
|
virtualenvwrapper
|
||||||
|
^^^^^^^^^^^^^^^^^
|
||||||
|
|
||||||
|
While not technically required, it is recommended to use ``virtualenvwrapper``
|
||||||
|
as well. There is more than one way to set this up, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: sh
|
||||||
|
|
||||||
|
sudo apt-get install python-virtualenvwrapper
|
||||||
|
|
||||||
|
The main variable as concerns these docs, is where your virtual environment(s)
|
||||||
|
will live. If you install virtualenvwrapper via the above command, then most
|
||||||
|
likely your ``$WORKON_HOME`` environment variable will be set to
|
||||||
|
``~/.virtualenvs`` - however these docs will assume ``/srv/envs`` instead.
|
||||||
|
Please adjust any commands as needed.
|
||||||
|
|
||||||
|
PostgreSQL
|
||||||
|
^^^^^^^^^^
|
||||||
|
|
||||||
|
The other primary requirement is PostgreSQL. Technically that may be installed
|
||||||
|
on a separate machine, which allows connection from the development machine.
|
||||||
|
But of course it will usually just be installed on the dev machine:
|
||||||
|
|
||||||
|
.. code-block:: sh
|
||||||
|
|
||||||
|
sudo apt-get install postgresql
|
||||||
|
|
||||||
|
Regardless of where your PG server lives, you will probably need some extras in
|
||||||
|
order to compile extensions for the ``psycopg2`` package:
|
||||||
|
|
||||||
|
.. code-block:: sh
|
||||||
|
|
||||||
|
sudo apt-get install libpq-dev
|
BIN
docs/images/poser-architecture.png
Normal file
BIN
docs/images/poser-architecture.png
Normal file
Binary file not shown.
After Width: | Height: | Size: 22 KiB |
BIN
docs/images/rattail_avatar.png
Normal file
BIN
docs/images/rattail_avatar.png
Normal file
Binary file not shown.
After Width: | Height: | Size: 7.6 KiB |
|
@ -2,15 +2,35 @@
|
||||||
Tailbone
|
Tailbone
|
||||||
========
|
========
|
||||||
|
|
||||||
Welcome to Tailbone, part of the Rattail project.
|
Welcome to Tailbone, part of the Rattail project. While the core Rattail
|
||||||
|
package provides the data layer, the Tailbone package provides the (default,
|
||||||
|
back-end) web application layer.
|
||||||
|
|
||||||
The documentation you are currently reading is for the Tailbone web application
|
Some additional information is available on the `website`_. Certainly not
|
||||||
package. Some additional information is available on the `website`_. Clearly
|
everything is documented yet, but here you can see what has received some
|
||||||
not everything is documented yet. Below you can see what has received some
|
|
||||||
attention thus far.
|
attention thus far.
|
||||||
|
|
||||||
.. _website: https://rattailproject.org/
|
.. _website: https://rattailproject.org/
|
||||||
|
|
||||||
|
Quick Start for Custom Apps:
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 1
|
||||||
|
|
||||||
|
structure
|
||||||
|
devenv
|
||||||
|
newproject
|
||||||
|
schemachange
|
||||||
|
|
||||||
|
Concept Guide:
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
|
||||||
|
concepts/config
|
||||||
|
concepts/console
|
||||||
|
concepts/schema
|
||||||
|
concepts/batches
|
||||||
|
|
||||||
Narrative Documentation:
|
Narrative Documentation:
|
||||||
|
|
||||||
.. toctree::
|
.. toctree::
|
||||||
|
@ -22,11 +42,32 @@ Package API:
|
||||||
.. toctree::
|
.. toctree::
|
||||||
:maxdepth: 1
|
:maxdepth: 1
|
||||||
|
|
||||||
|
api/api/batch/core
|
||||||
|
api/api/batch/ordering
|
||||||
|
api/db
|
||||||
|
api/diffs
|
||||||
|
api/forms
|
||||||
|
api/forms.widgets
|
||||||
api/grids
|
api/grids
|
||||||
|
api/grids.core
|
||||||
|
api/progress
|
||||||
api/subscribers
|
api/subscribers
|
||||||
|
api/util
|
||||||
api/views/batch
|
api/views/batch
|
||||||
|
api/views/batch.vendorcatalog
|
||||||
|
api/views/core
|
||||||
api/views/master
|
api/views/master
|
||||||
api/views/vendors.catalogs
|
api/views/members
|
||||||
|
api/views/purchasing.batch
|
||||||
|
api/views/purchasing.ordering
|
||||||
|
|
||||||
|
|
||||||
|
Changelog:
|
||||||
|
|
||||||
|
.. toctree::
|
||||||
|
:maxdepth: 1
|
||||||
|
|
||||||
|
changelog
|
||||||
|
|
||||||
|
|
||||||
Documentation To-Do
|
Documentation To-Do
|
||||||
|
|
154
docs/newproject.rst
Normal file
154
docs/newproject.rst
Normal file
|
@ -0,0 +1,154 @@
|
||||||
|
|
||||||
|
Creating a New Project
|
||||||
|
======================
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
.. highlight:: bash
|
||||||
|
|
||||||
|
This describes the process of creating a new app project based on
|
||||||
|
Rattail/Tailbone. It assumes you are working from a supported :doc:`devenv`.
|
||||||
|
|
||||||
|
Per convention, this doc uses "Poser" (and ``poser``) to represent the custom
|
||||||
|
app. Please adjust commands etc. accordingly. See also :doc:`structure`.
|
||||||
|
|
||||||
|
|
||||||
|
Create the Virtual Environment
|
||||||
|
------------------------------
|
||||||
|
|
||||||
|
First step is simple enough::
|
||||||
|
|
||||||
|
mkvirtualenv poser
|
||||||
|
|
||||||
|
Then with your new environment activated, install the Tailbone package::
|
||||||
|
|
||||||
|
pip install Tailbone
|
||||||
|
|
||||||
|
|
||||||
|
Create the Project
|
||||||
|
------------------
|
||||||
|
|
||||||
|
Now with your environment still activated, ``cd`` to wherever you like
|
||||||
|
(e.g. ``~/src``) and create a new project skeleton like so::
|
||||||
|
|
||||||
|
mkdir -p ~/src
|
||||||
|
cd ~/src
|
||||||
|
pcreate -s rattail poser
|
||||||
|
|
||||||
|
This will have created a new project at ``~/src/poser`` which you can then edit
|
||||||
|
as you wish. At some point you will need to "install" this project to the
|
||||||
|
environment like so (again with environment active)::
|
||||||
|
|
||||||
|
cd ~/src/poser
|
||||||
|
pip install -e .
|
||||||
|
|
||||||
|
|
||||||
|
Setup the App Environment
|
||||||
|
-------------------------
|
||||||
|
|
||||||
|
Any project based on Rattail will effectively be its own "app" (usually), but
|
||||||
|
Rattail itself provides some app functionality as well. However all such apps
|
||||||
|
require config files, usually. If running a web app then you may also need to
|
||||||
|
have configured a folder for session storage, etc. To hopefully simplify all
|
||||||
|
this, there are a few commands you should now run, with your virtual
|
||||||
|
environment still active::
|
||||||
|
|
||||||
|
rattail make-appdir
|
||||||
|
cdvirtualenv app
|
||||||
|
rattail make-config -T rattail
|
||||||
|
rattail make-config -T quiet
|
||||||
|
rattail make-config -T web
|
||||||
|
|
||||||
|
This will have created a new 'app' folder in your environment (e.g. at
|
||||||
|
``/srv/envs/poser/app``) and then created ``rattail.conf`` and ``web.conf``
|
||||||
|
files within that app dir. Note that there will be other folders inside the
|
||||||
|
app dir as well; these are referenced by the config files.
|
||||||
|
|
||||||
|
But you're not done yet... You should likely edit the config files, at the
|
||||||
|
very least edit ``rattail.conf`` and change the ``default.url`` value (under
|
||||||
|
``[rattail.db]`` section) which defines the Rattail database connection.
|
||||||
|
|
||||||
|
|
||||||
|
Create the Database
|
||||||
|
-------------------
|
||||||
|
|
||||||
|
If applicable, it's time for that. First you must literally create the user
|
||||||
|
and database on your PostgreSQL server, e.g.::
|
||||||
|
|
||||||
|
sudo -u postgres createuser --no-createdb --no-createrole --no-superuser poser
|
||||||
|
sudo -u postgres psql -c "alter user poser password 'mypassword'"
|
||||||
|
sudo -u postgres createdb --owner poser poser
|
||||||
|
|
||||||
|
Then you can install the schema; with your virtual environment activated::
|
||||||
|
|
||||||
|
cdvirtualenv
|
||||||
|
alembic -c app/rattail.conf upgrade heads
|
||||||
|
|
||||||
|
At this point your 'poser' database should have some empty tables. To confirm,
|
||||||
|
on your PG server do::
|
||||||
|
|
||||||
|
sudo -u postgres psql -c '\d' poser
|
||||||
|
|
||||||
|
|
||||||
|
Create Admin User
|
||||||
|
-----------------
|
||||||
|
|
||||||
|
If your intention is to have a web app, or at least to test one, you'll
|
||||||
|
probably want to create the initial admin user. With your env active::
|
||||||
|
|
||||||
|
cdvirtualenv
|
||||||
|
rattail -c app/quiet.conf make-user --admin myusername
|
||||||
|
|
||||||
|
This should prompt you for a password, then create a single user and assign it
|
||||||
|
to the Administrator role.
|
||||||
|
|
||||||
|
|
||||||
|
Install Sample Data
|
||||||
|
-------------------
|
||||||
|
|
||||||
|
If desired, you can install a bit of sample data to your fresh Rattail
|
||||||
|
database. With your env active do::
|
||||||
|
|
||||||
|
cdvirtualenv
|
||||||
|
rattail -c app/quiet.conf -P import-sample
|
||||||
|
|
||||||
|
|
||||||
|
Run Dev Web Server
|
||||||
|
------------------
|
||||||
|
|
||||||
|
With all the above in place, you may now run the web server in dev mode::
|
||||||
|
|
||||||
|
cdvirtualenv
|
||||||
|
pserve --reload app/web.conf
|
||||||
|
|
||||||
|
And finally..you may browse your new project dev site at http://localhost:9080/
|
||||||
|
(unless you changed the port etc.)
|
||||||
|
|
||||||
|
|
||||||
|
Schema Migrations
|
||||||
|
-----------------
|
||||||
|
|
||||||
|
Often a new project will require custom schema additions to track/manage data
|
||||||
|
unique to the project. Rattail uses `Alembic`_ for handling schema migrations.
|
||||||
|
General usage of that is documented elsewhere, but a little should be said here
|
||||||
|
regarding new projects.
|
||||||
|
|
||||||
|
.. _Alembic: https://pypi.python.org/pypi/alembic
|
||||||
|
|
||||||
|
The new project template includes most of an Alembic "repo" for schema
|
||||||
|
migrations. However there is one step required to really bootstrap it, i.e. to
|
||||||
|
the point where normal Alembic usage will work: you must create the initial
|
||||||
|
version script. Before you do this, you should be reasonably happy with any
|
||||||
|
ORM classes you've defined, as the initial version script will be used to
|
||||||
|
create that schema. Once you're ready for the script, this command should do
|
||||||
|
it::
|
||||||
|
|
||||||
|
cdvirtualenv
|
||||||
|
bin/alembic -c app/rattail.conf revision --autogenerate --version-path ~/src/poser/poser/db/alembic/versions/ -m 'initial Poser tables'
|
||||||
|
|
||||||
|
You should of course look over and edit the generated script as needed. One
|
||||||
|
change in particular you should make is to add a branch label, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: python
|
||||||
|
|
||||||
|
branch_labels = ('poser',)
|
63
docs/schemachange.rst
Normal file
63
docs/schemachange.rst
Normal file
|
@ -0,0 +1,63 @@
|
||||||
|
|
||||||
|
Migrating the Schema
|
||||||
|
====================
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
As development progresses for your custom app, you may need to migrate the
|
||||||
|
database schema from time to time.
|
||||||
|
|
||||||
|
See also this general discussion of the :doc:`concepts/schema`.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
The only "safe" migrations are those which add or modify (or remove)
|
||||||
|
"custom" tables, i.e. those *not* provided by the ``rattail.db.model``
|
||||||
|
package. This doc assumes you are aware of this and are only attempting a
|
||||||
|
safe migration.
|
||||||
|
|
||||||
|
|
||||||
|
Modify ORM Classes
|
||||||
|
------------------
|
||||||
|
|
||||||
|
First step is to modify the ORM classes defined by your app, so they reflect
|
||||||
|
the "desired" schema. Typically this will mean editing files under the
|
||||||
|
``poser.db.model`` package within your source. In particular when adding new
|
||||||
|
tables, you must be sure to include them within ``poser/db/model/__init__.py``.
|
||||||
|
|
||||||
|
As noted above, only those classes *not* provided by ``rattail.db.model``
|
||||||
|
should be modified here, to be safe. If you wish to "extend" an existing
|
||||||
|
table, you must create a secondary table which ties back to the first via
|
||||||
|
one-to-one foreign key relationship.
|
||||||
|
|
||||||
|
|
||||||
|
Create Migration Script
|
||||||
|
-----------------------
|
||||||
|
|
||||||
|
Next you will create the Alembic script which is responsible for performing the
|
||||||
|
schema migration against a database. This is typically done like so:
|
||||||
|
|
||||||
|
.. code-block:: sh
|
||||||
|
|
||||||
|
workon poser
|
||||||
|
cdvirtualenv
|
||||||
|
bin/alembic -c app/rattail.conf revision --autogenerate --head poser@head -m "describe migration here"
|
||||||
|
|
||||||
|
This will create a new file under
|
||||||
|
e.g. ``~/src/poser/poser/db/alembic/versions/``. You should edit this file as
|
||||||
|
needed to ensure it performs all steps required for the migration. Technically
|
||||||
|
it should support downgrade as well as upgrade, although in practice that isn't
|
||||||
|
always required.
|
||||||
|
|
||||||
|
|
||||||
|
Upgrade Database Schema
|
||||||
|
-----------------------
|
||||||
|
|
||||||
|
Once you're happy with the new script, you can apply it against your dev
|
||||||
|
database with something like:
|
||||||
|
|
||||||
|
.. code-block:: sh
|
||||||
|
|
||||||
|
workon poser
|
||||||
|
cdvirtualenv
|
||||||
|
bin/alembic -c app/rattail.conf upgrade heads
|
130
docs/structure.rst
Normal file
130
docs/structure.rst
Normal file
|
@ -0,0 +1,130 @@
|
||||||
|
|
||||||
|
App Organization & Structure
|
||||||
|
============================
|
||||||
|
|
||||||
|
.. contents:: :local:
|
||||||
|
|
||||||
|
Tailbone doesn't try to be an "app" proper. But it does try to provide just
|
||||||
|
about everything you'd need to make one. These docs assume you are making a
|
||||||
|
custom app, and will refer to the app as "Poser" to be consistent. In practice
|
||||||
|
you would give your app a unique name which is meaningful to you. Please
|
||||||
|
mentally replace "Poser" with your app name as you read.
|
||||||
|
|
||||||
|
.. note::
|
||||||
|
|
||||||
|
Technically it *is possible* to use Tailbone directly as the app. You may
|
||||||
|
do so for basic testing of the concepts, but you'd be stuck with Tailbone
|
||||||
|
logic, with far fewer customization options. All docs will assume a custom
|
||||||
|
"Poser" app which wraps and (as necessary) overrides Tailbone and Rattail.
|
||||||
|
|
||||||
|
|
||||||
|
Architecture
|
||||||
|
------------
|
||||||
|
|
||||||
|
In terms of how the Poser app hangs together, here is a conceptual diagram.
|
||||||
|
Note that all systems on the right-hand side are *external* to Poser, i.e. they
|
||||||
|
are not "plugins" although Poser may use plugin-like logic for the sake of
|
||||||
|
integrating with these systems.
|
||||||
|
|
||||||
|
.. image:: images/poser-architecture.png
|
||||||
|
|
||||||
|
|
||||||
|
Data Layer vs. Web Layer
|
||||||
|
^^^^^^^^^^^^^^^^^^^^^^^^
|
||||||
|
|
||||||
|
While the above graphic doesn't do a great job highlighting the difference, it
|
||||||
|
will (presumably) help to understand the difference in purpose and function of
|
||||||
|
Tailbone vs. Rattail packages.
|
||||||
|
|
||||||
|
**Rattail** is the data layer, and is responsible for database connectivity,
|
||||||
|
table schema information, and some business rules logic (among other things).
|
||||||
|
|
||||||
|
**Tailbone** is the web app layer, and is responsible for presentation and
|
||||||
|
management of data objects which are made available by Rattail (and others).
|
||||||
|
|
||||||
|
**Poser** is a custom layer which can make use of both data and web app layers,
|
||||||
|
supplementing each as necessary. In practice the lines may get blurry within
|
||||||
|
Poser.
|
||||||
|
|
||||||
|
The reason for this distinction between layers, is to allow creation of custom
|
||||||
|
apps which use only the data layer but not the web app layer. This can be
|
||||||
|
useful for console-based apps; a traditional GUI app would also be possible
|
||||||
|
although none is yet planned.
|
||||||
|
|
||||||
|
|
||||||
|
File Layout
|
||||||
|
-----------
|
||||||
|
|
||||||
|
Below is an example file layout for a Poser app project. This tries to be
|
||||||
|
"complete" and show most kinds of files a typical project may need. In
|
||||||
|
practice you can usually ignore anything which doesn't apply to your app,
|
||||||
|
i.e. relatively few of the files shown here are actually required. Of course
|
||||||
|
some apps may need many more files than this to achieve their goals.
|
||||||
|
|
||||||
|
Note that all files in the root ``poser`` package namespace would correspond to
|
||||||
|
the "data layer" mentioned above, whereas everything under ``poser.web`` would
|
||||||
|
of course supply the web app layer.
|
||||||
|
|
||||||
|
.. code-block:: none
|
||||||
|
|
||||||
|
~/src/poser/
|
||||||
|
├── CHANGELOG.md
|
||||||
|
├── docs/
|
||||||
|
├── fabfile.py
|
||||||
|
├── MANIFEST.in
|
||||||
|
├── poser/
|
||||||
|
│ ├── __init__.py
|
||||||
|
│ ├── batch/
|
||||||
|
│ │ ├── __init__.py
|
||||||
|
│ │ └── foobatch.py
|
||||||
|
│ ├── commands.py
|
||||||
|
│ ├── config.py
|
||||||
|
│ ├── datasync/
|
||||||
|
│ ├── db/
|
||||||
|
│ │ ├── __init__.py
|
||||||
|
│ │ ├── alembic/
|
||||||
|
│ │ └── model/
|
||||||
|
│ │ ├── __init__.py
|
||||||
|
│ │ ├── batch/
|
||||||
|
│ │ │ ├── __init__.py
|
||||||
|
│ │ │ └── foobatch.py
|
||||||
|
│ │ └── customers.py
|
||||||
|
│ ├── emails.py
|
||||||
|
│ ├── enum.py
|
||||||
|
│ ├── importing/
|
||||||
|
│ │ ├── __init__.py
|
||||||
|
│ │ ├── model.py
|
||||||
|
│ │ ├── poser.py
|
||||||
|
│ │ └── versions.py
|
||||||
|
│ ├── problems.py
|
||||||
|
│ ├── templates/
|
||||||
|
│ │ └── mail/
|
||||||
|
│ │ └── warn_about_foo.html.mako
|
||||||
|
│ ├── _version.py
|
||||||
|
│ └── web/
|
||||||
|
│ ├── __init__.py
|
||||||
|
│ ├── app.py
|
||||||
|
│ ├── static/
|
||||||
|
│ │ ├── __init__.py
|
||||||
|
│ │ ├── css/
|
||||||
|
│ │ ├── favicon.ico
|
||||||
|
│ │ ├── img/
|
||||||
|
│ │ └── js/
|
||||||
|
│ ├── subscribers.py
|
||||||
|
│ ├── templates/
|
||||||
|
│ │ ├── base.mako
|
||||||
|
│ │ ├── batch/
|
||||||
|
│ │ │ └── foobatch/
|
||||||
|
│ │ ├── customers/
|
||||||
|
│ │ ├── menu.mako
|
||||||
|
│ │ └── products/
|
||||||
|
│ └── views/
|
||||||
|
│ ├── __init__.py
|
||||||
|
│ ├── batch/
|
||||||
|
│ │ ├── __init__.py
|
||||||
|
│ │ └── foobatch.py
|
||||||
|
│ ├── common.py
|
||||||
|
│ ├── customers.py
|
||||||
|
│ └── products.py
|
||||||
|
├── README.rst
|
||||||
|
└── setup.py
|
103
pyproject.toml
Normal file
103
pyproject.toml
Normal file
|
@ -0,0 +1,103 @@
|
||||||
|
|
||||||
|
[build-system]
|
||||||
|
requires = ["hatchling"]
|
||||||
|
build-backend = "hatchling.build"
|
||||||
|
|
||||||
|
|
||||||
|
[project]
|
||||||
|
name = "Tailbone"
|
||||||
|
version = "0.22.8"
|
||||||
|
description = "Backoffice Web Application for Rattail"
|
||||||
|
readme = "README.md"
|
||||||
|
authors = [{name = "Lance Edgar", email = "lance@edbob.org"}]
|
||||||
|
license = {text = "GNU GPL v3+"}
|
||||||
|
classifiers = [
|
||||||
|
"Development Status :: 4 - Beta",
|
||||||
|
"Environment :: Web Environment",
|
||||||
|
"Framework :: Pyramid",
|
||||||
|
"Intended Audience :: Developers",
|
||||||
|
"License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)",
|
||||||
|
"Natural Language :: English",
|
||||||
|
"Operating System :: OS Independent",
|
||||||
|
"Programming Language :: Python",
|
||||||
|
"Programming Language :: Python :: 3",
|
||||||
|
"Programming Language :: Python :: 3.8",
|
||||||
|
"Programming Language :: Python :: 3.9",
|
||||||
|
"Programming Language :: Python :: 3.10",
|
||||||
|
"Programming Language :: Python :: 3.11",
|
||||||
|
"Topic :: Internet :: WWW/HTTP",
|
||||||
|
"Topic :: Office/Business",
|
||||||
|
"Topic :: Software Development :: Libraries :: Python Modules",
|
||||||
|
]
|
||||||
|
requires-python = ">= 3.8"
|
||||||
|
dependencies = [
|
||||||
|
"asgiref",
|
||||||
|
"colander",
|
||||||
|
"ColanderAlchemy",
|
||||||
|
"cornice",
|
||||||
|
"cornice-swagger",
|
||||||
|
"deform",
|
||||||
|
"humanize",
|
||||||
|
"Mako",
|
||||||
|
"markdown",
|
||||||
|
"openpyxl",
|
||||||
|
"paginate",
|
||||||
|
"paginate_sqlalchemy",
|
||||||
|
"passlib",
|
||||||
|
"Pillow",
|
||||||
|
"pyramid>=2",
|
||||||
|
"pyramid_beaker",
|
||||||
|
"pyramid_deform",
|
||||||
|
"pyramid_exclog",
|
||||||
|
"pyramid_fanstatic",
|
||||||
|
"pyramid_mako",
|
||||||
|
"pyramid_retry",
|
||||||
|
"pyramid_tm",
|
||||||
|
"rattail[db,bouncer]>=0.20.1",
|
||||||
|
"sa-filters",
|
||||||
|
"simplejson",
|
||||||
|
"transaction",
|
||||||
|
"waitress",
|
||||||
|
"WebHelpers2",
|
||||||
|
"WuttaWeb>=0.21.0",
|
||||||
|
"zope.sqlalchemy>=1.5",
|
||||||
|
]
|
||||||
|
|
||||||
|
|
||||||
|
[project.optional-dependencies]
|
||||||
|
docs = ["Sphinx", "furo"]
|
||||||
|
tests = ["coverage", "mock", "pytest", "pytest-cov"]
|
||||||
|
|
||||||
|
|
||||||
|
[project.entry-points."paste.app_factory"]
|
||||||
|
main = "tailbone.app:main"
|
||||||
|
webapi = "tailbone.webapi:main"
|
||||||
|
|
||||||
|
|
||||||
|
[project.entry-points."rattail.cleaners"]
|
||||||
|
beaker = "tailbone.cleanup:BeakerCleaner"
|
||||||
|
|
||||||
|
|
||||||
|
[project.entry-points."rattail.config.extensions"]
|
||||||
|
tailbone = "tailbone.config:ConfigExtension"
|
||||||
|
|
||||||
|
|
||||||
|
[project.urls]
|
||||||
|
Homepage = "https://rattailproject.org"
|
||||||
|
Repository = "https://forgejo.wuttaproject.org/rattail/tailbone"
|
||||||
|
Issues = "https://forgejo.wuttaproject.org/rattail/tailbone/issues"
|
||||||
|
Changelog = "https://forgejo.wuttaproject.org/rattail/tailbone/src/branch/master/CHANGELOG.md"
|
||||||
|
|
||||||
|
|
||||||
|
[tool.commitizen]
|
||||||
|
version_provider = "pep621"
|
||||||
|
tag_format = "v$version"
|
||||||
|
update_changelog_on_bump = true
|
||||||
|
|
||||||
|
|
||||||
|
[tool.nosetests]
|
||||||
|
nocapture = 1
|
||||||
|
cover-package = "tailbone"
|
||||||
|
cover-erase = 1
|
||||||
|
cover-html = 1
|
||||||
|
cover-html-dir = "htmlcov"
|
|
@ -1,6 +0,0 @@
|
||||||
[nosetests]
|
|
||||||
nocapture = 1
|
|
||||||
cover-package = tailbone
|
|
||||||
cover-erase = 1
|
|
||||||
cover-html = 1
|
|
||||||
cover-html-dir = htmlcov
|
|
177
setup.py
177
setup.py
|
@ -1,177 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Setup script for Tailbone
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import os.path
|
|
||||||
from setuptools import setup, find_packages
|
|
||||||
|
|
||||||
|
|
||||||
here = os.path.abspath(os.path.dirname(__file__))
|
|
||||||
exec(open(os.path.join(here, 'tailbone', '_version.py')).read())
|
|
||||||
README = open(os.path.join(here, 'README.rst')).read()
|
|
||||||
|
|
||||||
|
|
||||||
requires = [
|
|
||||||
#
|
|
||||||
# Version numbers within comments below have specific meanings.
|
|
||||||
# Basically the 'low' value is a "soft low," and 'high' a "soft high."
|
|
||||||
# In other words:
|
|
||||||
#
|
|
||||||
# If either a 'low' or 'high' value exists, the primary point to be
|
|
||||||
# made about the value is that it represents the most current (stable)
|
|
||||||
# version available for the package (assuming typical public access
|
|
||||||
# methods) whenever this project was started and/or documented.
|
|
||||||
# Therefore:
|
|
||||||
#
|
|
||||||
# If a 'low' version is present, you should know that attempts to use
|
|
||||||
# versions of the package significantly older than the 'low' version
|
|
||||||
# may not yield happy results. (A "hard" high limit may or may not be
|
|
||||||
# indicated by a true version requirement.)
|
|
||||||
#
|
|
||||||
# Similarly, if a 'high' version is present, and especially if this
|
|
||||||
# project has laid dormant for a while, you may need to refactor a bit
|
|
||||||
# when attempting to support a more recent version of the package. (A
|
|
||||||
# "hard" low limit should be indicated by a true version requirement
|
|
||||||
# when a 'high' version is present.)
|
|
||||||
#
|
|
||||||
# In any case, developers and other users are encouraged to play
|
|
||||||
# outside the lines with regard to these soft limits. If bugs are
|
|
||||||
# encountered then they should be filed as such.
|
|
||||||
#
|
|
||||||
# package # low high
|
|
||||||
|
|
||||||
# For now, let's restrict FormEncode to 1.2 since the 1.3 release
|
|
||||||
# introduces some deprecation warnings. Once we're running 1.2 everywhere
|
|
||||||
# in production, we can start looking at adding 1.3 support.
|
|
||||||
# TODO: Remove this restriction.
|
|
||||||
'FormEncode<=1.2.99', # 1.2.4 1.2.6
|
|
||||||
|
|
||||||
# FormAlchemy 1.5 supports Python 3 but is being a little aggressive about
|
|
||||||
# it, for our needs...We'll have to stick with 1.4 for now.
|
|
||||||
u'FormAlchemy<=1.4.99', # 1.4.3
|
|
||||||
|
|
||||||
# TODO: Pyramid 1.9 looks like it breaks us..? playing it safe for now..
|
|
||||||
'pyramid<1.9', # 1.3b2 1.8.3
|
|
||||||
|
|
||||||
# apparently 2.0 removes the retry support, in which case we then need
|
|
||||||
# pyramid_retry .. but that requires pyramid 1.9 ...
|
|
||||||
'pyramid_tm<2.0', # 0.3 1.1.1
|
|
||||||
|
|
||||||
'ColanderAlchemy', # 0.3.3
|
|
||||||
'deform', # 2.0.4
|
|
||||||
'humanize', # 0.5.1
|
|
||||||
'Mako', # 0.6.2
|
|
||||||
'openpyxl', # 2.4.7
|
|
||||||
'paginate', # 0.5.6
|
|
||||||
'paginate_sqlalchemy', # 0.2.0
|
|
||||||
'pyramid_beaker>=0.6', # 0.6.1
|
|
||||||
'pyramid_debugtoolbar', # 1.0
|
|
||||||
'pyramid_exclog', # 0.6
|
|
||||||
'pyramid_mako', # 1.0.2
|
|
||||||
'pyramid_simpleform', # 0.6.1
|
|
||||||
'rattail[db,auth,bouncer]', # 0.5.0
|
|
||||||
'six', # 1.10.0
|
|
||||||
'transaction', # 1.2.0
|
|
||||||
'waitress', # 0.8.1
|
|
||||||
'WebHelpers2', # 2.0
|
|
||||||
'webhelpers2_grid', # 0.1
|
|
||||||
'WTForms', # 2.1
|
|
||||||
'zope.sqlalchemy', # 0.7
|
|
||||||
]
|
|
||||||
|
|
||||||
|
|
||||||
extras = {
|
|
||||||
|
|
||||||
'docs': [
|
|
||||||
#
|
|
||||||
# package # low high
|
|
||||||
|
|
||||||
'Sphinx', # 1.2
|
|
||||||
],
|
|
||||||
|
|
||||||
'tests': [
|
|
||||||
#
|
|
||||||
# package # low high
|
|
||||||
|
|
||||||
'coverage', # 3.6
|
|
||||||
'fixture', # 1.5
|
|
||||||
'mock', # 1.0.1
|
|
||||||
'nose', # 1.3.0
|
|
||||||
],
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
setup(
|
|
||||||
name = "Tailbone",
|
|
||||||
version = __version__,
|
|
||||||
author = "Lance Edgar",
|
|
||||||
author_email = "lance@edbob.org",
|
|
||||||
url = "http://rattailproject.org/",
|
|
||||||
license = "GNU GPL v3",
|
|
||||||
description = "Backoffice Web Application for Rattail",
|
|
||||||
long_description = README,
|
|
||||||
|
|
||||||
classifiers = [
|
|
||||||
'Development Status :: 3 - Alpha',
|
|
||||||
'Environment :: Web Environment',
|
|
||||||
'Framework :: Pyramid',
|
|
||||||
'Intended Audience :: Developers',
|
|
||||||
'License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)',
|
|
||||||
'Natural Language :: English',
|
|
||||||
'Operating System :: OS Independent',
|
|
||||||
'Programming Language :: Python',
|
|
||||||
'Programming Language :: Python :: 2.6',
|
|
||||||
'Programming Language :: Python :: 2.7',
|
|
||||||
'Topic :: Internet :: WWW/HTTP',
|
|
||||||
'Topic :: Office/Business',
|
|
||||||
'Topic :: Software Development :: Libraries :: Python Modules',
|
|
||||||
],
|
|
||||||
|
|
||||||
install_requires = requires,
|
|
||||||
extras_require = extras,
|
|
||||||
tests_require = ['Tailbone[tests]'],
|
|
||||||
test_suite = 'nose.collector',
|
|
||||||
|
|
||||||
packages = find_packages(exclude=['tests.*', 'tests']),
|
|
||||||
include_package_data = True,
|
|
||||||
zip_safe = False,
|
|
||||||
|
|
||||||
entry_points = {
|
|
||||||
|
|
||||||
'paste.app_factory': [
|
|
||||||
'main = tailbone.app:main',
|
|
||||||
],
|
|
||||||
|
|
||||||
'rattail.config.extensions': [
|
|
||||||
'tailbone = tailbone.config:ConfigExtension',
|
|
||||||
],
|
|
||||||
|
|
||||||
'pyramid.scaffold': [
|
|
||||||
'rattail = tailbone.scaffolds:RattailTemplate',
|
|
||||||
],
|
|
||||||
},
|
|
||||||
)
|
|
|
@ -1,3 +1,9 @@
|
||||||
# -*- coding: utf-8; -*-
|
# -*- coding: utf-8; -*-
|
||||||
|
|
||||||
__version__ = '0.6.20'
|
try:
|
||||||
|
from importlib.metadata import version
|
||||||
|
except ImportError:
|
||||||
|
from importlib_metadata import version
|
||||||
|
|
||||||
|
|
||||||
|
__version__ = version('Tailbone')
|
||||||
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2022 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,22 +21,20 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Customer order field renderers
|
Tailbone Web API
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import formalchemy as fa
|
from .core import APIView, api
|
||||||
from webhelpers2.html import tags
|
from .master import APIMasterView, SortColumn
|
||||||
|
# TODO: remove this
|
||||||
|
from .master2 import APIMasterView2
|
||||||
|
|
||||||
|
|
||||||
class CustomerOrderFieldRenderer(fa.fields.SelectFieldRenderer):
|
def includeme(config):
|
||||||
"""
|
config.include('tailbone.api.common')
|
||||||
Renders a link to the customer order
|
config.include('tailbone.api.auth')
|
||||||
"""
|
config.include('tailbone.api.customers')
|
||||||
|
config.include('tailbone.api.upgrades')
|
||||||
def render_readonly(self, **kwargs):
|
config.include('tailbone.api.users')
|
||||||
order = self.raw_value
|
|
||||||
if not order:
|
|
||||||
return ''
|
|
||||||
return tags.link_to(order, self.request.route_url('custorders.view', uuid=order.uuid))
|
|
229
tailbone/api/auth.py
Normal file
229
tailbone/api/auth.py
Normal file
|
@ -0,0 +1,229 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Auth Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
|
||||||
|
from tailbone.api import APIView, api
|
||||||
|
from tailbone.db import Session
|
||||||
|
from tailbone.auth import login_user, logout_user
|
||||||
|
|
||||||
|
|
||||||
|
class AuthenticationView(APIView):
|
||||||
|
|
||||||
|
@api
|
||||||
|
def check_session(self):
|
||||||
|
"""
|
||||||
|
View to serve as "no-op" / ping action to check current user's session.
|
||||||
|
This will establish a server-side web session for the user if none
|
||||||
|
exists. Note that this also resets the user's session timer.
|
||||||
|
"""
|
||||||
|
data = {'ok': True, 'permissions': []}
|
||||||
|
if self.request.user:
|
||||||
|
data['user'] = self.get_user_info(self.request.user)
|
||||||
|
data['permissions'] = list(self.request.user_permissions)
|
||||||
|
|
||||||
|
# background color may be set per-request, by some apps
|
||||||
|
if hasattr(self.request, 'background_color') and self.request.background_color:
|
||||||
|
data['background_color'] = self.request.background_color
|
||||||
|
else: # otherwise we use the one from config
|
||||||
|
data['background_color'] = self.rattail_config.get(
|
||||||
|
'tailbone', 'background_color')
|
||||||
|
|
||||||
|
# TODO: this seems the best place to return some global app
|
||||||
|
# settings, but maybe not desirable in all cases..in which
|
||||||
|
# case should caller need to ask for these explicitly? or
|
||||||
|
# make a different call altogether to get them..?
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
customer_handler = app.get_clientele_handler()
|
||||||
|
data['settings'] = {
|
||||||
|
'customer_field_dropdown': customer_handler.choice_uses_dropdown(),
|
||||||
|
}
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
@api
|
||||||
|
def login(self):
|
||||||
|
"""
|
||||||
|
API login view.
|
||||||
|
"""
|
||||||
|
if self.request.method == 'OPTIONS':
|
||||||
|
return self.request.response
|
||||||
|
|
||||||
|
username = self.request.json.get('username')
|
||||||
|
password = self.request.json.get('password')
|
||||||
|
if not (username and password):
|
||||||
|
return {'error': "Invalid username or password"}
|
||||||
|
|
||||||
|
# make sure credentials are valid
|
||||||
|
user = self.authenticate_user(username, password)
|
||||||
|
if not user:
|
||||||
|
return {'error': "Invalid username or password"}
|
||||||
|
|
||||||
|
# is there some reason this user should not login?
|
||||||
|
error = self.why_cant_user_login(user)
|
||||||
|
if error:
|
||||||
|
return {'error': error}
|
||||||
|
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
auth = app.get_auth_handler()
|
||||||
|
|
||||||
|
login_user(self.request, user)
|
||||||
|
return {
|
||||||
|
'ok': True,
|
||||||
|
'user': self.get_user_info(user),
|
||||||
|
'permissions': list(auth.get_permissions(Session(), user)),
|
||||||
|
}
|
||||||
|
|
||||||
|
def authenticate_user(self, username, password):
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
auth = app.get_auth_handler()
|
||||||
|
return auth.authenticate_user(Session(), username, password)
|
||||||
|
|
||||||
|
def why_cant_user_login(self, user):
|
||||||
|
"""
|
||||||
|
This method is given a ``User`` instance, which represents someone who
|
||||||
|
is just now trying to login, and has already cleared the basic hurdle
|
||||||
|
of providing the correct credentials for a user on file. This method
|
||||||
|
is responsible then, for further verification that this user *should*
|
||||||
|
in fact be allowed to login to this app node. If the method determines
|
||||||
|
a reason the user should *not* be allowed to login, then it should
|
||||||
|
return that reason as a simple string.
|
||||||
|
"""
|
||||||
|
|
||||||
|
@api
|
||||||
|
def logout(self):
|
||||||
|
"""
|
||||||
|
API logout view.
|
||||||
|
"""
|
||||||
|
if self.request.method == 'OPTIONS':
|
||||||
|
return self.request.response
|
||||||
|
|
||||||
|
logout_user(self.request)
|
||||||
|
return {'ok': True}
|
||||||
|
|
||||||
|
@api
|
||||||
|
def become_root(self):
|
||||||
|
"""
|
||||||
|
Elevate the current request to 'root' for full system access.
|
||||||
|
"""
|
||||||
|
if not self.request.is_admin:
|
||||||
|
raise self.forbidden()
|
||||||
|
self.request.user.record_event(self.enum.USER_EVENT_BECOME_ROOT)
|
||||||
|
self.request.session['is_root'] = True
|
||||||
|
return {
|
||||||
|
'ok': True,
|
||||||
|
'user': self.get_user_info(self.request.user),
|
||||||
|
}
|
||||||
|
|
||||||
|
@api
|
||||||
|
def stop_root(self):
|
||||||
|
"""
|
||||||
|
Lower the current request from 'root' back to normal access.
|
||||||
|
"""
|
||||||
|
if not self.request.is_admin:
|
||||||
|
raise self.forbidden()
|
||||||
|
self.request.user.record_event(self.enum.USER_EVENT_STOP_ROOT)
|
||||||
|
self.request.session['is_root'] = False
|
||||||
|
return {
|
||||||
|
'ok': True,
|
||||||
|
'user': self.get_user_info(self.request.user),
|
||||||
|
}
|
||||||
|
|
||||||
|
@api
|
||||||
|
def change_password(self):
|
||||||
|
"""
|
||||||
|
View which allows a user to change their password.
|
||||||
|
"""
|
||||||
|
if self.request.method == 'OPTIONS':
|
||||||
|
return self.request.response
|
||||||
|
|
||||||
|
if not self.request.user:
|
||||||
|
raise self.forbidden()
|
||||||
|
|
||||||
|
if self.request.user.prevent_password_change and not self.request.is_root:
|
||||||
|
raise self.forbidden()
|
||||||
|
|
||||||
|
data = self.request.json_body
|
||||||
|
|
||||||
|
# first make sure "current" password is accurate
|
||||||
|
if not self.authenticate_user(self.request.user, data['current_password']):
|
||||||
|
return {'error': "The current/old password you provided is incorrect"}
|
||||||
|
|
||||||
|
# okay then, set new password
|
||||||
|
auth = self.app.get_auth_handler()
|
||||||
|
auth.set_user_password(self.request.user, data['new_password'])
|
||||||
|
return {
|
||||||
|
'ok': True,
|
||||||
|
'user': self.get_user_info(self.request.user),
|
||||||
|
}
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._auth_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _auth_defaults(cls, config):
|
||||||
|
|
||||||
|
# session
|
||||||
|
check_session = Service(name='check_session', path='/session')
|
||||||
|
check_session.add_view('GET', 'check_session', klass=cls)
|
||||||
|
config.add_cornice_service(check_session)
|
||||||
|
|
||||||
|
# login
|
||||||
|
login = Service(name='login', path='/login')
|
||||||
|
login.add_view('POST', 'login', klass=cls)
|
||||||
|
config.add_cornice_service(login)
|
||||||
|
|
||||||
|
# logout
|
||||||
|
logout = Service(name='logout', path='/logout')
|
||||||
|
logout.add_view('POST', 'logout', klass=cls)
|
||||||
|
config.add_cornice_service(logout)
|
||||||
|
|
||||||
|
# become root
|
||||||
|
become_root = Service(name='become_root', path='/become-root')
|
||||||
|
become_root.add_view('POST', 'become_root', klass=cls)
|
||||||
|
config.add_cornice_service(become_root)
|
||||||
|
|
||||||
|
# stop root
|
||||||
|
stop_root = Service(name='stop_root', path='/stop-root')
|
||||||
|
stop_root.add_view('POST', 'stop_root', klass=cls)
|
||||||
|
config.add_cornice_service(stop_root)
|
||||||
|
|
||||||
|
# change password
|
||||||
|
change_password = Service(name='change_password', path='/change-password')
|
||||||
|
change_password.add_view('POST', 'change_password', klass=cls)
|
||||||
|
config.add_cornice_service(change_password)
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
AuthenticationView = kwargs.get('AuthenticationView', base['AuthenticationView'])
|
||||||
|
AuthenticationView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2019 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,9 +21,9 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Forms Library
|
Tailbone Web API - Batches
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
from .core import Form
|
from .core import APIBatchView, APIBatchRowView, BatchAPIMasterView
|
360
tailbone/api/batch/core.py
Normal file
360
tailbone/api/batch/core.py
Normal file
|
@ -0,0 +1,360 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Batch Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
import logging
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
|
||||||
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class APIBatchMixin(object):
|
||||||
|
"""
|
||||||
|
Base class for all API views which are meant to handle "batch" *and/or*
|
||||||
|
"batch row" data.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def get_batch_class(self):
|
||||||
|
model_class = self.get_model_class()
|
||||||
|
if hasattr(model_class, '__batch_class__'):
|
||||||
|
return model_class.__batch_class__
|
||||||
|
return model_class
|
||||||
|
|
||||||
|
def get_handler(self):
|
||||||
|
"""
|
||||||
|
Returns a `BatchHandler` instance for the view. All (?) custom batch
|
||||||
|
API views should define a default handler class; however this may in all
|
||||||
|
(?) cases be overridden by config also. The specific setting required
|
||||||
|
to do so will depend on the 'key' for the type of batch involved, e.g.
|
||||||
|
assuming the 'vendor_catalog' batch:
|
||||||
|
|
||||||
|
.. code-block:: ini
|
||||||
|
|
||||||
|
[rattail.batch]
|
||||||
|
vendor_catalog.handler = myapp.batch.vendorcatalog:CustomCatalogHandler
|
||||||
|
|
||||||
|
Note that the 'key' for a batch is generally the same as its primary
|
||||||
|
table name, although technically it is whatever value returns from the
|
||||||
|
``batch_key`` attribute of the main batch model class.
|
||||||
|
"""
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
key = self.get_batch_class().batch_key
|
||||||
|
return app.get_batch_handler(key, default=self.default_handler_spec)
|
||||||
|
|
||||||
|
|
||||||
|
class APIBatchView(APIBatchMixin, APIMasterView):
|
||||||
|
"""
|
||||||
|
Base class for all API views which are meant to handle "batch" *and/or*
|
||||||
|
"batch row" data.
|
||||||
|
"""
|
||||||
|
supports_toggle_complete = False
|
||||||
|
supports_execute = False
|
||||||
|
|
||||||
|
def __init__(self, request, **kwargs):
|
||||||
|
super(APIBatchView, self).__init__(request, **kwargs)
|
||||||
|
self.batch_handler = self.get_handler()
|
||||||
|
|
||||||
|
@property
|
||||||
|
def handler(self):
|
||||||
|
warnings.warn("the `handler` property is deprecated; "
|
||||||
|
"please use `batch_handler` instead",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
return self.batch_handler
|
||||||
|
|
||||||
|
def normalize(self, batch):
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
created = app.localtime(batch.created, from_utc=True)
|
||||||
|
|
||||||
|
executed = None
|
||||||
|
if batch.executed:
|
||||||
|
executed = app.localtime(batch.executed, from_utc=True)
|
||||||
|
|
||||||
|
return {
|
||||||
|
'uuid': batch.uuid,
|
||||||
|
'_str': str(batch),
|
||||||
|
'id': batch.id,
|
||||||
|
'id_str': batch.id_str,
|
||||||
|
'description': batch.description,
|
||||||
|
'notes': batch.notes,
|
||||||
|
'params': batch.params or {},
|
||||||
|
'rowcount': batch.rowcount,
|
||||||
|
'created': str(created),
|
||||||
|
'created_display': self.pretty_datetime(created),
|
||||||
|
'created_by_uuid': batch.created_by.uuid,
|
||||||
|
'created_by_display': str(batch.created_by),
|
||||||
|
'complete': batch.complete,
|
||||||
|
'status_code': batch.status_code,
|
||||||
|
'status_display': batch.STATUS.get(batch.status_code,
|
||||||
|
str(batch.status_code)),
|
||||||
|
'executed': str(executed) if executed else None,
|
||||||
|
'executed_display': self.pretty_datetime(executed) if executed else None,
|
||||||
|
'executed_by_uuid': batch.executed_by_uuid,
|
||||||
|
'executed_by_display': str(batch.executed_by or ''),
|
||||||
|
'mutable': self.batch_handler.is_mutable(batch),
|
||||||
|
}
|
||||||
|
|
||||||
|
def create_object(self, data):
|
||||||
|
"""
|
||||||
|
Create a new object instance and populate it with the given data.
|
||||||
|
|
||||||
|
Here we'll invoke the handler for actual batch creation, instead of
|
||||||
|
typical logic used for simple records.
|
||||||
|
"""
|
||||||
|
user = self.request.user
|
||||||
|
kwargs = dict(data)
|
||||||
|
kwargs['user'] = user
|
||||||
|
batch = self.batch_handler.make_batch(self.Session(), **kwargs)
|
||||||
|
if self.batch_handler.should_populate(batch):
|
||||||
|
self.batch_handler.do_populate(batch, user)
|
||||||
|
return batch
|
||||||
|
|
||||||
|
def update_object(self, batch, data):
|
||||||
|
"""
|
||||||
|
Logic for updating a main object record.
|
||||||
|
|
||||||
|
Here we want to make sure we set "created by" to the current user, when
|
||||||
|
creating a new batch.
|
||||||
|
"""
|
||||||
|
# we're only concerned with *new* batches here
|
||||||
|
if not batch.uuid:
|
||||||
|
|
||||||
|
# assign creator; initialize row count
|
||||||
|
batch.created_by_uuid = self.request.user.uuid
|
||||||
|
if batch.rowcount is None:
|
||||||
|
batch.rowcount = 0
|
||||||
|
|
||||||
|
# then go ahead with usual logic
|
||||||
|
return super(APIBatchView, self).update_object(batch, data)
|
||||||
|
|
||||||
|
def mark_complete(self):
|
||||||
|
"""
|
||||||
|
Mark the given batch as "complete".
|
||||||
|
"""
|
||||||
|
batch = self.get_object()
|
||||||
|
|
||||||
|
if batch.executed:
|
||||||
|
return {'error': "Batch {} has already been executed: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
if batch.complete:
|
||||||
|
return {'error': "Batch {} is already marked complete: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
batch.complete = True
|
||||||
|
return self._get(obj=batch)
|
||||||
|
|
||||||
|
def mark_incomplete(self):
|
||||||
|
"""
|
||||||
|
Mark the given batch as "incomplete".
|
||||||
|
"""
|
||||||
|
batch = self.get_object()
|
||||||
|
|
||||||
|
if batch.executed:
|
||||||
|
return {'error': "Batch {} has already been executed: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
if not batch.complete:
|
||||||
|
return {'error': "Batch {} is already marked incomplete: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
batch.complete = False
|
||||||
|
return self._get(obj=batch)
|
||||||
|
|
||||||
|
def execute(self):
|
||||||
|
"""
|
||||||
|
Execute the given batch.
|
||||||
|
"""
|
||||||
|
batch = self.get_object()
|
||||||
|
|
||||||
|
if batch.executed:
|
||||||
|
return {'error': "Batch {} has already been executed: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
kwargs = dict(self.request.json_body)
|
||||||
|
kwargs.pop('user', None)
|
||||||
|
kwargs.pop('progress', None)
|
||||||
|
result = self.batch_handler.do_execute(batch, self.request.user, **kwargs)
|
||||||
|
return {'ok': bool(result), 'batch': self.normalize(batch)}
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._batch_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _batch_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
collection_url_prefix = cls.get_collection_url_prefix()
|
||||||
|
object_url_prefix = cls.get_object_url_prefix()
|
||||||
|
|
||||||
|
if cls.supports_toggle_complete:
|
||||||
|
|
||||||
|
# mark complete
|
||||||
|
mark_complete = Service(name='{}.mark_complete'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/mark-complete'.format(object_url_prefix))
|
||||||
|
mark_complete.add_view('POST', 'mark_complete', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(mark_complete)
|
||||||
|
|
||||||
|
# mark incomplete
|
||||||
|
mark_incomplete = Service(name='{}.mark_incomplete'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/mark-incomplete'.format(object_url_prefix))
|
||||||
|
mark_incomplete.add_view('POST', 'mark_incomplete', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(mark_incomplete)
|
||||||
|
|
||||||
|
if cls.supports_execute:
|
||||||
|
|
||||||
|
# execute batch
|
||||||
|
execute = Service(name='{}.execute'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/execute'.format(object_url_prefix))
|
||||||
|
execute.add_view('POST', 'execute', klass=cls,
|
||||||
|
permission='{}.execute'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(execute)
|
||||||
|
|
||||||
|
|
||||||
|
# TODO: deprecate / remove this
|
||||||
|
BatchAPIMasterView = APIBatchView
|
||||||
|
|
||||||
|
|
||||||
|
class APIBatchRowView(APIBatchMixin, APIMasterView):
|
||||||
|
"""
|
||||||
|
Base class for all API views which are meant to handle "batch rows" data.
|
||||||
|
"""
|
||||||
|
editable = False
|
||||||
|
supports_quick_entry = False
|
||||||
|
|
||||||
|
def __init__(self, request, **kwargs):
|
||||||
|
super(APIBatchRowView, self).__init__(request, **kwargs)
|
||||||
|
self.batch_handler = self.get_handler()
|
||||||
|
|
||||||
|
@property
|
||||||
|
def handler(self):
|
||||||
|
warnings.warn("the `handler` property is deprecated; "
|
||||||
|
"please use `batch_handler` instead",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
return self.batch_handler
|
||||||
|
|
||||||
|
def normalize(self, row):
|
||||||
|
batch = row.batch
|
||||||
|
return {
|
||||||
|
'uuid': row.uuid,
|
||||||
|
'_str': str(row),
|
||||||
|
'_parent_str': str(batch),
|
||||||
|
'_parent_uuid': batch.uuid,
|
||||||
|
'batch_uuid': batch.uuid,
|
||||||
|
'batch_id': batch.id,
|
||||||
|
'batch_id_str': batch.id_str,
|
||||||
|
'batch_description': batch.description,
|
||||||
|
'batch_complete': batch.complete,
|
||||||
|
'batch_executed': bool(batch.executed),
|
||||||
|
'batch_mutable': self.batch_handler.is_mutable(batch),
|
||||||
|
'sequence': row.sequence,
|
||||||
|
'status_code': row.status_code,
|
||||||
|
'status_display': row.STATUS.get(row.status_code, str(row.status_code)),
|
||||||
|
}
|
||||||
|
|
||||||
|
def update_object(self, row, data):
|
||||||
|
"""
|
||||||
|
Supplements the default logic as follows:
|
||||||
|
|
||||||
|
Invokes the batch handler's ``refresh_row()`` method after updating the
|
||||||
|
row's field data per usual.
|
||||||
|
"""
|
||||||
|
if not self.batch_handler.is_mutable(row.batch):
|
||||||
|
return {'error': "Batch is not mutable"}
|
||||||
|
|
||||||
|
# update row per usual
|
||||||
|
row = super(APIBatchRowView, self).update_object(row, data)
|
||||||
|
|
||||||
|
# okay now we apply handler refresh logic
|
||||||
|
self.batch_handler.refresh_row(row)
|
||||||
|
return row
|
||||||
|
|
||||||
|
def delete_object(self, row):
|
||||||
|
"""
|
||||||
|
Overrides the default logic as follows:
|
||||||
|
|
||||||
|
Delegates deletion of the row to the batch handler.
|
||||||
|
"""
|
||||||
|
self.batch_handler.do_remove_row(row)
|
||||||
|
|
||||||
|
def quick_entry(self):
|
||||||
|
"""
|
||||||
|
View for handling "quick entry" user input, for a batch.
|
||||||
|
"""
|
||||||
|
data = self.request.json_body
|
||||||
|
|
||||||
|
uuid = data['batch_uuid']
|
||||||
|
batch = self.Session.get(self.get_batch_class(), uuid)
|
||||||
|
if not batch:
|
||||||
|
raise self.notfound()
|
||||||
|
|
||||||
|
entry = data['quick_entry']
|
||||||
|
|
||||||
|
try:
|
||||||
|
row = self.batch_handler.quick_entry(self.Session(), batch, entry)
|
||||||
|
except Exception as error:
|
||||||
|
log.warning("quick entry failed for '%s' batch %s: %s",
|
||||||
|
self.batch_handler.batch_key, batch.id_str, entry,
|
||||||
|
exc_info=True)
|
||||||
|
msg = str(error)
|
||||||
|
if not msg and isinstance(error, NotImplementedError):
|
||||||
|
msg = "Feature is not implemented"
|
||||||
|
return {'error': msg}
|
||||||
|
|
||||||
|
if not row:
|
||||||
|
return {'error': "Could not identify product"}
|
||||||
|
|
||||||
|
self.Session.flush()
|
||||||
|
result = self._get(obj=row)
|
||||||
|
result['ok'] = True
|
||||||
|
return result
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._batch_row_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _batch_row_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
collection_url_prefix = cls.get_collection_url_prefix()
|
||||||
|
|
||||||
|
if cls.supports_quick_entry:
|
||||||
|
|
||||||
|
# quick entry
|
||||||
|
quick_entry = Service(name='{}.quick_entry'.format(route_prefix),
|
||||||
|
path='{}/quick-entry'.format(collection_url_prefix))
|
||||||
|
quick_entry.add_view('POST', 'quick_entry', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(quick_entry)
|
200
tailbone/api/batch/inventory.py
Normal file
200
tailbone/api/batch/inventory.py
Normal file
|
@ -0,0 +1,200 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Inventory Batches
|
||||||
|
"""
|
||||||
|
|
||||||
|
import decimal
|
||||||
|
|
||||||
|
import sqlalchemy as sa
|
||||||
|
|
||||||
|
from rattail import pod
|
||||||
|
from rattail.db.model import InventoryBatch, InventoryBatchRow
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
|
||||||
|
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
||||||
|
|
||||||
|
|
||||||
|
class InventoryBatchViews(APIBatchView):
|
||||||
|
|
||||||
|
model_class = InventoryBatch
|
||||||
|
default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler'
|
||||||
|
route_prefix = 'inventory'
|
||||||
|
permission_prefix = 'batch.inventory'
|
||||||
|
collection_url_prefix = '/inventory-batches'
|
||||||
|
object_url_prefix = '/inventory-batch'
|
||||||
|
supports_toggle_complete = True
|
||||||
|
|
||||||
|
def normalize(self, batch):
|
||||||
|
data = super().normalize(batch)
|
||||||
|
|
||||||
|
data['mode'] = batch.mode
|
||||||
|
data['mode_display'] = self.enum.INVENTORY_MODE.get(batch.mode)
|
||||||
|
if data['mode_display'] is None and batch.mode is not None:
|
||||||
|
data['mode_display'] = str(batch.mode)
|
||||||
|
|
||||||
|
data['reason_code'] = batch.reason_code
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
def count_modes(self):
|
||||||
|
"""
|
||||||
|
Retrieve info about the available batch count modes.
|
||||||
|
"""
|
||||||
|
permission_prefix = self.get_permission_prefix()
|
||||||
|
if self.request.is_root:
|
||||||
|
modes = self.batch_handler.get_count_modes()
|
||||||
|
else:
|
||||||
|
modes = self.batch_handler.get_allowed_count_modes(
|
||||||
|
self.Session(), self.request.user,
|
||||||
|
permission_prefix=permission_prefix)
|
||||||
|
return modes
|
||||||
|
|
||||||
|
def adjustment_reasons(self):
|
||||||
|
"""
|
||||||
|
Retrieve info about the available "reasons" for inventory adjustment
|
||||||
|
batches.
|
||||||
|
"""
|
||||||
|
raw_reasons = self.batch_handler.get_adjustment_reasons(self.Session())
|
||||||
|
reasons = []
|
||||||
|
for reason in raw_reasons:
|
||||||
|
reasons.append({
|
||||||
|
'uuid': reason.uuid,
|
||||||
|
'code': reason.code,
|
||||||
|
'description': reason.description,
|
||||||
|
'hidden': reason.hidden,
|
||||||
|
})
|
||||||
|
return reasons
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._batch_defaults(config)
|
||||||
|
cls._inventory_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _inventory_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
collection_url_prefix = cls.get_collection_url_prefix()
|
||||||
|
|
||||||
|
# get count modes
|
||||||
|
count_modes = Service(name='{}.count_modes'.format(route_prefix),
|
||||||
|
path='{}/count-modes'.format(collection_url_prefix))
|
||||||
|
count_modes.add_view('GET', 'count_modes', klass=cls,
|
||||||
|
permission='{}.list'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(count_modes)
|
||||||
|
|
||||||
|
# get adjustment reasons
|
||||||
|
adjustment_reasons = Service(name='{}.adjustment_reasons'.format(route_prefix),
|
||||||
|
path='{}/adjustment-reasons'.format(collection_url_prefix))
|
||||||
|
adjustment_reasons.add_view('GET', 'adjustment_reasons', klass=cls,
|
||||||
|
permission='{}.list'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(adjustment_reasons)
|
||||||
|
|
||||||
|
|
||||||
|
class InventoryBatchRowViews(APIBatchRowView):
|
||||||
|
|
||||||
|
model_class = InventoryBatchRow
|
||||||
|
default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler'
|
||||||
|
route_prefix = 'inventory.rows'
|
||||||
|
permission_prefix = 'batch.inventory'
|
||||||
|
collection_url_prefix = '/inventory-batch-rows'
|
||||||
|
object_url_prefix = '/inventory-batch-row'
|
||||||
|
editable = True
|
||||||
|
supports_quick_entry = True
|
||||||
|
|
||||||
|
def normalize(self, row):
|
||||||
|
batch = row.batch
|
||||||
|
data = super().normalize(row)
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
|
||||||
|
data['item_id'] = row.item_id
|
||||||
|
data['upc'] = str(row.upc)
|
||||||
|
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
||||||
|
data['brand_name'] = row.brand_name
|
||||||
|
data['description'] = row.description
|
||||||
|
data['size'] = row.size
|
||||||
|
data['full_description'] = row.product.full_description if row.product else row.description
|
||||||
|
data['image_url'] = pod.get_image_url(self.rattail_config, row.upc) if row.upc else None
|
||||||
|
data['case_quantity'] = app.render_quantity(row.case_quantity or 1)
|
||||||
|
|
||||||
|
data['cases'] = row.cases
|
||||||
|
data['units'] = row.units
|
||||||
|
data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA'
|
||||||
|
data['quantity_display'] = "{} {}".format(
|
||||||
|
app.render_quantity(row.cases or row.units),
|
||||||
|
'CS' if row.cases else data['unit_uom'])
|
||||||
|
|
||||||
|
data['allow_cases'] = self.batch_handler.allow_cases(batch)
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
def update_object(self, row, data):
|
||||||
|
"""
|
||||||
|
Supplements the default logic as follows:
|
||||||
|
|
||||||
|
Converts certain fields within the data, to proper "native" types.
|
||||||
|
"""
|
||||||
|
data = dict(data)
|
||||||
|
|
||||||
|
# convert some data types as needed
|
||||||
|
if 'cases' in data:
|
||||||
|
if data['cases'] == '':
|
||||||
|
data['cases'] = None
|
||||||
|
elif data['cases']:
|
||||||
|
data['cases'] = decimal.Decimal(data['cases'])
|
||||||
|
if 'units' in data:
|
||||||
|
if data['units'] == '':
|
||||||
|
data['units'] = None
|
||||||
|
elif data['units']:
|
||||||
|
data['units'] = decimal.Decimal(data['units'])
|
||||||
|
|
||||||
|
# update row per usual
|
||||||
|
try:
|
||||||
|
row = super().update_object(row, data)
|
||||||
|
except sa.exc.DataError as error:
|
||||||
|
# detect when user scans barcode for cases/units field
|
||||||
|
if hasattr(error, 'orig'):
|
||||||
|
orig = type(error.orig)
|
||||||
|
if hasattr(orig, '__name__'):
|
||||||
|
# nb. this particular error is from psycopg2
|
||||||
|
if orig.__name__ == 'NumericValueOutOfRange':
|
||||||
|
return {'error': "Numeric value out of range"}
|
||||||
|
raise
|
||||||
|
return row
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
InventoryBatchViews = kwargs.get('InventoryBatchViews', base['InventoryBatchViews'])
|
||||||
|
InventoryBatchViews.defaults(config)
|
||||||
|
|
||||||
|
InventoryBatchRowViews = kwargs.get('InventoryBatchRowViews', base['InventoryBatchRowViews'])
|
||||||
|
InventoryBatchRowViews.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
78
tailbone/api/batch/labels.py
Normal file
78
tailbone/api/batch/labels.py
Normal file
|
@ -0,0 +1,78 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Label Batches
|
||||||
|
"""
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
|
||||||
|
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
||||||
|
|
||||||
|
|
||||||
|
class LabelBatchViews(APIBatchView):
|
||||||
|
|
||||||
|
model_class = model.LabelBatch
|
||||||
|
default_handler_spec = 'rattail.batch.labels:LabelBatchHandler'
|
||||||
|
route_prefix = 'labelbatchviews'
|
||||||
|
permission_prefix = 'labels.batch'
|
||||||
|
collection_url_prefix = '/label-batches'
|
||||||
|
object_url_prefix = '/label-batch'
|
||||||
|
supports_toggle_complete = True
|
||||||
|
|
||||||
|
|
||||||
|
class LabelBatchRowViews(APIBatchRowView):
|
||||||
|
|
||||||
|
model_class = model.LabelBatchRow
|
||||||
|
default_handler_spec = 'rattail.batch.labels:LabelBatchHandler'
|
||||||
|
route_prefix = 'api.label_batch_rows'
|
||||||
|
permission_prefix = 'labels.batch'
|
||||||
|
collection_url_prefix = '/label-batch-rows'
|
||||||
|
object_url_prefix = '/label-batch-row'
|
||||||
|
supports_quick_entry = True
|
||||||
|
|
||||||
|
def normalize(self, row):
|
||||||
|
batch = row.batch
|
||||||
|
data = super().normalize(row)
|
||||||
|
|
||||||
|
data['item_id'] = row.item_id
|
||||||
|
data['upc'] = str(row.upc)
|
||||||
|
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
||||||
|
data['brand_name'] = row.brand_name
|
||||||
|
data['description'] = row.description
|
||||||
|
data['size'] = row.size
|
||||||
|
data['full_description'] = row.product.full_description if row.product else row.description
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
LabelBatchViews = kwargs.get('LabelBatchViews', base['LabelBatchViews'])
|
||||||
|
LabelBatchViews.defaults(config)
|
||||||
|
|
||||||
|
LabelBatchRowViews = kwargs.get('LabelBatchRowViews', base['LabelBatchRowViews'])
|
||||||
|
LabelBatchRowViews.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
318
tailbone/api/batch/ordering.py
Normal file
318
tailbone/api/batch/ordering.py
Normal file
|
@ -0,0 +1,318 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Ordering Batches
|
||||||
|
|
||||||
|
These views expose the basic CRUD interface to "ordering" batches, for the web
|
||||||
|
API.
|
||||||
|
"""
|
||||||
|
|
||||||
|
import datetime
|
||||||
|
import logging
|
||||||
|
|
||||||
|
import sqlalchemy as sa
|
||||||
|
|
||||||
|
from rattail.db.model import PurchaseBatch, PurchaseBatchRow
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
|
||||||
|
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
||||||
|
|
||||||
|
|
||||||
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class OrderingBatchViews(APIBatchView):
|
||||||
|
|
||||||
|
model_class = PurchaseBatch
|
||||||
|
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
||||||
|
route_prefix = 'orderingbatchviews'
|
||||||
|
permission_prefix = 'ordering'
|
||||||
|
collection_url_prefix = '/ordering-batches'
|
||||||
|
object_url_prefix = '/ordering-batch'
|
||||||
|
supports_toggle_complete = True
|
||||||
|
supports_execute = True
|
||||||
|
|
||||||
|
def base_query(self):
|
||||||
|
"""
|
||||||
|
Modifies the default logic as follows:
|
||||||
|
|
||||||
|
Adds a condition to the query, to ensure only purchase batches with
|
||||||
|
"ordering" mode are returned.
|
||||||
|
"""
|
||||||
|
model = self.model
|
||||||
|
query = super().base_query()
|
||||||
|
query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_ORDERING)
|
||||||
|
return query
|
||||||
|
|
||||||
|
def normalize(self, batch):
|
||||||
|
data = super().normalize(batch)
|
||||||
|
|
||||||
|
data['vendor_uuid'] = batch.vendor.uuid
|
||||||
|
data['vendor_display'] = str(batch.vendor)
|
||||||
|
|
||||||
|
data['department_uuid'] = batch.department_uuid
|
||||||
|
data['department_display'] = str(batch.department) if batch.department else None
|
||||||
|
|
||||||
|
data['po_total_calculated_display'] = "${:0.2f}".format(batch.po_total_calculated or 0)
|
||||||
|
data['ship_method'] = batch.ship_method
|
||||||
|
data['notes_to_vendor'] = batch.notes_to_vendor
|
||||||
|
return data
|
||||||
|
|
||||||
|
def create_object(self, data):
|
||||||
|
"""
|
||||||
|
Modifies the default logic as follows:
|
||||||
|
|
||||||
|
Sets the mode to "ordering" for the new batch.
|
||||||
|
"""
|
||||||
|
data = dict(data)
|
||||||
|
if not data.get('vendor_uuid'):
|
||||||
|
raise ValueError("You must specify the vendor")
|
||||||
|
data['mode'] = self.enum.PURCHASE_BATCH_MODE_ORDERING
|
||||||
|
batch = super().create_object(data)
|
||||||
|
return batch
|
||||||
|
|
||||||
|
def worksheet(self):
|
||||||
|
"""
|
||||||
|
Returns primary data for the Ordering Worksheet view.
|
||||||
|
"""
|
||||||
|
batch = self.get_object()
|
||||||
|
if batch.executed:
|
||||||
|
raise self.forbidden()
|
||||||
|
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
|
||||||
|
# TODO: much of the logic below was copied from the traditional master
|
||||||
|
# view for ordering batches. should maybe let them share it somehow?
|
||||||
|
|
||||||
|
# organize existing batch rows by product
|
||||||
|
order_items = {}
|
||||||
|
for row in batch.active_rows():
|
||||||
|
order_items[row.product_uuid] = row
|
||||||
|
|
||||||
|
# organize vendor catalog costs by dept / subdept
|
||||||
|
departments = {}
|
||||||
|
costs = self.batch_handler.get_order_form_costs(self.Session(), batch.vendor)
|
||||||
|
costs = self.batch_handler.sort_order_form_costs(costs)
|
||||||
|
costs = list(costs) # we must have a stable list for the rest of this
|
||||||
|
self.batch_handler.decorate_order_form_costs(batch, costs)
|
||||||
|
for cost in costs:
|
||||||
|
|
||||||
|
department = cost.product.department
|
||||||
|
if department:
|
||||||
|
department_dict = departments.setdefault(department.uuid, {
|
||||||
|
'uuid': department.uuid,
|
||||||
|
'number': department.number,
|
||||||
|
'name': department.name,
|
||||||
|
})
|
||||||
|
else:
|
||||||
|
if None not in departments:
|
||||||
|
departments[None] = {
|
||||||
|
'uuid': None,
|
||||||
|
'number': None,
|
||||||
|
'name': "",
|
||||||
|
}
|
||||||
|
department_dict = departments[None]
|
||||||
|
|
||||||
|
subdepartments = department_dict.setdefault('subdepartments', {})
|
||||||
|
|
||||||
|
subdepartment = cost.product.subdepartment
|
||||||
|
if subdepartment:
|
||||||
|
subdepartment_dict = subdepartments.setdefault(subdepartment.uuid, {
|
||||||
|
'uuid': subdepartment.uuid,
|
||||||
|
'number': subdepartment.number,
|
||||||
|
'name': subdepartment.name,
|
||||||
|
})
|
||||||
|
else:
|
||||||
|
if None not in subdepartments:
|
||||||
|
subdepartments[None] = {
|
||||||
|
'uuid': None,
|
||||||
|
'number': None,
|
||||||
|
'name': "",
|
||||||
|
}
|
||||||
|
subdepartment_dict = subdepartments[None]
|
||||||
|
|
||||||
|
subdept_costs = subdepartment_dict.setdefault('costs', [])
|
||||||
|
product = cost.product
|
||||||
|
subdept_costs.append({
|
||||||
|
'uuid': cost.uuid,
|
||||||
|
'upc': str(product.upc),
|
||||||
|
'upc_pretty': product.upc.pretty() if product.upc else None,
|
||||||
|
'brand_name': product.brand.name if product.brand else None,
|
||||||
|
'description': product.description,
|
||||||
|
'size': product.size,
|
||||||
|
'case_size': cost.case_size,
|
||||||
|
'uom_display': "LB" if product.weighed else "EA",
|
||||||
|
'vendor_item_code': cost.code,
|
||||||
|
'preference': cost.preference,
|
||||||
|
'preferred': cost.preference == 1,
|
||||||
|
'unit_cost': cost.unit_cost,
|
||||||
|
'unit_cost_display': "${:0.2f}".format(cost.unit_cost) if cost.unit_cost is not None else "",
|
||||||
|
# TODO
|
||||||
|
# 'cases_ordered': None,
|
||||||
|
# 'units_ordered': None,
|
||||||
|
# 'po_total': None,
|
||||||
|
# 'po_total_display': None,
|
||||||
|
})
|
||||||
|
|
||||||
|
# sort the (sub)department groupings
|
||||||
|
sorted_departments = []
|
||||||
|
for dept in sorted(departments.values(), key=lambda d: d['name']):
|
||||||
|
dept['subdepartments'] = sorted(dept['subdepartments'].values(),
|
||||||
|
key=lambda s: s['name'])
|
||||||
|
sorted_departments.append(dept)
|
||||||
|
|
||||||
|
# fetch recent purchase history, sort/pad for template convenience
|
||||||
|
history = self.batch_handler.get_order_form_history(batch, costs, 6)
|
||||||
|
for i in range(6 - len(history)):
|
||||||
|
history.append(None)
|
||||||
|
history = list(reversed(history))
|
||||||
|
# must convert some date objects to string, for JSON sake
|
||||||
|
for h in history:
|
||||||
|
if not h:
|
||||||
|
continue
|
||||||
|
purchase = h.get('purchase')
|
||||||
|
if purchase:
|
||||||
|
dt = purchase.get('date_ordered')
|
||||||
|
if dt and isinstance(dt, datetime.date):
|
||||||
|
purchase['date_ordered'] = app.render_date(dt)
|
||||||
|
dt = purchase.get('date_received')
|
||||||
|
if dt and isinstance(dt, datetime.date):
|
||||||
|
purchase['date_received'] = app.render_date(dt)
|
||||||
|
|
||||||
|
return {
|
||||||
|
'batch': self.normalize(batch),
|
||||||
|
'departments': departments,
|
||||||
|
'sorted_departments': sorted_departments,
|
||||||
|
'history': history,
|
||||||
|
}
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._batch_defaults(config)
|
||||||
|
cls._ordering_batch_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _ordering_batch_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
object_url_prefix = cls.get_object_url_prefix()
|
||||||
|
|
||||||
|
# worksheet
|
||||||
|
worksheet = Service(name='{}.worksheet'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/worksheet'.format(object_url_prefix))
|
||||||
|
worksheet.add_view('GET', 'worksheet', klass=cls,
|
||||||
|
permission='{}.worksheet'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(worksheet)
|
||||||
|
|
||||||
|
|
||||||
|
class OrderingBatchRowViews(APIBatchRowView):
|
||||||
|
|
||||||
|
model_class = PurchaseBatchRow
|
||||||
|
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
||||||
|
route_prefix = 'ordering.rows'
|
||||||
|
permission_prefix = 'ordering'
|
||||||
|
collection_url_prefix = '/ordering-batch-rows'
|
||||||
|
object_url_prefix = '/ordering-batch-row'
|
||||||
|
supports_quick_entry = True
|
||||||
|
editable = True
|
||||||
|
|
||||||
|
def normalize(self, row):
|
||||||
|
data = super().normalize(row)
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
batch = row.batch
|
||||||
|
|
||||||
|
data['item_id'] = row.item_id
|
||||||
|
data['upc'] = str(row.upc)
|
||||||
|
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
||||||
|
data['brand_name'] = row.brand_name
|
||||||
|
data['description'] = row.description
|
||||||
|
data['size'] = row.size
|
||||||
|
data['full_description'] = row.product.full_description if row.product else row.description
|
||||||
|
|
||||||
|
# # only provide image url if so configured
|
||||||
|
# if self.rattail_config.getbool('rattail.batch', 'purchase.mobile_images', default=True):
|
||||||
|
# data['image_url'] = pod.get_image_url(self.rattail_config, row.upc) if row.upc else None
|
||||||
|
|
||||||
|
# unit_uom can vary by product
|
||||||
|
data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA'
|
||||||
|
|
||||||
|
data['case_quantity'] = row.case_quantity
|
||||||
|
data['cases_ordered'] = row.cases_ordered
|
||||||
|
data['units_ordered'] = row.units_ordered
|
||||||
|
data['cases_ordered_display'] = app.render_quantity(row.cases_ordered or 0, empty_zero=False)
|
||||||
|
data['units_ordered_display'] = app.render_quantity(row.units_ordered or 0, empty_zero=False)
|
||||||
|
|
||||||
|
data['po_unit_cost'] = row.po_unit_cost
|
||||||
|
data['po_unit_cost_display'] = "${:0.2f}".format(row.po_unit_cost) if row.po_unit_cost is not None else None
|
||||||
|
data['po_total_calculated'] = row.po_total_calculated
|
||||||
|
data['po_total_calculated_display'] = "${:0.2f}".format(row.po_total_calculated) if row.po_total_calculated is not None else None
|
||||||
|
data['status_code'] = row.status_code
|
||||||
|
data['status_display'] = row.STATUS.get(row.status_code, str(row.status_code))
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
def update_object(self, row, data):
|
||||||
|
"""
|
||||||
|
Overrides the default logic as follows:
|
||||||
|
|
||||||
|
So far, we only allow updating the ``cases_ordered`` and/or
|
||||||
|
``units_ordered`` quantities; therefore ``data`` should have one or
|
||||||
|
both of those keys.
|
||||||
|
|
||||||
|
This data is then passed to the
|
||||||
|
:meth:`~rattail:rattail.batch.purchase.PurchaseBatchHandler.update_row_quantity()`
|
||||||
|
method of the batch handler.
|
||||||
|
|
||||||
|
Note that the "normal" logic for this method is not invoked at all.
|
||||||
|
"""
|
||||||
|
if not self.batch_handler.is_mutable(row.batch):
|
||||||
|
return {'error': "Batch is not mutable"}
|
||||||
|
|
||||||
|
try:
|
||||||
|
self.batch_handler.update_row_quantity(row, **data)
|
||||||
|
self.Session.flush()
|
||||||
|
except Exception as error:
|
||||||
|
log.warning("update_row_quantity failed", exc_info=True)
|
||||||
|
if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'):
|
||||||
|
error = str(error.orig)
|
||||||
|
else:
|
||||||
|
error = str(error)
|
||||||
|
return {'error': error}
|
||||||
|
|
||||||
|
return row
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
OrderingBatchViews = kwargs.get('OrderingBatchViews', base['OrderingBatchViews'])
|
||||||
|
OrderingBatchViews.defaults(config)
|
||||||
|
|
||||||
|
OrderingBatchRowViews = kwargs.get('OrderingBatchRowViews', base['OrderingBatchRowViews'])
|
||||||
|
OrderingBatchRowViews.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
492
tailbone/api/batch/receiving.py
Normal file
492
tailbone/api/batch/receiving.py
Normal file
|
@ -0,0 +1,492 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Receiving Batches
|
||||||
|
"""
|
||||||
|
|
||||||
|
import logging
|
||||||
|
|
||||||
|
import humanize
|
||||||
|
import sqlalchemy as sa
|
||||||
|
|
||||||
|
from rattail.db.model import PurchaseBatch, PurchaseBatchRow
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
from deform import widget as dfwidget
|
||||||
|
|
||||||
|
from tailbone import forms
|
||||||
|
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
||||||
|
from tailbone.forms.receiving import ReceiveRow
|
||||||
|
|
||||||
|
|
||||||
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class ReceivingBatchViews(APIBatchView):
|
||||||
|
|
||||||
|
model_class = PurchaseBatch
|
||||||
|
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
||||||
|
route_prefix = 'receivingbatchviews'
|
||||||
|
permission_prefix = 'receiving'
|
||||||
|
collection_url_prefix = '/receiving-batches'
|
||||||
|
object_url_prefix = '/receiving-batch'
|
||||||
|
supports_toggle_complete = True
|
||||||
|
supports_execute = True
|
||||||
|
|
||||||
|
def base_query(self):
|
||||||
|
model = self.app.model
|
||||||
|
query = super().base_query()
|
||||||
|
query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_RECEIVING)
|
||||||
|
return query
|
||||||
|
|
||||||
|
def normalize(self, batch):
|
||||||
|
data = super().normalize(batch)
|
||||||
|
|
||||||
|
data['vendor_uuid'] = batch.vendor.uuid
|
||||||
|
data['vendor_display'] = str(batch.vendor)
|
||||||
|
|
||||||
|
data['department_uuid'] = batch.department_uuid
|
||||||
|
data['department_display'] = str(batch.department) if batch.department else None
|
||||||
|
|
||||||
|
data['po_number'] = batch.po_number
|
||||||
|
data['po_total'] = batch.po_total
|
||||||
|
data['invoice_total'] = batch.invoice_total
|
||||||
|
data['invoice_total_calculated'] = batch.invoice_total_calculated
|
||||||
|
|
||||||
|
data['can_auto_receive'] = self.batch_handler.can_auto_receive(batch)
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
def create_object(self, data):
|
||||||
|
data = dict(data)
|
||||||
|
|
||||||
|
# all about receiving mode here
|
||||||
|
data['mode'] = self.enum.PURCHASE_BATCH_MODE_RECEIVING
|
||||||
|
|
||||||
|
# assume "receive from PO" if given a PO key
|
||||||
|
if data.get('purchase_key'):
|
||||||
|
data['workflow'] = 'from_po'
|
||||||
|
|
||||||
|
return super().create_object(data)
|
||||||
|
|
||||||
|
def auto_receive(self):
|
||||||
|
"""
|
||||||
|
View which handles auto-marking as received, all items within
|
||||||
|
a pending batch.
|
||||||
|
"""
|
||||||
|
batch = self.get_object()
|
||||||
|
self.batch_handler.auto_receive_all_items(batch)
|
||||||
|
return self._get(obj=batch)
|
||||||
|
|
||||||
|
def mark_receiving_complete(self):
|
||||||
|
"""
|
||||||
|
Mark the given batch as "receiving complete".
|
||||||
|
"""
|
||||||
|
batch = self.get_object()
|
||||||
|
|
||||||
|
if batch.executed:
|
||||||
|
return {'error': "Batch {} has already been executed: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
if batch.complete:
|
||||||
|
return {'error': "Batch {} is already marked complete: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
if batch.receiving_complete:
|
||||||
|
return {'error': "Receiving is already complete for batch {}: {}".format(
|
||||||
|
batch.id_str, batch.description)}
|
||||||
|
|
||||||
|
batch.receiving_complete = True
|
||||||
|
return self._get(obj=batch)
|
||||||
|
|
||||||
|
def eligible_purchases(self):
|
||||||
|
model = self.app.model
|
||||||
|
uuid = self.request.params.get('vendor_uuid')
|
||||||
|
vendor = self.Session.get(model.Vendor, uuid) if uuid else None
|
||||||
|
if not vendor:
|
||||||
|
return {'error': "Vendor not found"}
|
||||||
|
|
||||||
|
purchases = self.batch_handler.get_eligible_purchases(
|
||||||
|
vendor, self.enum.PURCHASE_BATCH_MODE_RECEIVING)
|
||||||
|
|
||||||
|
purchases = [self.normalize_eligible_purchase(p)
|
||||||
|
for p in purchases]
|
||||||
|
|
||||||
|
return {'purchases': purchases}
|
||||||
|
|
||||||
|
def normalize_eligible_purchase(self, purchase):
|
||||||
|
return self.batch_handler.normalize_eligible_purchase(purchase)
|
||||||
|
|
||||||
|
def render_eligible_purchase(self, purchase):
|
||||||
|
return self.batch_handler.render_eligible_purchase(purchase)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._batch_defaults(config)
|
||||||
|
cls._receiving_batch_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _receiving_batch_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
collection_url_prefix = cls.get_collection_url_prefix()
|
||||||
|
object_url_prefix = cls.get_object_url_prefix()
|
||||||
|
|
||||||
|
# auto_receive
|
||||||
|
auto_receive = Service(name='{}.auto_receive'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/auto-receive'.format(object_url_prefix))
|
||||||
|
auto_receive.add_view('GET', 'auto_receive', klass=cls,
|
||||||
|
permission='{}.auto_receive'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(auto_receive)
|
||||||
|
|
||||||
|
# mark_receiving_complete
|
||||||
|
mark_receiving_complete = Service(name='{}.mark_receiving_complete'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/mark-receiving-complete'.format(object_url_prefix))
|
||||||
|
mark_receiving_complete.add_view('POST', 'mark_receiving_complete', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(mark_receiving_complete)
|
||||||
|
|
||||||
|
# eligible purchases
|
||||||
|
eligible_purchases = Service(name='{}.eligible_purchases'.format(route_prefix),
|
||||||
|
path='{}/eligible-purchases'.format(collection_url_prefix))
|
||||||
|
eligible_purchases.add_view('GET', 'eligible_purchases', klass=cls,
|
||||||
|
permission='{}.create'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(eligible_purchases)
|
||||||
|
|
||||||
|
|
||||||
|
class ReceivingBatchRowViews(APIBatchRowView):
|
||||||
|
|
||||||
|
model_class = PurchaseBatchRow
|
||||||
|
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
||||||
|
route_prefix = 'receiving.rows'
|
||||||
|
permission_prefix = 'receiving'
|
||||||
|
collection_url_prefix = '/receiving-batch-rows'
|
||||||
|
object_url_prefix = '/receiving-batch-row'
|
||||||
|
supports_quick_entry = True
|
||||||
|
|
||||||
|
def make_filter_spec(self):
|
||||||
|
model = self.app.model
|
||||||
|
filters = super().make_filter_spec()
|
||||||
|
if filters:
|
||||||
|
|
||||||
|
# must translate certain convenience filters
|
||||||
|
orig_filters, filters = filters, []
|
||||||
|
for filtr in orig_filters:
|
||||||
|
|
||||||
|
# # is_received
|
||||||
|
# # NOTE: this is only relevant for truck dump or "from scratch"
|
||||||
|
# if filtr['field'] == 'is_received' and filtr['op'] == 'eq' and filtr['value'] is True:
|
||||||
|
# filters.extend([
|
||||||
|
# {'or': [
|
||||||
|
# {'field': 'cases_received', 'op': '!=', 'value': 0},
|
||||||
|
# {'field': 'units_received', 'op': '!=', 'value': 0},
|
||||||
|
# ]},
|
||||||
|
# ])
|
||||||
|
|
||||||
|
# is_incomplete
|
||||||
|
if filtr['field'] == 'is_incomplete' and filtr['op'] == 'eq' and filtr['value'] is True:
|
||||||
|
# looking for any rows with "ordered" quantity, but where the
|
||||||
|
# status does *not* signify a "settled" row so to speak
|
||||||
|
# TODO: would be nice if we had a simple flag to leverage?
|
||||||
|
filters.extend([
|
||||||
|
{'or': [
|
||||||
|
{'field': 'cases_ordered', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'units_ordered', 'op': '!=', 'value': 0},
|
||||||
|
]},
|
||||||
|
{'field': 'status_code', 'op': 'not_in', 'value': [
|
||||||
|
model.PurchaseBatchRow.STATUS_OK,
|
||||||
|
model.PurchaseBatchRow.STATUS_PRODUCT_NOT_FOUND,
|
||||||
|
model.PurchaseBatchRow.STATUS_CASE_QUANTITY_DIFFERS,
|
||||||
|
]},
|
||||||
|
])
|
||||||
|
|
||||||
|
# is_invalid
|
||||||
|
elif filtr['field'] == 'is_invalid' and filtr['op'] == 'eq' and filtr['value'] is True:
|
||||||
|
filters.extend([
|
||||||
|
{'field': 'status_code', 'op': 'in', 'value': [
|
||||||
|
model.PurchaseBatchRow.STATUS_PRODUCT_NOT_FOUND,
|
||||||
|
model.PurchaseBatchRow.STATUS_COST_NOT_FOUND,
|
||||||
|
model.PurchaseBatchRow.STATUS_CASE_QUANTITY_UNKNOWN,
|
||||||
|
model.PurchaseBatchRow.STATUS_CASE_QUANTITY_DIFFERS,
|
||||||
|
]},
|
||||||
|
])
|
||||||
|
|
||||||
|
# is_unexpected
|
||||||
|
elif filtr['field'] == 'is_unexpected' and filtr['op'] == 'eq' and filtr['value'] is True:
|
||||||
|
# looking for any rows which do *not* have "ordered/shipped" quantity
|
||||||
|
filters.extend([
|
||||||
|
{'and': [
|
||||||
|
{'or': [
|
||||||
|
{'field': 'cases_ordered', 'op': 'is_null'},
|
||||||
|
{'field': 'cases_ordered', 'op': '==', 'value': 0},
|
||||||
|
]},
|
||||||
|
{'or': [
|
||||||
|
{'field': 'units_ordered', 'op': 'is_null'},
|
||||||
|
{'field': 'units_ordered', 'op': '==', 'value': 0},
|
||||||
|
]},
|
||||||
|
{'or': [
|
||||||
|
{'field': 'cases_shipped', 'op': 'is_null'},
|
||||||
|
{'field': 'cases_shipped', 'op': '==', 'value': 0},
|
||||||
|
]},
|
||||||
|
{'or': [
|
||||||
|
{'field': 'units_shipped', 'op': 'is_null'},
|
||||||
|
{'field': 'units_shipped', 'op': '==', 'value': 0},
|
||||||
|
]},
|
||||||
|
{'or': [
|
||||||
|
# but "unexpected" also implies we have some confirmed amount(s)
|
||||||
|
{'field': 'cases_received', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'units_received', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'cases_damaged', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'units_damaged', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'cases_expired', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'units_expired', 'op': '!=', 'value': 0},
|
||||||
|
]},
|
||||||
|
]},
|
||||||
|
])
|
||||||
|
|
||||||
|
# is_damaged
|
||||||
|
elif filtr['field'] == 'is_damaged' and filtr['op'] == 'eq' and filtr['value'] is True:
|
||||||
|
filters.extend([
|
||||||
|
{'or': [
|
||||||
|
{'field': 'cases_damaged', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'units_damaged', 'op': '!=', 'value': 0},
|
||||||
|
]},
|
||||||
|
])
|
||||||
|
|
||||||
|
# is_expired
|
||||||
|
elif filtr['field'] == 'is_expired' and filtr['op'] == 'eq' and filtr['value'] is True:
|
||||||
|
filters.extend([
|
||||||
|
{'or': [
|
||||||
|
{'field': 'cases_expired', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'units_expired', 'op': '!=', 'value': 0},
|
||||||
|
]},
|
||||||
|
])
|
||||||
|
|
||||||
|
# is_missing
|
||||||
|
elif filtr['field'] == 'is_missing' and filtr['op'] == 'eq' and filtr['value'] is True:
|
||||||
|
filters.extend([
|
||||||
|
{'or': [
|
||||||
|
{'field': 'cases_missing', 'op': '!=', 'value': 0},
|
||||||
|
{'field': 'units_missing', 'op': '!=', 'value': 0},
|
||||||
|
]},
|
||||||
|
])
|
||||||
|
|
||||||
|
else: # just some filter, use as-is
|
||||||
|
filters.append(filtr)
|
||||||
|
|
||||||
|
return filters
|
||||||
|
|
||||||
|
def normalize(self, row):
|
||||||
|
data = super().normalize(row)
|
||||||
|
model = self.app.model
|
||||||
|
|
||||||
|
batch = row.batch
|
||||||
|
prodder = self.app.get_products_handler()
|
||||||
|
|
||||||
|
data['product_uuid'] = row.product_uuid
|
||||||
|
data['item_id'] = row.item_id
|
||||||
|
data['upc'] = str(row.upc)
|
||||||
|
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
||||||
|
data['brand_name'] = row.brand_name
|
||||||
|
data['description'] = row.description
|
||||||
|
data['size'] = row.size
|
||||||
|
data['full_description'] = row.product.full_description if row.product else row.description
|
||||||
|
|
||||||
|
# only provide image url if so configured
|
||||||
|
if self.rattail_config.getbool('rattail.batch', 'purchase.mobile_images', default=True):
|
||||||
|
data['image_url'] = prodder.get_image_url(product=row.product, upc=row.upc)
|
||||||
|
|
||||||
|
# unit_uom can vary by product
|
||||||
|
data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA'
|
||||||
|
|
||||||
|
data['case_quantity'] = row.case_quantity
|
||||||
|
data['order_quantities_known'] = batch.order_quantities_known
|
||||||
|
|
||||||
|
data['cases_ordered'] = row.cases_ordered
|
||||||
|
data['units_ordered'] = row.units_ordered
|
||||||
|
|
||||||
|
data['cases_shipped'] = row.cases_shipped
|
||||||
|
data['units_shipped'] = row.units_shipped
|
||||||
|
|
||||||
|
data['cases_received'] = row.cases_received
|
||||||
|
data['units_received'] = row.units_received
|
||||||
|
|
||||||
|
data['cases_damaged'] = row.cases_damaged
|
||||||
|
data['units_damaged'] = row.units_damaged
|
||||||
|
|
||||||
|
data['cases_expired'] = row.cases_expired
|
||||||
|
data['units_expired'] = row.units_expired
|
||||||
|
|
||||||
|
data['cases_missing'] = row.cases_missing
|
||||||
|
data['units_missing'] = row.units_missing
|
||||||
|
|
||||||
|
cases, units = self.batch_handler.get_unconfirmed_counts(row)
|
||||||
|
data['cases_unconfirmed'] = cases
|
||||||
|
data['units_unconfirmed'] = units
|
||||||
|
|
||||||
|
data['po_unit_cost'] = row.po_unit_cost
|
||||||
|
data['po_total'] = row.po_total
|
||||||
|
|
||||||
|
data['invoice_number'] = row.invoice_number
|
||||||
|
data['invoice_unit_cost'] = row.invoice_unit_cost
|
||||||
|
data['invoice_total'] = row.invoice_total
|
||||||
|
data['invoice_total_calculated'] = row.invoice_total_calculated
|
||||||
|
|
||||||
|
data['allow_cases'] = self.batch_handler.allow_cases()
|
||||||
|
|
||||||
|
data['quick_receive'] = self.rattail_config.getbool(
|
||||||
|
'rattail.batch', 'purchase.mobile_quick_receive',
|
||||||
|
default=True)
|
||||||
|
|
||||||
|
if batch.order_quantities_known:
|
||||||
|
data['quick_receive_all'] = self.rattail_config.getbool(
|
||||||
|
'rattail.batch', 'purchase.mobile_quick_receive_all',
|
||||||
|
default=False)
|
||||||
|
|
||||||
|
# TODO: this was copied from regular view receive_row() method; should merge
|
||||||
|
if data['quick_receive'] and data.get('quick_receive_all'):
|
||||||
|
if data['allow_cases']:
|
||||||
|
data['quick_receive_uom'] = 'CS'
|
||||||
|
raise NotImplementedError("TODO: add CS support for quick_receive_all")
|
||||||
|
else:
|
||||||
|
data['quick_receive_uom'] = data['unit_uom']
|
||||||
|
accounted_for = self.batch_handler.get_units_accounted_for(row)
|
||||||
|
remainder = self.batch_handler.get_units_ordered(row) - accounted_for
|
||||||
|
|
||||||
|
if accounted_for:
|
||||||
|
# some product accounted for; button should receive "remainder" only
|
||||||
|
if remainder:
|
||||||
|
remainder = self.app.render_quantity(remainder)
|
||||||
|
data['quick_receive_quantity'] = remainder
|
||||||
|
data['quick_receive_text'] = "Receive Remainder ({} {})".format(
|
||||||
|
remainder, data['unit_uom'])
|
||||||
|
else:
|
||||||
|
# unless there is no remainder, in which case disable it
|
||||||
|
data['quick_receive'] = False
|
||||||
|
|
||||||
|
else: # nothing yet accounted for, button should receive "all"
|
||||||
|
if not remainder:
|
||||||
|
log.warning("quick receive remainder is empty for row %s", row.uuid)
|
||||||
|
remainder = self.app.render_quantity(remainder)
|
||||||
|
data['quick_receive_quantity'] = remainder
|
||||||
|
data['quick_receive_text'] = "Receive ALL ({} {})".format(
|
||||||
|
remainder, data['unit_uom'])
|
||||||
|
|
||||||
|
data['unexpected_alert'] = None
|
||||||
|
if batch.order_quantities_known and not row.cases_ordered and not row.units_ordered:
|
||||||
|
warn = True
|
||||||
|
if batch.is_truck_dump_parent() and row.product:
|
||||||
|
uuids = [child.uuid for child in batch.truck_dump_children]
|
||||||
|
if uuids:
|
||||||
|
count = self.Session.query(model.PurchaseBatchRow)\
|
||||||
|
.filter(model.PurchaseBatchRow.batch_uuid.in_(uuids))\
|
||||||
|
.filter(model.PurchaseBatchRow.product == row.product)\
|
||||||
|
.count()
|
||||||
|
if count:
|
||||||
|
warn = False
|
||||||
|
if warn:
|
||||||
|
data['unexpected_alert'] = "This item was NOT on the original purchase order."
|
||||||
|
|
||||||
|
# TODO: surely the caller of API should determine this flag?
|
||||||
|
# maybe alert user if they've already received some of this product
|
||||||
|
alert_received = self.rattail_config.getbool('tailbone', 'receiving.alert_already_received',
|
||||||
|
default=False)
|
||||||
|
if alert_received:
|
||||||
|
data['received_alert'] = None
|
||||||
|
if self.batch_handler.get_units_confirmed(row):
|
||||||
|
msg = "You have already received some of this product; last update was {}.".format(
|
||||||
|
humanize.naturaltime(self.app.make_utc() - row.modified))
|
||||||
|
data['received_alert'] = msg
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
def receive(self):
|
||||||
|
"""
|
||||||
|
View which handles "receiving" against a particular batch row.
|
||||||
|
"""
|
||||||
|
model = self.app.model
|
||||||
|
|
||||||
|
# first do basic input validation
|
||||||
|
schema = ReceiveRow().bind(session=self.Session())
|
||||||
|
form = forms.Form(schema=schema, request=self.request)
|
||||||
|
# TODO: this seems hacky, but avoids "complex" date value parsing
|
||||||
|
form.set_widget('expiration_date', dfwidget.TextInputWidget())
|
||||||
|
if not form.validate():
|
||||||
|
log.warning("form did not validate: %s",
|
||||||
|
form.make_deform_form().error)
|
||||||
|
return {'error': "Form did not validate"}
|
||||||
|
|
||||||
|
# fetch / validate row object
|
||||||
|
row = self.Session.get(model.PurchaseBatchRow, form.validated['row'])
|
||||||
|
if row is not self.get_object():
|
||||||
|
return {'error': "Specified row does not match the route!"}
|
||||||
|
|
||||||
|
# handler takes care of the row receiving logic for us
|
||||||
|
kwargs = dict(form.validated)
|
||||||
|
del kwargs['row']
|
||||||
|
try:
|
||||||
|
self.batch_handler.receive_row(row, **kwargs)
|
||||||
|
self.Session.flush()
|
||||||
|
except Exception as error:
|
||||||
|
log.warning("receive() failed", exc_info=True)
|
||||||
|
if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'):
|
||||||
|
error = str(error.orig)
|
||||||
|
else:
|
||||||
|
error = str(error)
|
||||||
|
return {'error': error}
|
||||||
|
|
||||||
|
return self._get(obj=row)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._batch_row_defaults(config)
|
||||||
|
cls._receiving_batch_row_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _receiving_batch_row_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
object_url_prefix = cls.get_object_url_prefix()
|
||||||
|
|
||||||
|
# receive (row)
|
||||||
|
receive = Service(name='{}.receive'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/receive'.format(object_url_prefix))
|
||||||
|
receive.add_view('POST', 'receive', klass=cls,
|
||||||
|
permission='{}.edit_row'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(receive)
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
ReceivingBatchViews = kwargs.get('ReceivingBatchViews', base['ReceivingBatchViews'])
|
||||||
|
ReceivingBatchViews.defaults(config)
|
||||||
|
|
||||||
|
ReceivingBatchRowViews = kwargs.get('ReceivingBatchRowViews', base['ReceivingBatchRowViews'])
|
||||||
|
ReceivingBatchRowViews.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
159
tailbone/api/common.py
Normal file
159
tailbone/api/common.py
Normal file
|
@ -0,0 +1,159 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - "Common" Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
from collections import OrderedDict
|
||||||
|
|
||||||
|
from rattail.util import get_pkg_version
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
from cornice.service import get_services
|
||||||
|
from cornice_swagger import CorniceSwagger
|
||||||
|
|
||||||
|
from tailbone import forms
|
||||||
|
from tailbone.forms.common import Feedback
|
||||||
|
from tailbone.api import APIView, api
|
||||||
|
from tailbone.db import Session
|
||||||
|
|
||||||
|
|
||||||
|
class CommonView(APIView):
|
||||||
|
"""
|
||||||
|
Misc. "common" views for the API.
|
||||||
|
|
||||||
|
.. attribute:: feedback_email_key
|
||||||
|
|
||||||
|
This is the email key which will be used when sending "user feedback"
|
||||||
|
email. Default value is ``'user_feedback'``.
|
||||||
|
"""
|
||||||
|
feedback_email_key = 'user_feedback'
|
||||||
|
|
||||||
|
@api
|
||||||
|
def about(self):
|
||||||
|
"""
|
||||||
|
Generic view to show "about project" info page.
|
||||||
|
"""
|
||||||
|
packages = self.get_packages()
|
||||||
|
return {
|
||||||
|
'project_title': self.get_project_title(),
|
||||||
|
'project_version': self.get_project_version(),
|
||||||
|
'packages': packages,
|
||||||
|
'package_names': list(packages),
|
||||||
|
}
|
||||||
|
|
||||||
|
def get_project_title(self):
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
return app.get_title()
|
||||||
|
|
||||||
|
def get_project_version(self):
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
return app.get_version()
|
||||||
|
|
||||||
|
def get_packages(self):
|
||||||
|
"""
|
||||||
|
Should return the full set of packages which should be displayed on the
|
||||||
|
'about' page.
|
||||||
|
"""
|
||||||
|
return OrderedDict([
|
||||||
|
('rattail', get_pkg_version('rattail')),
|
||||||
|
('Tailbone', get_pkg_version('Tailbone')),
|
||||||
|
])
|
||||||
|
|
||||||
|
@api
|
||||||
|
def feedback(self):
|
||||||
|
"""
|
||||||
|
View to handle user feedback form submits.
|
||||||
|
"""
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
model = self.model
|
||||||
|
# TODO: this logic was copied from tailbone.views.common and is largely
|
||||||
|
# identical; perhaps should merge somehow?
|
||||||
|
schema = Feedback().bind(session=Session())
|
||||||
|
form = forms.Form(schema=schema, request=self.request)
|
||||||
|
if form.validate():
|
||||||
|
data = dict(form.validated)
|
||||||
|
|
||||||
|
# figure out who the sending user is, if any
|
||||||
|
if self.request.user:
|
||||||
|
data['user'] = self.request.user
|
||||||
|
elif data['user']:
|
||||||
|
data['user'] = Session.get(model.User, data['user'])
|
||||||
|
|
||||||
|
# TODO: should provide URL to view user
|
||||||
|
if data['user']:
|
||||||
|
data['user_url'] = '#' # TODO: could get from config?
|
||||||
|
|
||||||
|
data['client_ip'] = self.request.client_addr
|
||||||
|
email_key = data['email_key'] or self.feedback_email_key
|
||||||
|
app.send_email(email_key, data=data)
|
||||||
|
return {'ok': True}
|
||||||
|
|
||||||
|
return {'error': "Form did not validate!"}
|
||||||
|
|
||||||
|
def swagger(self):
|
||||||
|
doc = CorniceSwagger(get_services())
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
spec = doc.generate(f"{app.get_node_title()} API docs",
|
||||||
|
app.get_version(),
|
||||||
|
base_path='/api') # TODO
|
||||||
|
return spec
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._common_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _common_defaults(cls, config):
|
||||||
|
rattail_config = config.registry.settings.get('rattail_config')
|
||||||
|
app = rattail_config.get_app()
|
||||||
|
|
||||||
|
# about
|
||||||
|
about = Service(name='about', path='/about')
|
||||||
|
about.add_view('GET', 'about', klass=cls)
|
||||||
|
config.add_cornice_service(about)
|
||||||
|
|
||||||
|
# feedback
|
||||||
|
feedback = Service(name='feedback', path='/feedback')
|
||||||
|
feedback.add_view('POST', 'feedback', klass=cls,
|
||||||
|
permission='common.feedback')
|
||||||
|
config.add_cornice_service(feedback)
|
||||||
|
|
||||||
|
# swagger
|
||||||
|
swagger = Service(name='swagger',
|
||||||
|
path='/swagger.json',
|
||||||
|
description=f"OpenAPI documentation for {app.get_title()}")
|
||||||
|
swagger.add_view('GET', 'swagger', klass=cls,
|
||||||
|
permission='common.api_swagger')
|
||||||
|
config.add_cornice_service(swagger)
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
CommonView = kwargs.get('CommonView', base['CommonView'])
|
||||||
|
CommonView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
125
tailbone/api/core.py
Normal file
125
tailbone/api/core.py
Normal file
|
@ -0,0 +1,125 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Core Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
from tailbone.views import View
|
||||||
|
|
||||||
|
|
||||||
|
def api(view_meth):
|
||||||
|
"""
|
||||||
|
Common decorator for all API views. Ideally this would not be needed..but
|
||||||
|
for now, alas, it is.
|
||||||
|
"""
|
||||||
|
def wrapped(view, *args, **kwargs):
|
||||||
|
|
||||||
|
# TODO: why doesn't this work here...? (instead we have to repeat this
|
||||||
|
# code in lots of other places)
|
||||||
|
# if view.request.method == 'OPTIONS':
|
||||||
|
# return view.request.response
|
||||||
|
|
||||||
|
# invoke the view logic first, since presumably it may involve a
|
||||||
|
# redirect in which case we don't really need to add the CSRF token.
|
||||||
|
# main known use case for this is the /logout endpoint - if that gets
|
||||||
|
# hit then the "current" (old) session will be destroyed, in which case
|
||||||
|
# we can't use the token from that, but instead must generate a new one.
|
||||||
|
result = view_meth(view, *args, **kwargs)
|
||||||
|
|
||||||
|
# explicitly set CSRF token cookie, unless OPTIONS request
|
||||||
|
# TODO: why doesn't pyramid do this for us again?
|
||||||
|
if view.request.method != 'OPTIONS':
|
||||||
|
view.request.response.set_cookie(name='XSRF-TOKEN',
|
||||||
|
value=view.request.session.get_csrf_token())
|
||||||
|
|
||||||
|
return result
|
||||||
|
|
||||||
|
return wrapped
|
||||||
|
|
||||||
|
|
||||||
|
class APIView(View):
|
||||||
|
"""
|
||||||
|
Base class for all API views.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def pretty_datetime(self, dt):
|
||||||
|
if not dt:
|
||||||
|
return ""
|
||||||
|
return dt.strftime('%Y-%m-%d @ %I:%M %p')
|
||||||
|
|
||||||
|
def get_user_info(self, user):
|
||||||
|
"""
|
||||||
|
This method is present on *all* API views, and is meant to provide a
|
||||||
|
single means of obtaining "common" user info, for return to the caller.
|
||||||
|
Such info may be returned in several places, e.g. upon login but also
|
||||||
|
in the "check session" call, or e.g. as part of a broader return value
|
||||||
|
from any other call.
|
||||||
|
|
||||||
|
:returns: Dictionary of user info data, ready for JSON serialization.
|
||||||
|
|
||||||
|
Note that you should *not* (usually) override this method in any view,
|
||||||
|
but instead configure a "supplemental" function which can then add or
|
||||||
|
replace info entries. Config for that looks like e.g.:
|
||||||
|
|
||||||
|
.. code-block:: ini
|
||||||
|
|
||||||
|
[tailbone.api]
|
||||||
|
extra_user_info = poser.web.api.util:extra_user_info
|
||||||
|
|
||||||
|
Note that the above config assumes a simple *function* defined in your
|
||||||
|
``util`` module; such a function would look like e.g.::
|
||||||
|
|
||||||
|
def extra_user_info(request, user, **info):
|
||||||
|
# add favorite color
|
||||||
|
info['favorite_color'] = 'green'
|
||||||
|
# override display name
|
||||||
|
info['display_name'] = "TODO"
|
||||||
|
# remove short_name
|
||||||
|
info.pop('short_name', None)
|
||||||
|
return info
|
||||||
|
"""
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
auth = app.get_auth_handler()
|
||||||
|
|
||||||
|
# basic / default info
|
||||||
|
is_admin = auth.user_is_admin(user)
|
||||||
|
employee = app.get_employee(user)
|
||||||
|
info = {
|
||||||
|
'uuid': user.uuid,
|
||||||
|
'username': user.username,
|
||||||
|
'display_name': user.display_name,
|
||||||
|
'short_name': auth.get_short_display_name(user),
|
||||||
|
'is_admin': is_admin,
|
||||||
|
'is_root': is_admin and self.request.session.get('is_root', False),
|
||||||
|
'employee_uuid': employee.uuid if employee else None,
|
||||||
|
'email_address': app.get_contact_email_address(user),
|
||||||
|
}
|
||||||
|
|
||||||
|
# maybe get/use "extra" info
|
||||||
|
extra = self.rattail_config.get('tailbone.api', 'extra_user_info',
|
||||||
|
usedb=False)
|
||||||
|
if extra:
|
||||||
|
extra = app.load_object(extra)
|
||||||
|
info = extra(self.request, user, **info)
|
||||||
|
|
||||||
|
return info
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,29 +21,40 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Employee Field Renderers
|
Tailbone Web API - Customer Views
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from rattail.db import model
|
||||||
|
|
||||||
import six
|
from tailbone.api import APIMasterView
|
||||||
from webhelpers2.html import tags
|
|
||||||
|
|
||||||
from tailbone.forms.renderers import AutocompleteFieldRenderer
|
|
||||||
|
|
||||||
|
|
||||||
class EmployeeFieldRenderer(AutocompleteFieldRenderer):
|
class CustomerView(APIMasterView):
|
||||||
"""
|
"""
|
||||||
Renderer for :class:`rattail.db.model.Employee` instance fields.
|
API views for Customer data
|
||||||
"""
|
"""
|
||||||
service_route = 'employees.autocomplete'
|
model_class = model.Customer
|
||||||
|
collection_url_prefix = '/customers'
|
||||||
|
object_url_prefix = '/customer'
|
||||||
|
supports_autocomplete = True
|
||||||
|
autocomplete_fieldname = 'name'
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
def normalize(self, customer):
|
||||||
employee = self.raw_value
|
return {
|
||||||
if not employee:
|
'uuid': customer.uuid,
|
||||||
return ''
|
'_str': str(customer),
|
||||||
render_name = kwargs.get('render_name', six.text_type)
|
'id': customer.id,
|
||||||
title = render_name(employee)
|
'number': customer.number,
|
||||||
if kwargs.get('hyperlink') and self.request.has_perm('employees.view'):
|
'name': customer.name,
|
||||||
return tags.link_to(title, self.request.route_url('employees.view', uuid=employee.uuid))
|
}
|
||||||
return title
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
CustomerView = kwargs.get('CustomerView', base['CustomerView'])
|
||||||
|
CustomerView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
36
tailbone/api/essentials.py
Normal file
36
tailbone/api/essentials.py
Normal file
|
@ -0,0 +1,36 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Essential views for convenient includes
|
||||||
|
"""
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
mod = lambda spec: kwargs.get(spec, spec)
|
||||||
|
|
||||||
|
config.include(mod('tailbone.api.auth'))
|
||||||
|
config.include(mod('tailbone.api.common'))
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8; -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,25 +21,31 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Pyramid scaffold templates
|
Tailbone Web API - Label Views
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
from rattail.files import resource_path
|
from rattail.db.model import LabelProfile
|
||||||
from rattail.util import prettify
|
|
||||||
|
|
||||||
from pyramid.scaffolds import PyramidTemplate
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
class RattailTemplate(PyramidTemplate):
|
class LabelProfileView(APIMasterView):
|
||||||
_template_dir = resource_path('rattail:data/project')
|
"""
|
||||||
summary = "Starter project based on Rattail / Tailbone"
|
API views for Label Profile data
|
||||||
|
"""
|
||||||
|
model_class = LabelProfile
|
||||||
|
collection_url_prefix = '/label-profiles'
|
||||||
|
object_url_prefix = '/label-profile'
|
||||||
|
|
||||||
def pre(self, command, output_dir, vars):
|
|
||||||
"""
|
def defaults(config, **kwargs):
|
||||||
Adds some more variables to the template context.
|
base = globals()
|
||||||
"""
|
|
||||||
vars['project_title'] = prettify(vars['project'])
|
LabelProfileView = kwargs.get('LabelProfileView', base['LabelProfileView'])
|
||||||
vars['package_title'] = vars['package'].capitalize()
|
LabelProfileView.defaults(config)
|
||||||
return super(RattailTemplate, self).pre(command, output_dir, vars)
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
618
tailbone/api/master.py
Normal file
618
tailbone/api/master.py
Normal file
|
@ -0,0 +1,618 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Master View
|
||||||
|
"""
|
||||||
|
|
||||||
|
import json
|
||||||
|
|
||||||
|
from rattail.db.util import get_fieldnames
|
||||||
|
|
||||||
|
from cornice import resource, Service
|
||||||
|
|
||||||
|
from tailbone.api import APIView
|
||||||
|
from tailbone.db import Session
|
||||||
|
from tailbone.util import SortColumn
|
||||||
|
|
||||||
|
|
||||||
|
class APIMasterView(APIView):
|
||||||
|
"""
|
||||||
|
Base class for data model REST API views.
|
||||||
|
"""
|
||||||
|
listable = True
|
||||||
|
creatable = True
|
||||||
|
viewable = True
|
||||||
|
editable = True
|
||||||
|
deletable = True
|
||||||
|
supports_autocomplete = False
|
||||||
|
supports_download = False
|
||||||
|
supports_rawbytes = False
|
||||||
|
|
||||||
|
@property
|
||||||
|
def Session(self):
|
||||||
|
return Session
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_model_class(cls):
|
||||||
|
if hasattr(cls, 'model_class'):
|
||||||
|
return cls.model_class
|
||||||
|
raise NotImplementedError("must set `model_class` for {}".format(cls.__name__))
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_normalized_model_name(cls):
|
||||||
|
if hasattr(cls, 'normalized_model_name'):
|
||||||
|
return cls.normalized_model_name
|
||||||
|
return cls.get_model_class().__name__.lower()
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_route_prefix(cls):
|
||||||
|
"""
|
||||||
|
Returns a prefix which (by default) applies to all routes provided by
|
||||||
|
this view class.
|
||||||
|
"""
|
||||||
|
prefix = getattr(cls, 'route_prefix', None)
|
||||||
|
if prefix:
|
||||||
|
return prefix
|
||||||
|
model_name = cls.get_normalized_model_name()
|
||||||
|
return '{}s'.format(model_name)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_permission_prefix(cls):
|
||||||
|
"""
|
||||||
|
Returns a prefix which (by default) applies to all permissions
|
||||||
|
leveraged by this view class.
|
||||||
|
"""
|
||||||
|
prefix = getattr(cls, 'permission_prefix', None)
|
||||||
|
if prefix:
|
||||||
|
return prefix
|
||||||
|
return cls.get_route_prefix()
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_collection_url_prefix(cls):
|
||||||
|
"""
|
||||||
|
Returns a prefix which (by default) applies to all "collection" URLs
|
||||||
|
provided by this view class.
|
||||||
|
"""
|
||||||
|
prefix = getattr(cls, 'collection_url_prefix', None)
|
||||||
|
if prefix:
|
||||||
|
return prefix
|
||||||
|
return '/{}'.format(cls.get_route_prefix())
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_object_url_prefix(cls):
|
||||||
|
"""
|
||||||
|
Returns a prefix which (by default) applies to all "object" URLs
|
||||||
|
provided by this view class.
|
||||||
|
"""
|
||||||
|
prefix = getattr(cls, 'object_url_prefix', None)
|
||||||
|
if prefix:
|
||||||
|
return prefix
|
||||||
|
return '/{}'.format(cls.get_route_prefix())
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_object_key(cls):
|
||||||
|
if hasattr(cls, 'object_key'):
|
||||||
|
return cls.object_key
|
||||||
|
return cls.get_normalized_model_name()
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def get_collection_key(cls):
|
||||||
|
if hasattr(cls, 'collection_key'):
|
||||||
|
return cls.collection_key
|
||||||
|
return '{}s'.format(cls.get_object_key())
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def establish_method(cls, method_name):
|
||||||
|
"""
|
||||||
|
Establish the given HTTP method for this Cornice Resource.
|
||||||
|
|
||||||
|
Cornice will auto-register any class methods for a resource, if they
|
||||||
|
are named according to what it expects (i.e. 'get', 'collection_get'
|
||||||
|
etc.). Tailbone API tries to make things automagical for the sake of
|
||||||
|
e.g. Poser logic, but in this case if we predefine all of these methods
|
||||||
|
and then some subclass view wants to *not* allow one, it's not clear
|
||||||
|
how to "undefine" it per se. Or at least, the more straightforward
|
||||||
|
thing (I think) is to not define such a method in the first place, if
|
||||||
|
it was not wanted.
|
||||||
|
|
||||||
|
Enter ``establish_method()``, which is what finally "defines" each
|
||||||
|
resource method according to what the subclass has declared via its
|
||||||
|
various attributes (:attr:`creatable`, :attr:`deletable` etc.).
|
||||||
|
|
||||||
|
Note that you will not likely have any need to use this
|
||||||
|
``establish_method()`` yourself! But we describe its purpose here, for
|
||||||
|
clarity.
|
||||||
|
"""
|
||||||
|
def method(self):
|
||||||
|
internal_method = getattr(self, '_{}'.format(method_name))
|
||||||
|
return internal_method()
|
||||||
|
|
||||||
|
setattr(cls, method_name, method)
|
||||||
|
|
||||||
|
def make_filter_spec(self):
|
||||||
|
if not self.request.GET.has_key('filters'):
|
||||||
|
return []
|
||||||
|
|
||||||
|
filters = json.loads(self.request.GET.getone('filters'))
|
||||||
|
return filters
|
||||||
|
|
||||||
|
def make_sort_spec(self):
|
||||||
|
|
||||||
|
# we prefer a "native sort"
|
||||||
|
if self.request.GET.has_key('nativeSort'):
|
||||||
|
return json.loads(self.request.GET.getone('nativeSort'))
|
||||||
|
|
||||||
|
# these params are based on 'vuetable-2'
|
||||||
|
# https://www.vuetable.com/guide/sorting.html#initial-sorting-order
|
||||||
|
if 'sort' in self.request.params:
|
||||||
|
sort = self.request.params['sort']
|
||||||
|
sortkey, sortdir = sort.split('|')
|
||||||
|
if sortdir != 'desc':
|
||||||
|
sortdir = 'asc'
|
||||||
|
return [
|
||||||
|
{
|
||||||
|
# 'model': self.model_class.__name__,
|
||||||
|
'field': sortkey,
|
||||||
|
'direction': sortdir,
|
||||||
|
},
|
||||||
|
]
|
||||||
|
|
||||||
|
# these params are based on 'vue-tables-2'
|
||||||
|
# https://github.com/matfish2/vue-tables-2#server-side
|
||||||
|
if 'orderBy' in self.request.params and 'ascending' in self.request.params:
|
||||||
|
sortcol = self.interpret_sortcol(self.request.params['orderBy'])
|
||||||
|
if sortcol:
|
||||||
|
spec = {
|
||||||
|
'field': sortcol.field_name,
|
||||||
|
'direction': 'asc' if self.config.parse_bool(self.request.params['ascending']) else 'desc',
|
||||||
|
}
|
||||||
|
if sortcol.model_name:
|
||||||
|
spec['model'] = sortcol.model_name
|
||||||
|
return [spec]
|
||||||
|
|
||||||
|
def interpret_sortcol(self, order_by):
|
||||||
|
"""
|
||||||
|
This must return a ``SortColumn`` object based on parsing of the given
|
||||||
|
``order_by`` string, which is "raw" as received from the client.
|
||||||
|
|
||||||
|
Please override as necessary, but in all cases you should invoke
|
||||||
|
:meth:`sortcol()` to obtain your return value. Default behavior
|
||||||
|
for this method is to simply do (only) that::
|
||||||
|
|
||||||
|
return self.sortcol(order_by)
|
||||||
|
|
||||||
|
Note that you can also return ``None`` here, if the given ``order_by``
|
||||||
|
string does not represent a valid sort.
|
||||||
|
"""
|
||||||
|
return self.sortcol(order_by)
|
||||||
|
|
||||||
|
def sortcol(self, field_name, model_name=None):
|
||||||
|
"""
|
||||||
|
Return a simple ``SortColumn`` object which denotes the field and
|
||||||
|
optionally, the model, to be used when sorting.
|
||||||
|
"""
|
||||||
|
if not model_name:
|
||||||
|
model_name = self.model_class.__name__
|
||||||
|
return SortColumn(field_name, model_name)
|
||||||
|
|
||||||
|
def join_for_sort_spec(self, query, sort_spec):
|
||||||
|
"""
|
||||||
|
This should apply any joins needed on the given query, to accommodate
|
||||||
|
requested sorting as per ``sort_spec`` - which will be non-empty but
|
||||||
|
otherwise no claims are made regarding its contents.
|
||||||
|
|
||||||
|
Please override as necessary, but in all cases you should return a
|
||||||
|
query, either untouched or else with join(s) applied.
|
||||||
|
"""
|
||||||
|
model_name = sort_spec[0].get('model')
|
||||||
|
return self.join_for_sort_model(query, model_name)
|
||||||
|
|
||||||
|
def join_for_sort_model(self, query, model_name):
|
||||||
|
"""
|
||||||
|
This should apply any joins needed on the given query, to accommodate
|
||||||
|
requested sorting on a field associated with the given model.
|
||||||
|
|
||||||
|
Please override as necessary, but in all cases you should return a
|
||||||
|
query, either untouched or else with join(s) applied.
|
||||||
|
"""
|
||||||
|
return query
|
||||||
|
|
||||||
|
def make_pagination_spec(self):
|
||||||
|
|
||||||
|
# these params are based on 'vuetable-2'
|
||||||
|
# https://github.com/ratiw/vuetable-2-tutorial/wiki/prerequisite#sample-api-endpoint
|
||||||
|
if 'page' in self.request.params and 'per_page' in self.request.params:
|
||||||
|
page = self.request.params['page']
|
||||||
|
per_page = self.request.params['per_page']
|
||||||
|
if page.isdigit() and per_page.isdigit():
|
||||||
|
return int(page), int(per_page)
|
||||||
|
|
||||||
|
# these params are based on 'vue-tables-2'
|
||||||
|
# https://github.com/matfish2/vue-tables-2#server-side
|
||||||
|
if 'page' in self.request.params and 'limit' in self.request.params:
|
||||||
|
page = self.request.params['page']
|
||||||
|
limit = self.request.params['limit']
|
||||||
|
if page.isdigit() and limit.isdigit():
|
||||||
|
return int(page), int(limit)
|
||||||
|
|
||||||
|
def base_query(self):
|
||||||
|
cls = self.get_model_class()
|
||||||
|
query = self.Session.query(cls)
|
||||||
|
return query
|
||||||
|
|
||||||
|
def get_fieldnames(self):
|
||||||
|
if not hasattr(self, '_fieldnames'):
|
||||||
|
self._fieldnames = get_fieldnames(
|
||||||
|
self.rattail_config, self.model_class,
|
||||||
|
columns=True, proxies=True, relations=False)
|
||||||
|
return self._fieldnames
|
||||||
|
|
||||||
|
def normalize(self, obj):
|
||||||
|
data = {'_str': str(obj)}
|
||||||
|
|
||||||
|
for field in self.get_fieldnames():
|
||||||
|
data[field] = getattr(obj, field)
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
def _collection_get(self):
|
||||||
|
from sa_filters import apply_filters, apply_sort, apply_pagination
|
||||||
|
|
||||||
|
query = self.base_query()
|
||||||
|
context = {}
|
||||||
|
|
||||||
|
# maybe filter query
|
||||||
|
filter_spec = self.make_filter_spec()
|
||||||
|
if filter_spec:
|
||||||
|
query = apply_filters(query, filter_spec)
|
||||||
|
|
||||||
|
# maybe sort query
|
||||||
|
sort_spec = self.make_sort_spec()
|
||||||
|
if sort_spec:
|
||||||
|
query = self.join_for_sort_spec(query, sort_spec)
|
||||||
|
query = apply_sort(query, sort_spec)
|
||||||
|
|
||||||
|
# maybe paginate query
|
||||||
|
pagination_spec = self.make_pagination_spec()
|
||||||
|
if pagination_spec:
|
||||||
|
number, size = pagination_spec
|
||||||
|
query, pagination = apply_pagination(query, page_number=number, page_size=size)
|
||||||
|
|
||||||
|
# these properties are based on 'vuetable-2'
|
||||||
|
# https://www.vuetable.com/guide/pagination.html#how-the-pagination-component-works
|
||||||
|
context['total'] = pagination.total_results
|
||||||
|
context['per_page'] = pagination.page_size
|
||||||
|
context['current_page'] = pagination.page_number
|
||||||
|
context['last_page'] = pagination.num_pages
|
||||||
|
context['from'] = pagination.page_size * (pagination.page_number - 1) + 1
|
||||||
|
to = pagination.page_size * (pagination.page_number - 1) + pagination.page_size
|
||||||
|
if to > pagination.total_results:
|
||||||
|
context['to'] = pagination.total_results
|
||||||
|
else:
|
||||||
|
context['to'] = to
|
||||||
|
|
||||||
|
# these properties are based on 'vue-tables-2'
|
||||||
|
# https://github.com/matfish2/vue-tables-2#server-side
|
||||||
|
context['count'] = pagination.total_results
|
||||||
|
|
||||||
|
objects = [self.normalize(obj) for obj in query]
|
||||||
|
|
||||||
|
# TODO: test this for ratbob!
|
||||||
|
context[self.get_collection_key()] = objects
|
||||||
|
|
||||||
|
# these properties are based on 'vue-tables-2'
|
||||||
|
# https://github.com/matfish2/vue-tables-2#server-side
|
||||||
|
context['data'] = objects
|
||||||
|
if 'count' not in context:
|
||||||
|
context['count'] = len(objects)
|
||||||
|
|
||||||
|
return context
|
||||||
|
|
||||||
|
def get_object(self, uuid=None):
|
||||||
|
if not uuid:
|
||||||
|
uuid = self.request.matchdict['uuid']
|
||||||
|
|
||||||
|
obj = self.Session.get(self.get_model_class(), uuid)
|
||||||
|
if obj:
|
||||||
|
return obj
|
||||||
|
|
||||||
|
raise self.notfound()
|
||||||
|
|
||||||
|
def _get(self, obj=None, uuid=None):
|
||||||
|
if not obj:
|
||||||
|
obj = self.get_object(uuid=uuid)
|
||||||
|
key = self.get_object_key()
|
||||||
|
normal = self.normalize(obj)
|
||||||
|
return {key: normal, 'data': normal}
|
||||||
|
|
||||||
|
def _collection_post(self):
|
||||||
|
"""
|
||||||
|
Default method for actually processing a POST request for the
|
||||||
|
collection, aka. "create new object".
|
||||||
|
"""
|
||||||
|
# assume our data comes only from request JSON body
|
||||||
|
data = self.request.json_body
|
||||||
|
|
||||||
|
# add instance to session, and return data for it
|
||||||
|
try:
|
||||||
|
obj = self.create_object(data)
|
||||||
|
except Exception as error:
|
||||||
|
return self.json_response({'error': str(error)})
|
||||||
|
else:
|
||||||
|
self.Session.flush()
|
||||||
|
return self._get(obj)
|
||||||
|
|
||||||
|
def create_object(self, data):
|
||||||
|
"""
|
||||||
|
Create a new object instance and populate it with the given data.
|
||||||
|
|
||||||
|
Note that this method by default will only populate *simple* fields, so
|
||||||
|
you may need to subclass and override to add more complex field logic.
|
||||||
|
"""
|
||||||
|
# create new instance of model class
|
||||||
|
cls = self.get_model_class()
|
||||||
|
obj = cls()
|
||||||
|
|
||||||
|
# "update" new object with given data
|
||||||
|
obj = self.update_object(obj, data)
|
||||||
|
|
||||||
|
# that's all we can do here, subclass must override if more needed
|
||||||
|
self.Session.add(obj)
|
||||||
|
return obj
|
||||||
|
|
||||||
|
def _post(self, uuid=None):
|
||||||
|
"""
|
||||||
|
Default method for actually processing a POST request for an object,
|
||||||
|
aka. "update existing object".
|
||||||
|
"""
|
||||||
|
if not uuid:
|
||||||
|
uuid = self.request.matchdict['uuid']
|
||||||
|
obj = self.Session.get(self.get_model_class(), uuid)
|
||||||
|
if not obj:
|
||||||
|
raise self.notfound()
|
||||||
|
|
||||||
|
# assume our data comes only from request JSON body
|
||||||
|
data = self.request.json_body
|
||||||
|
|
||||||
|
# try to update data for object, returning error as necessary
|
||||||
|
obj = self.update_object(obj, data)
|
||||||
|
if isinstance(obj, dict) and 'error' in obj:
|
||||||
|
return {'error': obj['error']}
|
||||||
|
|
||||||
|
# return data for object
|
||||||
|
self.Session.flush()
|
||||||
|
return self._get(obj)
|
||||||
|
|
||||||
|
def update_object(self, obj, data):
|
||||||
|
"""
|
||||||
|
Update the given object instance with the given data.
|
||||||
|
|
||||||
|
Note that this method by default will only update *simple* fields, so
|
||||||
|
you may need to subclass and override to add more complex field logic.
|
||||||
|
"""
|
||||||
|
# set values for simple fields only
|
||||||
|
for key, value in data.items():
|
||||||
|
if hasattr(obj, key):
|
||||||
|
# TODO: what about datetime, decimal etc.?
|
||||||
|
setattr(obj, key, value)
|
||||||
|
|
||||||
|
# that's all we can do here, subclass must override if more needed
|
||||||
|
return obj
|
||||||
|
|
||||||
|
##############################
|
||||||
|
# delete
|
||||||
|
##############################
|
||||||
|
|
||||||
|
def _delete(self):
|
||||||
|
"""
|
||||||
|
View to handle DELETE action for an existing record/object.
|
||||||
|
"""
|
||||||
|
obj = self.get_object()
|
||||||
|
self.delete_object(obj)
|
||||||
|
|
||||||
|
def delete_object(self, obj):
|
||||||
|
"""
|
||||||
|
Delete the object, or mark it as deleted, or whatever you need to do.
|
||||||
|
"""
|
||||||
|
# flush immediately to force any pending integrity errors etc.
|
||||||
|
self.Session.delete(obj)
|
||||||
|
self.Session.flush()
|
||||||
|
|
||||||
|
##############################
|
||||||
|
# download
|
||||||
|
##############################
|
||||||
|
|
||||||
|
def download(self):
|
||||||
|
"""
|
||||||
|
GET view allowing for download of a single file, which is attached to a
|
||||||
|
given record.
|
||||||
|
"""
|
||||||
|
obj = self.get_object()
|
||||||
|
|
||||||
|
filename = self.request.GET.get('filename', None)
|
||||||
|
if not filename:
|
||||||
|
raise self.notfound()
|
||||||
|
path = self.download_path(obj, filename)
|
||||||
|
|
||||||
|
response = self.file_response(path)
|
||||||
|
return response
|
||||||
|
|
||||||
|
def download_path(self, obj, filename):
|
||||||
|
"""
|
||||||
|
Should return absolute path on disk, for the given object and filename.
|
||||||
|
Result will be used to return a file response to client.
|
||||||
|
"""
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
def rawbytes(self):
|
||||||
|
"""
|
||||||
|
GET view allowing for direct access to the raw bytes of a file, which
|
||||||
|
is attached to a given record. Basically the same as 'download' except
|
||||||
|
this does not come as an attachment.
|
||||||
|
"""
|
||||||
|
obj = self.get_object()
|
||||||
|
|
||||||
|
# TODO: is this really needed?
|
||||||
|
# filename = self.request.GET.get('filename', None)
|
||||||
|
# if filename:
|
||||||
|
# path = self.download_path(obj, filename)
|
||||||
|
# return self.file_response(path, attachment=False)
|
||||||
|
|
||||||
|
return self.rawbytes_response(obj)
|
||||||
|
|
||||||
|
def rawbytes_response(self, obj):
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
|
##############################
|
||||||
|
# autocomplete
|
||||||
|
##############################
|
||||||
|
|
||||||
|
def autocomplete(self):
|
||||||
|
"""
|
||||||
|
View which accepts a single ``term`` param, and returns a list of
|
||||||
|
autocomplete results to match.
|
||||||
|
"""
|
||||||
|
term = self.request.params.get('term', '').strip()
|
||||||
|
term = self.prepare_autocomplete_term(term)
|
||||||
|
if not term:
|
||||||
|
return []
|
||||||
|
|
||||||
|
results = self.get_autocomplete_data(term)
|
||||||
|
return [{'label': self.autocomplete_display(x),
|
||||||
|
'value': self.autocomplete_value(x)}
|
||||||
|
for x in results]
|
||||||
|
|
||||||
|
@property
|
||||||
|
def autocomplete_fieldname(self):
|
||||||
|
raise NotImplementedError("You must define `autocomplete_fieldname` "
|
||||||
|
"attribute for API view class: {}".format(
|
||||||
|
self.__class__))
|
||||||
|
|
||||||
|
def autocomplete_display(self, obj):
|
||||||
|
return getattr(obj, self.autocomplete_fieldname)
|
||||||
|
|
||||||
|
def autocomplete_value(self, obj):
|
||||||
|
return obj.uuid
|
||||||
|
|
||||||
|
def get_autocomplete_data(self, term):
|
||||||
|
query = self.make_autocomplete_query(term)
|
||||||
|
return query.all()
|
||||||
|
|
||||||
|
def make_autocomplete_query(self, term):
|
||||||
|
model_class = self.get_model_class()
|
||||||
|
query = self.Session.query(model_class)
|
||||||
|
query = self.filter_autocomplete_query(query)
|
||||||
|
|
||||||
|
field = getattr(model_class, self.autocomplete_fieldname)
|
||||||
|
query = query.filter(field.ilike('%%%s%%' % term))\
|
||||||
|
.order_by(field)
|
||||||
|
|
||||||
|
return query
|
||||||
|
|
||||||
|
def filter_autocomplete_query(self, query):
|
||||||
|
return query
|
||||||
|
|
||||||
|
def prepare_autocomplete_term(self, term):
|
||||||
|
"""
|
||||||
|
If necessary, massage the incoming search term for use with the
|
||||||
|
autocomplete query.
|
||||||
|
"""
|
||||||
|
return term
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
collection_url_prefix = cls.get_collection_url_prefix()
|
||||||
|
object_url_prefix = cls.get_object_url_prefix()
|
||||||
|
|
||||||
|
# first, the primary resource API
|
||||||
|
|
||||||
|
# list/search
|
||||||
|
if cls.listable:
|
||||||
|
cls.establish_method('collection_get')
|
||||||
|
resource.add_view(cls.collection_get, permission='{}.list'.format(permission_prefix))
|
||||||
|
|
||||||
|
# create
|
||||||
|
if cls.creatable:
|
||||||
|
cls.establish_method('collection_post')
|
||||||
|
if hasattr(cls, 'permission_to_create'):
|
||||||
|
permission = cls.permission_to_create
|
||||||
|
else:
|
||||||
|
permission = '{}.create'.format(permission_prefix)
|
||||||
|
resource.add_view(cls.collection_post, permission=permission)
|
||||||
|
|
||||||
|
# view
|
||||||
|
if cls.viewable:
|
||||||
|
cls.establish_method('get')
|
||||||
|
resource.add_view(cls.get, permission='{}.view'.format(permission_prefix))
|
||||||
|
|
||||||
|
# edit
|
||||||
|
if cls.editable:
|
||||||
|
cls.establish_method('post')
|
||||||
|
resource.add_view(cls.post, permission='{}.edit'.format(permission_prefix))
|
||||||
|
|
||||||
|
# delete
|
||||||
|
if cls.deletable:
|
||||||
|
cls.establish_method('delete')
|
||||||
|
resource.add_view(cls.delete, permission='{}.delete'.format(permission_prefix))
|
||||||
|
|
||||||
|
# register primary resource API via cornice
|
||||||
|
object_resource = resource.add_resource(
|
||||||
|
cls,
|
||||||
|
collection_path=collection_url_prefix,
|
||||||
|
# TODO: probably should allow for other (composite?) key fields
|
||||||
|
path='{}/{{uuid}}'.format(object_url_prefix))
|
||||||
|
config.add_cornice_resource(object_resource)
|
||||||
|
|
||||||
|
# now for some more "custom" things, which are still somewhat generic
|
||||||
|
|
||||||
|
# autocomplete
|
||||||
|
if cls.supports_autocomplete:
|
||||||
|
autocomplete = Service(name='{}.autocomplete'.format(route_prefix),
|
||||||
|
path='{}/autocomplete'.format(collection_url_prefix))
|
||||||
|
autocomplete.add_view('GET', 'autocomplete', klass=cls,
|
||||||
|
permission='{}.list'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(autocomplete)
|
||||||
|
|
||||||
|
# download
|
||||||
|
if cls.supports_download:
|
||||||
|
download = Service(name='{}.download'.format(route_prefix),
|
||||||
|
# TODO: probably should allow for other (composite?) key fields
|
||||||
|
path='{}/{{uuid}}/download'.format(object_url_prefix))
|
||||||
|
download.add_view('GET', 'download', klass=cls,
|
||||||
|
permission='{}.download'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(download)
|
||||||
|
|
||||||
|
# rawbytes
|
||||||
|
if cls.supports_rawbytes:
|
||||||
|
rawbytes = Service(name='{}.rawbytes'.format(route_prefix),
|
||||||
|
# TODO: probably should allow for other (composite?) key fields
|
||||||
|
path='{}/{{uuid}}/rawbytes'.format(object_url_prefix))
|
||||||
|
rawbytes.add_view('GET', 'rawbytes', klass=cls,
|
||||||
|
permission='{}.download'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(rawbytes)
|
43
tailbone/api/master2.py
Normal file
43
tailbone/api/master2.py
Normal file
|
@ -0,0 +1,43 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2022 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Master View (v2)
|
||||||
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
|
class APIMasterView2(APIMasterView):
|
||||||
|
"""
|
||||||
|
Base class for data model REST API views.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, request, context=None):
|
||||||
|
warnings.warn("APIMasterView2 class is deprecated; please use "
|
||||||
|
"APIMasterView instead",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
super(APIMasterView2, self).__init__(request, context=context)
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,29 +21,39 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Store Field Renderers
|
Tailbone Web API - Person Views
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from rattail.db import model
|
||||||
|
|
||||||
from formalchemy.fields import SelectFieldRenderer
|
from tailbone.api import APIMasterView
|
||||||
from webhelpers2.html import tags
|
|
||||||
|
|
||||||
|
|
||||||
class StoreFieldRenderer(SelectFieldRenderer):
|
class PersonView(APIMasterView):
|
||||||
"""
|
"""
|
||||||
Renderer for :class:`rattail.db.model.Store` instance fields.
|
API views for Person data
|
||||||
"""
|
"""
|
||||||
|
model_class = model.Person
|
||||||
|
permission_prefix = 'people'
|
||||||
|
collection_url_prefix = '/people'
|
||||||
|
object_url_prefix = '/person'
|
||||||
|
|
||||||
def render(self, **kwargs):
|
def normalize(self, person):
|
||||||
kwargs.setdefault('auto-enhance', 'true')
|
return {
|
||||||
return super(StoreFieldRenderer, self).render(**kwargs)
|
'uuid': person.uuid,
|
||||||
|
'_str': str(person),
|
||||||
|
'first_name': person.first_name,
|
||||||
|
'last_name': person.last_name,
|
||||||
|
'display_name': person.display_name,
|
||||||
|
}
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
store = self.raw_value
|
def defaults(config, **kwargs):
|
||||||
if not store:
|
base = globals()
|
||||||
return ""
|
|
||||||
text = "({}) {}".format(store.id, store.name)
|
PersonView = kwargs.get('PersonView', base['PersonView'])
|
||||||
if kwargs.get('hyperlink', True):
|
PersonView.defaults(config)
|
||||||
return tags.link_to(text, self.request.route_url('stores.view', uuid=store.uuid))
|
|
||||||
return text
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
220
tailbone/api/products.py
Normal file
220
tailbone/api/products.py
Normal file
|
@ -0,0 +1,220 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Product Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
import logging
|
||||||
|
|
||||||
|
import sqlalchemy as sa
|
||||||
|
from sqlalchemy import orm
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
|
||||||
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class ProductView(APIMasterView):
|
||||||
|
"""
|
||||||
|
API views for Product data
|
||||||
|
"""
|
||||||
|
model_class = model.Product
|
||||||
|
collection_url_prefix = '/products'
|
||||||
|
object_url_prefix = '/product'
|
||||||
|
supports_autocomplete = True
|
||||||
|
|
||||||
|
def __init__(self, request, context=None):
|
||||||
|
super(ProductView, self).__init__(request, context=context)
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
self.products_handler = app.get_products_handler()
|
||||||
|
|
||||||
|
def normalize(self, product):
|
||||||
|
|
||||||
|
# get what we can from handler
|
||||||
|
data = self.products_handler.normalize_product(product, fields=[
|
||||||
|
'brand_name',
|
||||||
|
'full_description',
|
||||||
|
'department_name',
|
||||||
|
'unit_price_display',
|
||||||
|
'sale_price',
|
||||||
|
'sale_price_display',
|
||||||
|
'sale_ends',
|
||||||
|
'sale_ends_display',
|
||||||
|
'tpr_price',
|
||||||
|
'tpr_price_display',
|
||||||
|
'tpr_ends',
|
||||||
|
'tpr_ends_display',
|
||||||
|
'current_price',
|
||||||
|
'current_price_display',
|
||||||
|
'current_ends',
|
||||||
|
'current_ends_display',
|
||||||
|
'vendor_name',
|
||||||
|
'costs',
|
||||||
|
'image_url',
|
||||||
|
])
|
||||||
|
|
||||||
|
# but must supplement
|
||||||
|
cost = product.cost
|
||||||
|
data.update({
|
||||||
|
'upc': str(product.upc),
|
||||||
|
'scancode': product.scancode,
|
||||||
|
'item_id': product.item_id,
|
||||||
|
'item_type': product.item_type,
|
||||||
|
'status_code': product.status_code,
|
||||||
|
'default_unit_cost': cost.unit_cost if cost else None,
|
||||||
|
'default_unit_cost_display': "${:0.2f}".format(cost.unit_cost) if cost and cost.unit_cost is not None else None,
|
||||||
|
})
|
||||||
|
|
||||||
|
return data
|
||||||
|
|
||||||
|
def make_autocomplete_query(self, term):
|
||||||
|
query = self.Session.query(model.Product)\
|
||||||
|
.outerjoin(model.Brand)\
|
||||||
|
.filter(sa.or_(
|
||||||
|
model.Brand.name.ilike('%{}%'.format(term)),
|
||||||
|
model.Product.description.ilike('%{}%'.format(term))))
|
||||||
|
|
||||||
|
if not self.request.has_perm('products.view_deleted'):
|
||||||
|
query = query.filter(model.Product.deleted == False)
|
||||||
|
|
||||||
|
query = query.order_by(model.Brand.name,
|
||||||
|
model.Product.description)\
|
||||||
|
.options(orm.joinedload(model.Product.brand))
|
||||||
|
return query
|
||||||
|
|
||||||
|
def autocomplete_display(self, product):
|
||||||
|
return product.full_description
|
||||||
|
|
||||||
|
def quick_lookup(self):
|
||||||
|
"""
|
||||||
|
View for handling "quick lookup" user input, for index page.
|
||||||
|
"""
|
||||||
|
data = self.request.GET
|
||||||
|
entry = data['entry']
|
||||||
|
|
||||||
|
product = self.products_handler.locate_product_for_entry(self.Session(),
|
||||||
|
entry)
|
||||||
|
if not product:
|
||||||
|
return {'error': "Product not found"}
|
||||||
|
|
||||||
|
return {'ok': True,
|
||||||
|
'product': self.normalize(product)}
|
||||||
|
|
||||||
|
def label_profiles(self):
|
||||||
|
"""
|
||||||
|
Returns the set of label profiles available for use with
|
||||||
|
printing label for product.
|
||||||
|
"""
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
label_handler = app.get_label_handler()
|
||||||
|
model = self.model
|
||||||
|
|
||||||
|
profiles = []
|
||||||
|
for profile in label_handler.get_label_profiles(self.Session()):
|
||||||
|
profiles.append({
|
||||||
|
'uuid': profile.uuid,
|
||||||
|
'description': profile.description,
|
||||||
|
})
|
||||||
|
|
||||||
|
return {'label_profiles': profiles}
|
||||||
|
|
||||||
|
def print_labels(self):
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
label_handler = app.get_label_handler()
|
||||||
|
model = self.model
|
||||||
|
data = self.request.json_body
|
||||||
|
|
||||||
|
uuid = data.get('label_profile_uuid')
|
||||||
|
profile = self.Session.get(model.LabelProfile, uuid) if uuid else None
|
||||||
|
if not profile:
|
||||||
|
return {'error': "Label profile not found"}
|
||||||
|
|
||||||
|
uuid = data.get('product_uuid')
|
||||||
|
product = self.Session.get(model.Product, uuid) if uuid else None
|
||||||
|
if not product:
|
||||||
|
return {'error': "Product not found"}
|
||||||
|
|
||||||
|
try:
|
||||||
|
quantity = int(data.get('quantity'))
|
||||||
|
except:
|
||||||
|
return {'error': "Quantity must be integer"}
|
||||||
|
|
||||||
|
printer = label_handler.get_printer(profile)
|
||||||
|
if not printer:
|
||||||
|
return {'error': "Couldn't get printer from label profile"}
|
||||||
|
|
||||||
|
try:
|
||||||
|
printer.print_labels([({'product': product}, quantity)])
|
||||||
|
except Exception as error:
|
||||||
|
log.warning("error occurred while printing labels", exc_info=True)
|
||||||
|
return {'error': str(error)}
|
||||||
|
|
||||||
|
return {'ok': True}
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._product_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _product_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
collection_url_prefix = cls.get_collection_url_prefix()
|
||||||
|
|
||||||
|
# quick lookup
|
||||||
|
quick_lookup = Service(name='{}.quick_lookup'.format(route_prefix),
|
||||||
|
path='{}/quick-lookup'.format(collection_url_prefix))
|
||||||
|
quick_lookup.add_view('GET', 'quick_lookup', klass=cls,
|
||||||
|
permission='{}.list'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(quick_lookup)
|
||||||
|
|
||||||
|
# label profiles
|
||||||
|
label_profiles = Service(name=f'{route_prefix}.label_profiles',
|
||||||
|
path=f'{collection_url_prefix}/label-profiles')
|
||||||
|
label_profiles.add_view('GET', 'label_profiles', klass=cls,
|
||||||
|
permission=f'{permission_prefix}.print_labels')
|
||||||
|
config.add_cornice_service(label_profiles)
|
||||||
|
|
||||||
|
# print labels
|
||||||
|
print_labels = Service(name='{}.print_labels'.format(route_prefix),
|
||||||
|
path='{}/print-labels'.format(collection_url_prefix))
|
||||||
|
print_labels.add_view('POST', 'print_labels', klass=cls,
|
||||||
|
permission='{}.print_labels'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(print_labels)
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
ProductView = kwargs.get('ProductView', base['ProductView'])
|
||||||
|
ProductView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
64
tailbone/api/upgrades.py
Normal file
64
tailbone/api/upgrades.py
Normal file
|
@ -0,0 +1,64 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Upgrade Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
|
||||||
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
|
class UpgradeView(APIMasterView):
|
||||||
|
"""
|
||||||
|
REST API views for Upgrade model.
|
||||||
|
"""
|
||||||
|
model_class = model.Upgrade
|
||||||
|
collection_url_prefix = '/upgrades'
|
||||||
|
object_url_prefix = '/upgrades'
|
||||||
|
|
||||||
|
def normalize(self, upgrade):
|
||||||
|
data = {
|
||||||
|
'created': upgrade.created.isoformat(),
|
||||||
|
'description': upgrade.description,
|
||||||
|
'enabled': upgrade.enabled,
|
||||||
|
'executed': upgrade.executed.isoformat() if upgrade.executed else None,
|
||||||
|
# 'executed_by':
|
||||||
|
}
|
||||||
|
if upgrade.status_code is None:
|
||||||
|
data['status_code'] = None
|
||||||
|
else:
|
||||||
|
data['status_code'] = self.enum.UPGRADE_STATUS.get(upgrade.status_code,
|
||||||
|
str(upgrade.status_code))
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
UpgradeView = kwargs.get('UpgradeView', base['UpgradeView'])
|
||||||
|
UpgradeView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
71
tailbone/api/users.py
Normal file
71
tailbone/api/users.py
Normal file
|
@ -0,0 +1,71 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - User Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
|
||||||
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
|
class UserView(APIMasterView):
|
||||||
|
"""
|
||||||
|
API views for User data
|
||||||
|
"""
|
||||||
|
model_class = model.User
|
||||||
|
collection_url_prefix = '/users'
|
||||||
|
object_url_prefix = '/user'
|
||||||
|
|
||||||
|
def normalize(self, user):
|
||||||
|
return {
|
||||||
|
'uuid': user.uuid,
|
||||||
|
'username': user.username,
|
||||||
|
'person_display_name': (user.person.display_name or '') if user.person else '',
|
||||||
|
'active': user.active,
|
||||||
|
}
|
||||||
|
|
||||||
|
def interpret_sortcol(self, order_by):
|
||||||
|
if order_by == 'person_display_name':
|
||||||
|
return self.sortcol('Person', 'display_name')
|
||||||
|
return self.sortcol(order_by)
|
||||||
|
|
||||||
|
def join_for_sort_model(self, query, model_name):
|
||||||
|
if model_name == 'Person':
|
||||||
|
query = query.outerjoin(model.Person)
|
||||||
|
return query
|
||||||
|
|
||||||
|
def update_object(self, user, data):
|
||||||
|
# TODO: should ensure prevent_password_change is respected
|
||||||
|
return super(UserView, self).update_object(user, data)
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
UserView = kwargs.get('UserView', base['UserView'])
|
||||||
|
UserView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
57
tailbone/api/vendors.py
Normal file
57
tailbone/api/vendors.py
Normal file
|
@ -0,0 +1,57 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Vendor Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
|
||||||
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
|
class VendorView(APIMasterView):
|
||||||
|
|
||||||
|
model_class = model.Vendor
|
||||||
|
collection_url_prefix = '/vendors'
|
||||||
|
object_url_prefix = '/vendor'
|
||||||
|
supports_autocomplete = True
|
||||||
|
autocomplete_fieldname = 'name'
|
||||||
|
|
||||||
|
def normalize(self, vendor):
|
||||||
|
return {
|
||||||
|
'uuid': vendor.uuid,
|
||||||
|
'_str': str(vendor),
|
||||||
|
'id': vendor.id,
|
||||||
|
'name': vendor.name,
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
VendorView = kwargs.get('VendorView', base['VendorView'])
|
||||||
|
VendorView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
234
tailbone/api/workorders.py
Normal file
234
tailbone/api/workorders.py
Normal file
|
@ -0,0 +1,234 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Web API - Work Order Views
|
||||||
|
"""
|
||||||
|
|
||||||
|
import datetime
|
||||||
|
|
||||||
|
from rattail.db.model import WorkOrder
|
||||||
|
|
||||||
|
from cornice import Service
|
||||||
|
|
||||||
|
from tailbone.api import APIMasterView
|
||||||
|
|
||||||
|
|
||||||
|
class WorkOrderView(APIMasterView):
|
||||||
|
|
||||||
|
model_class = WorkOrder
|
||||||
|
collection_url_prefix = '/workorders'
|
||||||
|
object_url_prefix = '/workorder'
|
||||||
|
|
||||||
|
def __init__(self, *args, **kwargs):
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
app = self.get_rattail_app()
|
||||||
|
self.workorder_handler = app.get_workorder_handler()
|
||||||
|
|
||||||
|
def normalize(self, workorder):
|
||||||
|
data = super().normalize(workorder)
|
||||||
|
data.update({
|
||||||
|
'customer_name': workorder.customer.name,
|
||||||
|
'status_label': self.enum.WORKORDER_STATUS[workorder.status_code],
|
||||||
|
'date_submitted': str(workorder.date_submitted or ''),
|
||||||
|
'date_received': str(workorder.date_received or ''),
|
||||||
|
'date_released': str(workorder.date_released or ''),
|
||||||
|
'date_delivered': str(workorder.date_delivered or ''),
|
||||||
|
})
|
||||||
|
return data
|
||||||
|
|
||||||
|
def create_object(self, data):
|
||||||
|
|
||||||
|
# invoke the handler instead of normal API CRUD logic
|
||||||
|
workorder = self.workorder_handler.make_workorder(self.Session(), **data)
|
||||||
|
return workorder
|
||||||
|
|
||||||
|
def update_object(self, workorder, data):
|
||||||
|
date_fields = [
|
||||||
|
'date_submitted',
|
||||||
|
'date_received',
|
||||||
|
'date_released',
|
||||||
|
'date_delivered',
|
||||||
|
]
|
||||||
|
|
||||||
|
# coerce date field values to proper datetime.date objects
|
||||||
|
for field in date_fields:
|
||||||
|
if field in data:
|
||||||
|
if data[field] == '':
|
||||||
|
data[field] = None
|
||||||
|
elif not isinstance(data[field], datetime.date):
|
||||||
|
date = datetime.datetime.strptime(data[field], '%Y-%m-%d').date()
|
||||||
|
data[field] = date
|
||||||
|
|
||||||
|
# coerce status code value to proper integer
|
||||||
|
if 'status_code' in data:
|
||||||
|
data['status_code'] = int(data['status_code'])
|
||||||
|
|
||||||
|
return super().update_object(workorder, data)
|
||||||
|
|
||||||
|
def status_codes(self):
|
||||||
|
"""
|
||||||
|
Retrieve all info about possible work order status codes.
|
||||||
|
"""
|
||||||
|
return self.workorder_handler.status_codes()
|
||||||
|
|
||||||
|
def receive(self):
|
||||||
|
"""
|
||||||
|
Sets work order status to "received".
|
||||||
|
"""
|
||||||
|
workorder = self.get_object()
|
||||||
|
self.workorder_handler.receive(workorder)
|
||||||
|
self.Session.flush()
|
||||||
|
return self.normalize(workorder)
|
||||||
|
|
||||||
|
def await_estimate(self):
|
||||||
|
"""
|
||||||
|
Sets work order status to "awaiting estimate confirmation".
|
||||||
|
"""
|
||||||
|
workorder = self.get_object()
|
||||||
|
self.workorder_handler.await_estimate(workorder)
|
||||||
|
self.Session.flush()
|
||||||
|
return self.normalize(workorder)
|
||||||
|
|
||||||
|
def await_parts(self):
|
||||||
|
"""
|
||||||
|
Sets work order status to "awaiting parts".
|
||||||
|
"""
|
||||||
|
workorder = self.get_object()
|
||||||
|
self.workorder_handler.await_parts(workorder)
|
||||||
|
self.Session.flush()
|
||||||
|
return self.normalize(workorder)
|
||||||
|
|
||||||
|
def work_on_it(self):
|
||||||
|
"""
|
||||||
|
Sets work order status to "working on it".
|
||||||
|
"""
|
||||||
|
workorder = self.get_object()
|
||||||
|
self.workorder_handler.work_on_it(workorder)
|
||||||
|
self.Session.flush()
|
||||||
|
return self.normalize(workorder)
|
||||||
|
|
||||||
|
def release(self):
|
||||||
|
"""
|
||||||
|
Sets work order status to "released".
|
||||||
|
"""
|
||||||
|
workorder = self.get_object()
|
||||||
|
self.workorder_handler.release(workorder)
|
||||||
|
self.Session.flush()
|
||||||
|
return self.normalize(workorder)
|
||||||
|
|
||||||
|
def deliver(self):
|
||||||
|
"""
|
||||||
|
Sets work order status to "delivered".
|
||||||
|
"""
|
||||||
|
workorder = self.get_object()
|
||||||
|
self.workorder_handler.deliver(workorder)
|
||||||
|
self.Session.flush()
|
||||||
|
return self.normalize(workorder)
|
||||||
|
|
||||||
|
def cancel(self):
|
||||||
|
"""
|
||||||
|
Sets work order status to "canceled".
|
||||||
|
"""
|
||||||
|
workorder = self.get_object()
|
||||||
|
self.workorder_handler.cancel(workorder)
|
||||||
|
self.Session.flush()
|
||||||
|
return self.normalize(workorder)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def defaults(cls, config):
|
||||||
|
cls._defaults(config)
|
||||||
|
cls._workorder_defaults(config)
|
||||||
|
|
||||||
|
@classmethod
|
||||||
|
def _workorder_defaults(cls, config):
|
||||||
|
route_prefix = cls.get_route_prefix()
|
||||||
|
permission_prefix = cls.get_permission_prefix()
|
||||||
|
collection_url_prefix = cls.get_collection_url_prefix()
|
||||||
|
object_url_prefix = cls.get_object_url_prefix()
|
||||||
|
|
||||||
|
# status codes
|
||||||
|
status_codes = Service(name='{}.status_codes'.format(route_prefix),
|
||||||
|
path='{}/status-codes'.format(collection_url_prefix))
|
||||||
|
status_codes.add_view('GET', 'status_codes', klass=cls,
|
||||||
|
permission='{}.list'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(status_codes)
|
||||||
|
|
||||||
|
# receive
|
||||||
|
receive = Service(name='{}.receive'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/receive'.format(object_url_prefix))
|
||||||
|
receive.add_view('POST', 'receive', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(receive)
|
||||||
|
|
||||||
|
# await estimate confirmation
|
||||||
|
await_estimate = Service(name='{}.await_estimate'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/await-estimate'.format(object_url_prefix))
|
||||||
|
await_estimate.add_view('POST', 'await_estimate', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(await_estimate)
|
||||||
|
|
||||||
|
# await parts
|
||||||
|
await_parts = Service(name='{}.await_parts'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/await-parts'.format(object_url_prefix))
|
||||||
|
await_parts.add_view('POST', 'await_parts', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(await_parts)
|
||||||
|
|
||||||
|
# work on it
|
||||||
|
work_on_it = Service(name='{}.work_on_it'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/work-on-it'.format(object_url_prefix))
|
||||||
|
work_on_it.add_view('POST', 'work_on_it', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(work_on_it)
|
||||||
|
|
||||||
|
# release
|
||||||
|
release = Service(name='{}.release'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/release'.format(object_url_prefix))
|
||||||
|
release.add_view('POST', 'release', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(release)
|
||||||
|
|
||||||
|
# deliver
|
||||||
|
deliver = Service(name='{}.deliver'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/deliver'.format(object_url_prefix))
|
||||||
|
deliver.add_view('POST', 'deliver', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(deliver)
|
||||||
|
|
||||||
|
# cancel
|
||||||
|
cancel = Service(name='{}.cancel'.format(route_prefix),
|
||||||
|
path='{}/{{uuid}}/cancel'.format(object_url_prefix))
|
||||||
|
cancel.add_view('POST', 'cancel', klass=cls,
|
||||||
|
permission='{}.edit'.format(permission_prefix))
|
||||||
|
config.add_cornice_service(cancel)
|
||||||
|
|
||||||
|
|
||||||
|
def defaults(config, **kwargs):
|
||||||
|
base = globals()
|
||||||
|
|
||||||
|
WorkOrderView = kwargs.get('WorkOrderView', base['WorkOrderView'])
|
||||||
|
WorkOrderView.defaults(config)
|
||||||
|
|
||||||
|
|
||||||
|
def includeme(config):
|
||||||
|
defaults(config)
|
294
tailbone/app.py
294
tailbone/app.py
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8; -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,25 +24,23 @@
|
||||||
Application Entry Point
|
Application Entry Point
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import os
|
import os
|
||||||
import warnings
|
|
||||||
|
|
||||||
import sqlalchemy as sa
|
from sqlalchemy.orm import sessionmaker, scoped_session
|
||||||
|
|
||||||
|
from wuttjamaican.util import parse_list
|
||||||
|
|
||||||
import rattail.db
|
|
||||||
from rattail.config import make_config
|
from rattail.config import make_config
|
||||||
from rattail.exceptions import ConfigurationError
|
from rattail.exceptions import ConfigurationError
|
||||||
from rattail.db.config import get_engines, configure_versioning
|
|
||||||
from rattail.db.types import GPCType
|
|
||||||
|
|
||||||
import formalchemy as fa
|
|
||||||
from pyramid.config import Configurator
|
from pyramid.config import Configurator
|
||||||
from pyramid.authentication import SessionAuthenticationPolicy
|
from zope.sqlalchemy import register
|
||||||
|
|
||||||
import tailbone.db
|
import tailbone.db
|
||||||
from tailbone.auth import TailboneAuthorizationPolicy
|
from tailbone.auth import TailboneSecurityPolicy
|
||||||
|
from tailbone.config import csrf_token_name, csrf_header_name
|
||||||
|
from tailbone.util import get_effective_theme, get_theme_template_path
|
||||||
|
from tailbone.providers import get_all_providers
|
||||||
|
|
||||||
|
|
||||||
def make_rattail_config(settings):
|
def make_rattail_config(settings):
|
||||||
|
@ -56,45 +54,48 @@ def make_rattail_config(settings):
|
||||||
# available for web requests later
|
# available for web requests later
|
||||||
path = settings.get('rattail.config')
|
path = settings.get('rattail.config')
|
||||||
if not path or not os.path.exists(path):
|
if not path or not os.path.exists(path):
|
||||||
path = settings.get('edbob.config')
|
raise ConfigurationError("Please set 'rattail.config' in [app:main] section of config "
|
||||||
if not path or not os.path.exists(path):
|
"to the path of your config file. Lame, but necessary.")
|
||||||
raise ConfigurationError("Please set 'rattail.config' in [app:main] section of config "
|
|
||||||
"to the path of your config file. Lame, but necessary.")
|
|
||||||
warnings.warn("[app:main] setting 'edbob.config' is deprecated; "
|
|
||||||
"please use 'rattail.config' setting instead",
|
|
||||||
DeprecationWarning)
|
|
||||||
rattail_config = make_config(path)
|
rattail_config = make_config(path)
|
||||||
settings['rattail_config'] = rattail_config
|
settings['rattail_config'] = rattail_config
|
||||||
rattail_config.configure_logging()
|
|
||||||
|
|
||||||
rattail_engines = settings.get('rattail_engines')
|
# nb. this is for compaibility with wuttaweb
|
||||||
if not rattail_engines:
|
settings['wutta_config'] = rattail_config
|
||||||
|
|
||||||
# Load all Rattail database engines from config, and store in settings
|
# must import all sqlalchemy models before things get rolling,
|
||||||
# dict. This is necessary e.g. in the case of a host server, to have
|
# otherwise can have errors about continuum TransactionMeta class
|
||||||
# access to its subordinate store servers.
|
# not yet mapped, when relevant pages are first requested...
|
||||||
rattail_engines = get_engines(rattail_config)
|
# cf. https://docs.pylonsproject.org/projects/pyramid_cookbook/en/latest/database/sqlalchemy.html#importing-all-sqlalchemy-models
|
||||||
settings['rattail_engines'] = rattail_engines
|
# hat tip to https://stackoverflow.com/a/59241485
|
||||||
|
if getattr(rattail_config, 'tempmon_engine', None):
|
||||||
|
from rattail_tempmon.db import model as tempmon_model, Session as TempmonSession
|
||||||
|
tempmon_session = TempmonSession()
|
||||||
|
tempmon_session.query(tempmon_model.Appliance).first()
|
||||||
|
tempmon_session.close()
|
||||||
|
|
||||||
# Configure the database session classes. Note that most of the time we'll
|
# configure database sessions
|
||||||
# be using the Tailbone Session, but occasionally (e.g. within batch
|
if hasattr(rattail_config, 'appdb_engine'):
|
||||||
# processing threads) we want the Rattail Session. The reason is that
|
tailbone.db.Session.configure(bind=rattail_config.appdb_engine)
|
||||||
# during normal request processing, the Tailbone Session is preferable as
|
|
||||||
# it includes Zope Transaction magic. Within an explicitly-spawned thread
|
|
||||||
# however, this is *not* desirable.
|
|
||||||
rattail.db.Session.configure(bind=rattail_engines['default'])
|
|
||||||
tailbone.db.Session.configure(bind=rattail_engines['default'])
|
|
||||||
if hasattr(rattail_config, 'tempmon_engine'):
|
|
||||||
tailbone.db.TempmonSession.configure(bind=rattail_config.tempmon_engine)
|
|
||||||
if hasattr(rattail_config, 'trainwreck_engine'):
|
if hasattr(rattail_config, 'trainwreck_engine'):
|
||||||
tailbone.db.TrainwreckSession.configure(bind=rattail_config.trainwreck_engine)
|
tailbone.db.TrainwreckSession.configure(bind=rattail_config.trainwreck_engine)
|
||||||
|
if hasattr(rattail_config, 'tempmon_engine'):
|
||||||
|
tailbone.db.TempmonSession.configure(bind=rattail_config.tempmon_engine)
|
||||||
|
|
||||||
|
# maybe set "future" behavior for SQLAlchemy
|
||||||
|
if rattail_config.getbool('rattail.db', 'sqlalchemy_future_mode', usedb=False):
|
||||||
|
tailbone.db.Session.configure(future=True)
|
||||||
|
|
||||||
|
# create session wrappers for each "extra" Trainwreck engine
|
||||||
|
for key, engine in rattail_config.trainwreck_engines.items():
|
||||||
|
if key != 'default':
|
||||||
|
Session = scoped_session(sessionmaker(bind=engine))
|
||||||
|
register(Session)
|
||||||
|
tailbone.db.ExtraTrainwreckSessions[key] = Session
|
||||||
|
|
||||||
# Make sure rattail config object uses our scoped session, to avoid
|
# Make sure rattail config object uses our scoped session, to avoid
|
||||||
# unnecessary connections (and pooling limits).
|
# unnecessary connections (and pooling limits).
|
||||||
rattail_config._session_factory = lambda: (tailbone.db.Session(), False)
|
rattail_config._session_factory = lambda: (tailbone.db.Session(), False)
|
||||||
|
|
||||||
# Configure (or not) Continuum versioning.
|
|
||||||
configure_versioning(rattail_config)
|
|
||||||
return rattail_config
|
return rattail_config
|
||||||
|
|
||||||
|
|
||||||
|
@ -104,7 +105,12 @@ def provide_postgresql_settings(settings):
|
||||||
this enables retrying transactions a second time, in an attempt to
|
this enables retrying transactions a second time, in an attempt to
|
||||||
gracefully handle database restarts.
|
gracefully handle database restarts.
|
||||||
"""
|
"""
|
||||||
settings.setdefault('tm.attempts', 2)
|
try:
|
||||||
|
import pyramid_retry
|
||||||
|
except ImportError:
|
||||||
|
settings.setdefault('tm.attempts', 2)
|
||||||
|
else:
|
||||||
|
settings.setdefault('retry.attempts', 2)
|
||||||
|
|
||||||
|
|
||||||
class Root(dict):
|
class Root(dict):
|
||||||
|
@ -118,50 +124,201 @@ class Root(dict):
|
||||||
self.request = request
|
self.request = request
|
||||||
|
|
||||||
|
|
||||||
def make_pyramid_config(settings):
|
def make_pyramid_config(settings, configure_csrf=True):
|
||||||
"""
|
"""
|
||||||
Make a Pyramid config object from the given settings.
|
Make a Pyramid config object from the given settings.
|
||||||
"""
|
"""
|
||||||
from tailbone.forms.alchemy import TemplateEngine
|
rattail_config = settings['rattail_config']
|
||||||
from tailbone.forms import renderers
|
|
||||||
|
|
||||||
config = Configurator(settings=settings, root_factory=Root)
|
config = settings.pop('pyramid_config', None)
|
||||||
|
if config:
|
||||||
|
config.set_root_factory(Root)
|
||||||
|
else:
|
||||||
|
|
||||||
# Configure user authentication / authorization.
|
# declare this web app of the "classic" variety
|
||||||
config.set_authentication_policy(SessionAuthenticationPolicy())
|
settings.setdefault('tailbone.classic', 'true')
|
||||||
config.set_authorization_policy(TailboneAuthorizationPolicy())
|
|
||||||
|
|
||||||
# always require CSRF token protection
|
# we want the new themes feature!
|
||||||
config.set_default_csrf_options(require_csrf=True, token='_csrf')
|
establish_theme(settings)
|
||||||
|
|
||||||
|
settings.setdefault('fanstatic.versioning', 'true')
|
||||||
|
settings.setdefault('pyramid_deform.template_search_path', 'tailbone:templates/deform')
|
||||||
|
config = Configurator(settings=settings, root_factory=Root)
|
||||||
|
|
||||||
|
# add rattail config directly to registry, for access throughout the app
|
||||||
|
config.registry['rattail_config'] = rattail_config
|
||||||
|
|
||||||
|
# configure user authorization / authentication
|
||||||
|
config.set_security_policy(TailboneSecurityPolicy())
|
||||||
|
|
||||||
|
# maybe require CSRF token protection
|
||||||
|
if configure_csrf:
|
||||||
|
config.set_default_csrf_options(require_csrf=True,
|
||||||
|
token=csrf_token_name(rattail_config),
|
||||||
|
header=csrf_header_name(rattail_config))
|
||||||
|
|
||||||
# Bring in some Pyramid goodies.
|
# Bring in some Pyramid goodies.
|
||||||
config.include('tailbone.beaker')
|
config.include('tailbone.beaker')
|
||||||
|
config.include('pyramid_deform')
|
||||||
|
config.include('pyramid_fanstatic')
|
||||||
config.include('pyramid_mako')
|
config.include('pyramid_mako')
|
||||||
config.include('pyramid_tm')
|
config.include('pyramid_tm')
|
||||||
|
|
||||||
# Add some permissions magic.
|
# TODO: this may be a good idea some day, if wanting to leverage
|
||||||
config.add_directive('add_tailbone_permission_group', 'tailbone.auth.add_permission_group')
|
# deform resources for component JS? cf. also base.mako template
|
||||||
config.add_directive('add_tailbone_permission', 'tailbone.auth.add_permission')
|
# # override default script mapping for deform
|
||||||
|
# from deform import Field
|
||||||
|
# from deform.widget import ResourceRegistry, default_resources
|
||||||
|
# registry = ResourceRegistry(use_defaults=False)
|
||||||
|
# for key in default_resources:
|
||||||
|
# registry.set_js_resources(key, None, {'js': []})
|
||||||
|
# Field.set_default_resource_registry(registry)
|
||||||
|
|
||||||
# TODO: This can finally be removed once all CRUD/index views have been
|
# bring in the pyramid_retry logic, if available
|
||||||
# converted to use the new master view etc.
|
# TODO: pretty soon we can require this package, hopefully..
|
||||||
for label, perms in settings.get('edbob.permissions', []):
|
try:
|
||||||
groupkey = label.lower().replace(' ', '_')
|
import pyramid_retry
|
||||||
config.add_tailbone_permission_group(groupkey, label)
|
except ImportError:
|
||||||
for key, label in perms:
|
pass
|
||||||
config.add_tailbone_permission(groupkey, key, label)
|
else:
|
||||||
|
config.include('pyramid_retry')
|
||||||
|
|
||||||
# Configure FormAlchemy.
|
# fetch all tailbone providers
|
||||||
fa.config.engine = TemplateEngine()
|
providers = get_all_providers(rattail_config)
|
||||||
fa.FieldSet.default_renderers[sa.Boolean] = renderers.YesNoFieldRenderer
|
for provider in providers.values():
|
||||||
fa.FieldSet.default_renderers[sa.Date] = renderers.DateFieldRenderer
|
|
||||||
fa.FieldSet.default_renderers[sa.DateTime] = renderers.DateTimeFieldRenderer
|
# configure DB sessions associated with transaction manager
|
||||||
fa.FieldSet.default_renderers[sa.Time] = renderers.TimeFieldRenderer
|
provider.configure_db_sessions(rattail_config, config)
|
||||||
fa.FieldSet.default_renderers[GPCType] = renderers.GPCFieldRenderer
|
|
||||||
|
# add any static includes
|
||||||
|
includes = provider.get_static_includes()
|
||||||
|
if includes:
|
||||||
|
for spec in includes:
|
||||||
|
config.include(spec)
|
||||||
|
|
||||||
|
# add some permissions magic
|
||||||
|
config.add_directive('add_wutta_permission_group',
|
||||||
|
'wuttaweb.auth.add_permission_group')
|
||||||
|
config.add_directive('add_wutta_permission',
|
||||||
|
'wuttaweb.auth.add_permission')
|
||||||
|
# TODO: deprecate / remove these
|
||||||
|
config.add_directive('add_tailbone_permission_group',
|
||||||
|
'wuttaweb.auth.add_permission_group')
|
||||||
|
config.add_directive('add_tailbone_permission',
|
||||||
|
'wuttaweb.auth.add_permission')
|
||||||
|
|
||||||
|
# and some similar magic for certain master views
|
||||||
|
config.add_directive('add_tailbone_index_page', 'tailbone.app.add_index_page')
|
||||||
|
config.add_directive('add_tailbone_config_page', 'tailbone.app.add_config_page')
|
||||||
|
config.add_directive('add_tailbone_model_view', 'tailbone.app.add_model_view')
|
||||||
|
config.add_directive('add_tailbone_view_supplement', 'tailbone.app.add_view_supplement')
|
||||||
|
|
||||||
|
config.add_directive('add_tailbone_websocket', 'tailbone.app.add_websocket')
|
||||||
|
|
||||||
return config
|
return config
|
||||||
|
|
||||||
|
|
||||||
|
def add_websocket(config, name, view, attr=None):
|
||||||
|
"""
|
||||||
|
Register a websocket entry point for the app.
|
||||||
|
"""
|
||||||
|
def action():
|
||||||
|
rattail_config = config.registry.settings['rattail_config']
|
||||||
|
rattail_app = rattail_config.get_app()
|
||||||
|
|
||||||
|
if isinstance(view, str):
|
||||||
|
view_callable = rattail_app.load_object(view)
|
||||||
|
else:
|
||||||
|
view_callable = view
|
||||||
|
view_callable = view_callable(config)
|
||||||
|
if attr:
|
||||||
|
view_callable = getattr(view_callable, attr)
|
||||||
|
|
||||||
|
# register route
|
||||||
|
path = '/ws/{}'.format(name)
|
||||||
|
route_name = 'ws.{}'.format(name)
|
||||||
|
config.add_route(route_name, path, static=True)
|
||||||
|
|
||||||
|
# register view callable
|
||||||
|
websockets = config.registry.setdefault('tailbone_websockets', {})
|
||||||
|
websockets[path] = view_callable
|
||||||
|
|
||||||
|
config.action('tailbone-add-websocket-{}'.format(name), action,
|
||||||
|
# nb. since this action adds routes, it must happen
|
||||||
|
# sooner in the order than it normally would, hence
|
||||||
|
# we declare that
|
||||||
|
order=-20)
|
||||||
|
|
||||||
|
|
||||||
|
def add_index_page(config, route_name, label, permission):
|
||||||
|
"""
|
||||||
|
Register a config page for the app.
|
||||||
|
"""
|
||||||
|
def action():
|
||||||
|
pages = config.get_settings().get('tailbone_index_pages', [])
|
||||||
|
pages.append({'label': label, 'route': route_name,
|
||||||
|
'permission': permission})
|
||||||
|
config.add_settings({'tailbone_index_pages': pages})
|
||||||
|
config.action(None, action)
|
||||||
|
|
||||||
|
|
||||||
|
def add_config_page(config, route_name, label, permission):
|
||||||
|
"""
|
||||||
|
Register a config page for the app.
|
||||||
|
"""
|
||||||
|
def action():
|
||||||
|
pages = config.get_settings().get('tailbone_config_pages', [])
|
||||||
|
pages.append({'label': label, 'route': route_name,
|
||||||
|
'permission': permission})
|
||||||
|
config.add_settings({'tailbone_config_pages': pages})
|
||||||
|
config.action(None, action)
|
||||||
|
|
||||||
|
|
||||||
|
def add_model_view(config, model_name, label, route_prefix, permission_prefix):
|
||||||
|
"""
|
||||||
|
Register a model view for the app.
|
||||||
|
"""
|
||||||
|
def action():
|
||||||
|
all_views = config.get_settings().get('tailbone_model_views', {})
|
||||||
|
|
||||||
|
model_views = all_views.setdefault(model_name, [])
|
||||||
|
model_views.append({
|
||||||
|
'label': label,
|
||||||
|
'route_prefix': route_prefix,
|
||||||
|
'permission_prefix': permission_prefix,
|
||||||
|
})
|
||||||
|
|
||||||
|
config.add_settings({'tailbone_model_views': all_views})
|
||||||
|
|
||||||
|
config.action(None, action)
|
||||||
|
|
||||||
|
|
||||||
|
def add_view_supplement(config, route_prefix, cls):
|
||||||
|
"""
|
||||||
|
Register a master view supplement for the app.
|
||||||
|
"""
|
||||||
|
def action():
|
||||||
|
supplements = config.get_settings().get('tailbone_view_supplements', {})
|
||||||
|
supplements.setdefault(route_prefix, []).append(cls)
|
||||||
|
config.add_settings({'tailbone_view_supplements': supplements})
|
||||||
|
config.action(None, action)
|
||||||
|
|
||||||
|
|
||||||
|
def establish_theme(settings):
|
||||||
|
rattail_config = settings['rattail_config']
|
||||||
|
|
||||||
|
theme = get_effective_theme(rattail_config)
|
||||||
|
settings['tailbone.theme'] = theme
|
||||||
|
|
||||||
|
directories = settings['mako.directories']
|
||||||
|
if isinstance(directories, str):
|
||||||
|
directories = parse_list(directories)
|
||||||
|
|
||||||
|
path = get_theme_template_path(rattail_config)
|
||||||
|
directories.insert(0, path)
|
||||||
|
settings['mako.directories'] = directories
|
||||||
|
|
||||||
|
|
||||||
def configure_postgresql(pyramid_config):
|
def configure_postgresql(pyramid_config):
|
||||||
"""
|
"""
|
||||||
Add some PostgreSQL-specific tweaks to the final app config. Specifically,
|
Add some PostgreSQL-specific tweaks to the final app config. Specifically,
|
||||||
|
@ -175,9 +332,8 @@ def main(global_config, **settings):
|
||||||
"""
|
"""
|
||||||
This function returns a Pyramid WSGI application.
|
This function returns a Pyramid WSGI application.
|
||||||
"""
|
"""
|
||||||
settings.setdefault('mako.directories', [
|
settings.setdefault('mako.directories', ['tailbone:templates',
|
||||||
'tailbone:templates/themes/better',
|
'wuttaweb:templates'])
|
||||||
'tailbone:templates'])
|
|
||||||
rattail_config = make_rattail_config(settings)
|
rattail_config = make_rattail_config(settings)
|
||||||
pyramid_config = make_pyramid_config(settings)
|
pyramid_config = make_pyramid_config(settings)
|
||||||
pyramid_config.include('tailbone')
|
pyramid_config.include('tailbone')
|
||||||
|
|
110
tailbone/asgi.py
Normal file
110
tailbone/asgi.py
Normal file
|
@ -0,0 +1,110 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
ASGI App Utilities
|
||||||
|
"""
|
||||||
|
|
||||||
|
import os
|
||||||
|
import configparser
|
||||||
|
import logging
|
||||||
|
|
||||||
|
from rattail.util import load_object
|
||||||
|
|
||||||
|
from asgiref.wsgi import WsgiToAsgi
|
||||||
|
|
||||||
|
|
||||||
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class TailboneWsgiToAsgi(WsgiToAsgi):
|
||||||
|
"""
|
||||||
|
Custom WSGI -> ASGI wrapper, to add routing for websockets.
|
||||||
|
"""
|
||||||
|
|
||||||
|
async def __call__(self, scope, *args, **kwargs):
|
||||||
|
protocol = scope['type']
|
||||||
|
path = scope['path']
|
||||||
|
|
||||||
|
# strip off the root path, if non-empty. needed for serving
|
||||||
|
# under /poser or anything other than true site root
|
||||||
|
root_path = scope['root_path']
|
||||||
|
if root_path and path.startswith(root_path):
|
||||||
|
path = path[len(root_path):]
|
||||||
|
|
||||||
|
if protocol == 'websocket':
|
||||||
|
websockets = self.wsgi_application.registry.get(
|
||||||
|
'tailbone_websockets', {})
|
||||||
|
if path in websockets:
|
||||||
|
await websockets[path](scope, *args, **kwargs)
|
||||||
|
|
||||||
|
try:
|
||||||
|
await super().__call__(scope, *args, **kwargs)
|
||||||
|
except ValueError as e:
|
||||||
|
# The developer may wish to improve handling of this exception.
|
||||||
|
# See https://github.com/Pylons/pyramid_cookbook/issues/225 and
|
||||||
|
# https://asgi.readthedocs.io/en/latest/specs/www.html#websocket
|
||||||
|
pass
|
||||||
|
except Exception as e:
|
||||||
|
raise e
|
||||||
|
|
||||||
|
|
||||||
|
def make_asgi_app(main_app=None):
|
||||||
|
"""
|
||||||
|
This function returns an ASGI application.
|
||||||
|
"""
|
||||||
|
path = os.environ.get('TAILBONE_ASGI_CONFIG')
|
||||||
|
if not path:
|
||||||
|
raise RuntimeError("You must define TAILBONE_ASGI_CONFIG env variable.")
|
||||||
|
|
||||||
|
# make a config parser good enough to load pyramid settings
|
||||||
|
configdir = os.path.dirname(path)
|
||||||
|
parser = configparser.ConfigParser(defaults={'__file__': path,
|
||||||
|
'here': configdir})
|
||||||
|
|
||||||
|
# read the config file
|
||||||
|
parser.read(path)
|
||||||
|
|
||||||
|
# parse the settings needed for pyramid app
|
||||||
|
settings = dict(parser.items('app:main'))
|
||||||
|
|
||||||
|
if isinstance(main_app, str):
|
||||||
|
make_wsgi_app = load_object(main_app)
|
||||||
|
elif callable(main_app):
|
||||||
|
make_wsgi_app = main_app
|
||||||
|
else:
|
||||||
|
if main_app:
|
||||||
|
log.warning("specified main app of unknown type: %s", main_app)
|
||||||
|
make_wsgi_app = load_object('tailbone.app:main')
|
||||||
|
|
||||||
|
# construct a pyramid app "per usual"
|
||||||
|
app = make_wsgi_app({}, **settings)
|
||||||
|
|
||||||
|
# then wrap it with ASGI
|
||||||
|
return TailboneWsgiToAsgi(app)
|
||||||
|
|
||||||
|
|
||||||
|
def asgi_main():
|
||||||
|
"""
|
||||||
|
This function returns an ASGI application.
|
||||||
|
"""
|
||||||
|
return make_asgi_app()
|
111
tailbone/auth.py
111
tailbone/auth.py
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,33 +24,31 @@
|
||||||
Authentication & Authorization
|
Authentication & Authorization
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import logging
|
import logging
|
||||||
|
import re
|
||||||
|
|
||||||
from rattail import enum
|
from wuttjamaican.util import UNSPECIFIED
|
||||||
from rattail.db import model
|
|
||||||
from rattail.util import prettify, NOTSET
|
|
||||||
|
|
||||||
from zope.interface import implementer
|
from pyramid.security import remember, forget
|
||||||
from pyramid.interfaces import IAuthorizationPolicy
|
|
||||||
from pyramid.security import remember, forget, Everyone, Authenticated
|
|
||||||
|
|
||||||
|
from wuttaweb.auth import WuttaSecurityPolicy
|
||||||
from tailbone.db import Session
|
from tailbone.db import Session
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
def login_user(request, user, timeout=NOTSET):
|
def login_user(request, user, timeout=UNSPECIFIED):
|
||||||
"""
|
"""
|
||||||
Perform the steps necessary to login the given user. Note that this
|
Perform the steps necessary to login the given user. Note that this
|
||||||
returns a ``headers`` dict which you should pass to the redirect.
|
returns a ``headers`` dict which you should pass to the redirect.
|
||||||
"""
|
"""
|
||||||
user.record_event(enum.USER_EVENT_LOGIN)
|
config = request.rattail_config
|
||||||
|
app = config.get_app()
|
||||||
|
user.record_event(app.enum.USER_EVENT_LOGIN)
|
||||||
headers = remember(request, user.uuid)
|
headers = remember(request, user.uuid)
|
||||||
if timeout is NOTSET:
|
if timeout is UNSPECIFIED:
|
||||||
timeout = session_timeout_for_user(user)
|
timeout = session_timeout_for_user(config, user)
|
||||||
log.debug("setting session timeout for '{}' to {}".format(user.username, timeout))
|
log.debug("setting session timeout for '{}' to {}".format(user.username, timeout))
|
||||||
set_session_timeout(request, timeout)
|
set_session_timeout(request, timeout)
|
||||||
return headers
|
return headers
|
||||||
|
@ -61,24 +59,28 @@ def logout_user(request):
|
||||||
Perform the logout action for the given request. Note that this returns a
|
Perform the logout action for the given request. Note that this returns a
|
||||||
``headers`` dict which you should pass to the redirect.
|
``headers`` dict which you should pass to the redirect.
|
||||||
"""
|
"""
|
||||||
|
app = request.rattail_config.get_app()
|
||||||
user = request.user
|
user = request.user
|
||||||
if user:
|
if user:
|
||||||
user.record_event(enum.USER_EVENT_LOGOUT)
|
user.record_event(app.enum.USER_EVENT_LOGOUT)
|
||||||
request.session.delete()
|
request.session.delete()
|
||||||
request.session.invalidate()
|
request.session.invalidate()
|
||||||
headers = forget(request)
|
headers = forget(request)
|
||||||
return headers
|
return headers
|
||||||
|
|
||||||
|
|
||||||
def session_timeout_for_user(user):
|
def session_timeout_for_user(config, user):
|
||||||
"""
|
"""
|
||||||
Returns the "max" session timeout for the user, according to roles
|
Returns the "max" session timeout for the user, according to roles
|
||||||
"""
|
"""
|
||||||
from rattail.db.auth import authenticated_role
|
app = config.get_app()
|
||||||
|
auth = app.get_auth_handler()
|
||||||
|
|
||||||
roles = user.roles + [authenticated_role(Session())]
|
authenticated = auth.get_role_authenticated(Session())
|
||||||
|
roles = user.roles + [authenticated]
|
||||||
timeouts = [role.session_timeout for role in roles
|
timeouts = [role.session_timeout for role in roles
|
||||||
if role.session_timeout is not None]
|
if role.session_timeout is not None]
|
||||||
|
|
||||||
if timeouts and 0 not in timeouts:
|
if timeouts and 0 not in timeouts:
|
||||||
return max(timeouts)
|
return max(timeouts)
|
||||||
|
|
||||||
|
@ -90,53 +92,42 @@ def set_session_timeout(request, timeout):
|
||||||
request.session['_timeout'] = timeout or None
|
request.session['_timeout'] = timeout or None
|
||||||
|
|
||||||
|
|
||||||
@implementer(IAuthorizationPolicy)
|
class TailboneSecurityPolicy(WuttaSecurityPolicy):
|
||||||
class TailboneAuthorizationPolicy(object):
|
|
||||||
|
|
||||||
def permits(self, context, principals, permission):
|
def __init__(self, db_session=None, api_mode=False, **kwargs):
|
||||||
from rattail.db import model
|
kwargs['db_session'] = db_session or Session()
|
||||||
from rattail.db.auth import has_permission
|
super().__init__(**kwargs)
|
||||||
|
self.api_mode = api_mode
|
||||||
|
|
||||||
for userid in principals:
|
def load_identity(self, request):
|
||||||
if userid not in (Everyone, Authenticated):
|
config = request.registry.settings.get('rattail_config')
|
||||||
if context.request.user and context.request.user.uuid == userid:
|
app = config.get_app()
|
||||||
return context.request.has_perm(permission)
|
user = None
|
||||||
else:
|
|
||||||
assert False # should no longer happen..right?
|
|
||||||
user = Session.query(model.User).get(userid)
|
|
||||||
if user:
|
|
||||||
if has_permission(Session(), user, permission):
|
|
||||||
return True
|
|
||||||
if Everyone in principals:
|
|
||||||
return has_permission(Session(), None, permission)
|
|
||||||
return False
|
|
||||||
|
|
||||||
def principals_allowed_by_permission(self, context, permission):
|
if self.api_mode:
|
||||||
raise NotImplementedError
|
|
||||||
|
|
||||||
|
# determine/load user from header token if present
|
||||||
|
credentials = request.headers.get('Authorization')
|
||||||
|
if credentials:
|
||||||
|
match = re.match(r'^Bearer (\S+)$', credentials)
|
||||||
|
if match:
|
||||||
|
token = match.group(1)
|
||||||
|
auth = app.get_auth_handler()
|
||||||
|
user = auth.authenticate_user_token(self.db_session, token)
|
||||||
|
|
||||||
def add_permission_group(config, key, label=None, overwrite=True):
|
if not user:
|
||||||
"""
|
|
||||||
Add a permission group to the app configuration.
|
|
||||||
"""
|
|
||||||
def action():
|
|
||||||
perms = config.get_settings().get('tailbone_permissions', {})
|
|
||||||
if key not in perms or overwrite:
|
|
||||||
group = perms.setdefault(key, {'key': key})
|
|
||||||
group['label'] = label or prettify(key)
|
|
||||||
config.add_settings({'tailbone_permissions': perms})
|
|
||||||
config.action(None, action)
|
|
||||||
|
|
||||||
|
# fetch user uuid from current session
|
||||||
|
uuid = self.session_helper.authenticated_userid(request)
|
||||||
|
if not uuid:
|
||||||
|
return
|
||||||
|
|
||||||
def add_permission(config, groupkey, key, label=None):
|
# fetch user object from db
|
||||||
"""
|
model = app.model
|
||||||
Add a permission to the app configuration.
|
user = self.db_session.get(model.User, uuid)
|
||||||
"""
|
if not user:
|
||||||
def action():
|
return
|
||||||
perms = config.get_settings().get('tailbone_permissions', {})
|
|
||||||
group = perms.setdefault(groupkey, {'key': groupkey})
|
# this user is responsible for data changes in current request
|
||||||
group.setdefault('label', prettify(groupkey))
|
self.db_session.set_continuum_user(user)
|
||||||
perm = group.setdefault('perms', {}).setdefault(key, {'key': key})
|
return user
|
||||||
perm['label'] = label or prettify(key)
|
|
||||||
config.add_settings({'tailbone_permissions': perms})
|
|
||||||
config.action(None, action)
|
|
||||||
|
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8; -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -27,10 +27,12 @@ Note that most of the code for this module was copied from the beaker and
|
||||||
pyramid_beaker projects.
|
pyramid_beaker projects.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import time
|
import time
|
||||||
|
from pkg_resources import parse_version
|
||||||
|
|
||||||
|
from rattail.util import get_pkg_version
|
||||||
|
|
||||||
|
import beaker
|
||||||
from beaker.session import Session
|
from beaker.session import Session
|
||||||
from beaker.util import coerce_session_params
|
from beaker.util import coerce_session_params
|
||||||
from pyramid.settings import asbool
|
from pyramid.settings import asbool
|
||||||
|
@ -45,6 +47,10 @@ class TailboneSession(Session):
|
||||||
|
|
||||||
def load(self):
|
def load(self):
|
||||||
"Loads the data from this session from persistent storage"
|
"Loads the data from this session from persistent storage"
|
||||||
|
|
||||||
|
# are we using older version of beaker?
|
||||||
|
old_beaker = parse_version(get_pkg_version('beaker')) < parse_version('1.12')
|
||||||
|
|
||||||
self.namespace = self.namespace_class(self.id,
|
self.namespace = self.namespace_class(self.id,
|
||||||
data_dir=self.data_dir,
|
data_dir=self.data_dir,
|
||||||
digest_filenames=False,
|
digest_filenames=False,
|
||||||
|
@ -60,8 +66,12 @@ class TailboneSession(Session):
|
||||||
try:
|
try:
|
||||||
session_data = self.namespace['session']
|
session_data = self.namespace['session']
|
||||||
|
|
||||||
if (session_data is not None and self.encrypt_key):
|
if old_beaker:
|
||||||
session_data = self._decrypt_data(session_data)
|
if (session_data is not None and self.encrypt_key):
|
||||||
|
session_data = self._decrypt_data(session_data)
|
||||||
|
else: # beaker >= 1.12
|
||||||
|
if session_data is not None:
|
||||||
|
session_data = self._decrypt_data(session_data)
|
||||||
|
|
||||||
# Memcached always returns a key, its None when its not
|
# Memcached always returns a key, its None when its not
|
||||||
# present
|
# present
|
||||||
|
@ -90,6 +100,7 @@ class TailboneSession(Session):
|
||||||
# for this module entirely...
|
# for this module entirely...
|
||||||
timeout = session_data.get('_timeout', self.timeout)
|
timeout = session_data.get('_timeout', self.timeout)
|
||||||
if timeout is not None and \
|
if timeout is not None and \
|
||||||
|
'_accessed_time' in session_data and \
|
||||||
now - session_data['_accessed_time'] > timeout:
|
now - session_data['_accessed_time'] > timeout:
|
||||||
timed_out = True
|
timed_out = True
|
||||||
else:
|
else:
|
||||||
|
@ -103,9 +114,6 @@ class TailboneSession(Session):
|
||||||
# Update the current _accessed_time
|
# Update the current _accessed_time
|
||||||
session_data['_accessed_time'] = now
|
session_data['_accessed_time'] = now
|
||||||
|
|
||||||
# Set the path if applicable
|
|
||||||
if '_path' in session_data:
|
|
||||||
self._path = session_data['_path']
|
|
||||||
self.update(session_data)
|
self.update(session_data)
|
||||||
self.accessed_dict = session_data.copy()
|
self.accessed_dict = session_data.copy()
|
||||||
finally:
|
finally:
|
||||||
|
|
80
tailbone/cleanup.py
Normal file
80
tailbone/cleanup.py
Normal file
|
@ -0,0 +1,80 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2022 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Cleanup logic
|
||||||
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
|
import os
|
||||||
|
import logging
|
||||||
|
import time
|
||||||
|
|
||||||
|
from rattail.cleanup import Cleaner
|
||||||
|
|
||||||
|
|
||||||
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class BeakerCleaner(Cleaner):
|
||||||
|
"""
|
||||||
|
Cleanup logic for old Beaker session files.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def get_session_dir(self):
|
||||||
|
session_dir = self.config.get('rattail.cleanup', 'beaker.session_dir')
|
||||||
|
if session_dir and os.path.isdir(session_dir):
|
||||||
|
return session_dir
|
||||||
|
|
||||||
|
session_dir = os.path.join(self.config.appdir(), 'sessions')
|
||||||
|
if os.path.isdir(session_dir):
|
||||||
|
return session_dir
|
||||||
|
|
||||||
|
def cleanup(self, session, dry_run=False, progress=None, **kwargs):
|
||||||
|
session_dir = self.get_session_dir()
|
||||||
|
if not session_dir:
|
||||||
|
return
|
||||||
|
|
||||||
|
data_dir = os.path.join(session_dir, 'data')
|
||||||
|
lock_dir = os.path.join(session_dir, 'lock')
|
||||||
|
|
||||||
|
# looking for files older than X days
|
||||||
|
days = self.config.getint('rattail.cleanup',
|
||||||
|
'beaker.session_cutoff_days',
|
||||||
|
default=30)
|
||||||
|
cutoff = time.time() - 3600 * 24 * days
|
||||||
|
|
||||||
|
for topdir in (data_dir, lock_dir):
|
||||||
|
if not os.path.isdir(topdir):
|
||||||
|
continue
|
||||||
|
|
||||||
|
for dirpath, dirnames, filenames in os.walk(topdir):
|
||||||
|
for fname in filenames:
|
||||||
|
path = os.path.join(dirpath, fname)
|
||||||
|
ts = os.path.getmtime(path)
|
||||||
|
if ts <= cutoff:
|
||||||
|
if dry_run:
|
||||||
|
log.debug("would delete file: %s", path)
|
||||||
|
else:
|
||||||
|
os.remove(path)
|
||||||
|
log.debug("deleted file: %s", path)
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8; -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,15 +24,16 @@
|
||||||
Rattail config extension for Tailbone
|
Rattail config extension for Tailbone
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
import warnings
|
||||||
|
|
||||||
|
from wuttjamaican.conf import WuttaConfigExtension
|
||||||
|
|
||||||
from rattail.config import ConfigExtension as BaseExtension
|
|
||||||
from rattail.db.config import configure_session
|
from rattail.db.config import configure_session
|
||||||
|
|
||||||
from tailbone.db import Session
|
from tailbone.db import Session
|
||||||
|
|
||||||
|
|
||||||
class ConfigExtension(BaseExtension):
|
class ConfigExtension(WuttaConfigExtension):
|
||||||
"""
|
"""
|
||||||
Rattail config extension for Tailbone. Does the following:
|
Rattail config extension for Tailbone. Does the following:
|
||||||
|
|
||||||
|
@ -47,3 +48,31 @@ class ConfigExtension(BaseExtension):
|
||||||
def configure(self, config):
|
def configure(self, config):
|
||||||
Session.configure(rattail_config=config)
|
Session.configure(rattail_config=config)
|
||||||
configure_session(config, Session)
|
configure_session(config, Session)
|
||||||
|
|
||||||
|
# provide default theme selection
|
||||||
|
config.setdefault('tailbone', 'themes.keys', 'default, butterball')
|
||||||
|
config.setdefault('tailbone', 'themes.expose_picker', 'true')
|
||||||
|
|
||||||
|
# override oruga detection
|
||||||
|
config.setdefault('wuttaweb.oruga_detector.spec', 'tailbone.util:should_use_oruga')
|
||||||
|
|
||||||
|
|
||||||
|
def csrf_token_name(config):
|
||||||
|
return config.get('tailbone', 'csrf_token_name', default='_csrf')
|
||||||
|
|
||||||
|
|
||||||
|
def csrf_header_name(config):
|
||||||
|
return config.get('tailbone', 'csrf_header_name', default='X-CSRF-TOKEN')
|
||||||
|
|
||||||
|
|
||||||
|
def global_help_url(config):
|
||||||
|
return config.get('tailbone', 'global_help_url')
|
||||||
|
|
||||||
|
|
||||||
|
def protected_usernames(config):
|
||||||
|
return config.getlist('tailbone', 'protected_usernames')
|
||||||
|
|
||||||
|
|
||||||
|
def should_expose_websockets(config):
|
||||||
|
return config.getbool('tailbone', 'expose_websockets',
|
||||||
|
usedb=False, default=False)
|
||||||
|
|
145
tailbone/db.py
145
tailbone/db.py
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8; -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,11 +21,9 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Database Stuff
|
Database sessions etc.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import sqlalchemy as sa
|
import sqlalchemy as sa
|
||||||
from zope.sqlalchemy import datamanager
|
from zope.sqlalchemy import datamanager
|
||||||
import sqlalchemy_continuum as continuum
|
import sqlalchemy_continuum as continuum
|
||||||
|
@ -35,24 +33,37 @@ from rattail.db import SessionBase
|
||||||
from rattail.db.continuum import versioning_manager
|
from rattail.db.continuum import versioning_manager
|
||||||
|
|
||||||
|
|
||||||
Session = scoped_session(sessionmaker(class_=SessionBase, rattail_config=None, rattail_record_changes=False))
|
Session = scoped_session(sessionmaker(class_=SessionBase, rattail_config=None, expire_on_commit=False))
|
||||||
|
|
||||||
# not necessarily used, but here if you need it
|
# not necessarily used, but here if you need it
|
||||||
TempmonSession = scoped_session(sessionmaker())
|
TempmonSession = scoped_session(sessionmaker())
|
||||||
TrainwreckSession = scoped_session(sessionmaker())
|
TrainwreckSession = scoped_session(sessionmaker())
|
||||||
|
|
||||||
|
# empty dict for now, this must populated on app startup (if needed)
|
||||||
|
ExtraTrainwreckSessions = {}
|
||||||
|
|
||||||
|
|
||||||
class TailboneSessionDataManager(datamanager.SessionDataManager):
|
class TailboneSessionDataManager(datamanager.SessionDataManager):
|
||||||
"""Integrate a top level sqlalchemy session transaction into a zope transaction
|
"""
|
||||||
|
Integrate a top level sqlalchemy session transaction into a zope
|
||||||
|
transaction
|
||||||
|
|
||||||
One phase variant.
|
One phase variant.
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
This class appears to be necessary in order for the Continuum
|
|
||||||
integration to work alongside the Zope transaction integration.
|
This class appears to be necessary in order for the
|
||||||
|
SQLAlchemy-Continuum integration to work alongside the Zope
|
||||||
|
transaction integration.
|
||||||
|
|
||||||
|
It subclasses
|
||||||
|
``zope.sqlalchemy.datamanager.SessionDataManager`` but injects
|
||||||
|
some SQLAlchemy-Continuum logic within :meth:`tpc_vote()`, and
|
||||||
|
is sort of monkey-patched into the mix.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def tpc_vote(self, trans):
|
def tpc_vote(self, trans):
|
||||||
|
""" """
|
||||||
# for a one phase data manager commit last in tpc_vote
|
# for a one phase data manager commit last in tpc_vote
|
||||||
if self.tx is not None: # there may have been no work to do
|
if self.tx is not None: # there may have been no work to do
|
||||||
|
|
||||||
|
@ -64,25 +75,42 @@ class TailboneSessionDataManager(datamanager.SessionDataManager):
|
||||||
self._finish('committed')
|
self._finish('committed')
|
||||||
|
|
||||||
|
|
||||||
def join_transaction(session, initial_state=datamanager.STATUS_ACTIVE, transaction_manager=datamanager.zope_transaction.manager, keep_session=False):
|
def join_transaction(
|
||||||
"""Join a session to a transaction using the appropriate datamanager.
|
session,
|
||||||
|
initial_state=datamanager.STATUS_ACTIVE,
|
||||||
|
transaction_manager=datamanager.zope_transaction.manager,
|
||||||
|
keep_session=False,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Join a session to a transaction using the appropriate datamanager.
|
||||||
|
|
||||||
It is safe to call this multiple times, if the session is already joined
|
It is safe to call this multiple times, if the session is already
|
||||||
then it just returns.
|
joined then it just returns.
|
||||||
|
|
||||||
`initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or STATUS_READONLY
|
`initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or
|
||||||
|
STATUS_READONLY
|
||||||
|
|
||||||
If using the default initial status of STATUS_ACTIVE, you must ensure that
|
If using the default initial status of STATUS_ACTIVE, you must
|
||||||
mark_changed(session) is called when data is written to the database.
|
ensure that mark_changed(session) is called when data is written
|
||||||
|
to the database.
|
||||||
|
|
||||||
The ZopeTransactionExtesion SessionExtension can be used to ensure that this is
|
The ZopeTransactionExtesion SessionExtension can be used to ensure
|
||||||
called automatically after session write operations.
|
that this is called automatically after session write operations.
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
This function is copied from upstream, and tweaked so that our custom
|
|
||||||
:class:`TailboneSessionDataManager` will be used.
|
This function appears to be necessary in order for the
|
||||||
|
SQLAlchemy-Continuum integration to work alongside the Zope
|
||||||
|
transaction integration.
|
||||||
|
|
||||||
|
It overrides ``zope.sqlalchemy.datamanager.join_transaction()``
|
||||||
|
to ensure the custom :class:`TailboneSessionDataManager` is
|
||||||
|
used, and is sort of monkey-patched into the mix.
|
||||||
"""
|
"""
|
||||||
if datamanager._SESSION_STATE.get(id(session), None) is None:
|
# the upstream internals of this function has changed a little over time.
|
||||||
|
# unfortunately for us, that means we must include each variant here.
|
||||||
|
|
||||||
|
if datamanager._SESSION_STATE.get(session, None) is None:
|
||||||
if session.twophase:
|
if session.twophase:
|
||||||
DataManager = datamanager.TwoPhaseSessionDataManager
|
DataManager = datamanager.TwoPhaseSessionDataManager
|
||||||
else:
|
else:
|
||||||
|
@ -90,44 +118,74 @@ def join_transaction(session, initial_state=datamanager.STATUS_ACTIVE, transacti
|
||||||
DataManager(session, initial_state, transaction_manager, keep_session=keep_session)
|
DataManager(session, initial_state, transaction_manager, keep_session=keep_session)
|
||||||
|
|
||||||
|
|
||||||
class ZopeTransactionExtension(datamanager.ZopeTransactionExtension):
|
class ZopeTransactionEvents(datamanager.ZopeTransactionEvents):
|
||||||
"""Record that a flush has occurred on a session's connection. This allows
|
"""
|
||||||
the DataManager to rollback rather than commit on read only transactions.
|
Record that a flush has occurred on a session's connection. This
|
||||||
|
allows the DataManager to rollback rather than commit on read only
|
||||||
|
transactions.
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
This class is copied from upstream, and tweaked so that our custom
|
|
||||||
:func:`join_transaction()` will be used.
|
This class appears to be necessary in order for the
|
||||||
|
SQLAlchemy-Continuum integration to work alongside the Zope
|
||||||
|
transaction integration.
|
||||||
|
|
||||||
|
It subclasses
|
||||||
|
``zope.sqlalchemy.datamanager.ZopeTransactionEvents`` but
|
||||||
|
overrides various methods to ensure the custom
|
||||||
|
:func:`join_transaction()` is called, and is sort of
|
||||||
|
monkey-patched into the mix.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def after_begin(self, session, transaction, connection):
|
def after_begin(self, session, transaction, connection):
|
||||||
join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session)
|
""" """
|
||||||
|
join_transaction(session, self.initial_state,
|
||||||
|
self.transaction_manager, self.keep_session)
|
||||||
|
|
||||||
def after_attach(self, session, instance):
|
def after_attach(self, session, instance):
|
||||||
join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session)
|
""" """
|
||||||
|
join_transaction(session, self.initial_state,
|
||||||
|
self.transaction_manager, self.keep_session)
|
||||||
|
|
||||||
|
def join_transaction(self, session):
|
||||||
|
""" """
|
||||||
|
join_transaction(session, self.initial_state,
|
||||||
|
self.transaction_manager, self.keep_session)
|
||||||
|
|
||||||
|
|
||||||
def register(session, initial_state=datamanager.STATUS_ACTIVE,
|
def register(
|
||||||
transaction_manager=datamanager.zope_transaction.manager, keep_session=False):
|
session,
|
||||||
"""Register ZopeTransaction listener events on the
|
initial_state=datamanager.STATUS_ACTIVE,
|
||||||
given Session or Session factory/class.
|
transaction_manager=datamanager.zope_transaction.manager,
|
||||||
|
keep_session=False,
|
||||||
|
):
|
||||||
|
"""
|
||||||
|
Register ZopeTransaction listener events on the given Session or
|
||||||
|
Session factory/class.
|
||||||
|
|
||||||
This function requires at least SQLAlchemy 0.7 and makes use
|
This function requires at least SQLAlchemy 0.7 and makes use of
|
||||||
of the newer sqlalchemy.event package in order to register event listeners
|
the newer sqlalchemy.event package in order to register event
|
||||||
on the given Session.
|
listeners on the given Session.
|
||||||
|
|
||||||
The session argument here may be a Session class or subclass, a
|
The session argument here may be a Session class or subclass, a
|
||||||
sessionmaker or scoped_session instance, or a specific Session instance.
|
sessionmaker or scoped_session instance, or a specific Session
|
||||||
Event listening will be specific to the scope of the type of argument
|
instance. Event listening will be specific to the scope of the
|
||||||
passed, including specificity to its subclass as well as its identity.
|
type of argument passed, including specificity to its subclass as
|
||||||
|
well as its identity.
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
This function is copied from upstream, and tweaked so that our custom
|
|
||||||
:class:`ZopeTransactionExtension` will be used.
|
This function appears to be necessary in order for the
|
||||||
|
SQLAlchemy-Continuum integration to work alongside the Zope
|
||||||
|
transaction integration.
|
||||||
|
|
||||||
|
It overrides ``zope.sqlalchemy.datamanager.regsiter()`` to
|
||||||
|
ensure the custom :class:`ZopeTransactionEvents` is used.
|
||||||
"""
|
"""
|
||||||
from sqlalchemy import event
|
from sqlalchemy import event
|
||||||
|
|
||||||
ext = ZopeTransactionExtension(
|
ext = ZopeTransactionEvents(
|
||||||
initial_state=initial_state,
|
initial_state=initial_state,
|
||||||
transaction_manager=transaction_manager,
|
transaction_manager=transaction_manager,
|
||||||
keep_session=keep_session,
|
keep_session=keep_session,
|
||||||
)
|
)
|
||||||
|
@ -139,6 +197,9 @@ def register(session, initial_state=datamanager.STATUS_ACTIVE,
|
||||||
event.listen(session, "after_bulk_delete", ext.after_bulk_delete)
|
event.listen(session, "after_bulk_delete", ext.after_bulk_delete)
|
||||||
event.listen(session, "before_commit", ext.before_commit)
|
event.listen(session, "before_commit", ext.before_commit)
|
||||||
|
|
||||||
|
if datamanager.SA_GE_14:
|
||||||
|
event.listen(session, "do_orm_execute", ext.do_orm_execute)
|
||||||
|
|
||||||
|
|
||||||
register(Session)
|
register(Session)
|
||||||
register(TempmonSession)
|
register(TempmonSession)
|
||||||
|
|
291
tailbone/diffs.py
Normal file
291
tailbone/diffs.py
Normal file
|
@ -0,0 +1,291 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tools for displaying data diffs
|
||||||
|
"""
|
||||||
|
|
||||||
|
import sqlalchemy as sa
|
||||||
|
import sqlalchemy_continuum as continuum
|
||||||
|
|
||||||
|
from pyramid.renderers import render
|
||||||
|
from webhelpers2.html import HTML
|
||||||
|
|
||||||
|
|
||||||
|
class Diff(object):
|
||||||
|
"""
|
||||||
|
Core diff class. In sore need of documentation.
|
||||||
|
|
||||||
|
You must provide the old and new data sets, and the set of
|
||||||
|
relevant fields as well, if they cannot be easily introspected.
|
||||||
|
|
||||||
|
:param old_data: Dict of "old" data values.
|
||||||
|
|
||||||
|
:param new_data: Dict of "old" data values.
|
||||||
|
|
||||||
|
:param fields: Sequence of relevant field names. Note that
|
||||||
|
both data dicts are expected to have keys which match these
|
||||||
|
field names. If you do not specify the fields then they
|
||||||
|
will (hopefully) be introspected from the old or new data
|
||||||
|
sets; however this will not work if they are both empty.
|
||||||
|
|
||||||
|
:param monospace: If true, this flag will cause the value
|
||||||
|
columns to be rendered in monospace font. This is assumed
|
||||||
|
to be helpful when comparing "raw" data values which are
|
||||||
|
shown as e.g. ``repr(val)``.
|
||||||
|
|
||||||
|
:param enums: Optional dict of enums for use when displaying field
|
||||||
|
values. If specified, keys should be field names and values
|
||||||
|
should be enum dicts.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, old_data, new_data, columns=None, fields=None, enums=None,
|
||||||
|
render_field=None, render_value=None, nature='dirty',
|
||||||
|
monospace=False, extra_row_attrs=None):
|
||||||
|
self.old_data = old_data
|
||||||
|
self.new_data = new_data
|
||||||
|
self.columns = columns or ["field name", "old value", "new value"]
|
||||||
|
self.fields = fields or self.make_fields()
|
||||||
|
self.enums = enums or {}
|
||||||
|
self._render_field = render_field or self.render_field_default
|
||||||
|
self.render_value = render_value or self.render_value_default
|
||||||
|
self.nature = nature
|
||||||
|
self.monospace = monospace
|
||||||
|
self.extra_row_attrs = extra_row_attrs
|
||||||
|
|
||||||
|
def make_fields(self):
|
||||||
|
return sorted(set(self.old_data) | set(self.new_data), key=lambda x: x.lower())
|
||||||
|
|
||||||
|
def old_value(self, field):
|
||||||
|
return self.old_data.get(field)
|
||||||
|
|
||||||
|
def new_value(self, field):
|
||||||
|
return self.new_data.get(field)
|
||||||
|
|
||||||
|
def values_differ(self, field):
|
||||||
|
return self.new_value(field) != self.old_value(field)
|
||||||
|
|
||||||
|
def render_html(self, template='/diff.mako', **kwargs):
|
||||||
|
context = kwargs
|
||||||
|
context['diff'] = self
|
||||||
|
return HTML.literal(render(template, context))
|
||||||
|
|
||||||
|
def get_row_attrs(self, field):
|
||||||
|
"""
|
||||||
|
Returns a *rendered* set of extra attributes for the ``<tr>`` element
|
||||||
|
for the given field. May be an empty string, or a snippet of HTML
|
||||||
|
attribute syntax, e.g.:
|
||||||
|
|
||||||
|
.. code-block:: none
|
||||||
|
|
||||||
|
class="diff" foo="bar"
|
||||||
|
|
||||||
|
If you wish to supply additional attributes, please define
|
||||||
|
:attr:`extra_row_attrs`, which can be either a static dict, or a
|
||||||
|
callable returning a dict.
|
||||||
|
"""
|
||||||
|
attrs = {}
|
||||||
|
if self.values_differ(field):
|
||||||
|
attrs['class'] = 'diff'
|
||||||
|
|
||||||
|
if self.extra_row_attrs:
|
||||||
|
if callable(self.extra_row_attrs):
|
||||||
|
attrs.update(self.extra_row_attrs(field, attrs))
|
||||||
|
else:
|
||||||
|
attrs.update(self.extra_row_attrs)
|
||||||
|
|
||||||
|
return HTML.render_attrs(attrs)
|
||||||
|
|
||||||
|
def render_field(self, field):
|
||||||
|
return self._render_field(field, self)
|
||||||
|
|
||||||
|
def render_field_default(self, field, diff):
|
||||||
|
return field
|
||||||
|
|
||||||
|
def render_value_default(self, field, value):
|
||||||
|
return repr(value)
|
||||||
|
|
||||||
|
def render_old_value(self, field):
|
||||||
|
value = self.old_value(field)
|
||||||
|
return self.render_value(field, value)
|
||||||
|
|
||||||
|
def render_new_value(self, field):
|
||||||
|
value = self.new_value(field)
|
||||||
|
return self.render_value(field, value)
|
||||||
|
|
||||||
|
|
||||||
|
class VersionDiff(Diff):
|
||||||
|
"""
|
||||||
|
Special diff class, for use with version history views. Note that
|
||||||
|
while based on :class:`Diff`, this class uses a different
|
||||||
|
signature for the constructor.
|
||||||
|
|
||||||
|
:param version: Reference to a Continuum version record (object).
|
||||||
|
|
||||||
|
:param \*args: Typical usage will not require positional args
|
||||||
|
beyond the ``version`` param, in which case ``old_data`` and
|
||||||
|
``new_data`` params will be auto-determined based on the
|
||||||
|
``version``. But if you specify positional args then nothing
|
||||||
|
automatic is done, they are passed as-is to the parent
|
||||||
|
:class:`Diff` constructor.
|
||||||
|
|
||||||
|
:param \*\*kwargs: Remaining kwargs are passed as-is to the
|
||||||
|
:class:`Diff` constructor.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, version, *args, **kwargs):
|
||||||
|
self.version = version
|
||||||
|
self.mapper = sa.inspect(continuum.parent_class(type(self.version)))
|
||||||
|
self.version_mapper = sa.inspect(type(self.version))
|
||||||
|
self.title = kwargs.pop('title', None)
|
||||||
|
|
||||||
|
if 'nature' not in kwargs:
|
||||||
|
if version.previous and version.operation_type == continuum.Operation.DELETE:
|
||||||
|
kwargs['nature'] = 'deleted'
|
||||||
|
elif version.previous:
|
||||||
|
kwargs['nature'] = 'dirty'
|
||||||
|
else:
|
||||||
|
kwargs['nature'] = 'new'
|
||||||
|
|
||||||
|
if 'fields' not in kwargs:
|
||||||
|
kwargs['fields'] = self.get_default_fields()
|
||||||
|
|
||||||
|
if not args:
|
||||||
|
old_data = {}
|
||||||
|
new_data = {}
|
||||||
|
for field in kwargs['fields']:
|
||||||
|
if version.previous:
|
||||||
|
old_data[field] = getattr(version.previous, field)
|
||||||
|
new_data[field] = getattr(version, field)
|
||||||
|
args = (old_data, new_data)
|
||||||
|
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
|
||||||
|
def get_default_fields(self):
|
||||||
|
fields = sorted(self.version_mapper.columns.keys())
|
||||||
|
|
||||||
|
unwanted = [
|
||||||
|
'transaction_id',
|
||||||
|
'end_transaction_id',
|
||||||
|
'operation_type',
|
||||||
|
]
|
||||||
|
|
||||||
|
return [field for field in fields
|
||||||
|
if field not in unwanted]
|
||||||
|
|
||||||
|
def render_version_value(self, field, value, version):
|
||||||
|
"""
|
||||||
|
Render the cell value text for the given version/field info.
|
||||||
|
|
||||||
|
Note that this method is used to render both sides of the diff
|
||||||
|
(before and after values).
|
||||||
|
|
||||||
|
:param field: Name of the field, as string.
|
||||||
|
|
||||||
|
:param value: Raw value for the field, as obtained from ``version``.
|
||||||
|
|
||||||
|
:param version: Reference to the Continuum version object.
|
||||||
|
|
||||||
|
:returns: Rendered text as string, or ``None``.
|
||||||
|
"""
|
||||||
|
text = HTML.tag('span', c=[repr(value)],
|
||||||
|
style='font-family: monospace;')
|
||||||
|
|
||||||
|
# assume the enum display is all we need, if enum exists for the field
|
||||||
|
if field in self.enums:
|
||||||
|
|
||||||
|
# but skip the enum display if None
|
||||||
|
display = self.enums[field].get(value)
|
||||||
|
if display is None and value is None:
|
||||||
|
return text
|
||||||
|
|
||||||
|
# otherwise show enum display to the right of raw value
|
||||||
|
display = self.enums[field].get(value, str(value))
|
||||||
|
return HTML.tag('span', c=[
|
||||||
|
text,
|
||||||
|
HTML.tag('span', c=[display],
|
||||||
|
style='margin-left: 2rem; font-style: italic; font-weight: bold;'),
|
||||||
|
])
|
||||||
|
|
||||||
|
# next we look for a relationship and may render the foreign object
|
||||||
|
for prop in self.mapper.relationships:
|
||||||
|
if prop.uselist:
|
||||||
|
continue
|
||||||
|
|
||||||
|
for col in prop.local_columns:
|
||||||
|
if col.name != field:
|
||||||
|
continue
|
||||||
|
|
||||||
|
if not hasattr(version, prop.key):
|
||||||
|
continue
|
||||||
|
|
||||||
|
if col in self.mapper.primary_key:
|
||||||
|
continue
|
||||||
|
|
||||||
|
ref = getattr(version, prop.key)
|
||||||
|
if ref:
|
||||||
|
ref = getattr(ref, 'version_parent', None)
|
||||||
|
if ref:
|
||||||
|
return HTML.tag('span', c=[
|
||||||
|
text,
|
||||||
|
HTML.tag('span', c=[str(ref)],
|
||||||
|
style='margin-left: 2rem; font-style: italic; font-weight: bold;'),
|
||||||
|
])
|
||||||
|
|
||||||
|
return text
|
||||||
|
|
||||||
|
def render_old_value(self, field):
|
||||||
|
if self.nature == 'new':
|
||||||
|
return ''
|
||||||
|
value = self.old_value(field)
|
||||||
|
return self.render_version_value(field, value, self.version.previous)
|
||||||
|
|
||||||
|
def render_new_value(self, field):
|
||||||
|
if self.nature == 'deleted':
|
||||||
|
return ''
|
||||||
|
value = self.new_value(field)
|
||||||
|
return self.render_version_value(field, value, self.version)
|
||||||
|
|
||||||
|
def as_struct(self):
|
||||||
|
values = {}
|
||||||
|
for field in self.fields:
|
||||||
|
values[field] = {'before': self.render_old_value(field),
|
||||||
|
'after': self.render_new_value(field)}
|
||||||
|
|
||||||
|
operation = None
|
||||||
|
if self.version.operation_type == continuum.Operation.INSERT:
|
||||||
|
operation = 'INSERT'
|
||||||
|
elif self.version.operation_type == continuum.Operation.UPDATE:
|
||||||
|
operation = 'UPDATE'
|
||||||
|
elif self.version.operation_type == continuum.Operation.DELETE:
|
||||||
|
operation = 'DELETE'
|
||||||
|
else:
|
||||||
|
operation = self.version.operation_type
|
||||||
|
|
||||||
|
return {
|
||||||
|
'key': id(self.version),
|
||||||
|
'model_title': self.title,
|
||||||
|
'operation': operation,
|
||||||
|
'diff_class': self.nature,
|
||||||
|
'fields': self.fields,
|
||||||
|
'values': values,
|
||||||
|
}
|
49
tailbone/exceptions.py
Normal file
49
tailbone/exceptions.py
Normal file
|
@ -0,0 +1,49 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Exceptions
|
||||||
|
"""
|
||||||
|
|
||||||
|
from rattail.exceptions import RattailError
|
||||||
|
|
||||||
|
|
||||||
|
class TailboneError(RattailError):
|
||||||
|
"""
|
||||||
|
Base class for all Tailbone exceptions.
|
||||||
|
"""
|
||||||
|
|
||||||
|
|
||||||
|
class TailboneJSONFieldError(TailboneError):
|
||||||
|
"""
|
||||||
|
Error raised when JSON serialization of a form field results in an error.
|
||||||
|
This is just a simple wrapper, to make the error message more helpful for
|
||||||
|
the developer.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, field, error):
|
||||||
|
self.field = field
|
||||||
|
self.error = error
|
||||||
|
|
||||||
|
def __str__(self):
|
||||||
|
return ("Failed to serialize field '{}' as JSON! "
|
||||||
|
"Original error was: {}".format(self.field, self.error))
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8; -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,19 +21,10 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Forms
|
Forms Library
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
# nb. import widgets before types, b/c types may refer to widgets
|
||||||
|
from . import widgets
|
||||||
from formencode import Schema
|
from . import types
|
||||||
|
from .core import Form, SimpleFileImport
|
||||||
from .core import Form, Field, FieldSet, GenericFieldSet
|
|
||||||
from .simpleform import SimpleForm, FormRenderer
|
|
||||||
from .alchemy import AlchemyForm
|
|
||||||
from .fields import AssociationProxyField
|
|
||||||
from .renderers import *
|
|
||||||
|
|
||||||
from . import fields
|
|
||||||
from . import renderers
|
|
||||||
from . import validators
|
|
||||||
|
|
|
@ -1,117 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
FormAlchemy Forms
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from rattail.core import Object
|
|
||||||
|
|
||||||
import formalchemy as fa
|
|
||||||
from pyramid.renderers import render
|
|
||||||
from webhelpers2.html import HTML, tags
|
|
||||||
|
|
||||||
from tailbone.db import Session
|
|
||||||
|
|
||||||
|
|
||||||
class TemplateEngine(fa.templates.TemplateEngine):
|
|
||||||
"""
|
|
||||||
Mako template engine for FormAlchemy.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render(self, template, prefix='/forms/', suffix='.mako', **kwargs):
|
|
||||||
template = ''.join((prefix, template, suffix))
|
|
||||||
return render(template, kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyForm(Object):
|
|
||||||
"""
|
|
||||||
Form to contain a :class:`formalchemy.FieldSet` instance.
|
|
||||||
"""
|
|
||||||
id = None
|
|
||||||
create_label = "Create"
|
|
||||||
update_label = "Save"
|
|
||||||
|
|
||||||
allow_successive_creates = False
|
|
||||||
|
|
||||||
def __init__(self, request, fieldset, session=None, csrf_field='_csrf', **kwargs):
|
|
||||||
super(AlchemyForm, self).__init__(**kwargs)
|
|
||||||
self.request = request
|
|
||||||
self.fieldset = fieldset
|
|
||||||
self.session = session
|
|
||||||
self.csrf_field = csrf_field
|
|
||||||
|
|
||||||
def _get_readonly(self):
|
|
||||||
return self.fieldset.readonly
|
|
||||||
def _set_readonly(self, val):
|
|
||||||
self.fieldset.readonly = val
|
|
||||||
readonly = property(_get_readonly, _set_readonly)
|
|
||||||
|
|
||||||
@property
|
|
||||||
def successive_create_label(self):
|
|
||||||
return "%s and continue" % self.create_label
|
|
||||||
|
|
||||||
def csrf(self, name=None):
|
|
||||||
"""
|
|
||||||
NOTE: this method was copied from `pyramid_simpleform.FormRenderer`
|
|
||||||
|
|
||||||
Returns the CSRF hidden input. Creates new CSRF token
|
|
||||||
if none has been assigned yet.
|
|
||||||
|
|
||||||
The name of the hidden field is **_csrf** by default.
|
|
||||||
"""
|
|
||||||
name = name or self.csrf_field
|
|
||||||
|
|
||||||
token = self.request.session.get_csrf_token()
|
|
||||||
if token is None:
|
|
||||||
token = self.request.session.new_csrf_token()
|
|
||||||
|
|
||||||
return tags.hidden(name, value=token)
|
|
||||||
|
|
||||||
def csrf_token(self, name=None):
|
|
||||||
"""
|
|
||||||
NOTE: this method was copied from `pyramid_simpleform.FormRenderer`
|
|
||||||
|
|
||||||
Convenience function. Returns CSRF hidden tag inside hidden DIV.
|
|
||||||
"""
|
|
||||||
return HTML.tag("div", self.csrf(name), style="display:none;")
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
kwargs['form'] = self
|
|
||||||
if self.readonly:
|
|
||||||
template = '/forms/form_readonly.mako'
|
|
||||||
else:
|
|
||||||
template = '/forms/form.mako'
|
|
||||||
return render(template, kwargs)
|
|
||||||
|
|
||||||
def render_fields(self):
|
|
||||||
return self.fieldset.render()
|
|
||||||
|
|
||||||
def save(self):
|
|
||||||
self.fieldset.sync()
|
|
||||||
self.session.flush()
|
|
||||||
|
|
||||||
def validate(self):
|
|
||||||
self.fieldset.rebind(data=self.request.params)
|
|
||||||
return self.fieldset.validate()
|
|
62
tailbone/forms/common.py
Normal file
62
tailbone/forms/common.py
Normal file
|
@ -0,0 +1,62 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Common Forms
|
||||||
|
"""
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
|
||||||
|
import colander
|
||||||
|
|
||||||
|
|
||||||
|
@colander.deferred
|
||||||
|
def validate_user(node, kw):
|
||||||
|
session = kw['session']
|
||||||
|
def validate(node, value):
|
||||||
|
user = session.get(model.User, value)
|
||||||
|
if not user:
|
||||||
|
raise colander.Invalid(node, "User not found")
|
||||||
|
return user.uuid
|
||||||
|
return validate
|
||||||
|
|
||||||
|
|
||||||
|
class Feedback(colander.Schema):
|
||||||
|
"""
|
||||||
|
Form schema for user feedback.
|
||||||
|
"""
|
||||||
|
email_key = colander.SchemaNode(colander.String(),
|
||||||
|
missing=colander.null)
|
||||||
|
|
||||||
|
referrer = colander.SchemaNode(colander.String())
|
||||||
|
|
||||||
|
user = colander.SchemaNode(colander.String(),
|
||||||
|
missing=colander.null,
|
||||||
|
validator=validate_user)
|
||||||
|
|
||||||
|
user_name = colander.SchemaNode(colander.String(),
|
||||||
|
missing=colander.null)
|
||||||
|
|
||||||
|
please_reply_to = colander.SchemaNode(colander.String(),
|
||||||
|
missing=colander.null)
|
||||||
|
|
||||||
|
message = colander.SchemaNode(colander.String())
|
File diff suppressed because it is too large
Load diff
|
@ -1,106 +0,0 @@
|
||||||
# -*- coding: utf-8 -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
FormAlchemy Fields
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import formalchemy as fa
|
|
||||||
|
|
||||||
|
|
||||||
def AssociationProxyField(name, **kwargs):
|
|
||||||
"""
|
|
||||||
Returns a FormAlchemy ``Field`` class which is aware of association
|
|
||||||
proxies.
|
|
||||||
"""
|
|
||||||
|
|
||||||
class ProxyField(fa.Field):
|
|
||||||
|
|
||||||
def sync(self):
|
|
||||||
if not self.is_readonly():
|
|
||||||
setattr(self.parent.model, self.name,
|
|
||||||
self.renderer.deserialize())
|
|
||||||
|
|
||||||
def value(obj):
|
|
||||||
return getattr(obj, name, None)
|
|
||||||
|
|
||||||
kwargs.setdefault('value', value)
|
|
||||||
return ProxyField(name, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class DefaultEmailField(fa.Field):
|
|
||||||
"""
|
|
||||||
Generic field for view/edit of default email address for a contact
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, name=None, **kwargs):
|
|
||||||
kwargs.setdefault('value', self.value)
|
|
||||||
if 'renderer' not in kwargs:
|
|
||||||
from tailbone.forms.renderers import EmailFieldRenderer
|
|
||||||
kwargs['renderer'] = EmailFieldRenderer
|
|
||||||
super(DefaultEmailField, self).__init__(name, **kwargs)
|
|
||||||
|
|
||||||
def value(self, contact):
|
|
||||||
if contact.emails:
|
|
||||||
return contact.emails[0].address
|
|
||||||
|
|
||||||
def sync(self):
|
|
||||||
if not self.is_readonly():
|
|
||||||
address = self._deserialize()
|
|
||||||
contact = self.parent.model
|
|
||||||
if contact.emails:
|
|
||||||
if address:
|
|
||||||
email = contact.emails[0]
|
|
||||||
email.address = address
|
|
||||||
else:
|
|
||||||
contact.emails.pop(0)
|
|
||||||
elif address:
|
|
||||||
email = contact.add_email_address(address)
|
|
||||||
|
|
||||||
|
|
||||||
class DefaultPhoneField(fa.Field):
|
|
||||||
"""
|
|
||||||
Generic field for view/edit of default phone number for a contact
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, name=None, **kwargs):
|
|
||||||
kwargs.setdefault('value', self.value)
|
|
||||||
super(DefaultPhoneField, self).__init__(name, **kwargs)
|
|
||||||
|
|
||||||
def value(self, contact):
|
|
||||||
if contact.phones:
|
|
||||||
return contact.phones[0].number
|
|
||||||
|
|
||||||
def sync(self):
|
|
||||||
if not self.is_readonly():
|
|
||||||
number = self._deserialize()
|
|
||||||
contact = self.parent.model
|
|
||||||
if contact.phones:
|
|
||||||
if number:
|
|
||||||
phone = contact.phones[0]
|
|
||||||
phone.number = number
|
|
||||||
else:
|
|
||||||
contact.phones.pop(0)
|
|
||||||
elif number:
|
|
||||||
phone = contact.add_phone_number(number)
|
|
68
tailbone/forms/receiving.py
Normal file
68
tailbone/forms/receiving.py
Normal file
|
@ -0,0 +1,68 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Forms for Receiving
|
||||||
|
"""
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
|
||||||
|
import colander
|
||||||
|
|
||||||
|
|
||||||
|
@colander.deferred
|
||||||
|
def valid_purchase_batch_row(node, kw):
|
||||||
|
session = kw['session']
|
||||||
|
def validate(node, value):
|
||||||
|
row = session.get(model.PurchaseBatchRow, value)
|
||||||
|
if not row:
|
||||||
|
raise colander.Invalid(node, "Batch row not found")
|
||||||
|
if row.batch.executed:
|
||||||
|
raise colander.Invalid(node, "Batch has already been executed")
|
||||||
|
return row.uuid
|
||||||
|
return validate
|
||||||
|
|
||||||
|
|
||||||
|
class ReceiveRow(colander.MappingSchema):
|
||||||
|
|
||||||
|
row = colander.SchemaNode(colander.String(),
|
||||||
|
validator=valid_purchase_batch_row)
|
||||||
|
|
||||||
|
mode = colander.SchemaNode(colander.String(),
|
||||||
|
validator=colander.OneOf([
|
||||||
|
'received',
|
||||||
|
'damaged',
|
||||||
|
'expired',
|
||||||
|
'missing',
|
||||||
|
# 'mispick',
|
||||||
|
]))
|
||||||
|
|
||||||
|
cases = colander.SchemaNode(colander.Decimal(),
|
||||||
|
missing=colander.null)
|
||||||
|
|
||||||
|
units = colander.SchemaNode(colander.Decimal(),
|
||||||
|
missing=colander.null)
|
||||||
|
|
||||||
|
expiration_date = colander.SchemaNode(colander.Date(),
|
||||||
|
missing=colander.null)
|
||||||
|
|
||||||
|
quick_receive = colander.SchemaNode(colander.Boolean())
|
|
@ -1,51 +0,0 @@
|
||||||
# -*- coding: utf-8 -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
FormAlchemy Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from .core import CustomFieldRenderer, DateFieldRenderer
|
|
||||||
|
|
||||||
from .common import (StrippedTextFieldRenderer, CodeTextAreaFieldRenderer, AutocompleteFieldRenderer,
|
|
||||||
DecimalFieldRenderer, CurrencyFieldRenderer, QuantityFieldRenderer,
|
|
||||||
DateTimeFieldRenderer, DateTimePrettyFieldRenderer, TimeFieldRenderer,
|
|
||||||
EmailFieldRenderer, EnumFieldRenderer, YesNoFieldRenderer)
|
|
||||||
|
|
||||||
from .files import FileFieldRenderer
|
|
||||||
|
|
||||||
from .people import PersonFieldRenderer, PeopleFieldRenderer, CustomerFieldRenderer
|
|
||||||
from .users import UserFieldRenderer, PermissionsFieldRenderer
|
|
||||||
from .employees import EmployeeFieldRenderer
|
|
||||||
|
|
||||||
from .stores import StoreFieldRenderer
|
|
||||||
from .vendors import VendorFieldRenderer, PurchaseFieldRenderer
|
|
||||||
from .products import (GPCFieldRenderer, ScancodeFieldRenderer,
|
|
||||||
DepartmentFieldRenderer, SubdepartmentFieldRenderer, CategoryFieldRenderer,
|
|
||||||
BrandFieldRenderer, ProductFieldRenderer,
|
|
||||||
CostFieldRenderer, PriceFieldRenderer, PriceWithExpirationFieldRenderer)
|
|
||||||
|
|
||||||
from .custorders import CustomerOrderFieldRenderer
|
|
||||||
|
|
||||||
from .batch import BatchIDFieldRenderer, HandheldBatchFieldRenderer, HandheldBatchesFieldRenderer
|
|
|
@ -1,103 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Batch Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import os
|
|
||||||
import stat
|
|
||||||
import random
|
|
||||||
|
|
||||||
import formalchemy as fa
|
|
||||||
from webhelpers2.html import tags, HTML
|
|
||||||
|
|
||||||
from tailbone.forms.renderers import FileFieldRenderer as BaseFileFieldRenderer
|
|
||||||
|
|
||||||
|
|
||||||
class BatchIDFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for batch ID fields.
|
|
||||||
"""
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
try:
|
|
||||||
batch_id = self.raw_value
|
|
||||||
except AttributeError:
|
|
||||||
# this can happen when creating a new batch, b/c the default value
|
|
||||||
# comes from a sequence
|
|
||||||
pass
|
|
||||||
else:
|
|
||||||
if batch_id:
|
|
||||||
return '{:08d}'.format(batch_id)
|
|
||||||
return ''
|
|
||||||
|
|
||||||
|
|
||||||
class FileFieldRenderer(BaseFileFieldRenderer):
|
|
||||||
"""
|
|
||||||
Custom file field renderer for batches based on a single source data file.
|
|
||||||
In edit mode, shows a file upload field. In readonly mode, shows the
|
|
||||||
filename and its size.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def get_size(self):
|
|
||||||
size = super(FileFieldRenderer, self).get_size()
|
|
||||||
if size:
|
|
||||||
return size
|
|
||||||
batch = self.field.parent.model
|
|
||||||
path = batch.filepath(self.request.rattail_config, filename=self.field.value)
|
|
||||||
if os.path.isfile(path):
|
|
||||||
return os.stat(path)[stat.ST_SIZE]
|
|
||||||
return 0
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
return BaseFileFieldRenderer.render(self, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class HandheldBatchFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for inventory batch's "handheld batch" field.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
batch = self.raw_value
|
|
||||||
if batch:
|
|
||||||
return tags.link_to(
|
|
||||||
batch.id_str,
|
|
||||||
self.request.route_url('batch.handheld.view', uuid=batch.uuid))
|
|
||||||
return ''
|
|
||||||
|
|
||||||
|
|
||||||
class HandheldBatchesFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Renders a list of associated handheld batches, for a given (presumably
|
|
||||||
inventory or labels) batch.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
items = ''
|
|
||||||
for handheld in self.raw_value:
|
|
||||||
text = tags.link_to(handheld.handheld.id_str,
|
|
||||||
self.request.route_url('batch.handheld.view', uuid=handheld.handheld_uuid))
|
|
||||||
items += HTML.tag('li', c=text)
|
|
||||||
return HTML.tag('ul', c=items)
|
|
|
@ -1,63 +0,0 @@
|
||||||
# -*- coding: utf-8 -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Batch Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals
|
|
||||||
|
|
||||||
import os
|
|
||||||
import stat
|
|
||||||
import random
|
|
||||||
|
|
||||||
from formalchemy.ext import fsblob
|
|
||||||
|
|
||||||
|
|
||||||
class BounceMessageFieldRenderer(fsblob.FileFieldRenderer):
|
|
||||||
"""
|
|
||||||
Custom file field renderer for email bounce messages. In readonly mode,
|
|
||||||
shows the filename and size.
|
|
||||||
"""
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def new(cls, request, handler):
|
|
||||||
name = 'Configured%s_%s' % (cls.__name__, unicode(random.random())[2:])
|
|
||||||
return type(str(name), (cls,), dict(request=request, handler=handler))
|
|
||||||
|
|
||||||
@property
|
|
||||||
def storage_path(self):
|
|
||||||
return self.handler.root_msgdir
|
|
||||||
|
|
||||||
def get_size(self):
|
|
||||||
size = super(BounceMessageFieldRenderer, self).get_size()
|
|
||||||
if size:
|
|
||||||
return size
|
|
||||||
bounce = self.field.parent.model
|
|
||||||
path = os.path.join(self.handler.msgpath(bounce))
|
|
||||||
if os.path.isfile(path):
|
|
||||||
return os.stat(path)[stat.ST_SIZE]
|
|
||||||
return 0
|
|
||||||
|
|
||||||
def get_url(self, filename):
|
|
||||||
bounce = self.field.parent.model
|
|
||||||
return self.request.route_url('emailbounces.download', uuid=bounce.uuid)
|
|
|
@ -1,302 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Common Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import datetime
|
|
||||||
|
|
||||||
from rattail.time import localtime, make_utc
|
|
||||||
from rattail.util import pretty_quantity
|
|
||||||
|
|
||||||
import formalchemy as fa
|
|
||||||
from formalchemy import fields as fa_fields, helpers as fa_helpers
|
|
||||||
from pyramid.renderers import render
|
|
||||||
from webhelpers2.html import HTML, tags
|
|
||||||
|
|
||||||
from tailbone.util import pretty_datetime, raw_datetime
|
|
||||||
|
|
||||||
|
|
||||||
class StrippedTextFieldRenderer(fa.TextFieldRenderer):
|
|
||||||
"""
|
|
||||||
Standard text field renderer, which strips whitespace from either end of
|
|
||||||
the input value on deserialization.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def deserialize(self):
|
|
||||||
value = super(StrippedTextFieldRenderer, self).deserialize()
|
|
||||||
if value is not None:
|
|
||||||
return value.strip()
|
|
||||||
|
|
||||||
|
|
||||||
class CodeTextAreaFieldRenderer(fa.TextAreaFieldRenderer):
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if not value:
|
|
||||||
return ''
|
|
||||||
return HTML.tag('pre', c=value)
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
kwargs.setdefault('size', (80, 8))
|
|
||||||
return super(CodeTextAreaFieldRenderer, self).render(**kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class AutocompleteFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Custom renderer for an autocomplete field.
|
|
||||||
"""
|
|
||||||
|
|
||||||
service_route = None
|
|
||||||
width = '300px'
|
|
||||||
|
|
||||||
@property
|
|
||||||
def focus_name(self):
|
|
||||||
return self.name + '-textbox'
|
|
||||||
|
|
||||||
@property
|
|
||||||
def needs_focus(self):
|
|
||||||
return not bool(self.value or self.field_value)
|
|
||||||
|
|
||||||
@property
|
|
||||||
def field_display(self):
|
|
||||||
return self.raw_value
|
|
||||||
|
|
||||||
@property
|
|
||||||
def field_value(self):
|
|
||||||
return self.value
|
|
||||||
|
|
||||||
@property
|
|
||||||
def service_url(self):
|
|
||||||
return self.request.route_url(self.service_route)
|
|
||||||
|
|
||||||
def render(self, options=None, **kwargs):
|
|
||||||
if kwargs.pop('autocomplete', True):
|
|
||||||
return self.render_autocomplete(**kwargs)
|
|
||||||
# 'selected' is a kwarg for autocomplete template *and* select tag
|
|
||||||
kwargs.pop('selected', None)
|
|
||||||
return self.render_dropdown(options, **kwargs)
|
|
||||||
|
|
||||||
def render_autocomplete(self, **kwargs):
|
|
||||||
kwargs.setdefault('field_name', self.name)
|
|
||||||
kwargs.setdefault('field_value', self.field_value)
|
|
||||||
kwargs.setdefault('field_display', self.field_display)
|
|
||||||
kwargs.setdefault('service_url', self.service_url)
|
|
||||||
kwargs.setdefault('width', self.width)
|
|
||||||
return render('/forms/field_autocomplete.mako', kwargs)
|
|
||||||
|
|
||||||
def render_dropdown(self, options, **kwargs):
|
|
||||||
# NOTE: this logic copied from formalchemy.fields.SelectFieldRenderer.render()
|
|
||||||
kwargs.setdefault('auto-enhance', 'true')
|
|
||||||
if callable(options):
|
|
||||||
L = fa_fields._normalized_options(options(self.field.parent))
|
|
||||||
if not self.field.is_required() and not self.field.is_collection:
|
|
||||||
L.insert(0, self.field._null_option)
|
|
||||||
else:
|
|
||||||
L = list(options)
|
|
||||||
if len(L) > 0:
|
|
||||||
if len(L[0]) == 2:
|
|
||||||
L = [(k, self.stringify_value(v)) for k, v in L]
|
|
||||||
else:
|
|
||||||
L = [fa_fields._stringify(k) for k in L]
|
|
||||||
return fa_fields.h.select(self.name, self.value, L, **kwargs)
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.field_display
|
|
||||||
if value is None:
|
|
||||||
return u''
|
|
||||||
return unicode(value)
|
|
||||||
|
|
||||||
|
|
||||||
class DateTimeFieldRenderer(fa.DateTimeFieldRenderer):
|
|
||||||
"""
|
|
||||||
This renderer assumes the datetime field value is in UTC, and will convert
|
|
||||||
it to the local time zone before rendering it in the standard "raw" format.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if not value:
|
|
||||||
return ''
|
|
||||||
return raw_datetime(self.request.rattail_config, value)
|
|
||||||
|
|
||||||
|
|
||||||
class DateTimePrettyFieldRenderer(fa.DateTimeFieldRenderer):
|
|
||||||
"""
|
|
||||||
Custom date/time field renderer, which displays a "pretty" value in
|
|
||||||
read-only mode, leveraging config to show the correct timezone.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if not value:
|
|
||||||
return ''
|
|
||||||
return pretty_datetime(self.request.rattail_config, value)
|
|
||||||
|
|
||||||
|
|
||||||
class TimeFieldRenderer(fa.TimeFieldRenderer):
|
|
||||||
"""
|
|
||||||
Custom renderer for time fields. In edit mode, renders a simple text
|
|
||||||
input, which is expected to become a 'timepicker' widget in the UI.
|
|
||||||
However the particular magic required for that lives in 'tailbone.js'.
|
|
||||||
"""
|
|
||||||
format = '%I:%M %p'
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
kwargs.setdefault('class_', 'timepicker')
|
|
||||||
return fa_helpers.text_field(self.name, value=self.value, **kwargs)
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
return self.render_value(self.raw_value)
|
|
||||||
|
|
||||||
def render_value(self, value):
|
|
||||||
value = self.convert_value(value)
|
|
||||||
if isinstance(value, datetime.time):
|
|
||||||
return value.strftime(self.format)
|
|
||||||
return ''
|
|
||||||
|
|
||||||
def convert_value(self, value):
|
|
||||||
if isinstance(value, datetime.datetime):
|
|
||||||
if not value.tzinfo:
|
|
||||||
value = make_utc(value, tzinfo=True)
|
|
||||||
return localtime(self.request.rattail_config, value).time()
|
|
||||||
return value
|
|
||||||
|
|
||||||
def stringify_value(self, value, as_html=False):
|
|
||||||
if not as_html:
|
|
||||||
return self.render_value(value)
|
|
||||||
return super(TimeFieldRenderer, self).stringify_value(value, as_html=as_html)
|
|
||||||
|
|
||||||
def _serialized_value(self):
|
|
||||||
return self.params.getone(self.name)
|
|
||||||
|
|
||||||
def deserialize(self):
|
|
||||||
value = self._serialized_value()
|
|
||||||
if value:
|
|
||||||
try:
|
|
||||||
return datetime.datetime.strptime(value, self.format).time()
|
|
||||||
except ValueError:
|
|
||||||
pass
|
|
||||||
|
|
||||||
|
|
||||||
class EmailFieldRenderer(fa.TextFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for email address fields
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
address = self.raw_value
|
|
||||||
if not address:
|
|
||||||
return ''
|
|
||||||
return tags.link_to(address, 'mailto:{}'.format(address))
|
|
||||||
|
|
||||||
|
|
||||||
class EnumFieldRenderer(fa_fields.SelectFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for simple enumeration fields.
|
|
||||||
"""
|
|
||||||
enumeration = {}
|
|
||||||
render_key = False
|
|
||||||
|
|
||||||
def __init__(self, arg, render_key=False):
|
|
||||||
if isinstance(arg, dict):
|
|
||||||
self.enumeration = arg
|
|
||||||
self.render_key = render_key
|
|
||||||
else:
|
|
||||||
self(arg)
|
|
||||||
|
|
||||||
def __call__(self, field):
|
|
||||||
super(EnumFieldRenderer, self).__init__(field)
|
|
||||||
return self
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if value is None:
|
|
||||||
return ''
|
|
||||||
rendered = self.enumeration.get(value, unicode(value))
|
|
||||||
if self.render_key:
|
|
||||||
rendered = '{} - {}'.format(value, rendered)
|
|
||||||
return rendered
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
opts = [(self.enumeration[x], x) for x in self.enumeration]
|
|
||||||
if not self.field.is_required():
|
|
||||||
opts.insert(0, self.field._null_option)
|
|
||||||
return fa_fields.SelectFieldRenderer.render(self, opts, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class DecimalFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Sort of generic field renderer for decimal values. You must provide the
|
|
||||||
number of places after the decimal (scale). Note that this in turn relies
|
|
||||||
on simple string formatting; the renderer does not attempt any mathematics
|
|
||||||
of its own.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, scale):
|
|
||||||
self.scale = scale
|
|
||||||
|
|
||||||
def __call__(self, field):
|
|
||||||
super(DecimalFieldRenderer, self).__init__(field)
|
|
||||||
return self
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if value is None:
|
|
||||||
return ''
|
|
||||||
fmt = '{{0:0.{0}f}}'.format(self.scale)
|
|
||||||
return fmt.format(value)
|
|
||||||
|
|
||||||
|
|
||||||
class CurrencyFieldRenderer(fa_fields.FloatFieldRenderer):
|
|
||||||
"""
|
|
||||||
Sort of generic field renderer for currency values.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if value is None:
|
|
||||||
return ''
|
|
||||||
if value < 0:
|
|
||||||
return "(${:0,.2f})".format(0 - value)
|
|
||||||
return "${:0,.2f}".format(value)
|
|
||||||
|
|
||||||
|
|
||||||
class QuantityFieldRenderer(fa_fields.FloatFieldRenderer):
|
|
||||||
"""
|
|
||||||
Sort of generic field renderer for quantity values.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
return pretty_quantity(self.raw_value)
|
|
||||||
|
|
||||||
|
|
||||||
class YesNoFieldRenderer(fa.CheckBoxFieldRenderer):
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if value is None:
|
|
||||||
return u''
|
|
||||||
return u'Yes' if value else u'No'
|
|
|
@ -1,100 +0,0 @@
|
||||||
# -*- coding: utf-8 -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Core Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import datetime
|
|
||||||
|
|
||||||
import formalchemy as fa
|
|
||||||
from formalchemy.fields import AbstractField
|
|
||||||
from pyramid.renderers import render
|
|
||||||
|
|
||||||
|
|
||||||
class CustomFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Base class for renderers which accept customization args, and "fake out"
|
|
||||||
FormAlchemy by pretending to still be a renderer factory when in fact it's
|
|
||||||
already dealing with a renderer instance.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
|
||||||
if len(args) == 1 and isinstance(args[0], AbstractField):
|
|
||||||
super(CustomFieldRenderer, self).__init__(args[0])
|
|
||||||
self.init(**kwargs)
|
|
||||||
else:
|
|
||||||
assert len(args) == 0
|
|
||||||
self.init(**kwargs)
|
|
||||||
|
|
||||||
def __call__(self, field):
|
|
||||||
super(CustomFieldRenderer, self).__init__(field)
|
|
||||||
return self
|
|
||||||
|
|
||||||
def init(self, **kwargs):
|
|
||||||
pass
|
|
||||||
|
|
||||||
@property
|
|
||||||
def rattail_config(self):
|
|
||||||
return self.request.rattail_config
|
|
||||||
|
|
||||||
|
|
||||||
class DateFieldRenderer(CustomFieldRenderer, fa.DateFieldRenderer):
|
|
||||||
"""
|
|
||||||
Date field renderer which uses jQuery UI datepicker widget when rendering
|
|
||||||
in edit mode.
|
|
||||||
"""
|
|
||||||
date_format = '%Y-%m-%d'
|
|
||||||
change_year = False
|
|
||||||
|
|
||||||
def init(self, date_format=None, change_year=False):
|
|
||||||
if date_format:
|
|
||||||
self.date_format = date_format
|
|
||||||
self.change_year = change_year
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if value is None:
|
|
||||||
return ''
|
|
||||||
return value.strftime(self.date_format)
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
kwargs['name'] = self.name
|
|
||||||
kwargs['value'] = self.value
|
|
||||||
kwargs['change_year'] = self.change_year
|
|
||||||
return render('/forms/fields/date.mako', kwargs)
|
|
||||||
|
|
||||||
def deserialize(self):
|
|
||||||
value = self._serialized_value()
|
|
||||||
if not value:
|
|
||||||
return None
|
|
||||||
try:
|
|
||||||
return datetime.datetime.strptime(value, '%Y-%m-%d')
|
|
||||||
except ValueError:
|
|
||||||
raise fa.ValidationError("Date value must be in YYYY-MM-DD format")
|
|
||||||
except Exception as error:
|
|
||||||
raise fa.ValidationError(unicode(error))
|
|
||||||
|
|
||||||
def _serialized_value(self):
|
|
||||||
return self.params.getone(self.name)
|
|
|
@ -1,102 +0,0 @@
|
||||||
# -*- coding: utf-8 -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Batch Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import os
|
|
||||||
import stat
|
|
||||||
import random
|
|
||||||
|
|
||||||
from formalchemy.ext import fsblob
|
|
||||||
from formalchemy.fields import FileFieldRenderer as Base
|
|
||||||
|
|
||||||
|
|
||||||
class FileFieldRenderer(fsblob.FileFieldRenderer):
|
|
||||||
"""
|
|
||||||
Custom file field renderer. In readonly mode, shows a filename and its
|
|
||||||
size; in edit mode, supports a single file upload.
|
|
||||||
"""
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def new(cls, view, **kwargs):
|
|
||||||
name = b'Configured{}_{}'.format(cls.__name__, str(random.random())[2:])
|
|
||||||
return type(name, (cls,), dict(view=view, **kwargs))
|
|
||||||
|
|
||||||
@property
|
|
||||||
def request(self):
|
|
||||||
return self.view.request
|
|
||||||
|
|
||||||
@property
|
|
||||||
def storage_path(self):
|
|
||||||
return self.view.upload_dir
|
|
||||||
|
|
||||||
def get_file_path(self):
|
|
||||||
"""
|
|
||||||
Returns the absolute path to the data file.
|
|
||||||
"""
|
|
||||||
if hasattr(self, 'file_path'):
|
|
||||||
return self.file_path
|
|
||||||
return self.field.value
|
|
||||||
|
|
||||||
def get_size(self):
|
|
||||||
"""
|
|
||||||
Returns the size of the data file, in bytes.
|
|
||||||
"""
|
|
||||||
path = self.get_file_path()
|
|
||||||
if path and os.path.isfile(path):
|
|
||||||
return os.stat(path)[stat.ST_SIZE]
|
|
||||||
return 0
|
|
||||||
|
|
||||||
def get_url(self, filename):
|
|
||||||
"""
|
|
||||||
Must return a URL suitable for downloading the file
|
|
||||||
"""
|
|
||||||
url = self.get_download_url()
|
|
||||||
if url:
|
|
||||||
if callable(url):
|
|
||||||
return url(filename)
|
|
||||||
return url
|
|
||||||
return self.view.get_action_url('download', self.field.parent.model)
|
|
||||||
|
|
||||||
def get_download_url(self):
|
|
||||||
if hasattr(self, 'download_url'):
|
|
||||||
return self.download_url
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
return Base.render(self, **kwargs)
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
"""
|
|
||||||
Render the filename and the binary size in a human readable with a link
|
|
||||||
to the file itself.
|
|
||||||
"""
|
|
||||||
value = self.get_file_path()
|
|
||||||
if value:
|
|
||||||
content = '{} ({})'.format(fsblob.normalized_basename(value),
|
|
||||||
self.readable_size())
|
|
||||||
return fsblob.h.content_tag('a', content,
|
|
||||||
href=self.get_url(value), **kwargs)
|
|
||||||
return ''
|
|
|
@ -1,81 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
People Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import six
|
|
||||||
import formalchemy as fa
|
|
||||||
from webhelpers2.html import tags, HTML
|
|
||||||
|
|
||||||
from tailbone.forms.renderers.common import AutocompleteFieldRenderer
|
|
||||||
|
|
||||||
|
|
||||||
class PersonFieldRenderer(AutocompleteFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.db.model.Person` instance fields.
|
|
||||||
"""
|
|
||||||
service_route = 'people.autocomplete'
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
person = self.raw_value
|
|
||||||
if not person:
|
|
||||||
return ''
|
|
||||||
return tags.link_to(person, self.request.route_url('people.view', uuid=person.uuid))
|
|
||||||
|
|
||||||
|
|
||||||
class PeopleFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for "people" list relationship
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
html = ''
|
|
||||||
people = self.raw_value
|
|
||||||
if not people:
|
|
||||||
return html
|
|
||||||
for person in people:
|
|
||||||
link = tags.link_to(person, self.request.route_url('people.view', uuid=person.uuid))
|
|
||||||
html += HTML.tag('li', c=link)
|
|
||||||
html = HTML.tag('ul', c=html)
|
|
||||||
return html
|
|
||||||
|
|
||||||
|
|
||||||
class CustomerFieldRenderer(AutocompleteFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.db.model.Customer` instance fields.
|
|
||||||
"""
|
|
||||||
|
|
||||||
service_route = 'customers.autocomplete'
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
customer = self.raw_value
|
|
||||||
if not customer:
|
|
||||||
return ''
|
|
||||||
text = self.render_value(customer)
|
|
||||||
return tags.link_to(text, self.request.route_url('customers.view', uuid=customer.uuid))
|
|
||||||
|
|
||||||
def render_value(self, customer):
|
|
||||||
return six.text_type(customer)
|
|
|
@ -1,219 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Product Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import six
|
|
||||||
|
|
||||||
from rattail.gpc import GPC
|
|
||||||
from rattail.db import model
|
|
||||||
from rattail.db.util import maxlen
|
|
||||||
|
|
||||||
import formalchemy as fa
|
|
||||||
from formalchemy import TextFieldRenderer
|
|
||||||
from formalchemy.fields import SelectFieldRenderer
|
|
||||||
from webhelpers2.html import tags, literal
|
|
||||||
|
|
||||||
from tailbone.forms.renderers.common import AutocompleteFieldRenderer
|
|
||||||
from tailbone.util import pretty_datetime
|
|
||||||
|
|
||||||
|
|
||||||
class ProductFieldRenderer(AutocompleteFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.db.model.Product` instance fields.
|
|
||||||
"""
|
|
||||||
|
|
||||||
service_route = 'products.autocomplete'
|
|
||||||
|
|
||||||
@property
|
|
||||||
def field_display(self):
|
|
||||||
product = self.raw_value
|
|
||||||
if product:
|
|
||||||
return product.full_description
|
|
||||||
return ''
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
product = self.raw_value
|
|
||||||
if not product:
|
|
||||||
return ''
|
|
||||||
if kwargs.get('hyperlink', True):
|
|
||||||
return tags.link_to(product, self.request.route_url('products.view', uuid=product.uuid))
|
|
||||||
return six.text_type(product)
|
|
||||||
|
|
||||||
|
|
||||||
class ProductKeyFieldRenderer(TextFieldRenderer):
|
|
||||||
"""
|
|
||||||
Base class for product key field renderers.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
value = self.raw_value
|
|
||||||
if value is None:
|
|
||||||
return ''
|
|
||||||
value = self.render_value(value)
|
|
||||||
if kwargs.get('link'):
|
|
||||||
product = self.field.parent.model
|
|
||||||
value = tags.link_to(value, kwargs['link'](product))
|
|
||||||
return value
|
|
||||||
|
|
||||||
def render_value(self, value):
|
|
||||||
return unicode(value)
|
|
||||||
|
|
||||||
|
|
||||||
class GPCFieldRenderer(ProductKeyFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.gpc.GPC` fields.
|
|
||||||
"""
|
|
||||||
|
|
||||||
@property
|
|
||||||
def length(self):
|
|
||||||
# Hm, should maybe consider hard-coding this...?
|
|
||||||
return len(unicode(GPC(0)))
|
|
||||||
|
|
||||||
def render_value(self, gpc):
|
|
||||||
return gpc.pretty()
|
|
||||||
|
|
||||||
|
|
||||||
class ScancodeFieldRenderer(ProductKeyFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.db.model.Product.scancode` field
|
|
||||||
"""
|
|
||||||
|
|
||||||
@property
|
|
||||||
def length(self):
|
|
||||||
return maxlen(model.Product.scancode)
|
|
||||||
|
|
||||||
|
|
||||||
class DepartmentFieldRenderer(SelectFieldRenderer):
|
|
||||||
"""
|
|
||||||
Shows the department number as well as the name.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
kwargs.setdefault('auto-enhance', 'true')
|
|
||||||
return super(DepartmentFieldRenderer, self).render(**kwargs)
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
department = self.raw_value
|
|
||||||
if not department:
|
|
||||||
return ''
|
|
||||||
if department.number:
|
|
||||||
text = '({}) {}'.format(department.number, department.name)
|
|
||||||
else:
|
|
||||||
text = department.name
|
|
||||||
return tags.link_to(text, self.request.route_url('departments.view', uuid=department.uuid))
|
|
||||||
|
|
||||||
|
|
||||||
class SubdepartmentFieldRenderer(SelectFieldRenderer):
|
|
||||||
"""
|
|
||||||
Shows a link to the subdepartment.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
subdept = self.raw_value
|
|
||||||
if not subdept:
|
|
||||||
return ""
|
|
||||||
if subdept.number:
|
|
||||||
text = "({}) {}".format(subdept.number, subdept.name)
|
|
||||||
else:
|
|
||||||
text = subdept.name
|
|
||||||
return tags.link_to(text, self.request.route_url('subdepartments.view', uuid=subdept.uuid))
|
|
||||||
|
|
||||||
|
|
||||||
class CategoryFieldRenderer(SelectFieldRenderer):
|
|
||||||
"""
|
|
||||||
Shows a link to the category.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
category = self.raw_value
|
|
||||||
if not category:
|
|
||||||
return ""
|
|
||||||
if category.code:
|
|
||||||
text = "({}) {}".format(category.code, category.name)
|
|
||||||
else:
|
|
||||||
text = category.name
|
|
||||||
return tags.link_to(text, self.request.route_url('categories.view', uuid=category.uuid))
|
|
||||||
|
|
||||||
|
|
||||||
class BrandFieldRenderer(AutocompleteFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.db.model.Brand` instance fields.
|
|
||||||
"""
|
|
||||||
|
|
||||||
service_route = 'brands.autocomplete'
|
|
||||||
|
|
||||||
|
|
||||||
class CostFieldRenderer(fa.FieldRenderer):
|
|
||||||
"""
|
|
||||||
Renders fields which reference a ProductCost object
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
cost = self.raw_value
|
|
||||||
if not cost:
|
|
||||||
return ''
|
|
||||||
return '${:0.2f}'.format(cost.unit_cost)
|
|
||||||
|
|
||||||
|
|
||||||
class PriceFieldRenderer(TextFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for fields which reference a :class:`ProductPrice` instance.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
price = self.field.raw_value
|
|
||||||
if price:
|
|
||||||
if not price.product.not_for_sale:
|
|
||||||
if price.price is not None and price.pack_price is not None:
|
|
||||||
if price.multiple > 1:
|
|
||||||
return literal('$ %0.2f / %u ($ %0.2f / %u)' % (
|
|
||||||
price.price, price.multiple,
|
|
||||||
price.pack_price, price.pack_multiple))
|
|
||||||
return literal('$ %0.2f ($ %0.2f / %u)' % (
|
|
||||||
price.price, price.pack_price, price.pack_multiple))
|
|
||||||
if price.price is not None:
|
|
||||||
if price.multiple > 1:
|
|
||||||
return '$ %0.2f / %u' % (price.price, price.multiple)
|
|
||||||
return '$ %0.2f' % price.price
|
|
||||||
if price.pack_price is not None:
|
|
||||||
return '$ %0.2f / %u' % (price.pack_price, price.pack_multiple)
|
|
||||||
return ''
|
|
||||||
|
|
||||||
|
|
||||||
class PriceWithExpirationFieldRenderer(PriceFieldRenderer):
|
|
||||||
"""
|
|
||||||
Price field renderer which also displays the expiration date, if present.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
result = super(PriceWithExpirationFieldRenderer, self).render_readonly(**kwargs)
|
|
||||||
if result:
|
|
||||||
price = self.field.raw_value
|
|
||||||
if price.ends:
|
|
||||||
result = '{0} ({1})'.format(
|
|
||||||
result, pretty_datetime(self.request.rattail_config, price.ends))
|
|
||||||
return result
|
|
|
@ -1,95 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
User Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
from rattail.db.auth import has_permission, administrator_role
|
|
||||||
|
|
||||||
import formalchemy
|
|
||||||
from webhelpers2.html import HTML, tags
|
|
||||||
|
|
||||||
from tailbone.db import Session
|
|
||||||
|
|
||||||
|
|
||||||
class UserFieldRenderer(formalchemy.TextFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail:rattail.db.model.User` instance fields.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
user = self.raw_value
|
|
||||||
if not user:
|
|
||||||
return ''
|
|
||||||
title = user.display_name
|
|
||||||
if kwargs.get('hyperlink') and self.request.has_perm('users.view'):
|
|
||||||
return tags.link_to(title, self.request.route_url('users.view', uuid=user.uuid))
|
|
||||||
return title
|
|
||||||
|
|
||||||
|
|
||||||
def PermissionsFieldRenderer(permissions, include_guest=False, include_authenticated=False):
|
|
||||||
|
|
||||||
class PermissionsFieldRenderer(formalchemy.FieldRenderer):
|
|
||||||
|
|
||||||
def deserialize(self):
|
|
||||||
perms = []
|
|
||||||
i = len(self.name) + 1
|
|
||||||
for key in self.params:
|
|
||||||
if key.startswith(self.name):
|
|
||||||
perms.append(key[i:])
|
|
||||||
return perms
|
|
||||||
|
|
||||||
def _render(self, readonly=False, **kwargs):
|
|
||||||
principal = self.field.model
|
|
||||||
html = ''
|
|
||||||
for groupkey in sorted(permissions, key=lambda k: permissions[k]['label'].lower()):
|
|
||||||
inner = HTML.tag('p', c=permissions[groupkey]['label'])
|
|
||||||
perms = permissions[groupkey]['perms']
|
|
||||||
rendered = False
|
|
||||||
for key in sorted(perms, key=lambda p: perms[p]['label'].lower()):
|
|
||||||
checked = has_permission(Session(), principal, key,
|
|
||||||
include_guest=include_guest,
|
|
||||||
include_authenticated=include_authenticated)
|
|
||||||
if checked or not readonly:
|
|
||||||
label = perms[key]['label']
|
|
||||||
if readonly:
|
|
||||||
span = HTML.tag('span', c="[X]" if checked else "[ ]")
|
|
||||||
inner += HTML.tag('p', class_='perm', c=span + ' ' + label)
|
|
||||||
else:
|
|
||||||
inner += tags.checkbox(self.name + '-' + key,
|
|
||||||
checked=checked, label=label)
|
|
||||||
rendered = True
|
|
||||||
if rendered:
|
|
||||||
html += HTML.tag('div', class_='group', c=inner)
|
|
||||||
return html or "(none granted)"
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
return self._render(**kwargs)
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
return self._render(readonly=True, **kwargs)
|
|
||||||
|
|
||||||
return PermissionsFieldRenderer
|
|
|
@ -1,60 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Vendor Field Renderers
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from formalchemy.fields import SelectFieldRenderer
|
|
||||||
from webhelpers2.html import tags
|
|
||||||
|
|
||||||
from tailbone.forms.renderers.common import AutocompleteFieldRenderer
|
|
||||||
|
|
||||||
|
|
||||||
class VendorFieldRenderer(AutocompleteFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.db.model.Vendor` instance fields.
|
|
||||||
"""
|
|
||||||
service_route = 'vendors.autocomplete'
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
vendor = self.raw_value
|
|
||||||
if not vendor:
|
|
||||||
return ""
|
|
||||||
text = "({}) {}".format(vendor.id, vendor.name)
|
|
||||||
if kwargs.get('hyperlink', True):
|
|
||||||
return tags.link_to(text, self.request.route_url('vendors.view', uuid=vendor.uuid))
|
|
||||||
return text
|
|
||||||
|
|
||||||
|
|
||||||
class PurchaseFieldRenderer(SelectFieldRenderer):
|
|
||||||
"""
|
|
||||||
Renderer for :class:`rattail.db.model.Purchase` relation fields.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def render_readonly(self, **kwargs):
|
|
||||||
purchase = self.raw_value
|
|
||||||
if not purchase:
|
|
||||||
return ''
|
|
||||||
return tags.link_to(purchase, self.request.route_url('purchases.view', uuid=purchase.uuid))
|
|
|
@ -1,82 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Simple Forms
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from rattail.util import prettify
|
|
||||||
|
|
||||||
import pyramid_simpleform
|
|
||||||
from pyramid_simpleform import renderers
|
|
||||||
from webhelpers2.html import tags, HTML
|
|
||||||
|
|
||||||
from tailbone.forms import Form
|
|
||||||
|
|
||||||
|
|
||||||
class SimpleForm(Form):
|
|
||||||
"""
|
|
||||||
Customized simple form.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, request, schema, obj=None, **kwargs):
|
|
||||||
super(SimpleForm, self).__init__(request, **kwargs)
|
|
||||||
self._form = pyramid_simpleform.Form(request, schema=schema, obj=obj)
|
|
||||||
|
|
||||||
def __getattr__(self, attr):
|
|
||||||
return getattr(self._form, attr)
|
|
||||||
|
|
||||||
def render(self, **kwargs):
|
|
||||||
kwargs['form'] = FormRenderer(self)
|
|
||||||
return super(SimpleForm, self).render(**kwargs)
|
|
||||||
|
|
||||||
def validate(self):
|
|
||||||
return self._form.validate()
|
|
||||||
|
|
||||||
|
|
||||||
class FormRenderer(renderers.FormRenderer):
|
|
||||||
"""
|
|
||||||
Customized form renderer. Provides some extra methods for convenience.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __getattr__(self, attr):
|
|
||||||
return getattr(self.form, attr)
|
|
||||||
|
|
||||||
def field_div(self, name, field, label=None):
|
|
||||||
errors = self.errors_for(name)
|
|
||||||
if errors:
|
|
||||||
errors = [HTML.tag('div', class_='field-error', c=x) for x in errors]
|
|
||||||
errors = tags.literal('').join(errors)
|
|
||||||
|
|
||||||
label = HTML.tag('label', for_=name, c=label or prettify(name))
|
|
||||||
inner = HTML.tag('div', class_='field', c=field)
|
|
||||||
|
|
||||||
outer_class = 'field-wrapper'
|
|
||||||
if errors:
|
|
||||||
outer_class += ' error'
|
|
||||||
outer = HTML.tag('div', class_=outer_class, c=(errors or '') + label + inner)
|
|
||||||
return outer
|
|
||||||
|
|
||||||
def referrer_field(self):
|
|
||||||
return self.hidden('referrer', value=self.form.request.get_referrer())
|
|
265
tailbone/forms/types.py
Normal file
265
tailbone/forms/types.py
Normal file
|
@ -0,0 +1,265 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Form Schema Types
|
||||||
|
"""
|
||||||
|
|
||||||
|
import re
|
||||||
|
import datetime
|
||||||
|
import json
|
||||||
|
|
||||||
|
from rattail.db import model
|
||||||
|
from rattail.gpc import GPC
|
||||||
|
|
||||||
|
import colander
|
||||||
|
|
||||||
|
from tailbone.db import Session
|
||||||
|
from tailbone.forms import widgets
|
||||||
|
|
||||||
|
|
||||||
|
class JQueryTime(colander.Time):
|
||||||
|
"""
|
||||||
|
Custom type for jQuery widget Time data.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def deserialize(self, node, cstruct):
|
||||||
|
if not cstruct:
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
formats = [
|
||||||
|
'%I:%M %p',
|
||||||
|
'%I:%M%p',
|
||||||
|
'%I %p',
|
||||||
|
'%I%p',
|
||||||
|
]
|
||||||
|
for fmt in formats:
|
||||||
|
try:
|
||||||
|
return datetime.datetime.strptime(cstruct, fmt).time()
|
||||||
|
except ValueError:
|
||||||
|
pass
|
||||||
|
|
||||||
|
# re-try first format, for "better" error message
|
||||||
|
return datetime.datetime.strptime(cstruct, formats[0]).time()
|
||||||
|
|
||||||
|
|
||||||
|
class DateTimeBoolean(colander.Boolean):
|
||||||
|
"""
|
||||||
|
Schema type which presents the user with a "boolean" whereas the underlying
|
||||||
|
node is really a datetime (assumed to be "naive" UTC, and allow nulls).
|
||||||
|
"""
|
||||||
|
|
||||||
|
def deserialize(self, node, cstruct):
|
||||||
|
value = super(DateTimeBoolean, self).deserialize(node, cstruct)
|
||||||
|
if value: # else return None
|
||||||
|
return datetime.datetime.utcnow()
|
||||||
|
|
||||||
|
|
||||||
|
class FalafelDateTime(colander.DateTime):
|
||||||
|
"""
|
||||||
|
Custom schema node type for rattail UTC datetimes
|
||||||
|
"""
|
||||||
|
widget_maker = widgets.FalafelDateTimeWidget
|
||||||
|
|
||||||
|
def __init__(self, *args, **kwargs):
|
||||||
|
request = kwargs.pop('request')
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
self.request = request
|
||||||
|
|
||||||
|
def serialize(self, node, appstruct):
|
||||||
|
if not appstruct:
|
||||||
|
return {}
|
||||||
|
|
||||||
|
# cant use isinstance; dt subs date
|
||||||
|
if type(appstruct) is datetime.date:
|
||||||
|
appstruct = datetime.datetime.combine(appstruct, datetime.time())
|
||||||
|
|
||||||
|
if not isinstance(appstruct, datetime.datetime):
|
||||||
|
raise colander.Invalid(node, f'"{appstruct}" is not a datetime object')
|
||||||
|
|
||||||
|
if appstruct.tzinfo is None:
|
||||||
|
appstruct = appstruct.replace(tzinfo=self.default_tzinfo)
|
||||||
|
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
dt = app.localtime(appstruct, from_utc=True)
|
||||||
|
|
||||||
|
return {
|
||||||
|
'date': str(dt.date()),
|
||||||
|
'time': str(dt.time()),
|
||||||
|
}
|
||||||
|
|
||||||
|
def deserialize(self, node, cstruct):
|
||||||
|
if not cstruct:
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
if not cstruct['date'] and not cstruct['time']:
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
try:
|
||||||
|
date = datetime.datetime.strptime(cstruct['date'], '%Y-%m-%d').date()
|
||||||
|
except:
|
||||||
|
node.raise_invalid("Missing or invalid date")
|
||||||
|
|
||||||
|
try:
|
||||||
|
time = datetime.datetime.strptime(cstruct['time'], '%H:%M:%S').time()
|
||||||
|
except:
|
||||||
|
node.raise_invalid("Missing or invalid time")
|
||||||
|
|
||||||
|
result = datetime.datetime.combine(date, time)
|
||||||
|
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
result = app.localtime(result)
|
||||||
|
result = app.make_utc(result)
|
||||||
|
return result
|
||||||
|
|
||||||
|
|
||||||
|
class FalafelTime(colander.Time):
|
||||||
|
"""
|
||||||
|
Custom schema node type for simple time fields
|
||||||
|
"""
|
||||||
|
widget_maker = widgets.FalafelTimeWidget
|
||||||
|
|
||||||
|
def __init__(self, *args, **kwargs):
|
||||||
|
request = kwargs.pop('request')
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
self.request = request
|
||||||
|
|
||||||
|
|
||||||
|
class GPCType(colander.SchemaType):
|
||||||
|
"""
|
||||||
|
Schema type for product GPC data.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def serialize(self, node, appstruct):
|
||||||
|
if appstruct is colander.null:
|
||||||
|
return colander.null
|
||||||
|
return str(appstruct)
|
||||||
|
|
||||||
|
def deserialize(self, node, cstruct):
|
||||||
|
if not cstruct:
|
||||||
|
return None
|
||||||
|
digits = re.sub(r'\D', '', cstruct)
|
||||||
|
if not digits:
|
||||||
|
return None
|
||||||
|
try:
|
||||||
|
return GPC(digits)
|
||||||
|
except Exception as err:
|
||||||
|
raise colander.Invalid(node, str(err))
|
||||||
|
|
||||||
|
|
||||||
|
class ProductQuantity(colander.MappingSchema):
|
||||||
|
"""
|
||||||
|
Combo schema type for product cases and units; useful for inventory,
|
||||||
|
ordering, receiving etc. Meant to be used with the ``CasesUnitsWidget``.
|
||||||
|
"""
|
||||||
|
cases = colander.SchemaNode(colander.Decimal(), missing=colander.null)
|
||||||
|
|
||||||
|
units = colander.SchemaNode(colander.Decimal(), missing=colander.null)
|
||||||
|
|
||||||
|
|
||||||
|
class ModelType(colander.SchemaType):
|
||||||
|
"""
|
||||||
|
Custom schema type for scalar ORM relationship fields.
|
||||||
|
"""
|
||||||
|
model_class = None
|
||||||
|
session = None
|
||||||
|
|
||||||
|
def __init__(self, model_class=None, session=None):
|
||||||
|
if model_class:
|
||||||
|
self.model_class = model_class
|
||||||
|
if session:
|
||||||
|
self.session = session
|
||||||
|
else:
|
||||||
|
self.session = self.make_session()
|
||||||
|
|
||||||
|
def make_session(self):
|
||||||
|
return Session()
|
||||||
|
|
||||||
|
@property
|
||||||
|
def model_title(self):
|
||||||
|
self.model_class.get_model_title()
|
||||||
|
|
||||||
|
def serialize(self, node, appstruct):
|
||||||
|
if appstruct is colander.null:
|
||||||
|
return colander.null
|
||||||
|
return str(appstruct)
|
||||||
|
|
||||||
|
def deserialize(self, node, cstruct):
|
||||||
|
if not cstruct:
|
||||||
|
return None
|
||||||
|
obj = self.session.get(self.model_class, cstruct)
|
||||||
|
if not obj:
|
||||||
|
raise colander.Invalid(node, "{} not found".format(self.model_title))
|
||||||
|
return obj
|
||||||
|
|
||||||
|
|
||||||
|
# TODO: deprecate / remove this
|
||||||
|
ObjectType = ModelType
|
||||||
|
|
||||||
|
|
||||||
|
class StoreType(ModelType):
|
||||||
|
"""
|
||||||
|
Custom schema type for store field.
|
||||||
|
"""
|
||||||
|
model_class = model.Store
|
||||||
|
|
||||||
|
|
||||||
|
class CustomerType(ModelType):
|
||||||
|
"""
|
||||||
|
Custom schema type for customer field.
|
||||||
|
"""
|
||||||
|
model_class = model.Customer
|
||||||
|
|
||||||
|
|
||||||
|
class DepartmentType(ModelType):
|
||||||
|
"""
|
||||||
|
Custom schema type for department field.
|
||||||
|
"""
|
||||||
|
model_class = model.Department
|
||||||
|
|
||||||
|
|
||||||
|
class EmployeeType(ModelType):
|
||||||
|
"""
|
||||||
|
Custom schema type for employee field.
|
||||||
|
"""
|
||||||
|
model_class = model.Employee
|
||||||
|
|
||||||
|
|
||||||
|
class VendorType(ModelType):
|
||||||
|
"""
|
||||||
|
Custom schema type for vendor relationship field.
|
||||||
|
"""
|
||||||
|
model_class = model.Vendor
|
||||||
|
|
||||||
|
|
||||||
|
class ProductType(ModelType):
|
||||||
|
"""
|
||||||
|
Custom schema type for product relationship field.
|
||||||
|
"""
|
||||||
|
model_class = model.Product
|
||||||
|
|
||||||
|
|
||||||
|
class UserType(ModelType):
|
||||||
|
"""
|
||||||
|
Custom schema type for user field.
|
||||||
|
"""
|
||||||
|
model_class = model.User
|
|
@ -1,153 +0,0 @@
|
||||||
# -*- coding: utf-8 -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Custom Form Validators
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import re
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
from rattail.db.util import validate_email_address, validate_phone_number
|
|
||||||
from rattail.gpc import GPC
|
|
||||||
|
|
||||||
import formencode as fe
|
|
||||||
import formalchemy as fa
|
|
||||||
|
|
||||||
from tailbone.db import Session
|
|
||||||
|
|
||||||
|
|
||||||
class ValidGPC(fe.validators.FancyValidator):
|
|
||||||
"""
|
|
||||||
Validator for fields which should contain GPC value.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def _to_python(self, value, state):
|
|
||||||
if value is not None:
|
|
||||||
digits = re.sub(r'\D', '', value)
|
|
||||||
if digits:
|
|
||||||
try:
|
|
||||||
return GPC(digits)
|
|
||||||
except ValueError as error:
|
|
||||||
raise fe.Invalid("Invalid UPC: {}".format(error), value, state)
|
|
||||||
|
|
||||||
def _from_python(self, upc, state):
|
|
||||||
if upc is None:
|
|
||||||
return ''
|
|
||||||
return upc.pretty()
|
|
||||||
|
|
||||||
|
|
||||||
class ModelValidator(fe.validators.FancyValidator):
|
|
||||||
"""
|
|
||||||
Generic validator for data model reference fields.
|
|
||||||
"""
|
|
||||||
model_class = None
|
|
||||||
|
|
||||||
@property
|
|
||||||
def model_name(self):
|
|
||||||
self.model_class.__name__
|
|
||||||
|
|
||||||
def _to_python(self, value, state):
|
|
||||||
if value:
|
|
||||||
obj = Session.query(self.model_class).get(value)
|
|
||||||
if obj:
|
|
||||||
return obj
|
|
||||||
raise fe.Invalid("{} not found".format(self.model_name), value, state)
|
|
||||||
|
|
||||||
def _from_python(self, value, state):
|
|
||||||
obj = value
|
|
||||||
if not obj:
|
|
||||||
return ''
|
|
||||||
return obj.uuid
|
|
||||||
|
|
||||||
def validate_python(self, value, state):
|
|
||||||
obj = value
|
|
||||||
if obj is not None and not isinstance(obj, self.model_class):
|
|
||||||
raise fe.Invalid("Value must be a valid {} object".format(self.model_name), value, state)
|
|
||||||
|
|
||||||
|
|
||||||
class ValidStore(ModelValidator):
|
|
||||||
"""
|
|
||||||
Validator for store field.
|
|
||||||
"""
|
|
||||||
model_class = model.Store
|
|
||||||
|
|
||||||
|
|
||||||
class ValidCustomer(ModelValidator):
|
|
||||||
"""
|
|
||||||
Validator for customer field.
|
|
||||||
"""
|
|
||||||
model_class = model.Customer
|
|
||||||
|
|
||||||
|
|
||||||
class ValidDepartment(ModelValidator):
|
|
||||||
"""
|
|
||||||
Validator for department field.
|
|
||||||
"""
|
|
||||||
model_class = model.Department
|
|
||||||
|
|
||||||
|
|
||||||
class ValidEmployee(ModelValidator):
|
|
||||||
"""
|
|
||||||
Validator for employee field.
|
|
||||||
"""
|
|
||||||
model_class = model.Employee
|
|
||||||
|
|
||||||
|
|
||||||
class ValidProduct(ModelValidator):
|
|
||||||
"""
|
|
||||||
Validator for product field.
|
|
||||||
"""
|
|
||||||
model_class = model.Product
|
|
||||||
|
|
||||||
|
|
||||||
class ValidUser(ModelValidator):
|
|
||||||
"""
|
|
||||||
Validator for user field.
|
|
||||||
"""
|
|
||||||
model_class = model.User
|
|
||||||
|
|
||||||
|
|
||||||
def valid_email_address(value, field=None):
|
|
||||||
"""
|
|
||||||
FormAlchemy-compatible validation function, which leverages FormEncode
|
|
||||||
under the hood.
|
|
||||||
"""
|
|
||||||
if value:
|
|
||||||
try:
|
|
||||||
return validate_email_address(value, error=True)
|
|
||||||
except Exception as error:
|
|
||||||
raise fa.ValidationError(unicode(error))
|
|
||||||
|
|
||||||
|
|
||||||
def valid_phone_number(value, field=None):
|
|
||||||
"""
|
|
||||||
FormAlchemy-compatible validation function, which leverages FormEncode
|
|
||||||
under the hood.
|
|
||||||
"""
|
|
||||||
if value:
|
|
||||||
try:
|
|
||||||
return validate_phone_number(value, error=True)
|
|
||||||
except Exception as error:
|
|
||||||
raise fa.ValidationError(unicode(error))
|
|
659
tailbone/forms/widgets.py
Normal file
659
tailbone/forms/widgets.py
Normal file
|
@ -0,0 +1,659 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Form Widgets
|
||||||
|
"""
|
||||||
|
|
||||||
|
import json
|
||||||
|
import datetime
|
||||||
|
import decimal
|
||||||
|
import re
|
||||||
|
|
||||||
|
import colander
|
||||||
|
from deform import widget as dfwidget
|
||||||
|
from webhelpers2.html import tags, HTML
|
||||||
|
|
||||||
|
from tailbone.db import Session
|
||||||
|
|
||||||
|
|
||||||
|
class ReadonlyWidget(dfwidget.HiddenWidget):
|
||||||
|
|
||||||
|
readonly = True
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
if cstruct in (colander.null, None):
|
||||||
|
cstruct = ''
|
||||||
|
# TODO: is this hacky?
|
||||||
|
text = kw.get('text')
|
||||||
|
if not text:
|
||||||
|
text = field.parent.tailbone_form.render_field_value(field.name)
|
||||||
|
return HTML.tag('span', text) + tags.hidden(field.name, value=cstruct, id=field.oid)
|
||||||
|
|
||||||
|
|
||||||
|
class NumberInputWidget(dfwidget.TextInputWidget):
|
||||||
|
template = 'numberinput'
|
||||||
|
autocomplete = 'off'
|
||||||
|
|
||||||
|
|
||||||
|
class NumericInputWidget(NumberInputWidget):
|
||||||
|
"""
|
||||||
|
This widget uses a ``<numeric-input>`` component, which will
|
||||||
|
leverage the ``numeric.js`` functions to ensure user doesn't enter
|
||||||
|
any non-numeric values. Note that this still uses a normal "text"
|
||||||
|
input on the HTML side, as opposed to a "number" input, since the
|
||||||
|
latter is a bit ugly IMHO.
|
||||||
|
"""
|
||||||
|
template = 'numericinput'
|
||||||
|
allow_enter = True
|
||||||
|
|
||||||
|
|
||||||
|
class PercentInputWidget(dfwidget.TextInputWidget):
|
||||||
|
"""
|
||||||
|
Custom text input widget, used for "percent" type fields. This widget
|
||||||
|
assumes that the underlying storage for the value is a "traditional"
|
||||||
|
percent value, e.g. ``0.36135`` - but the UI should represent this as a
|
||||||
|
"human-friendly" value, e.g. ``36.135 %``.
|
||||||
|
"""
|
||||||
|
template = 'percentinput'
|
||||||
|
autocomplete = 'off'
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
if cstruct not in (colander.null, None):
|
||||||
|
# convert "traditional" value to "human-friendly"
|
||||||
|
value = decimal.Decimal(cstruct) * 100
|
||||||
|
value = value.quantize(decimal.Decimal('0.001'))
|
||||||
|
cstruct = str(value)
|
||||||
|
return super().serialize(field, cstruct, **kw)
|
||||||
|
|
||||||
|
def deserialize(self, field, pstruct):
|
||||||
|
""" """
|
||||||
|
pstruct = super().deserialize(field, pstruct)
|
||||||
|
if pstruct is colander.null:
|
||||||
|
return colander.null
|
||||||
|
# convert "human-friendly" value to "traditional"
|
||||||
|
try:
|
||||||
|
value = decimal.Decimal(pstruct)
|
||||||
|
except decimal.InvalidOperation:
|
||||||
|
raise colander.Invalid(field.schema, "Invalid decimal string: {}".format(pstruct))
|
||||||
|
value = value.quantize(decimal.Decimal('0.00001'))
|
||||||
|
value /= 100
|
||||||
|
return str(value)
|
||||||
|
|
||||||
|
|
||||||
|
class CasesUnitsWidget(dfwidget.Widget):
|
||||||
|
"""
|
||||||
|
Widget for collecting case and/or unit quantities. Most useful when you
|
||||||
|
need to ensure user provides cases *or* units but not both.
|
||||||
|
"""
|
||||||
|
template = 'cases_units'
|
||||||
|
amount_required = False
|
||||||
|
one_amount_only = False
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
if cstruct in (colander.null, None):
|
||||||
|
cstruct = ''
|
||||||
|
readonly = kw.get('readonly', self.readonly)
|
||||||
|
kw['cases'] = cstruct['cases'] or ''
|
||||||
|
kw['units'] = cstruct['units'] or ''
|
||||||
|
template = readonly and self.readonly_template or self.template
|
||||||
|
values = self.get_template_values(field, cstruct, kw)
|
||||||
|
return field.renderer(template, **values)
|
||||||
|
|
||||||
|
def deserialize(self, field, pstruct):
|
||||||
|
""" """
|
||||||
|
from tailbone.forms.types import ProductQuantity
|
||||||
|
|
||||||
|
if pstruct is colander.null:
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
schema = ProductQuantity()
|
||||||
|
try:
|
||||||
|
validated = schema.deserialize(pstruct)
|
||||||
|
except colander.Invalid as exc:
|
||||||
|
raise colander.Invalid(field.schema, "Invalid pstruct: %s" % exc)
|
||||||
|
|
||||||
|
if self.amount_required and not (validated['cases'] or validated['units']):
|
||||||
|
raise colander.Invalid(field.schema, "Must provide case or unit amount",
|
||||||
|
value=validated)
|
||||||
|
|
||||||
|
if self.amount_required and self.one_amount_only and validated['cases'] and validated['units']:
|
||||||
|
raise colander.Invalid(field.schema, "Must provide case *or* unit amount, "
|
||||||
|
"but *not* both", value=validated)
|
||||||
|
|
||||||
|
return validated
|
||||||
|
|
||||||
|
|
||||||
|
class DynamicCheckboxWidget(dfwidget.CheckboxWidget):
|
||||||
|
"""
|
||||||
|
This checkbox widget can be "dynamic" in the sense that form logic can
|
||||||
|
control its value and state.
|
||||||
|
"""
|
||||||
|
template = 'checkbox_dynamic'
|
||||||
|
|
||||||
|
|
||||||
|
# TODO: deprecate / remove this
|
||||||
|
class PlainSelectWidget(dfwidget.SelectWidget):
|
||||||
|
template = 'select_plain'
|
||||||
|
|
||||||
|
|
||||||
|
class CustomSelectWidget(dfwidget.SelectWidget):
|
||||||
|
"""
|
||||||
|
This widget is mostly for convenience. You can set extra kwargs for the
|
||||||
|
:meth:`serialize()` method, e.g.::
|
||||||
|
|
||||||
|
widget.set_template_values(foo='bar')
|
||||||
|
"""
|
||||||
|
|
||||||
|
def set_template_values(self, **kw):
|
||||||
|
if not hasattr(self, 'extra_template_values'):
|
||||||
|
self.extra_template_values = {}
|
||||||
|
self.extra_template_values.update(kw)
|
||||||
|
|
||||||
|
def get_template_values(self, field, cstruct, kw):
|
||||||
|
values = super().get_template_values(field, cstruct, kw)
|
||||||
|
if hasattr(self, 'extra_template_values'):
|
||||||
|
values.update(self.extra_template_values)
|
||||||
|
return values
|
||||||
|
|
||||||
|
|
||||||
|
class DynamicSelectWidget(CustomSelectWidget):
|
||||||
|
"""
|
||||||
|
This is a "normal" select widget, but instead of (or in addition to) its
|
||||||
|
values being set when constructed, they must be assigned dynamically in
|
||||||
|
real-time, e.g. based on other user selections.
|
||||||
|
|
||||||
|
Really all this widget "does" is render some Vue.js-compatible HTML, but
|
||||||
|
the page which contains the widget is ultimately responsible for wiring up
|
||||||
|
the logic for things to work right.
|
||||||
|
"""
|
||||||
|
template = 'select_dynamic'
|
||||||
|
|
||||||
|
|
||||||
|
class JQuerySelectWidget(dfwidget.SelectWidget):
|
||||||
|
template = 'select_jquery'
|
||||||
|
|
||||||
|
|
||||||
|
class PlainDateWidget(dfwidget.DateInputWidget):
|
||||||
|
template = 'date_plain'
|
||||||
|
|
||||||
|
|
||||||
|
class JQueryDateWidget(dfwidget.DateInputWidget):
|
||||||
|
"""
|
||||||
|
Uses the jQuery datepicker UI widget, instead of whatever it is deform uses
|
||||||
|
by default.
|
||||||
|
"""
|
||||||
|
template = 'date_jquery'
|
||||||
|
type_name = 'text'
|
||||||
|
requirements = None
|
||||||
|
|
||||||
|
default_options = (
|
||||||
|
('changeMonth', True),
|
||||||
|
('changeYear', True),
|
||||||
|
('dateFormat', 'yy-mm-dd'),
|
||||||
|
)
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
if cstruct in (colander.null, None):
|
||||||
|
cstruct = ''
|
||||||
|
readonly = kw.get('readonly', self.readonly)
|
||||||
|
template = readonly and self.readonly_template or self.template
|
||||||
|
options = dict(
|
||||||
|
kw.get('options') or self.options or self.default_options
|
||||||
|
)
|
||||||
|
options.update(kw.get('extra_options', {}))
|
||||||
|
kw.setdefault('options_json', json.dumps(options))
|
||||||
|
kw.setdefault('selected_callback', None)
|
||||||
|
values = self.get_template_values(field, cstruct, kw)
|
||||||
|
return field.renderer(template, **values)
|
||||||
|
|
||||||
|
|
||||||
|
class JQueryTimeWidget(dfwidget.TimeInputWidget):
|
||||||
|
"""
|
||||||
|
Uses the jQuery datepicker UI widget, instead of whatever it is deform uses
|
||||||
|
by default.
|
||||||
|
"""
|
||||||
|
template = 'time_jquery'
|
||||||
|
type_name = 'text'
|
||||||
|
requirements = None
|
||||||
|
default_options = (
|
||||||
|
('showPeriod', True),
|
||||||
|
)
|
||||||
|
|
||||||
|
|
||||||
|
class FalafelDateTimeWidget(dfwidget.DateTimeInputWidget):
|
||||||
|
"""
|
||||||
|
Custom widget for rattail UTC datetimes
|
||||||
|
"""
|
||||||
|
template = 'datetime_falafel'
|
||||||
|
|
||||||
|
new_pattern = re.compile(r'^\d\d?:\d\d:\d\d [AP]M$')
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
readonly = kw.get('readonly', self.readonly)
|
||||||
|
values = self.get_template_values(field, cstruct, kw)
|
||||||
|
template = self.readonly_template if readonly else self.template
|
||||||
|
return field.renderer(template, **values)
|
||||||
|
|
||||||
|
def deserialize(self, field, pstruct):
|
||||||
|
""" """
|
||||||
|
if pstruct == '':
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
# nb. we now allow '4:20:00 PM' on the widget side, but the
|
||||||
|
# true node needs it to be '16:20:00' instead
|
||||||
|
if self.new_pattern.match(pstruct['time']):
|
||||||
|
time = datetime.datetime.strptime(pstruct['time'], '%I:%M:%S %p')
|
||||||
|
pstruct['time'] = time.strftime('%H:%M:%S')
|
||||||
|
|
||||||
|
return pstruct
|
||||||
|
|
||||||
|
|
||||||
|
class FalafelTimeWidget(dfwidget.TimeInputWidget):
|
||||||
|
"""
|
||||||
|
Custom widget for simple time fields
|
||||||
|
"""
|
||||||
|
template = 'time_falafel'
|
||||||
|
|
||||||
|
def deserialize(self, field, pstruct):
|
||||||
|
""" """
|
||||||
|
if pstruct == '':
|
||||||
|
return colander.null
|
||||||
|
return pstruct
|
||||||
|
|
||||||
|
|
||||||
|
class JQueryAutocompleteWidget(dfwidget.AutocompleteInputWidget):
|
||||||
|
"""
|
||||||
|
Uses the jQuery autocomplete plugin, instead of whatever it is deform uses
|
||||||
|
by default.
|
||||||
|
"""
|
||||||
|
template = 'autocomplete_jquery'
|
||||||
|
requirements = None
|
||||||
|
field_display = ""
|
||||||
|
assigned_label = None
|
||||||
|
service_url = None
|
||||||
|
cleared_callback = None
|
||||||
|
selected_callback = None
|
||||||
|
input_callback = None
|
||||||
|
new_label_callback = None
|
||||||
|
ref = None
|
||||||
|
|
||||||
|
default_options = (
|
||||||
|
('autoFocus', True),
|
||||||
|
)
|
||||||
|
options = None
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
if 'delay' in kw or getattr(self, 'delay', None):
|
||||||
|
raise ValueError(
|
||||||
|
'AutocompleteWidget does not support *delay* parameter '
|
||||||
|
'any longer.'
|
||||||
|
)
|
||||||
|
if cstruct in (colander.null, None):
|
||||||
|
cstruct = ''
|
||||||
|
self.values = self.values or []
|
||||||
|
readonly = kw.get('readonly', self.readonly)
|
||||||
|
|
||||||
|
options = dict(
|
||||||
|
kw.get('options') or self.options or self.default_options
|
||||||
|
)
|
||||||
|
options['source'] = self.service_url
|
||||||
|
|
||||||
|
kw['options'] = json.dumps(options)
|
||||||
|
kw['field_display'] = self.field_display
|
||||||
|
kw['cleared_callback'] = self.cleared_callback
|
||||||
|
kw['assigned_label'] = self.assigned_label
|
||||||
|
kw['input_callback'] = self.input_callback
|
||||||
|
kw['new_label_callback'] = self.new_label_callback
|
||||||
|
kw['ref'] = self.ref
|
||||||
|
kw.setdefault('selected_callback', self.selected_callback)
|
||||||
|
tmpl_values = self.get_template_values(field, cstruct, kw)
|
||||||
|
template = readonly and self.readonly_template or self.template
|
||||||
|
return field.renderer(template, **tmpl_values)
|
||||||
|
|
||||||
|
|
||||||
|
class FileUploadWidget(dfwidget.FileUploadWidget):
|
||||||
|
"""
|
||||||
|
Widget to handle file upload. Must override to add ``use_oruga``
|
||||||
|
to field template context.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, *args, **kwargs):
|
||||||
|
self.request = kwargs.pop('request')
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
|
||||||
|
def get_template_values(self, field, cstruct, kw):
|
||||||
|
values = super().get_template_values(field, cstruct, kw)
|
||||||
|
if self.request:
|
||||||
|
values['use_oruga'] = self.request.use_oruga
|
||||||
|
return values
|
||||||
|
|
||||||
|
|
||||||
|
class MultiFileUploadWidget(dfwidget.FileUploadWidget):
|
||||||
|
"""
|
||||||
|
Widget to handle multiple (arbitrary number) of file uploads.
|
||||||
|
"""
|
||||||
|
template = 'multi_file_upload'
|
||||||
|
requirements = ()
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
if cstruct in (colander.null, None):
|
||||||
|
cstruct = []
|
||||||
|
|
||||||
|
if cstruct:
|
||||||
|
for fileinfo in cstruct:
|
||||||
|
uid = fileinfo['uid']
|
||||||
|
if uid not in self.tmpstore:
|
||||||
|
self.tmpstore[uid] = fileinfo
|
||||||
|
|
||||||
|
readonly = kw.get("readonly", self.readonly)
|
||||||
|
template = readonly and self.readonly_template or self.template
|
||||||
|
values = self.get_template_values(field, cstruct, kw)
|
||||||
|
return field.renderer(template, **values)
|
||||||
|
|
||||||
|
def deserialize(self, field, pstruct):
|
||||||
|
""" """
|
||||||
|
if pstruct is colander.null:
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
# TODO: why is this a thing? pstruct == [b'']
|
||||||
|
if len(pstruct) == 1 and pstruct[0] == b'':
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
files_data = []
|
||||||
|
for upload in pstruct:
|
||||||
|
|
||||||
|
data = self.deserialize_upload(upload)
|
||||||
|
if data:
|
||||||
|
files_data.append(data)
|
||||||
|
|
||||||
|
if not files_data:
|
||||||
|
return colander.null
|
||||||
|
|
||||||
|
return files_data
|
||||||
|
|
||||||
|
def deserialize_upload(self, upload):
|
||||||
|
""" """
|
||||||
|
# nb. this logic was copied from parent class and adapted
|
||||||
|
# to allow for multiple files. needs some more love.
|
||||||
|
|
||||||
|
uid = None # TODO?
|
||||||
|
|
||||||
|
if hasattr(upload, "file"):
|
||||||
|
# the upload control had a file selected
|
||||||
|
data = dfwidget.filedict()
|
||||||
|
data["fp"] = upload.file
|
||||||
|
filename = upload.filename
|
||||||
|
# sanitize IE whole-path filenames
|
||||||
|
filename = filename[filename.rfind("\\") + 1 :].strip()
|
||||||
|
data["filename"] = filename
|
||||||
|
data["mimetype"] = upload.type
|
||||||
|
data["size"] = upload.length
|
||||||
|
if uid is None:
|
||||||
|
# no previous file exists
|
||||||
|
while 1:
|
||||||
|
uid = self.random_id()
|
||||||
|
if self.tmpstore.get(uid) is None:
|
||||||
|
data["uid"] = uid
|
||||||
|
self.tmpstore[uid] = data
|
||||||
|
preview_url = self.tmpstore.preview_url(uid)
|
||||||
|
self.tmpstore[uid]["preview_url"] = preview_url
|
||||||
|
break
|
||||||
|
else:
|
||||||
|
# a previous file exists
|
||||||
|
data["uid"] = uid
|
||||||
|
self.tmpstore[uid] = data
|
||||||
|
preview_url = self.tmpstore.preview_url(uid)
|
||||||
|
self.tmpstore[uid]["preview_url"] = preview_url
|
||||||
|
else:
|
||||||
|
# the upload control had no file selected
|
||||||
|
if uid is None:
|
||||||
|
# no previous file exists
|
||||||
|
return colander.null
|
||||||
|
else:
|
||||||
|
# a previous file should exist
|
||||||
|
data = self.tmpstore.get(uid)
|
||||||
|
# but if it doesn't, don't blow up
|
||||||
|
if data is None:
|
||||||
|
return colander.null
|
||||||
|
return data
|
||||||
|
|
||||||
|
|
||||||
|
def make_customer_widget(request, **kwargs):
|
||||||
|
"""
|
||||||
|
Make a customer widget; will be either autocomplete or dropdown
|
||||||
|
depending on config.
|
||||||
|
"""
|
||||||
|
# use autocomplete widget by default
|
||||||
|
factory = CustomerAutocompleteWidget
|
||||||
|
|
||||||
|
# caller may request dropdown widget
|
||||||
|
if kwargs.pop('dropdown', False):
|
||||||
|
factory = CustomerDropdownWidget
|
||||||
|
|
||||||
|
else: # or, config may say to use dropdown
|
||||||
|
if request.rattail_config.getbool(
|
||||||
|
'rattail', 'customers.choice_uses_dropdown',
|
||||||
|
default=False):
|
||||||
|
factory = CustomerDropdownWidget
|
||||||
|
|
||||||
|
# instantiate whichever
|
||||||
|
return factory(request, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
class CustomerAutocompleteWidget(JQueryAutocompleteWidget):
|
||||||
|
"""
|
||||||
|
Autocomplete widget for a
|
||||||
|
:class:`~rattail:rattail.db.model.customers.Customer` reference
|
||||||
|
field.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, request, *args, **kwargs):
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
self.request = request
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
model = app.model
|
||||||
|
|
||||||
|
# must figure out URL providing autocomplete service
|
||||||
|
if 'service_url' not in kwargs:
|
||||||
|
|
||||||
|
# caller can just pass 'url' instead of 'service_url'
|
||||||
|
if 'url' in kwargs:
|
||||||
|
self.service_url = kwargs['url']
|
||||||
|
|
||||||
|
else: # use default url
|
||||||
|
self.service_url = self.request.route_url('customers.autocomplete')
|
||||||
|
|
||||||
|
# TODO
|
||||||
|
if 'input_callback' not in kwargs:
|
||||||
|
if 'input_handler' in kwargs:
|
||||||
|
self.input_callback = input_handler
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
# fetch customer to provide button label, if we have a value
|
||||||
|
if cstruct:
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
model = app.model
|
||||||
|
customer = Session.get(model.Customer, cstruct)
|
||||||
|
if customer:
|
||||||
|
self.field_display = str(customer)
|
||||||
|
|
||||||
|
return super().serialize(
|
||||||
|
field, cstruct, **kw)
|
||||||
|
|
||||||
|
|
||||||
|
class CustomerDropdownWidget(dfwidget.SelectWidget):
|
||||||
|
"""
|
||||||
|
Dropdown widget for a
|
||||||
|
:class:`~rattail:rattail.db.model.customers.Customer` reference
|
||||||
|
field.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, request, *args, **kwargs):
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
self.request = request
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
|
||||||
|
# must figure out dropdown values, if they weren't given
|
||||||
|
if 'values' not in kwargs:
|
||||||
|
|
||||||
|
# use what caller gave us, if they did
|
||||||
|
if 'customers' in kwargs:
|
||||||
|
customers = kwargs['customers']
|
||||||
|
if callable(customers):
|
||||||
|
customers = customers()
|
||||||
|
|
||||||
|
else: # default customer list
|
||||||
|
customers = app.get_clientele_handler()\
|
||||||
|
.get_all_customers(Session())
|
||||||
|
|
||||||
|
# convert customer list to option values
|
||||||
|
self.values = [(c.uuid, c.name)
|
||||||
|
for c in customers]
|
||||||
|
|
||||||
|
|
||||||
|
class DepartmentWidget(dfwidget.SelectWidget):
|
||||||
|
"""
|
||||||
|
Custom select widget for a Department reference field.
|
||||||
|
|
||||||
|
Constructor accepts the normal ``values`` kwarg but if not
|
||||||
|
provided then the widget will fetch department list from Rattail
|
||||||
|
DB.
|
||||||
|
|
||||||
|
Constructor also accepts ``required`` kwarg, which defaults to
|
||||||
|
true unless specified.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, request, **kwargs):
|
||||||
|
|
||||||
|
if 'values' not in kwargs:
|
||||||
|
app = request.rattail_config.get_app()
|
||||||
|
model = app.model
|
||||||
|
departments = Session.query(model.Department)\
|
||||||
|
.order_by(model.Department.number)
|
||||||
|
values = [(dept.uuid, str(dept))
|
||||||
|
for dept in departments]
|
||||||
|
if not kwargs.pop('required', True):
|
||||||
|
values.insert(0, ('', "(none)"))
|
||||||
|
kwargs['values'] = values
|
||||||
|
|
||||||
|
super().__init__(**kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
def make_vendor_widget(request, **kwargs):
|
||||||
|
"""
|
||||||
|
Make a vendor widget; will be either autocomplete or dropdown
|
||||||
|
depending on config.
|
||||||
|
"""
|
||||||
|
# use autocomplete widget by default
|
||||||
|
factory = VendorAutocompleteWidget
|
||||||
|
|
||||||
|
# caller may request dropdown widget
|
||||||
|
if kwargs.pop('dropdown', False):
|
||||||
|
factory = VendorDropdownWidget
|
||||||
|
|
||||||
|
else: # or, config may say to use dropdown
|
||||||
|
app = request.rattail_config.get_app()
|
||||||
|
vendor_handler = app.get_vendor_handler()
|
||||||
|
if vendor_handler.choice_uses_dropdown():
|
||||||
|
factory = VendorDropdownWidget
|
||||||
|
|
||||||
|
# instantiate whichever
|
||||||
|
return factory(request, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
class VendorAutocompleteWidget(JQueryAutocompleteWidget):
|
||||||
|
"""
|
||||||
|
Autocomplete widget for a Vendor reference field.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, request, *args, **kwargs):
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
self.request = request
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
model = app.model
|
||||||
|
|
||||||
|
# must figure out URL providing autocomplete service
|
||||||
|
if 'service_url' not in kwargs:
|
||||||
|
|
||||||
|
# caller can just pass 'url' instead of 'service_url'
|
||||||
|
if 'url' in kwargs:
|
||||||
|
self.service_url = kwargs['url']
|
||||||
|
|
||||||
|
else: # use default url
|
||||||
|
self.service_url = self.request.route_url('vendors.autocomplete')
|
||||||
|
|
||||||
|
# # TODO
|
||||||
|
# if 'input_callback' not in kwargs:
|
||||||
|
# if 'input_handler' in kwargs:
|
||||||
|
# self.input_callback = input_handler
|
||||||
|
|
||||||
|
def serialize(self, field, cstruct, **kw):
|
||||||
|
""" """
|
||||||
|
# fetch vendor to provide button label, if we have a value
|
||||||
|
if cstruct:
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
model = app.model
|
||||||
|
vendor = Session.get(model.Vendor, cstruct)
|
||||||
|
if vendor:
|
||||||
|
self.field_display = str(vendor)
|
||||||
|
|
||||||
|
return super().serialize(
|
||||||
|
field, cstruct, **kw)
|
||||||
|
|
||||||
|
|
||||||
|
class VendorDropdownWidget(dfwidget.SelectWidget):
|
||||||
|
"""
|
||||||
|
Dropdown widget for a Vendor reference field.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, request, *args, **kwargs):
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
self.request = request
|
||||||
|
|
||||||
|
# must figure out dropdown values, if they weren't given
|
||||||
|
if 'values' not in kwargs:
|
||||||
|
|
||||||
|
# use what caller gave us, if they did
|
||||||
|
if 'vendors' in kwargs:
|
||||||
|
vendors = kwargs['vendors']
|
||||||
|
if callable(vendors):
|
||||||
|
vendors = vendors()
|
||||||
|
|
||||||
|
else: # default vendor list
|
||||||
|
app = self.request.rattail_config.get_app()
|
||||||
|
model = app.model
|
||||||
|
vendors = Session.query(model.Vendor)\
|
||||||
|
.order_by(model.Vendor.name)\
|
||||||
|
.all()
|
||||||
|
|
||||||
|
# convert vendor list to option values
|
||||||
|
self.values = [(c.uuid, c.name)
|
||||||
|
for c in vendors]
|
|
@ -1,399 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Forms Core
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import logging
|
|
||||||
|
|
||||||
import six
|
|
||||||
import sqlalchemy as sa
|
|
||||||
from sqlalchemy import orm
|
|
||||||
from sqlalchemy.ext.associationproxy import AssociationProxy, ASSOCIATION_PROXY
|
|
||||||
|
|
||||||
from rattail.util import prettify, pretty_boolean
|
|
||||||
|
|
||||||
import colander
|
|
||||||
from colanderalchemy import SQLAlchemySchemaNode
|
|
||||||
import deform
|
|
||||||
from deform import widget as dfwidget
|
|
||||||
from pyramid.renderers import render
|
|
||||||
from webhelpers2.html import tags, HTML
|
|
||||||
|
|
||||||
from tailbone.util import raw_datetime
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class CustomSchemaNode(SQLAlchemySchemaNode):
|
|
||||||
|
|
||||||
def get_schema_from_relationship(self, prop, overrides):
|
|
||||||
""" Build and return a :class:`colander.SchemaNode` for a relationship.
|
|
||||||
"""
|
|
||||||
|
|
||||||
# for some reason ColanderAlchemy wants to crawl our entire ORM by
|
|
||||||
# default, by way of relationships. this 'excludes' hack is used to
|
|
||||||
# prevent that, by forcing skip of 2nd-level relationships
|
|
||||||
|
|
||||||
excludes = []
|
|
||||||
if isinstance(prop, orm.RelationshipProperty):
|
|
||||||
for next_prop in prop.mapper.iterate_properties:
|
|
||||||
if isinstance(next_prop, orm.RelationshipProperty):
|
|
||||||
excludes.append(next_prop.key)
|
|
||||||
|
|
||||||
if excludes:
|
|
||||||
overrides['excludes'] = excludes
|
|
||||||
|
|
||||||
return super(CustomSchemaNode, self).get_schema_from_relationship(prop, overrides)
|
|
||||||
|
|
||||||
def dictify(self, obj):
|
|
||||||
""" Return a dictified version of `obj` using schema information.
|
|
||||||
|
|
||||||
.. note::
|
|
||||||
This method was copied from upstream and modified to add automatic
|
|
||||||
handling of "association proxy" fields.
|
|
||||||
"""
|
|
||||||
dict_ = super(CustomSchemaNode, self).dictify(obj)
|
|
||||||
for node in self:
|
|
||||||
|
|
||||||
name = node.name
|
|
||||||
if name not in dict_:
|
|
||||||
|
|
||||||
try:
|
|
||||||
desc = getattr(self.inspector.all_orm_descriptors, name)
|
|
||||||
if desc.extension_type != ASSOCIATION_PROXY:
|
|
||||||
continue
|
|
||||||
value = getattr(obj, name)
|
|
||||||
except AttributeError:
|
|
||||||
continue
|
|
||||||
|
|
||||||
if value is None:
|
|
||||||
if isinstance(node.typ, colander.String):
|
|
||||||
# colander has an issue with `None` on a String type
|
|
||||||
# where it translates it into "None". Let's check
|
|
||||||
# for that specific case and turn it into a
|
|
||||||
# `colander.null`.
|
|
||||||
dict_[name] = colander.null
|
|
||||||
else:
|
|
||||||
# A specific case this helps is with Integer where
|
|
||||||
# `None` is an invalid value. We call serialize()
|
|
||||||
# to test if we have a value that will work later
|
|
||||||
# for serialization and then allow it if it doesn't
|
|
||||||
# raise an exception. Hopefully this also catches
|
|
||||||
# issues with user defined types and future issues.
|
|
||||||
try:
|
|
||||||
node.serialize(value)
|
|
||||||
except:
|
|
||||||
dict_[name] = colander.null
|
|
||||||
else:
|
|
||||||
dict_[name] = value
|
|
||||||
else:
|
|
||||||
dict_[name] = value
|
|
||||||
|
|
||||||
return dict_
|
|
||||||
|
|
||||||
def objectify(self, dict_, context=None):
|
|
||||||
""" Return an object representing ``dict_`` using schema information.
|
|
||||||
|
|
||||||
.. note::
|
|
||||||
This method was copied from upstream and modified to add automatic
|
|
||||||
handling of "association proxy" fields.
|
|
||||||
"""
|
|
||||||
mapper = self.inspector
|
|
||||||
context = mapper.class_() if context is None else context
|
|
||||||
for attr in dict_:
|
|
||||||
if mapper.has_property(attr):
|
|
||||||
prop = mapper.get_property(attr)
|
|
||||||
if hasattr(prop, 'mapper'):
|
|
||||||
cls = prop.mapper.class_
|
|
||||||
if prop.uselist:
|
|
||||||
# Sequence of objects
|
|
||||||
value = [self[attr].children[0].objectify(obj)
|
|
||||||
for obj in dict_[attr]]
|
|
||||||
else:
|
|
||||||
# Single object
|
|
||||||
value = self[attr].objectify(dict_[attr])
|
|
||||||
else:
|
|
||||||
value = dict_[attr]
|
|
||||||
if value is colander.null:
|
|
||||||
# `colander.null` is never an appropriate
|
|
||||||
# value to be placed on an SQLAlchemy object
|
|
||||||
# so we translate it into `None`.
|
|
||||||
value = None
|
|
||||||
setattr(context, attr, value)
|
|
||||||
|
|
||||||
else:
|
|
||||||
# try to process association proxy field
|
|
||||||
desc = mapper.all_orm_descriptors.get(attr)
|
|
||||||
if desc and desc.extension_type == ASSOCIATION_PROXY:
|
|
||||||
value = dict_[attr]
|
|
||||||
if value is colander.null:
|
|
||||||
# `colander.null` is never an appropriate
|
|
||||||
# value to be placed on an SQLAlchemy object
|
|
||||||
# so we translate it into `None`.
|
|
||||||
value = None
|
|
||||||
setattr(context, attr, value)
|
|
||||||
|
|
||||||
else:
|
|
||||||
# Ignore attributes if they are not mapped
|
|
||||||
log.debug(
|
|
||||||
'SQLAlchemySchemaNode.objectify: %s not found on '
|
|
||||||
'%s. This property has been ignored.',
|
|
||||||
attr, self
|
|
||||||
)
|
|
||||||
continue
|
|
||||||
|
|
||||||
return context
|
|
||||||
|
|
||||||
|
|
||||||
class Form(object):
|
|
||||||
"""
|
|
||||||
Base class for all forms.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, fields=None, schema=None, request=None, readonly=False, readonly_fields=[],
|
|
||||||
model_instance=None, model_class=None, labels={}, renderers={}, widgets={},
|
|
||||||
action_url=None, cancel_url=None):
|
|
||||||
|
|
||||||
self.fields = list(fields) if fields is not None else None
|
|
||||||
self.schema = schema
|
|
||||||
self.request = request
|
|
||||||
self.readonly = readonly
|
|
||||||
self.readonly_fields = set(readonly_fields or [])
|
|
||||||
self.model_instance = model_instance
|
|
||||||
self.model_class = model_class
|
|
||||||
if self.model_instance and not self.model_class:
|
|
||||||
self.model_class = type(self.model_instance)
|
|
||||||
if self.model_class and self.fields is None:
|
|
||||||
self.fields = self.make_fields()
|
|
||||||
self.labels = labels or {}
|
|
||||||
self.renderers = renderers or {}
|
|
||||||
self.widgets = widgets or {}
|
|
||||||
self.action_url = action_url
|
|
||||||
self.cancel_url = cancel_url
|
|
||||||
|
|
||||||
def make_fields(self):
|
|
||||||
"""
|
|
||||||
Return a default list of fields, based on :attr:`model_class`.
|
|
||||||
"""
|
|
||||||
if not self.model_class:
|
|
||||||
raise ValueError("Must define model_class to use make_fields()")
|
|
||||||
|
|
||||||
mapper = orm.class_mapper(self.model_class)
|
|
||||||
|
|
||||||
# first add primary column fields
|
|
||||||
fields = [prop.key for prop in mapper.iterate_properties
|
|
||||||
if not prop.key.startswith('_')
|
|
||||||
and prop.key != 'versions']
|
|
||||||
|
|
||||||
# then add association proxy fields
|
|
||||||
for key, desc in sa.inspect(self.model_class).all_orm_descriptors.items():
|
|
||||||
if desc.extension_type == ASSOCIATION_PROXY:
|
|
||||||
fields.append(key)
|
|
||||||
|
|
||||||
return fields
|
|
||||||
|
|
||||||
def remove_field(self, key):
|
|
||||||
if key in self.fields:
|
|
||||||
self.fields.remove(key)
|
|
||||||
|
|
||||||
def make_schema(self):
|
|
||||||
if not self.model_class:
|
|
||||||
# TODO
|
|
||||||
raise NotImplementedError
|
|
||||||
|
|
||||||
if not self.schema:
|
|
||||||
|
|
||||||
mapper = orm.class_mapper(self.model_class)
|
|
||||||
|
|
||||||
# first filter our "full" field list so we ignore certain ones. in
|
|
||||||
# particular we don't want readonly fields in the schema, or any
|
|
||||||
# which appear to be "private"
|
|
||||||
includes = [f for f in self.fields
|
|
||||||
if f not in self.readonly_fields
|
|
||||||
and not f.startswith('_')
|
|
||||||
and f != 'versions']
|
|
||||||
|
|
||||||
# make schema - only include *property* fields at this point
|
|
||||||
schema = CustomSchemaNode(self.model_class,
|
|
||||||
includes=[p.key for p in mapper.iterate_properties
|
|
||||||
if p.key in includes])
|
|
||||||
|
|
||||||
# for now, must manually add any "extra" fields? this includes all
|
|
||||||
# association proxy fields, not sure how other fields will behave
|
|
||||||
for field in includes:
|
|
||||||
if field not in schema:
|
|
||||||
schema.add(colander.SchemaNode(colander.String(), name=field))
|
|
||||||
|
|
||||||
# apply any label overrides
|
|
||||||
for key, label in self.labels.items():
|
|
||||||
if key in schema:
|
|
||||||
schema[key].title = label
|
|
||||||
|
|
||||||
# apply any widget overrides
|
|
||||||
for key, widget in self.widgets.items():
|
|
||||||
if key in schema:
|
|
||||||
schema[key].widget = widget
|
|
||||||
|
|
||||||
self.schema = schema
|
|
||||||
|
|
||||||
return self.schema
|
|
||||||
|
|
||||||
def set_label(self, key, label):
|
|
||||||
self.labels[key] = label
|
|
||||||
|
|
||||||
def get_label(self, key):
|
|
||||||
return self.labels.get(key, prettify(key))
|
|
||||||
|
|
||||||
def set_readonly(self, key, readonly=True):
|
|
||||||
if readonly:
|
|
||||||
self.readonly_fields.add(key)
|
|
||||||
else:
|
|
||||||
if key in self.readonly_fields:
|
|
||||||
self.readonly_fields.remove(key)
|
|
||||||
|
|
||||||
def set_type(self, key, type_):
|
|
||||||
if type_ == 'datetime':
|
|
||||||
self.set_renderer(key, self.render_datetime)
|
|
||||||
elif type_ == 'boolean':
|
|
||||||
self.set_renderer(key, self.render_boolean)
|
|
||||||
elif type_ == 'codeblock':
|
|
||||||
self.set_renderer(key, self.render_codeblock)
|
|
||||||
self.set_widget(key, dfwidget.TextAreaWidget(cols=80, rows=8))
|
|
||||||
else:
|
|
||||||
raise ValueError("unknown type for '{}' field: {}".format(key, type_))
|
|
||||||
|
|
||||||
def set_renderer(self, key, renderer):
|
|
||||||
self.renderers[key] = renderer
|
|
||||||
|
|
||||||
def set_widget(self, key, widget):
|
|
||||||
self.widgets[key] = widget
|
|
||||||
|
|
||||||
def set_validator(self, key, validator):
|
|
||||||
schema = self.make_schema()
|
|
||||||
schema[key].validator = validator
|
|
||||||
|
|
||||||
def render(self, template=None, **kwargs):
|
|
||||||
if not template:
|
|
||||||
if self.readonly:
|
|
||||||
template = '/forms2/form_readonly.mako'
|
|
||||||
else:
|
|
||||||
template = '/forms2/form.mako'
|
|
||||||
context = kwargs
|
|
||||||
context['form'] = self
|
|
||||||
return render(template, context)
|
|
||||||
|
|
||||||
def make_deform_form(self):
|
|
||||||
if not hasattr(self, 'deform_form'):
|
|
||||||
|
|
||||||
schema = self.make_schema()
|
|
||||||
|
|
||||||
# get initial form values from model instance
|
|
||||||
kwargs = {}
|
|
||||||
if self.model_instance:
|
|
||||||
kwargs['appstruct'] = schema.dictify(self.model_instance)
|
|
||||||
|
|
||||||
# create form
|
|
||||||
form = deform.Form(schema, **kwargs)
|
|
||||||
|
|
||||||
# set readonly widget where applicable
|
|
||||||
for field in self.readonly_fields:
|
|
||||||
if field in form:
|
|
||||||
form[field].widget = ReadonlyWidget()
|
|
||||||
|
|
||||||
self.deform_form = form
|
|
||||||
|
|
||||||
return self.deform_form
|
|
||||||
|
|
||||||
def render_deform(self, dform=None, template='/forms2/deform.mako', **kwargs):
|
|
||||||
if dform is None:
|
|
||||||
dform = self.make_deform_form()
|
|
||||||
|
|
||||||
# TODO: would perhaps be nice to leverage deform's default rendering
|
|
||||||
# someday..? i.e. using Chameleon *.pt templates
|
|
||||||
# return form.render()
|
|
||||||
|
|
||||||
context = kwargs
|
|
||||||
context['form'] = self
|
|
||||||
context['dform'] = dform
|
|
||||||
context['request'] = self.request
|
|
||||||
context['readonly_fields'] = self.readonly_fields
|
|
||||||
context['render_field_readonly'] = self.render_field_readonly
|
|
||||||
return render('/forms2/deform.mako', context)
|
|
||||||
|
|
||||||
def render_field_readonly(self, field_name, **kwargs):
|
|
||||||
label = HTML.tag('label', self.get_label(field_name), for_=field_name)
|
|
||||||
field = self.render_field_value(field_name) or ''
|
|
||||||
field_div = HTML.tag('div', class_='field', c=field)
|
|
||||||
return HTML.tag('div', class_='field-wrapper {}'.format(field), c=label + field_div)
|
|
||||||
|
|
||||||
def render_field_value(self, field_name):
|
|
||||||
record = self.model_instance
|
|
||||||
if self.renderers and field_name in self.renderers:
|
|
||||||
return self.renderers[field_name](record, field_name)
|
|
||||||
return self.render_generic(record, field_name)
|
|
||||||
|
|
||||||
def render_generic(self, record, field_name):
|
|
||||||
value = self.obtain_value(record, field_name)
|
|
||||||
if value is None:
|
|
||||||
return ""
|
|
||||||
return six.text_type(value)
|
|
||||||
|
|
||||||
def render_datetime(self, record, field_name):
|
|
||||||
value = self.obtain_value(record, field_name)
|
|
||||||
if value is None:
|
|
||||||
return ""
|
|
||||||
return raw_datetime(self.request.rattail_config, value)
|
|
||||||
|
|
||||||
def render_boolean(self, record, field_name):
|
|
||||||
value = self.obtain_value(record, field_name)
|
|
||||||
return pretty_boolean(value)
|
|
||||||
|
|
||||||
def render_codeblock(self, record, field_name):
|
|
||||||
value = self.obtain_value(record, field_name)
|
|
||||||
if value is None:
|
|
||||||
return ""
|
|
||||||
return HTML.tag('pre', value)
|
|
||||||
|
|
||||||
def obtain_value(self, record, field_name):
|
|
||||||
try:
|
|
||||||
return record[field_name]
|
|
||||||
except TypeError:
|
|
||||||
return getattr(record, field_name)
|
|
||||||
|
|
||||||
def validate(self, *args, **kwargs):
|
|
||||||
form = self.make_deform_form()
|
|
||||||
return form.validate(*args, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class ReadonlyWidget(dfwidget.HiddenWidget):
|
|
||||||
|
|
||||||
readonly = True
|
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
|
||||||
if cstruct in (colander.null, None):
|
|
||||||
cstruct = ''
|
|
||||||
return HTML.tag('span', cstruct) + tags.hidden(field.name, value=cstruct, id=field.oid)
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2021 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -28,4 +28,3 @@ from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
from . import filters
|
from . import filters
|
||||||
from .core import Grid, GridAction
|
from .core import Grid, GridAction
|
||||||
from .mobile import MobileGrid
|
|
||||||
|
|
File diff suppressed because it is too large
Load diff
File diff suppressed because it is too large
Load diff
82
tailbone/handler.py
Normal file
82
tailbone/handler.py
Normal file
|
@ -0,0 +1,82 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Tailbone Handler
|
||||||
|
"""
|
||||||
|
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
from mako.lookup import TemplateLookup
|
||||||
|
|
||||||
|
from rattail.app import GenericHandler
|
||||||
|
from rattail.files import resource_path
|
||||||
|
|
||||||
|
from tailbone.providers import get_all_providers
|
||||||
|
|
||||||
|
|
||||||
|
class TailboneHandler(GenericHandler):
|
||||||
|
"""
|
||||||
|
Base class and default implementation for Tailbone handler.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, *args, **kwargs):
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
|
||||||
|
# TODO: make templates dir configurable?
|
||||||
|
templates = [resource_path('rattail:templates/web')]
|
||||||
|
self.templates = TemplateLookup(directories=templates)
|
||||||
|
|
||||||
|
def get_menu_handler(self, **kwargs):
|
||||||
|
"""
|
||||||
|
DEPRECATED; use
|
||||||
|
:meth:`wuttaweb.handler.WebHandler.get_menu_handler()`
|
||||||
|
instead.
|
||||||
|
"""
|
||||||
|
warnings.warn("TailboneHandler.get_menu_handler() is deprecated; "
|
||||||
|
"please use WebHandler.get_menu_handler() instead",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
|
||||||
|
if not hasattr(self, 'menu_handler'):
|
||||||
|
spec = self.config.get('tailbone.menus', 'handler',
|
||||||
|
default='tailbone.menus:MenuHandler')
|
||||||
|
Handler = self.app.load_object(spec)
|
||||||
|
self.menu_handler = Handler(self.config)
|
||||||
|
self.menu_handler.tb = self
|
||||||
|
return self.menu_handler
|
||||||
|
|
||||||
|
def iter_providers(self):
|
||||||
|
"""
|
||||||
|
Returns an iterator over all registered Tailbone providers.
|
||||||
|
"""
|
||||||
|
providers = get_all_providers(self.config)
|
||||||
|
return providers.values()
|
||||||
|
|
||||||
|
def write_model_view(self, data, path, **kwargs):
|
||||||
|
"""
|
||||||
|
Write code for a new model view, based on the given data dict,
|
||||||
|
to the given path.
|
||||||
|
"""
|
||||||
|
template = self.templates.get_template('/new-model-view.mako')
|
||||||
|
content = template.render(**data)
|
||||||
|
with open(path, 'wt') as f:
|
||||||
|
f.write(content)
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,18 +24,21 @@
|
||||||
Template Context Helpers
|
Template Context Helpers
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
# start off with all from wuttaweb
|
||||||
|
from wuttaweb.helpers import *
|
||||||
|
|
||||||
|
import os
|
||||||
import datetime
|
import datetime
|
||||||
from decimal import Decimal
|
from decimal import Decimal
|
||||||
|
from collections import OrderedDict
|
||||||
|
|
||||||
from rattail.time import localtime, make_utc
|
from rattail.time import localtime, make_utc
|
||||||
from rattail.util import pretty_quantity
|
from rattail.util import pretty_quantity, pretty_hours, hours_as_decimal
|
||||||
|
from rattail.db.util import maxlen
|
||||||
|
|
||||||
from webhelpers2.html import *
|
from tailbone.util import (pretty_datetime, raw_datetime,
|
||||||
from webhelpers2.html.tags import *
|
render_markdown,
|
||||||
|
route_exists)
|
||||||
from tailbone.util import csrf_token, pretty_datetime
|
|
||||||
|
|
||||||
|
|
||||||
def pretty_date(date):
|
def pretty_date(date):
|
||||||
|
|
772
tailbone/menus.py
Normal file
772
tailbone/menus.py
Normal file
|
@ -0,0 +1,772 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2024 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
App Menus
|
||||||
|
"""
|
||||||
|
|
||||||
|
import logging
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
from rattail.util import prettify, simple_error
|
||||||
|
|
||||||
|
from webhelpers2.html import tags, HTML
|
||||||
|
|
||||||
|
from wuttaweb.menus import MenuHandler as WuttaMenuHandler
|
||||||
|
|
||||||
|
from tailbone.db import Session
|
||||||
|
|
||||||
|
|
||||||
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
|
class TailboneMenuHandler(WuttaMenuHandler):
|
||||||
|
"""
|
||||||
|
Base class and default implementation for menu handler.
|
||||||
|
"""
|
||||||
|
|
||||||
|
##############################
|
||||||
|
# internal methods
|
||||||
|
##############################
|
||||||
|
|
||||||
|
def _is_allowed(self, request, item):
|
||||||
|
"""
|
||||||
|
TODO: must override this until wuttaweb has proper user auth checks
|
||||||
|
"""
|
||||||
|
perm = item.get('perm')
|
||||||
|
if perm:
|
||||||
|
return request.has_perm(perm)
|
||||||
|
return True
|
||||||
|
|
||||||
|
def _make_raw_menus(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
We are overriding this to allow for making dynamic menus from
|
||||||
|
config/settings. Which may or may not be a good idea..
|
||||||
|
"""
|
||||||
|
# first try to make menus from config, but this is highly
|
||||||
|
# susceptible to failure, so try to warn user of problems
|
||||||
|
try:
|
||||||
|
menus = self._make_menus_from_config(request)
|
||||||
|
if menus:
|
||||||
|
return menus
|
||||||
|
except Exception as error:
|
||||||
|
|
||||||
|
# TODO: these messages show up multiple times on some pages?!
|
||||||
|
# that must mean the BeforeRender event is firing multiple
|
||||||
|
# times..but why?? seems like there is only 1 request...
|
||||||
|
log.warning("failed to make menus from config", exc_info=True)
|
||||||
|
request.session.flash(simple_error(error), 'error')
|
||||||
|
request.session.flash("Menu config is invalid! Reverting to menus "
|
||||||
|
"defined in code!", 'warning')
|
||||||
|
msg = HTML.literal('Please edit your {} ASAP.'.format(
|
||||||
|
tags.link_to("Menu Config", request.route_url('configure_menus'))))
|
||||||
|
request.session.flash(msg, 'warning')
|
||||||
|
|
||||||
|
# okay, no config, so menus will be built from code
|
||||||
|
return self.make_menus(request, **kwargs)
|
||||||
|
|
||||||
|
def _make_menus_from_config(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Try to build a complete menu set from config/settings.
|
||||||
|
|
||||||
|
This will look in the DB settings table, or config file, for
|
||||||
|
menu data. If found, it constructs menus from that data.
|
||||||
|
"""
|
||||||
|
# bail unless config defines top-level menu keys
|
||||||
|
main_keys = self.config.getlist('tailbone.menu', 'menus')
|
||||||
|
if not main_keys:
|
||||||
|
return
|
||||||
|
|
||||||
|
model = self.app.model
|
||||||
|
menus = []
|
||||||
|
|
||||||
|
# menu definition can come either from config file or db
|
||||||
|
# settings, but if the latter then we want to optimize with
|
||||||
|
# one big query
|
||||||
|
if self.config.getbool('tailbone.menu', 'from_settings',
|
||||||
|
default=False):
|
||||||
|
|
||||||
|
# fetch all menu-related settings at once
|
||||||
|
query = Session().query(model.Setting)\
|
||||||
|
.filter(model.Setting.name.like('tailbone.menu.%'))
|
||||||
|
settings = self.app.cache_model(Session(), model.Setting,
|
||||||
|
query=query, key='name',
|
||||||
|
normalizer=lambda s: s.value)
|
||||||
|
for key in main_keys:
|
||||||
|
menus.append(self._make_single_menu_from_settings(request, key, settings))
|
||||||
|
|
||||||
|
else: # read from config file only
|
||||||
|
for key in main_keys:
|
||||||
|
menus.append(self._make_single_menu_from_config(request, key))
|
||||||
|
|
||||||
|
return menus
|
||||||
|
|
||||||
|
def _make_single_menu_from_config(self, request, key, **kwargs):
|
||||||
|
"""
|
||||||
|
Makes a single top-level menu dict from config file. Note
|
||||||
|
that this will read from config file(s) *only* and avoids
|
||||||
|
querying the database, for efficiency.
|
||||||
|
"""
|
||||||
|
menu = {
|
||||||
|
'key': key,
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [],
|
||||||
|
}
|
||||||
|
|
||||||
|
# title
|
||||||
|
title = self.config.get('tailbone.menu',
|
||||||
|
'menu.{}.label'.format(key),
|
||||||
|
usedb=False)
|
||||||
|
menu['title'] = title or prettify(key)
|
||||||
|
|
||||||
|
# items
|
||||||
|
item_keys = self.config.getlist('tailbone.menu',
|
||||||
|
'menu.{}.items'.format(key),
|
||||||
|
usedb=False)
|
||||||
|
for item_key in item_keys:
|
||||||
|
item = {}
|
||||||
|
|
||||||
|
if item_key == 'SEP':
|
||||||
|
item['type'] = 'sep'
|
||||||
|
|
||||||
|
else:
|
||||||
|
item['type'] = 'item'
|
||||||
|
item['key'] = item_key
|
||||||
|
|
||||||
|
# title
|
||||||
|
title = self.config.get('tailbone.menu',
|
||||||
|
'menu.{}.item.{}.label'.format(key, item_key),
|
||||||
|
usedb=False)
|
||||||
|
item['title'] = title or prettify(item_key)
|
||||||
|
|
||||||
|
# route
|
||||||
|
route = self.config.get('tailbone.menu',
|
||||||
|
'menu.{}.item.{}.route'.format(key, item_key),
|
||||||
|
usedb=False)
|
||||||
|
if route:
|
||||||
|
item['route'] = route
|
||||||
|
item['url'] = request.route_url(route)
|
||||||
|
|
||||||
|
else:
|
||||||
|
|
||||||
|
# url
|
||||||
|
url = self.config.get('tailbone.menu',
|
||||||
|
'menu.{}.item.{}.url'.format(key, item_key),
|
||||||
|
usedb=False)
|
||||||
|
if not url:
|
||||||
|
url = request.route_url(item_key)
|
||||||
|
elif url.startswith('route:'):
|
||||||
|
url = request.route_url(url[6:])
|
||||||
|
item['url'] = url
|
||||||
|
|
||||||
|
# perm
|
||||||
|
perm = self.config.get('tailbone.menu',
|
||||||
|
'menu.{}.item.{}.perm'.format(key, item_key),
|
||||||
|
usedb=False)
|
||||||
|
item['perm'] = perm or '{}.list'.format(item_key)
|
||||||
|
|
||||||
|
menu['items'].append(item)
|
||||||
|
|
||||||
|
return menu
|
||||||
|
|
||||||
|
def _make_single_menu_from_settings(self, request, key, settings, **kwargs):
|
||||||
|
"""
|
||||||
|
Makes a single top-level menu dict from DB settings.
|
||||||
|
"""
|
||||||
|
menu = {
|
||||||
|
'key': key,
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [],
|
||||||
|
}
|
||||||
|
|
||||||
|
# title
|
||||||
|
title = settings.get('tailbone.menu.menu.{}.label'.format(key))
|
||||||
|
menu['title'] = title or prettify(key)
|
||||||
|
|
||||||
|
# items
|
||||||
|
item_keys = self.config.parse_list(
|
||||||
|
settings.get('tailbone.menu.menu.{}.items'.format(key)))
|
||||||
|
for item_key in item_keys:
|
||||||
|
item = {}
|
||||||
|
|
||||||
|
if item_key == 'SEP':
|
||||||
|
item['type'] = 'sep'
|
||||||
|
|
||||||
|
else:
|
||||||
|
item['type'] = 'item'
|
||||||
|
item['key'] = item_key
|
||||||
|
|
||||||
|
# title
|
||||||
|
title = settings.get('tailbone.menu.menu.{}.item.{}.label'.format(
|
||||||
|
key, item_key))
|
||||||
|
item['title'] = title or prettify(item_key)
|
||||||
|
|
||||||
|
# route
|
||||||
|
route = settings.get('tailbone.menu.menu.{}.item.{}.route'.format(
|
||||||
|
key, item_key))
|
||||||
|
if route:
|
||||||
|
item['route'] = route
|
||||||
|
item['url'] = request.route_url(route)
|
||||||
|
|
||||||
|
else:
|
||||||
|
|
||||||
|
# url
|
||||||
|
url = settings.get('tailbone.menu.menu.{}.item.{}.url'.format(
|
||||||
|
key, item_key))
|
||||||
|
if not url:
|
||||||
|
url = request.route_url(item_key)
|
||||||
|
if url.startswith('route:'):
|
||||||
|
url = request.route_url(url[6:])
|
||||||
|
item['url'] = url
|
||||||
|
|
||||||
|
# perm
|
||||||
|
perm = settings.get('tailbone.menu.menu.{}.item.{}.perm'.format(
|
||||||
|
key, item_key))
|
||||||
|
item['perm'] = perm or '{}.list'.format(item_key)
|
||||||
|
|
||||||
|
menu['items'].append(item)
|
||||||
|
|
||||||
|
return menu
|
||||||
|
|
||||||
|
##############################
|
||||||
|
# menu defaults
|
||||||
|
##############################
|
||||||
|
|
||||||
|
def make_menus(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Make the full set of menus for the app.
|
||||||
|
|
||||||
|
This method provides a semi-sane menu set by default, but it
|
||||||
|
is expected for most apps to override it.
|
||||||
|
"""
|
||||||
|
menus = [
|
||||||
|
self.make_custorders_menu(request),
|
||||||
|
self.make_people_menu(request),
|
||||||
|
self.make_products_menu(request),
|
||||||
|
self.make_vendors_menu(request),
|
||||||
|
]
|
||||||
|
|
||||||
|
integration_menus = self.make_integration_menus(request)
|
||||||
|
if integration_menus:
|
||||||
|
menus.extend(integration_menus)
|
||||||
|
|
||||||
|
menus.extend([
|
||||||
|
self.make_reports_menu(request, include_trainwreck=True),
|
||||||
|
self.make_batches_menu(request),
|
||||||
|
self.make_admin_menu(request, include_stores=True),
|
||||||
|
])
|
||||||
|
|
||||||
|
return menus
|
||||||
|
|
||||||
|
def make_integration_menus(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Make a set of menus for all registered system integrations.
|
||||||
|
"""
|
||||||
|
tb = self.app.get_tailbone_handler()
|
||||||
|
menus = []
|
||||||
|
for provider in tb.iter_providers():
|
||||||
|
menu = provider.make_integration_menu(request)
|
||||||
|
if menu:
|
||||||
|
menus.append(menu)
|
||||||
|
menus.sort(key=lambda menu: menu['title'].lower())
|
||||||
|
return menus
|
||||||
|
|
||||||
|
def make_custorders_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical Customer Orders menu
|
||||||
|
"""
|
||||||
|
return {
|
||||||
|
'title': "Orders",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [
|
||||||
|
{
|
||||||
|
'title': "New Customer Order",
|
||||||
|
'route': 'custorders.create',
|
||||||
|
'perm': 'custorders.create',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "All New Orders",
|
||||||
|
'route': 'new_custorders',
|
||||||
|
'perm': 'new_custorders.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "All Customer Orders",
|
||||||
|
'route': 'custorders',
|
||||||
|
'perm': 'custorders.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "All Order Items",
|
||||||
|
'route': 'custorders.items',
|
||||||
|
'perm': 'custorders.items.list',
|
||||||
|
},
|
||||||
|
],
|
||||||
|
}
|
||||||
|
|
||||||
|
def make_people_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical People menu
|
||||||
|
"""
|
||||||
|
return {
|
||||||
|
'title': "People",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [
|
||||||
|
{
|
||||||
|
'title': "Members",
|
||||||
|
'route': 'members',
|
||||||
|
'perm': 'members.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Member Equity Payments",
|
||||||
|
'route': 'member_equity_payments',
|
||||||
|
'perm': 'member_equity_payments.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Membership Types",
|
||||||
|
'route': 'membership_types',
|
||||||
|
'perm': 'membership_types.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Customers",
|
||||||
|
'route': 'customers',
|
||||||
|
'perm': 'customers.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Customer Shoppers",
|
||||||
|
'route': 'customer_shoppers',
|
||||||
|
'perm': 'customer_shoppers.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Customer Groups",
|
||||||
|
'route': 'customergroups',
|
||||||
|
'perm': 'customergroups.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Pending Customers",
|
||||||
|
'route': 'pending_customers',
|
||||||
|
'perm': 'pending_customers.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Employees",
|
||||||
|
'route': 'employees',
|
||||||
|
'perm': 'employees.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "All People",
|
||||||
|
'route': 'people',
|
||||||
|
'perm': 'people.list',
|
||||||
|
},
|
||||||
|
],
|
||||||
|
}
|
||||||
|
|
||||||
|
def make_products_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical Products menu
|
||||||
|
"""
|
||||||
|
return {
|
||||||
|
'title': "Products",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [
|
||||||
|
{
|
||||||
|
'title': "Products",
|
||||||
|
'route': 'products',
|
||||||
|
'perm': 'products.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Product Costs",
|
||||||
|
'route': 'product_costs',
|
||||||
|
'perm': 'product_costs.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Departments",
|
||||||
|
'route': 'departments',
|
||||||
|
'perm': 'departments.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Subdepartments",
|
||||||
|
'route': 'subdepartments',
|
||||||
|
'perm': 'subdepartments.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Brands",
|
||||||
|
'route': 'brands',
|
||||||
|
'perm': 'brands.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Categories",
|
||||||
|
'route': 'categories',
|
||||||
|
'perm': 'categories.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Families",
|
||||||
|
'route': 'families',
|
||||||
|
'perm': 'families.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Report Codes",
|
||||||
|
'route': 'reportcodes',
|
||||||
|
'perm': 'reportcodes.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Units of Measure",
|
||||||
|
'route': 'uoms',
|
||||||
|
'perm': 'uoms.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Pending Products",
|
||||||
|
'route': 'pending_products',
|
||||||
|
'perm': 'pending_products.list',
|
||||||
|
},
|
||||||
|
],
|
||||||
|
}
|
||||||
|
|
||||||
|
def make_vendors_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical Vendors menu
|
||||||
|
"""
|
||||||
|
return {
|
||||||
|
'title': "Vendors",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [
|
||||||
|
{
|
||||||
|
'title': "Vendors",
|
||||||
|
'route': 'vendors',
|
||||||
|
'perm': 'vendors.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Product Costs",
|
||||||
|
'route': 'product_costs',
|
||||||
|
'perm': 'product_costs.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Ordering",
|
||||||
|
'route': 'ordering',
|
||||||
|
'perm': 'ordering.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Receiving",
|
||||||
|
'route': 'receiving',
|
||||||
|
'perm': 'receiving.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Invoice Costing",
|
||||||
|
'route': 'invoice_costing',
|
||||||
|
'perm': 'invoice_costing.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Purchases",
|
||||||
|
'route': 'purchases',
|
||||||
|
'perm': 'purchases.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Credits",
|
||||||
|
'route': 'purchases.credits',
|
||||||
|
'perm': 'purchases.credits.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Catalog Batches",
|
||||||
|
'route': 'vendorcatalogs',
|
||||||
|
'perm': 'vendorcatalogs.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Sample Files",
|
||||||
|
'route': 'vendorsamplefiles',
|
||||||
|
'perm': 'vendorsamplefiles.list',
|
||||||
|
},
|
||||||
|
],
|
||||||
|
}
|
||||||
|
|
||||||
|
def make_batches_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical Batches menu
|
||||||
|
"""
|
||||||
|
return {
|
||||||
|
'title': "Batches",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [
|
||||||
|
{
|
||||||
|
'title': "Handheld",
|
||||||
|
'route': 'batch.handheld',
|
||||||
|
'perm': 'batch.handheld.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Inventory",
|
||||||
|
'route': 'batch.inventory',
|
||||||
|
'perm': 'batch.inventory.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Import / Export",
|
||||||
|
'route': 'batch.importer',
|
||||||
|
'perm': 'batch.importer.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "POS",
|
||||||
|
'route': 'batch.pos',
|
||||||
|
'perm': 'batch.pos.list',
|
||||||
|
},
|
||||||
|
],
|
||||||
|
}
|
||||||
|
|
||||||
|
def make_reports_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical Reports menu
|
||||||
|
"""
|
||||||
|
items = [
|
||||||
|
{
|
||||||
|
'title': "New Report",
|
||||||
|
'route': 'report_output.create',
|
||||||
|
'perm': 'report_output.create',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Generated Reports",
|
||||||
|
'route': 'report_output',
|
||||||
|
'perm': 'report_output.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Problem Reports",
|
||||||
|
'route': 'problem_reports',
|
||||||
|
'perm': 'problem_reports.list',
|
||||||
|
},
|
||||||
|
]
|
||||||
|
|
||||||
|
if kwargs.get('include_poser', False):
|
||||||
|
items.extend([
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Poser Reports",
|
||||||
|
'route': 'poser_reports',
|
||||||
|
'perm': 'poser_reports.list',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
if kwargs.get('include_worksheets', False):
|
||||||
|
items.extend([
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Ordering Worksheet",
|
||||||
|
'route': 'reports.ordering',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Inventory Worksheet",
|
||||||
|
'route': 'reports.inventory',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
if kwargs.get('include_trainwreck', False):
|
||||||
|
items.extend([
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Trainwreck",
|
||||||
|
'route': 'trainwreck.transactions',
|
||||||
|
'perm': 'trainwreck.transactions.list',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
return {
|
||||||
|
'title': "Reports",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': items,
|
||||||
|
}
|
||||||
|
|
||||||
|
def make_tempmon_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical TempMon menu
|
||||||
|
"""
|
||||||
|
return {
|
||||||
|
'title': "TempMon",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': [
|
||||||
|
{
|
||||||
|
'title': "Dashboard",
|
||||||
|
'route': 'tempmon.dashboard',
|
||||||
|
'perm': 'tempmon.appliances.dashboard',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Appliances",
|
||||||
|
'route': 'tempmon.appliances',
|
||||||
|
'perm': 'tempmon.appliances.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Clients",
|
||||||
|
'route': 'tempmon.clients',
|
||||||
|
'perm': 'tempmon.clients.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Probes",
|
||||||
|
'route': 'tempmon.probes',
|
||||||
|
'perm': 'tempmon.probes.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Readings",
|
||||||
|
'route': 'tempmon.readings',
|
||||||
|
'perm': 'tempmon.readings.list',
|
||||||
|
},
|
||||||
|
],
|
||||||
|
}
|
||||||
|
|
||||||
|
def make_admin_menu(self, request, **kwargs):
|
||||||
|
"""
|
||||||
|
Generate a typical Admin menu
|
||||||
|
"""
|
||||||
|
items = []
|
||||||
|
|
||||||
|
include_stores = kwargs.get('include_stores', True)
|
||||||
|
include_tenders = kwargs.get('include_tenders', True)
|
||||||
|
|
||||||
|
if include_stores or include_tenders:
|
||||||
|
|
||||||
|
if include_stores:
|
||||||
|
items.extend([
|
||||||
|
{
|
||||||
|
'title': "Stores",
|
||||||
|
'route': 'stores',
|
||||||
|
'perm': 'stores.list',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
if include_tenders:
|
||||||
|
items.extend([
|
||||||
|
{
|
||||||
|
'title': "Tenders",
|
||||||
|
'route': 'tenders',
|
||||||
|
'perm': 'tenders.list',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
items.append({'type': 'sep'})
|
||||||
|
|
||||||
|
items.extend([
|
||||||
|
{
|
||||||
|
'title': "Users",
|
||||||
|
'route': 'users',
|
||||||
|
'perm': 'users.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Roles",
|
||||||
|
'route': 'roles',
|
||||||
|
'perm': 'roles.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Raw Permissions",
|
||||||
|
'route': 'permissions',
|
||||||
|
'perm': 'permissions.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "Email Settings",
|
||||||
|
'route': 'emailprofiles',
|
||||||
|
'perm': 'emailprofiles.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Email Attempts",
|
||||||
|
'route': 'email_attempts',
|
||||||
|
'perm': 'email_attempts.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "DataSync Status",
|
||||||
|
'route': 'datasync.status',
|
||||||
|
'perm': 'datasync.status',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "DataSync Changes",
|
||||||
|
'route': 'datasyncchanges',
|
||||||
|
'perm': 'datasync_changes.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Importing / Exporting",
|
||||||
|
'route': 'importing',
|
||||||
|
'perm': 'importing.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Luigi Tasks",
|
||||||
|
'route': 'luigi',
|
||||||
|
'perm': 'luigi.list',
|
||||||
|
},
|
||||||
|
{'type': 'sep'},
|
||||||
|
{
|
||||||
|
'title': "App Info",
|
||||||
|
'route': 'appinfo',
|
||||||
|
'perm': 'appinfo.list',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
if kwargs.get('include_label_settings', False):
|
||||||
|
items.extend([
|
||||||
|
{
|
||||||
|
'title': "Label Settings",
|
||||||
|
'route': 'labelprofiles',
|
||||||
|
'perm': 'labelprofiles.list',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
items.extend([
|
||||||
|
{
|
||||||
|
'title': "Raw Settings",
|
||||||
|
'route': 'settings',
|
||||||
|
'perm': 'settings.list',
|
||||||
|
},
|
||||||
|
{
|
||||||
|
'title': "Upgrades",
|
||||||
|
'route': 'upgrades',
|
||||||
|
'perm': 'upgrades.list',
|
||||||
|
},
|
||||||
|
])
|
||||||
|
|
||||||
|
return {
|
||||||
|
'title': "Admin",
|
||||||
|
'type': 'menu',
|
||||||
|
'items': items,
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
class MenuHandler(TailboneMenuHandler):
|
||||||
|
|
||||||
|
def __init__(self, *args, **kwargs):
|
||||||
|
warnings.warn("tailbone.menus.MenuHandler is deprecated; "
|
||||||
|
"please use tailbone.menus.TailboneMenuHandler instead",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
super().__init__(*args, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
class NullMenuHandler(WuttaMenuHandler):
|
||||||
|
"""
|
||||||
|
Null menu handler which uses an empty menu set.
|
||||||
|
|
||||||
|
.. note:
|
||||||
|
|
||||||
|
This class shouldn't even exist, but for the moment, it is
|
||||||
|
useful to configure non-traditional (e.g. API) web apps to use
|
||||||
|
this, in order to avoid most of the overhead.
|
||||||
|
"""
|
||||||
|
|
||||||
|
def make_menus(self, request, **kwargs):
|
||||||
|
return []
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8 -*-
|
# -*- coding: utf-8; -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2017 Lance Edgar
|
# Copyright © 2010-2022 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -26,28 +26,57 @@ Progress Indicator
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
|
import os
|
||||||
|
import warnings
|
||||||
|
|
||||||
|
from rattail.progress import ProgressBase
|
||||||
|
|
||||||
from beaker.session import Session
|
from beaker.session import Session
|
||||||
|
|
||||||
|
|
||||||
def get_progress_session(request, key):
|
def get_basic_session(config, request={}, **kwargs):
|
||||||
|
"""
|
||||||
|
Create/get a "basic" Beaker session object.
|
||||||
|
"""
|
||||||
|
kwargs['use_cookies'] = False
|
||||||
|
session = Session(request, **kwargs)
|
||||||
|
return session
|
||||||
|
|
||||||
|
|
||||||
|
def get_progress_session(request, key, **kwargs):
|
||||||
"""
|
"""
|
||||||
Create/get a Beaker session object, to be used for progress.
|
Create/get a Beaker session object, to be used for progress.
|
||||||
"""
|
"""
|
||||||
id = '{0}.progress.{1}'.format(request.session.id, key)
|
kwargs['id'] = '{}.progress.{}'.format(request.session.id, key)
|
||||||
return Session(request, id, use_cookies=False)
|
if kwargs.get('type') == 'file':
|
||||||
|
warnings.warn("Passing a 'type' kwarg to get_progress_session() "
|
||||||
|
"is deprecated...i think",
|
||||||
|
DeprecationWarning, stacklevel=2)
|
||||||
|
kwargs['data_dir'] = os.path.join(request.rattail_config.appdir(), 'sessions')
|
||||||
|
return get_basic_session(request.rattail_config, request, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
class SessionProgress(object):
|
class SessionProgress(ProgressBase):
|
||||||
"""
|
"""
|
||||||
Provides a session-based progress bar mechanism.
|
Provides a session-based progress bar mechanism.
|
||||||
|
|
||||||
This class is only responsible for keeping the progress *data* current. It
|
This class is only responsible for keeping the progress *data* current. It
|
||||||
is the responsibility of some client-side AJAX (etc.) to consume the data
|
is the responsibility of some client-side AJAX (etc.) to consume the data
|
||||||
for display to the user.
|
for display to the user.
|
||||||
|
|
||||||
|
:param ws: If true, then websockets are assumed, and the progress will
|
||||||
|
behave accordingly. The default is false, "traditional" behavior.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, request, key):
|
def __init__(self, request, key, session_type=None, ws=False):
|
||||||
self.session = get_progress_session(request, key)
|
self.key = key
|
||||||
|
self.ws = ws
|
||||||
|
|
||||||
|
if self.ws:
|
||||||
|
self.session = get_basic_session(request.rattail_config, id=key)
|
||||||
|
else:
|
||||||
|
self.session = get_progress_session(request, key, type=session_type)
|
||||||
|
|
||||||
self.canceled = False
|
self.canceled = False
|
||||||
self.clear()
|
self.clear()
|
||||||
|
|
||||||
|
@ -75,6 +104,3 @@ class SessionProgress(object):
|
||||||
self.session['value'] = value
|
self.session['value'] = value
|
||||||
self.session.save()
|
self.session.save()
|
||||||
return not self.canceled
|
return not self.canceled
|
||||||
|
|
||||||
def destroy(self):
|
|
||||||
pass
|
|
||||||
|
|
62
tailbone/providers.py
Normal file
62
tailbone/providers.py
Normal file
|
@ -0,0 +1,62 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2023 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Providers for Tailbone features
|
||||||
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
|
from rattail.util import load_entry_points
|
||||||
|
|
||||||
|
|
||||||
|
class TailboneProvider(object):
|
||||||
|
"""
|
||||||
|
Base class for Tailbone providers. These are responsible for
|
||||||
|
declaring which things a given project makes available to the app.
|
||||||
|
(Or at least the things which should be easily configurable.)
|
||||||
|
"""
|
||||||
|
|
||||||
|
def __init__(self, config):
|
||||||
|
self.config = config
|
||||||
|
|
||||||
|
def configure_db_sessions(self, rattail_config, pyramid_config):
|
||||||
|
pass
|
||||||
|
|
||||||
|
def get_static_includes(self):
|
||||||
|
pass
|
||||||
|
|
||||||
|
def get_provided_views(self):
|
||||||
|
return {}
|
||||||
|
|
||||||
|
def make_integration_menu(self, request, **kwargs):
|
||||||
|
pass
|
||||||
|
|
||||||
|
|
||||||
|
def get_all_providers(config):
|
||||||
|
"""
|
||||||
|
Returns a dict of all registered providers.
|
||||||
|
"""
|
||||||
|
providers = load_entry_points('tailbone.providers')
|
||||||
|
for key in list(providers):
|
||||||
|
providers[key] = providers[key](config)
|
||||||
|
return providers
|
|
@ -111,7 +111,7 @@
|
||||||
<td class="brand">${cost.product.brand or ''}</td>
|
<td class="brand">${cost.product.brand or ''}</td>
|
||||||
<td class="desc">${cost.product.description}</td>
|
<td class="desc">${cost.product.description}</td>
|
||||||
<td class="size">${cost.product.size or ''}</td>
|
<td class="size">${cost.product.size or ''}</td>
|
||||||
<td class="case-qty">${cost.case_size} ${"LB" if cost.product.weighed else "EA"}</td>
|
<td class="case-qty">${app.render_quantity(cost.case_size)} ${"LB" if cost.product.weighed else "EA"}</td>
|
||||||
<td class="code">${cost.code or ''}</td>
|
<td class="code">${cost.code or ''}</td>
|
||||||
<td class="preferred">${'X' if cost.preference == 1 else ''}</td>
|
<td class="preferred">${'X' if cost.preference == 1 else ''}</td>
|
||||||
% for i in range(14):
|
% for i in range(14):
|
||||||
|
|
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Add a link
Reference in a new issue