Compare commits
No commits in common. "master" and "v0.7.27" have entirely different histories.
500 changed files with 20883 additions and 78020 deletions
3
.gitignore
vendored
3
.gitignore
vendored
|
@ -1,8 +1,5 @@
|
||||||
*~
|
|
||||||
*.pyc
|
|
||||||
.coverage
|
.coverage
|
||||||
.tox/
|
.tox/
|
||||||
dist/
|
|
||||||
docs/_build/
|
docs/_build/
|
||||||
htmlcov/
|
htmlcov/
|
||||||
Tailbone.egg-info/
|
Tailbone.egg-info/
|
||||||
|
|
689
CHANGELOG.md
689
CHANGELOG.md
|
@ -1,689 +0,0 @@
|
||||||
|
|
||||||
# Changelog
|
|
||||||
All notable changes to Tailbone will be documented in this file.
|
|
||||||
|
|
||||||
The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/)
|
|
||||||
and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html).
|
|
||||||
|
|
||||||
## v0.22.8 (2025-05-20)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- add startup hack for tempmon DB model
|
|
||||||
|
|
||||||
## v0.22.7 (2025-02-19)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- stop using old config for logo image url on login page
|
|
||||||
- fix warning msg for deprecated Grid param
|
|
||||||
|
|
||||||
## v0.22.6 (2025-02-01)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- register vue3 form component for products -> make batch
|
|
||||||
|
|
||||||
## v0.22.5 (2024-12-16)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- whoops this is latest rattail
|
|
||||||
- require newer rattail lib
|
|
||||||
- require newer wuttaweb
|
|
||||||
- let caller request safe HTML literal for rendered grid table
|
|
||||||
|
|
||||||
## v0.22.4 (2024-11-22)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid error in product search for duplicated key
|
|
||||||
- use vmodel for confirm password widget input
|
|
||||||
|
|
||||||
## v0.22.3 (2024-11-19)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid error for trainwreck query when not a customer
|
|
||||||
|
|
||||||
## v0.22.2 (2024-11-18)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- use local/custom enum for continuum operations
|
|
||||||
- add basic master view for Product Costs
|
|
||||||
- show continuum operation type when viewing version history
|
|
||||||
- always define `app` attr for ViewSupplement
|
|
||||||
- avoid deprecated import
|
|
||||||
|
|
||||||
## v0.22.1 (2024-11-02)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix submit button for running problem report
|
|
||||||
- avoid deprecated grid method
|
|
||||||
|
|
||||||
## v0.22.0 (2024-10-22)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- add support for new ordering batch from parsed file
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid deprecated method to suggest username
|
|
||||||
|
|
||||||
## v0.21.11 (2024-10-03)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- custom method for adding grid action
|
|
||||||
- become/stop root should redirect to previous url
|
|
||||||
|
|
||||||
## v0.21.10 (2024-09-15)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- update project repo links, kallithea -> forgejo
|
|
||||||
- use better icon for submit button on login page
|
|
||||||
- wrap notes text for batch view
|
|
||||||
- expose datasync consumer batch size via configure page
|
|
||||||
|
|
||||||
## v0.21.9 (2024-08-28)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- render custom attrs in form component tag
|
|
||||||
|
|
||||||
## v0.21.8 (2024-08-28)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- ignore session kwarg for `MasterView.make_row_grid()`
|
|
||||||
|
|
||||||
## v0.21.7 (2024-08-28)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid error when form value cannot be obtained
|
|
||||||
|
|
||||||
## v0.21.6 (2024-08-28)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid error when grid value cannot be obtained
|
|
||||||
|
|
||||||
## v0.21.5 (2024-08-28)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- set empty string for "-new-" file configure option
|
|
||||||
|
|
||||||
## v0.21.4 (2024-08-26)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- handle differing email profile keys for appinfo/configure
|
|
||||||
|
|
||||||
## v0.21.3 (2024-08-26)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- show non-standard config values for app info configure email
|
|
||||||
|
|
||||||
## v0.21.2 (2024-08-26)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- refactor waterpark base template to use wutta feedback component
|
|
||||||
- fix input/output file upload feature for configure pages, per oruga
|
|
||||||
- tweak how grid data translates to Vue template context
|
|
||||||
- merge filters into main grid template
|
|
||||||
- add basic wutta view for users
|
|
||||||
- some fixes for wutta people view
|
|
||||||
- various fixes for waterpark theme
|
|
||||||
- avoid deprecated `component` form kwarg
|
|
||||||
|
|
||||||
## v0.21.1 (2024-08-22)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- misc. bugfixes per recent changes
|
|
||||||
|
|
||||||
## v0.21.0 (2024-08-22)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- move "most" filtering logic for grid class to wuttaweb
|
|
||||||
- inherit from wuttaweb templates for home, login pages
|
|
||||||
- inherit from wuttaweb for AppInfoView, appinfo/configure template
|
|
||||||
- add "has output file templates" config option for master view
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- change grid reset-view param name to match wuttaweb
|
|
||||||
- move "searchable columns" grid feature to wuttaweb
|
|
||||||
- use wuttaweb to get/render csrf token
|
|
||||||
- inherit from wuttaweb for appinfo/index template
|
|
||||||
- prefer wuttaweb config for "home redirect to login" feature
|
|
||||||
- fix master/index template rendering for waterpark theme
|
|
||||||
- fix spacing for navbar logo/title in waterpark theme
|
|
||||||
|
|
||||||
## v0.20.1 (2024-08-20)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix default filter verbs logic for workorder status
|
|
||||||
|
|
||||||
## v0.20.0 (2024-08-20)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- add new 'waterpark' theme, based on wuttaweb w/ vue2 + buefy
|
|
||||||
- refactor templates to simplify base/page/form structure
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid deprecated reference to app db engine
|
|
||||||
|
|
||||||
## v0.19.3 (2024-08-19)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- add pager stats to all grid vue data (fixes view history)
|
|
||||||
|
|
||||||
## v0.19.2 (2024-08-19)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- sort on frontend for appinfo package listing grid
|
|
||||||
- prefer attr over key lookup when getting model values
|
|
||||||
- replace all occurrences of `component_studly` => `vue_component`
|
|
||||||
|
|
||||||
## v0.19.1 (2024-08-19)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix broken user auth for web API app
|
|
||||||
|
|
||||||
## v0.19.0 (2024-08-18)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- move multi-column grid sorting logic to wuttaweb
|
|
||||||
- move single-column grid sorting logic to wuttaweb
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix misc. errors in grid template per wuttaweb
|
|
||||||
- fix broken permission directives in web api startup
|
|
||||||
|
|
||||||
## v0.18.0 (2024-08-16)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- move "basic" grid pagination logic to wuttaweb
|
|
||||||
- inherit from wutta base class for Grid
|
|
||||||
- inherit most logic from wuttaweb, for GridAction
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid route error in user view, when using wutta people view
|
|
||||||
- fix some more wutta compat for base template
|
|
||||||
|
|
||||||
## v0.17.0 (2024-08-15)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- use wuttaweb for `get_liburl()` logic
|
|
||||||
|
|
||||||
## v0.16.1 (2024-08-15)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- improve wutta People view a bit
|
|
||||||
- update references to `get_class_hierarchy()`
|
|
||||||
- tweak template for `people/view_profile` per wutta compat
|
|
||||||
|
|
||||||
## v0.16.0 (2024-08-15)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- add first wutta-based master, for PersonView
|
|
||||||
- refactor forms/grids/views/templates per wuttaweb compat
|
|
||||||
|
|
||||||
## v0.15.6 (2024-08-13)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid `before_render` subscriber hook for web API
|
|
||||||
- simplify verbiage for batch execution panel
|
|
||||||
|
|
||||||
## v0.15.5 (2024-08-09)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- assign convenience attrs for all views (config, app, enum, model)
|
|
||||||
|
|
||||||
## v0.15.4 (2024-08-09)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid bug when checking current theme
|
|
||||||
|
|
||||||
## v0.15.3 (2024-08-08)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix timepicker `parseTime()` when value is null
|
|
||||||
|
|
||||||
## v0.15.2 (2024-08-06)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- use auth handler, avoid legacy calls for role/perm checks
|
|
||||||
|
|
||||||
## v0.15.1 (2024-08-05)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- move magic `b` template context var to wuttaweb
|
|
||||||
|
|
||||||
## v0.15.0 (2024-08-05)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- move more subscriber logic to wuttaweb
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- use wuttaweb logic for `util.get_form_data()`
|
|
||||||
|
|
||||||
## v0.14.5 (2024-08-03)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- use auth handler instead of deprecated auth functions
|
|
||||||
- avoid duplicate `partial` param when grid reloads data
|
|
||||||
|
|
||||||
## v0.14.4 (2024-07-18)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix more settings persistence bug(s) for datasync/configure
|
|
||||||
- fix modals for luigi tasks page, per oruga
|
|
||||||
|
|
||||||
## v0.14.3 (2024-07-17)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix auto-collapse title for viewing trainwreck txn
|
|
||||||
- allow auto-collapse of header when viewing trainwreck txn
|
|
||||||
|
|
||||||
## v0.14.2 (2024-07-15)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- add null menu handler, for use with API apps
|
|
||||||
|
|
||||||
## v0.14.1 (2024-07-14)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- update usage of auth handler, per rattail changes
|
|
||||||
- fix model reference in menu handler
|
|
||||||
- fix bug when making "integration" menus
|
|
||||||
|
|
||||||
## v0.14.0 (2024-07-14)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- move core menu logic to wuttaweb
|
|
||||||
|
|
||||||
## v0.13.2 (2024-07-13)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix logic bug for datasync/config settings save
|
|
||||||
|
|
||||||
## v0.13.1 (2024-07-13)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix settings persistence bug(s) for datasync/configure page
|
|
||||||
|
|
||||||
## v0.13.0 (2024-07-12)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- begin integrating WuttaWeb as upstream dependency
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- cast enum as list to satisfy deform widget
|
|
||||||
|
|
||||||
## v0.12.1 (2024-07-11)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- refactor `config.get_model()` => `app.model`
|
|
||||||
|
|
||||||
## v0.12.0 (2024-07-09)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- drop python 3.6 support, use pyproject.toml (again)
|
|
||||||
|
|
||||||
## v0.11.10 (2024-07-05)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- make the Members tab optional, for profile view
|
|
||||||
|
|
||||||
## v0.11.9 (2024-07-05)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- do not show flash message when changing app theme
|
|
||||||
|
|
||||||
- improve collapse panels for butterball theme
|
|
||||||
|
|
||||||
- expand input for butterball theme
|
|
||||||
|
|
||||||
- add xref button to customer profile, for trainwreck txn view
|
|
||||||
|
|
||||||
- add optional Transactions tab for profile view
|
|
||||||
|
|
||||||
## v0.11.8 (2024-07-04)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix grid action icons for datasync/configure, per oruga
|
|
||||||
|
|
||||||
- allow view supplements to add extra links for profile employee tab
|
|
||||||
|
|
||||||
- leverage import handler method to determine command/subcommand
|
|
||||||
|
|
||||||
- add tool to make user account from profile view
|
|
||||||
|
|
||||||
## v0.11.7 (2024-07-04)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- add stacklevel to deprecation warnings
|
|
||||||
|
|
||||||
- require zope.sqlalchemy >= 1.5
|
|
||||||
|
|
||||||
- include edit profile email/phone dialogs only if user has perms
|
|
||||||
|
|
||||||
- allow view supplements to add to profile member context
|
|
||||||
|
|
||||||
- cast enum as list to satisfy deform widget
|
|
||||||
|
|
||||||
- expand POD image URL setting input
|
|
||||||
|
|
||||||
## v0.11.6 (2024-07-01)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- set explicit referrer when changing dbkey
|
|
||||||
|
|
||||||
- remove references, dependency for `six` package
|
|
||||||
|
|
||||||
## v0.11.5 (2024-06-30)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- allow comma in numeric filter input
|
|
||||||
|
|
||||||
- add custom url prefix if needed, for fanstatic
|
|
||||||
|
|
||||||
- use vue 3.4.31 and oruga 0.8.12 by default
|
|
||||||
|
|
||||||
## v0.11.4 (2024-06-30)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- start/stop being root should submit POST instead of GET
|
|
||||||
|
|
||||||
- require vendor when making new ordering batch via api
|
|
||||||
|
|
||||||
- don't escape each address for email attempts grid
|
|
||||||
|
|
||||||
## v0.11.3 (2024-06-28)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- add link to "resolved by" user for pending products
|
|
||||||
|
|
||||||
- handle error when merging 2 records fails
|
|
||||||
|
|
||||||
## v0.11.2 (2024-06-18)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- hide certain custorder settings if not applicable
|
|
||||||
|
|
||||||
- use different logic for buefy/oruga for product lookup keydown
|
|
||||||
|
|
||||||
- product records should be touchable
|
|
||||||
|
|
||||||
- show flash error message if resolve pending product fails
|
|
||||||
|
|
||||||
## v0.11.1 (2024-06-14)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- revert back to setup.py + setup.cfg
|
|
||||||
|
|
||||||
## v0.11.0 (2024-06-10)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- switch from setup.cfg to pyproject.toml + hatchling
|
|
||||||
|
|
||||||
## v0.10.16 (2024-06-10)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- standardize how app, package versions are determined
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- avoid deprecated config methods for app/node title
|
|
||||||
|
|
||||||
## v0.10.15 (2024-06-07)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- do *not* Use `pkg_resources` to determine package versions
|
|
||||||
|
|
||||||
## v0.10.14 (2024-06-06)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- use `pkg_resources` to determine package versions
|
|
||||||
|
|
||||||
## v0.10.13 (2024-06-06)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- remove old/unused scaffold for use with `pcreate`
|
|
||||||
|
|
||||||
- add 'fanstatic' support for sake of libcache assets
|
|
||||||
|
|
||||||
## v0.10.12 (2024-06-04)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- require pyramid 2.x; remove 1.x-style auth policies
|
|
||||||
|
|
||||||
- remove version cap for deform
|
|
||||||
|
|
||||||
- set explicit referrer when changing app theme
|
|
||||||
|
|
||||||
- add `<b-tooltip>` component shim
|
|
||||||
|
|
||||||
- include extra styles from `base_meta` template for butterball
|
|
||||||
|
|
||||||
- include butterball theme by default for new apps
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix product lookup component, per butterball
|
|
||||||
|
|
||||||
## v0.10.11 (2024-06-03)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- fix vue3 refresh bugs for various views
|
|
||||||
|
|
||||||
- fix grid bug for tempmon appliance view, per oruga
|
|
||||||
|
|
||||||
- fix ordering worksheet generator, per butterball
|
|
||||||
|
|
||||||
- fix inventory worksheet generator, per butterball
|
|
||||||
|
|
||||||
## v0.10.10 (2024-06-03)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- more butterball fixes for "view profile" template
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix focus for `<b-select>` shim component
|
|
||||||
|
|
||||||
## v0.10.9 (2024-06-03)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- let master view control context menu items for page
|
|
||||||
|
|
||||||
- fix the "new custorder" page for butterball
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix panel style for PO vs. Invoice breakdown in receiving batch
|
|
||||||
|
|
||||||
## v0.10.8 (2024-06-02)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- add styling for checked grid rows, per oruga/butterball
|
|
||||||
|
|
||||||
- fix product view template for oruga/butterball
|
|
||||||
|
|
||||||
- allow per-user custom styles for butterball
|
|
||||||
|
|
||||||
- use oruga 0.8.9 by default
|
|
||||||
|
|
||||||
## v0.10.7 (2024-06-01)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- add setting to allow decimal quantities for receiving
|
|
||||||
|
|
||||||
- log error if registry has no rattail config
|
|
||||||
|
|
||||||
- add column filters for import/export main grid
|
|
||||||
|
|
||||||
- escape all unsafe html for grid data
|
|
||||||
|
|
||||||
- add speedbumps for delete, set preferred email/phone in profile view
|
|
||||||
|
|
||||||
- fix file upload widget for oruga
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix overflow when instance header title is too long (butterball)
|
|
||||||
|
|
||||||
## v0.10.6 (2024-05-29)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- add way to flag organic products within lookup dialog
|
|
||||||
|
|
||||||
- expose db picker for butterball theme
|
|
||||||
|
|
||||||
- expose quickie lookup for butterball theme
|
|
||||||
|
|
||||||
- fix basic problems with people profile view, per butterball
|
|
||||||
|
|
||||||
## v0.10.5 (2024-05-29)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- add `<tailbone-timepicker>` component for oruga
|
|
||||||
|
|
||||||
## v0.10.4 (2024-05-12)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix styles for grid actions, per butterball
|
|
||||||
|
|
||||||
## v0.10.3 (2024-05-10)
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix bug with grid date filters
|
|
||||||
|
|
||||||
## v0.10.2 (2024-05-08)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- remove version restriction for pyramid_beaker dependency
|
|
||||||
|
|
||||||
- rename some attrs etc. for buefy components used with oruga
|
|
||||||
|
|
||||||
- fix "tools" helper for receiving batch view, per oruga
|
|
||||||
|
|
||||||
- more data type fixes for ``<tailbone-datepicker>``
|
|
||||||
|
|
||||||
- fix "view receiving row" page, per oruga
|
|
||||||
|
|
||||||
- tweak styles for grid action links, per butterball
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix employees grid when viewing department (per oruga)
|
|
||||||
|
|
||||||
- fix login "enter" key behavior, per oruga
|
|
||||||
|
|
||||||
- fix button text for autocomplete
|
|
||||||
|
|
||||||
## v0.10.1 (2024-04-28)
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- sort list of available themes
|
|
||||||
|
|
||||||
- update various icon names for oruga compatibility
|
|
||||||
|
|
||||||
- show "View This" button when cloning a record
|
|
||||||
|
|
||||||
- stop including 'falafel' as available theme
|
|
||||||
|
|
||||||
### Fix
|
|
||||||
|
|
||||||
- fix vertical alignment in main menu bar, for butterball
|
|
||||||
|
|
||||||
- fix upgrade execution logic/UI per oruga
|
|
||||||
|
|
||||||
## v0.10.0 (2024-04-28)
|
|
||||||
|
|
||||||
This version bump is to reflect adding support for Vue 3 + Oruga via
|
|
||||||
the 'butterball' theme. There is likely more work to be done for that
|
|
||||||
yet, but it mostly works at this point.
|
|
||||||
|
|
||||||
### Feat
|
|
||||||
|
|
||||||
- misc. template and view logic tweaks (applicable to all themes) for
|
|
||||||
better patterns, consistency etc.
|
|
||||||
|
|
||||||
- add initial support for Vue 3 + Oruga, via "butterball" theme
|
|
||||||
|
|
||||||
|
|
||||||
## Older Releases
|
|
||||||
|
|
||||||
Please see `docs/OLDCHANGES.rst` for older release notes.
|
|
3214
CHANGES.rst
Normal file
3214
CHANGES.rst
Normal file
File diff suppressed because it is too large
Load diff
|
@ -3,7 +3,6 @@ include *.txt
|
||||||
include *.rst
|
include *.rst
|
||||||
include *.py
|
include *.py
|
||||||
|
|
||||||
include tailbone/static/robots.txt
|
|
||||||
recursive-include tailbone/static *.js
|
recursive-include tailbone/static *.js
|
||||||
recursive-include tailbone/static *.css
|
recursive-include tailbone/static *.css
|
||||||
recursive-include tailbone/static *.png
|
recursive-include tailbone/static *.png
|
||||||
|
@ -11,8 +10,6 @@ recursive-include tailbone/static *.jpg
|
||||||
recursive-include tailbone/static *.gif
|
recursive-include tailbone/static *.gif
|
||||||
recursive-include tailbone/static *.ico
|
recursive-include tailbone/static *.ico
|
||||||
|
|
||||||
recursive-include tailbone/static/files *
|
|
||||||
|
|
||||||
recursive-include tailbone/templates *.mako
|
recursive-include tailbone/templates *.mako
|
||||||
recursive-include tailbone/templates *.pt
|
recursive-include tailbone/templates *.pt
|
||||||
recursive-include tailbone/reports *.mako
|
recursive-include tailbone/reports *.mako
|
||||||
|
|
|
@ -1,8 +1,10 @@
|
||||||
|
|
||||||
# Tailbone
|
Tailbone
|
||||||
|
========
|
||||||
|
|
||||||
Tailbone is an extensible web application based on Rattail. It provides a
|
Tailbone is an extensible web application based on Rattail. It provides a
|
||||||
"back-office network environment" (BONE) for use in managing retail data.
|
"back-office network environment" (BONE) for use in managing retail data.
|
||||||
|
|
||||||
Please see Rattail's [home page](http://rattailproject.org/) for more
|
Please see Rattail's `home page`_ for more information.
|
||||||
information.
|
|
||||||
|
.. _home page: http://rattailproject.org/
|
7539
docs/OLDCHANGES.rst
7539
docs/OLDCHANGES.rst
File diff suppressed because it is too large
Load diff
|
@ -1,15 +0,0 @@
|
||||||
|
|
||||||
``tailbone.api.batch.core``
|
|
||||||
===========================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.api.batch.core
|
|
||||||
|
|
||||||
.. autoclass:: APIBatchMixin
|
|
||||||
|
|
||||||
.. autoclass:: APIBatchView
|
|
||||||
|
|
||||||
.. autoclass:: APIBatchRowView
|
|
||||||
|
|
||||||
.. autoattribute:: editable
|
|
||||||
|
|
||||||
.. autoattribute:: supports_quick_entry
|
|
|
@ -1,41 +0,0 @@
|
||||||
|
|
||||||
``tailbone.api.batch.ordering``
|
|
||||||
===============================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.api.batch.ordering
|
|
||||||
|
|
||||||
.. autoclass:: OrderingBatchViews
|
|
||||||
|
|
||||||
.. autoattribute:: collection_url_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: object_url_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: model_class
|
|
||||||
|
|
||||||
.. autoattribute:: route_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: permission_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: default_handler_spec
|
|
||||||
|
|
||||||
.. automethod:: base_query
|
|
||||||
|
|
||||||
.. automethod:: create_object
|
|
||||||
|
|
||||||
.. autoclass:: OrderingBatchRowViews
|
|
||||||
|
|
||||||
.. autoattribute:: collection_url_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: object_url_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: model_class
|
|
||||||
|
|
||||||
.. autoattribute:: route_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: permission_prefix
|
|
||||||
|
|
||||||
.. autoattribute:: default_handler_spec
|
|
||||||
|
|
||||||
.. autoattribute:: supports_quick_entry
|
|
||||||
|
|
||||||
.. automethod:: update_object
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.db``
|
|
||||||
===============
|
|
||||||
|
|
||||||
.. automodule:: tailbone.db
|
|
||||||
:members:
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.diffs``
|
|
||||||
==================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.diffs
|
|
||||||
:members:
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.forms.widgets``
|
|
||||||
==========================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.forms.widgets
|
|
||||||
:members:
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.grids.core``
|
|
||||||
=======================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.grids.core
|
|
||||||
:members:
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.progress``
|
|
||||||
=====================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.progress
|
|
||||||
:members:
|
|
|
@ -3,4 +3,5 @@
|
||||||
========================
|
========================
|
||||||
|
|
||||||
.. automodule:: tailbone.subscribers
|
.. automodule:: tailbone.subscribers
|
||||||
:members:
|
|
||||||
|
.. autofunction:: add_rattail_config_attribute_to_request
|
||||||
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.util``
|
|
||||||
=================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.util
|
|
||||||
:members:
|
|
|
@ -1,10 +0,0 @@
|
||||||
|
|
||||||
``tailbone.views.batch.vendorcatalog``
|
|
||||||
======================================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.views.batch.vendorcatalog
|
|
||||||
|
|
||||||
.. autoclass:: VendorCatalogsView
|
|
||||||
:members:
|
|
||||||
|
|
||||||
.. autofunction:: includeme
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.views.core``
|
|
||||||
=======================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.views.core
|
|
||||||
:members:
|
|
|
@ -81,12 +81,6 @@ override when defining your subclass.
|
||||||
override this for certain views, if so that should be done within
|
override this for certain views, if so that should be done within
|
||||||
:meth:`get_help_url()`.
|
:meth:`get_help_url()`.
|
||||||
|
|
||||||
.. attribute:: MasterView.version_diff_factory
|
|
||||||
|
|
||||||
Optional factory to use for version diff objects. By default
|
|
||||||
this is *not set* but a subclass is free to set it. See also
|
|
||||||
:meth:`get_version_diff_factory()`.
|
|
||||||
|
|
||||||
|
|
||||||
Methods to Override
|
Methods to Override
|
||||||
-------------------
|
-------------------
|
||||||
|
@ -94,8 +88,6 @@ Methods to Override
|
||||||
The following is a list of methods which you can override when defining your
|
The following is a list of methods which you can override when defining your
|
||||||
subclass.
|
subclass.
|
||||||
|
|
||||||
.. automethod:: MasterView.editable_instance
|
|
||||||
|
|
||||||
.. .. automethod:: MasterView.get_settings
|
.. .. automethod:: MasterView.get_settings
|
||||||
|
|
||||||
.. automethod:: MasterView.get_csv_fields
|
.. automethod:: MasterView.get_csv_fields
|
||||||
|
@ -103,24 +95,3 @@ subclass.
|
||||||
.. automethod:: MasterView.get_csv_row
|
.. automethod:: MasterView.get_csv_row
|
||||||
|
|
||||||
.. automethod:: MasterView.get_help_url
|
.. automethod:: MasterView.get_help_url
|
||||||
|
|
||||||
.. automethod:: MasterView.get_model_key
|
|
||||||
|
|
||||||
.. automethod:: MasterView.get_version_diff_enums
|
|
||||||
|
|
||||||
.. automethod:: MasterView.get_version_diff_factory
|
|
||||||
|
|
||||||
.. automethod:: MasterView.make_version_diff
|
|
||||||
|
|
||||||
.. automethod:: MasterView.title_for_version
|
|
||||||
|
|
||||||
|
|
||||||
Support Methods
|
|
||||||
---------------
|
|
||||||
|
|
||||||
The following is a list of methods you should (probably) not need to
|
|
||||||
override, but may find useful:
|
|
||||||
|
|
||||||
.. automethod:: MasterView.default_edit_url
|
|
||||||
|
|
||||||
.. automethod:: MasterView.get_action_route_kwargs
|
|
||||||
|
|
|
@ -1,6 +0,0 @@
|
||||||
|
|
||||||
``tailbone.views.members``
|
|
||||||
==========================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.views.members
|
|
||||||
:members:
|
|
|
@ -1,9 +0,0 @@
|
||||||
|
|
||||||
``tailbone.views.purchasing.batch``
|
|
||||||
===================================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.views.purchasing.batch
|
|
||||||
|
|
||||||
.. autoclass:: PurchasingBatchView
|
|
||||||
|
|
||||||
.. automethod:: save_edit_row_form
|
|
|
@ -1,15 +0,0 @@
|
||||||
|
|
||||||
``tailbone.views.purchasing.ordering``
|
|
||||||
======================================
|
|
||||||
|
|
||||||
.. automodule:: tailbone.views.purchasing.ordering
|
|
||||||
|
|
||||||
.. autoclass:: OrderingBatchView
|
|
||||||
|
|
||||||
.. autoattribute:: model_class
|
|
||||||
|
|
||||||
.. autoattribute:: default_handler_spec
|
|
||||||
|
|
||||||
.. automethod:: configure_row_form
|
|
||||||
|
|
||||||
.. automethod:: worksheet_update
|
|
10
docs/api/views/vendors.catalogs.rst
Normal file
10
docs/api/views/vendors.catalogs.rst
Normal file
|
@ -0,0 +1,10 @@
|
||||||
|
|
||||||
|
``tailbone.views.vendors.catalogs``
|
||||||
|
===================================
|
||||||
|
|
||||||
|
.. automodule:: tailbone.views.vendors.catalogs
|
||||||
|
|
||||||
|
.. autoclass:: VendorCatalogsView
|
||||||
|
:members:
|
||||||
|
|
||||||
|
.. autofunction:: includeme
|
|
@ -1,8 +0,0 @@
|
||||||
|
|
||||||
Changelog Archive
|
|
||||||
=================
|
|
||||||
|
|
||||||
.. toctree::
|
|
||||||
:maxdepth: 1
|
|
||||||
|
|
||||||
OLDCHANGES
|
|
276
docs/conf.py
276
docs/conf.py
|
@ -1,21 +1,38 @@
|
||||||
# Configuration file for the Sphinx documentation builder.
|
# -*- coding: utf-8; -*-
|
||||||
#
|
#
|
||||||
# For the full list of built-in configuration values, see the documentation:
|
# Tailbone documentation build configuration file, created by
|
||||||
# https://www.sphinx-doc.org/en/master/usage/configuration.html
|
# sphinx-quickstart on Sat Feb 15 23:15:27 2014.
|
||||||
|
#
|
||||||
|
# This file is exec()d with the current directory set to its
|
||||||
|
# containing dir.
|
||||||
|
#
|
||||||
|
# Note that not all possible configuration values are present in this
|
||||||
|
# autogenerated file.
|
||||||
|
#
|
||||||
|
# All configuration values have a default; values that are commented out
|
||||||
|
# serve to show the default.
|
||||||
|
|
||||||
# -- Project information -----------------------------------------------------
|
import sys
|
||||||
# https://www.sphinx-doc.org/en/master/usage/configuration.html#project-information
|
import os
|
||||||
|
|
||||||
from importlib.metadata import version as get_version
|
import sphinx_rtd_theme
|
||||||
|
|
||||||
project = 'Tailbone'
|
exec(open(os.path.join(os.pardir, 'tailbone', '_version.py')).read())
|
||||||
copyright = '2010 - 2024, Lance Edgar'
|
|
||||||
author = 'Lance Edgar'
|
|
||||||
release = get_version('Tailbone')
|
|
||||||
|
|
||||||
# -- General configuration ---------------------------------------------------
|
|
||||||
# https://www.sphinx-doc.org/en/master/usage/configuration.html#general-configuration
|
|
||||||
|
|
||||||
|
# If extensions (or modules to document with autodoc) are in another directory,
|
||||||
|
# add these directories to sys.path here. If the directory is relative to the
|
||||||
|
# documentation root, use os.path.abspath to make it absolute, like shown here.
|
||||||
|
#sys.path.insert(0, os.path.abspath('.'))
|
||||||
|
|
||||||
|
# -- General configuration ------------------------------------------------
|
||||||
|
|
||||||
|
# If your documentation needs a minimal Sphinx version, state it here.
|
||||||
|
#needs_sphinx = '1.0'
|
||||||
|
|
||||||
|
# Add any Sphinx extension module names here, as strings. They can be
|
||||||
|
# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom
|
||||||
|
# ones.
|
||||||
extensions = [
|
extensions = [
|
||||||
'sphinx.ext.autodoc',
|
'sphinx.ext.autodoc',
|
||||||
'sphinx.ext.todo',
|
'sphinx.ext.todo',
|
||||||
|
@ -23,30 +40,237 @@ extensions = [
|
||||||
'sphinx.ext.viewcode',
|
'sphinx.ext.viewcode',
|
||||||
]
|
]
|
||||||
|
|
||||||
templates_path = ['_templates']
|
|
||||||
exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store']
|
|
||||||
|
|
||||||
intersphinx_mapping = {
|
intersphinx_mapping = {
|
||||||
'rattail': ('https://docs.wuttaproject.org/rattail/', None),
|
|
||||||
'webhelpers2': ('https://webhelpers2.readthedocs.io/en/latest/', None),
|
'webhelpers2': ('https://webhelpers2.readthedocs.io/en/latest/', None),
|
||||||
'wuttaweb': ('https://docs.wuttaproject.org/wuttaweb/', None),
|
|
||||||
'wuttjamaican': ('https://docs.wuttaproject.org/wuttjamaican/', None),
|
|
||||||
}
|
}
|
||||||
|
|
||||||
# allow todo entries to show up
|
# Add any paths that contain templates here, relative to this directory.
|
||||||
todo_include_todos = True
|
templates_path = ['_templates']
|
||||||
|
|
||||||
|
# The suffix of source filenames.
|
||||||
|
source_suffix = '.rst'
|
||||||
|
|
||||||
|
# The encoding of source files.
|
||||||
|
#source_encoding = 'utf-8-sig'
|
||||||
|
|
||||||
|
# The master toctree document.
|
||||||
|
master_doc = 'index'
|
||||||
|
|
||||||
|
# General information about the project.
|
||||||
|
project = u'Tailbone'
|
||||||
|
copyright = u'2010 - 2018, Lance Edgar'
|
||||||
|
|
||||||
|
# The version info for the project you're documenting, acts as replacement for
|
||||||
|
# |version| and |release|, also used in various other places throughout the
|
||||||
|
# built documents.
|
||||||
|
#
|
||||||
|
# The short X.Y version.
|
||||||
|
# version = '0.3'
|
||||||
|
version = '.'.join(__version__.split('.')[:2])
|
||||||
|
# The full version, including alpha/beta/rc tags.
|
||||||
|
release = __version__
|
||||||
|
|
||||||
|
# The language for content autogenerated by Sphinx. Refer to documentation
|
||||||
|
# for a list of supported languages.
|
||||||
|
#language = None
|
||||||
|
|
||||||
|
# There are two options for replacing |today|: either, you set today to some
|
||||||
|
# non-false value, then it is used:
|
||||||
|
#today = ''
|
||||||
|
# Else, today_fmt is used as the format for a strftime call.
|
||||||
|
#today_fmt = '%B %d, %Y'
|
||||||
|
|
||||||
|
# List of patterns, relative to source directory, that match files and
|
||||||
|
# directories to ignore when looking for source files.
|
||||||
|
exclude_patterns = ['_build']
|
||||||
|
|
||||||
|
# The reST default role (used for this markup: `text`) to use for all
|
||||||
|
# documents.
|
||||||
|
#default_role = None
|
||||||
|
|
||||||
|
# If true, '()' will be appended to :func: etc. cross-reference text.
|
||||||
|
#add_function_parentheses = True
|
||||||
|
|
||||||
|
# If true, the current module name will be prepended to all description
|
||||||
|
# unit titles (such as .. function::).
|
||||||
|
#add_module_names = True
|
||||||
|
|
||||||
|
# If true, sectionauthor and moduleauthor directives will be shown in the
|
||||||
|
# output. They are ignored by default.
|
||||||
|
#show_authors = False
|
||||||
|
|
||||||
|
# The name of the Pygments (syntax highlighting) style to use.
|
||||||
|
pygments_style = 'sphinx'
|
||||||
|
|
||||||
|
# A list of ignored prefixes for module index sorting.
|
||||||
|
#modindex_common_prefix = []
|
||||||
|
|
||||||
|
# If true, keep warnings as "system message" paragraphs in the built documents.
|
||||||
|
#keep_warnings = False
|
||||||
|
|
||||||
|
|
||||||
# -- Options for HTML output -------------------------------------------------
|
# -- Options for HTML output ----------------------------------------------
|
||||||
# https://www.sphinx-doc.org/en/master/usage/configuration.html#options-for-html-output
|
|
||||||
|
|
||||||
html_theme = 'furo'
|
# The theme to use for HTML and HTML Help pages. See the documentation for
|
||||||
html_static_path = ['_static']
|
# a list of builtin themes.
|
||||||
|
# html_theme = 'classic'
|
||||||
|
html_theme = 'sphinx_rtd_theme'
|
||||||
|
|
||||||
|
# Theme options are theme-specific and customize the look and feel of a theme
|
||||||
|
# further. For a list of options available for each theme, see the
|
||||||
|
# documentation.
|
||||||
|
#html_theme_options = {}
|
||||||
|
|
||||||
|
# Add any paths that contain custom themes here, relative to this directory.
|
||||||
|
#html_theme_path = []
|
||||||
|
html_theme_path = [sphinx_rtd_theme.get_html_theme_path()]
|
||||||
|
|
||||||
|
# The name for this set of Sphinx documents. If None, it defaults to
|
||||||
|
# "<project> v<release> documentation".
|
||||||
|
#html_title = None
|
||||||
|
|
||||||
|
# A shorter title for the navigation bar. Default is the same as html_title.
|
||||||
|
#html_short_title = None
|
||||||
|
|
||||||
# The name of an image file (relative to this directory) to place at the top
|
# The name of an image file (relative to this directory) to place at the top
|
||||||
# of the sidebar.
|
# of the sidebar.
|
||||||
#html_logo = None
|
#html_logo = None
|
||||||
#html_logo = 'images/rattail_avatar.png'
|
html_logo = 'images/rattail_avatar.png'
|
||||||
|
|
||||||
|
# The name of an image file (within the static path) to use as favicon of the
|
||||||
|
# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32
|
||||||
|
# pixels large.
|
||||||
|
#html_favicon = None
|
||||||
|
|
||||||
|
# Add any paths that contain custom static files (such as style sheets) here,
|
||||||
|
# relative to this directory. They are copied after the builtin static files,
|
||||||
|
# so a file named "default.css" will overwrite the builtin "default.css".
|
||||||
|
html_static_path = ['_static']
|
||||||
|
|
||||||
|
# Add any extra paths that contain custom files (such as robots.txt or
|
||||||
|
# .htaccess) here, relative to this directory. These files are copied
|
||||||
|
# directly to the root of the documentation.
|
||||||
|
#html_extra_path = []
|
||||||
|
|
||||||
|
# If not '', a 'Last updated on:' timestamp is inserted at every page bottom,
|
||||||
|
# using the given strftime format.
|
||||||
|
#html_last_updated_fmt = '%b %d, %Y'
|
||||||
|
|
||||||
|
# If true, SmartyPants will be used to convert quotes and dashes to
|
||||||
|
# typographically correct entities.
|
||||||
|
#html_use_smartypants = True
|
||||||
|
|
||||||
|
# Custom sidebar templates, maps document names to template names.
|
||||||
|
#html_sidebars = {}
|
||||||
|
|
||||||
|
# Additional templates that should be rendered to pages, maps page names to
|
||||||
|
# template names.
|
||||||
|
#html_additional_pages = {}
|
||||||
|
|
||||||
|
# If false, no module index is generated.
|
||||||
|
#html_domain_indices = True
|
||||||
|
|
||||||
|
# If false, no index is generated.
|
||||||
|
#html_use_index = True
|
||||||
|
|
||||||
|
# If true, the index is split into individual pages for each letter.
|
||||||
|
#html_split_index = False
|
||||||
|
|
||||||
|
# If true, links to the reST sources are added to the pages.
|
||||||
|
#html_show_sourcelink = True
|
||||||
|
|
||||||
|
# If true, "Created using Sphinx" is shown in the HTML footer. Default is True.
|
||||||
|
#html_show_sphinx = True
|
||||||
|
|
||||||
|
# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True.
|
||||||
|
#html_show_copyright = True
|
||||||
|
|
||||||
|
# If true, an OpenSearch description file will be output, and all pages will
|
||||||
|
# contain a <link> tag referring to it. The value of this option must be the
|
||||||
|
# base URL from which the finished HTML is served.
|
||||||
|
#html_use_opensearch = ''
|
||||||
|
|
||||||
|
# This is the file name suffix for HTML files (e.g. ".xhtml").
|
||||||
|
#html_file_suffix = None
|
||||||
|
|
||||||
# Output file base name for HTML help builder.
|
# Output file base name for HTML help builder.
|
||||||
#htmlhelp_basename = 'Tailbonedoc'
|
htmlhelp_basename = 'Tailbonedoc'
|
||||||
|
|
||||||
|
|
||||||
|
# -- Options for LaTeX output ---------------------------------------------
|
||||||
|
|
||||||
|
latex_elements = {
|
||||||
|
# The paper size ('letterpaper' or 'a4paper').
|
||||||
|
#'papersize': 'letterpaper',
|
||||||
|
|
||||||
|
# The font size ('10pt', '11pt' or '12pt').
|
||||||
|
#'pointsize': '10pt',
|
||||||
|
|
||||||
|
# Additional stuff for the LaTeX preamble.
|
||||||
|
#'preamble': '',
|
||||||
|
}
|
||||||
|
|
||||||
|
# Grouping the document tree into LaTeX files. List of tuples
|
||||||
|
# (source start file, target name, title,
|
||||||
|
# author, documentclass [howto, manual, or own class]).
|
||||||
|
latex_documents = [
|
||||||
|
('index', 'Tailbone.tex', u'Tailbone Documentation',
|
||||||
|
u'Lance Edgar', 'manual'),
|
||||||
|
]
|
||||||
|
|
||||||
|
# The name of an image file (relative to this directory) to place at the top of
|
||||||
|
# the title page.
|
||||||
|
#latex_logo = None
|
||||||
|
|
||||||
|
# For "manual" documents, if this is true, then toplevel headings are parts,
|
||||||
|
# not chapters.
|
||||||
|
#latex_use_parts = False
|
||||||
|
|
||||||
|
# If true, show page references after internal links.
|
||||||
|
#latex_show_pagerefs = False
|
||||||
|
|
||||||
|
# If true, show URL addresses after external links.
|
||||||
|
#latex_show_urls = False
|
||||||
|
|
||||||
|
# Documents to append as an appendix to all manuals.
|
||||||
|
#latex_appendices = []
|
||||||
|
|
||||||
|
# If false, no module index is generated.
|
||||||
|
#latex_domain_indices = True
|
||||||
|
|
||||||
|
|
||||||
|
# -- Options for manual page output ---------------------------------------
|
||||||
|
|
||||||
|
# One entry per manual page. List of tuples
|
||||||
|
# (source start file, name, description, authors, manual section).
|
||||||
|
man_pages = [
|
||||||
|
('index', 'tailbone', u'Tailbone Documentation',
|
||||||
|
[u'Lance Edgar'], 1)
|
||||||
|
]
|
||||||
|
|
||||||
|
# If true, show URL addresses after external links.
|
||||||
|
#man_show_urls = False
|
||||||
|
|
||||||
|
|
||||||
|
# -- Options for Texinfo output -------------------------------------------
|
||||||
|
|
||||||
|
# Grouping the document tree into Texinfo files. List of tuples
|
||||||
|
# (source start file, target name, title, author,
|
||||||
|
# dir menu entry, description, category)
|
||||||
|
texinfo_documents = [
|
||||||
|
('index', 'Tailbone', u'Tailbone Documentation',
|
||||||
|
u'Lance Edgar', 'Tailbone', 'One line description of project.',
|
||||||
|
'Miscellaneous'),
|
||||||
|
]
|
||||||
|
|
||||||
|
# Documents to append as an appendix to all manuals.
|
||||||
|
#texinfo_appendices = []
|
||||||
|
|
||||||
|
# If false, no module index is generated.
|
||||||
|
#texinfo_domain_indices = True
|
||||||
|
|
||||||
|
# How to display URL addresses: 'footnote', 'no', or 'inline'.
|
||||||
|
#texinfo_show_urls = 'footnote'
|
||||||
|
|
||||||
|
# If true, do not generate a @detailmenu in the "Top" node's menu.
|
||||||
|
#texinfo_no_detailmenu = False
|
||||||
|
|
|
@ -42,32 +42,12 @@ Package API:
|
||||||
.. toctree::
|
.. toctree::
|
||||||
:maxdepth: 1
|
:maxdepth: 1
|
||||||
|
|
||||||
api/api/batch/core
|
|
||||||
api/api/batch/ordering
|
|
||||||
api/db
|
|
||||||
api/diffs
|
|
||||||
api/forms
|
api/forms
|
||||||
api/forms.widgets
|
|
||||||
api/grids
|
api/grids
|
||||||
api/grids.core
|
|
||||||
api/progress
|
|
||||||
api/subscribers
|
api/subscribers
|
||||||
api/util
|
|
||||||
api/views/batch
|
api/views/batch
|
||||||
api/views/batch.vendorcatalog
|
|
||||||
api/views/core
|
|
||||||
api/views/master
|
api/views/master
|
||||||
api/views/members
|
api/views/vendors.catalogs
|
||||||
api/views/purchasing.batch
|
|
||||||
api/views/purchasing.ordering
|
|
||||||
|
|
||||||
|
|
||||||
Changelog:
|
|
||||||
|
|
||||||
.. toctree::
|
|
||||||
:maxdepth: 1
|
|
||||||
|
|
||||||
changelog
|
|
||||||
|
|
||||||
|
|
||||||
Documentation To-Do
|
Documentation To-Do
|
||||||
|
|
|
@ -117,6 +117,7 @@ of course supply the web app layer.
|
||||||
│ │ │ └── foobatch/
|
│ │ │ └── foobatch/
|
||||||
│ │ ├── customers/
|
│ │ ├── customers/
|
||||||
│ │ ├── menu.mako
|
│ │ ├── menu.mako
|
||||||
|
│ │ ├── mobile/
|
||||||
│ │ └── products/
|
│ │ └── products/
|
||||||
│ └── views/
|
│ └── views/
|
||||||
│ ├── __init__.py
|
│ ├── __init__.py
|
||||||
|
|
103
pyproject.toml
103
pyproject.toml
|
@ -1,103 +0,0 @@
|
||||||
|
|
||||||
[build-system]
|
|
||||||
requires = ["hatchling"]
|
|
||||||
build-backend = "hatchling.build"
|
|
||||||
|
|
||||||
|
|
||||||
[project]
|
|
||||||
name = "Tailbone"
|
|
||||||
version = "0.22.8"
|
|
||||||
description = "Backoffice Web Application for Rattail"
|
|
||||||
readme = "README.md"
|
|
||||||
authors = [{name = "Lance Edgar", email = "lance@edbob.org"}]
|
|
||||||
license = {text = "GNU GPL v3+"}
|
|
||||||
classifiers = [
|
|
||||||
"Development Status :: 4 - Beta",
|
|
||||||
"Environment :: Web Environment",
|
|
||||||
"Framework :: Pyramid",
|
|
||||||
"Intended Audience :: Developers",
|
|
||||||
"License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)",
|
|
||||||
"Natural Language :: English",
|
|
||||||
"Operating System :: OS Independent",
|
|
||||||
"Programming Language :: Python",
|
|
||||||
"Programming Language :: Python :: 3",
|
|
||||||
"Programming Language :: Python :: 3.8",
|
|
||||||
"Programming Language :: Python :: 3.9",
|
|
||||||
"Programming Language :: Python :: 3.10",
|
|
||||||
"Programming Language :: Python :: 3.11",
|
|
||||||
"Topic :: Internet :: WWW/HTTP",
|
|
||||||
"Topic :: Office/Business",
|
|
||||||
"Topic :: Software Development :: Libraries :: Python Modules",
|
|
||||||
]
|
|
||||||
requires-python = ">= 3.8"
|
|
||||||
dependencies = [
|
|
||||||
"asgiref",
|
|
||||||
"colander",
|
|
||||||
"ColanderAlchemy",
|
|
||||||
"cornice",
|
|
||||||
"cornice-swagger",
|
|
||||||
"deform",
|
|
||||||
"humanize",
|
|
||||||
"Mako",
|
|
||||||
"markdown",
|
|
||||||
"openpyxl",
|
|
||||||
"paginate",
|
|
||||||
"paginate_sqlalchemy",
|
|
||||||
"passlib",
|
|
||||||
"Pillow",
|
|
||||||
"pyramid>=2",
|
|
||||||
"pyramid_beaker",
|
|
||||||
"pyramid_deform",
|
|
||||||
"pyramid_exclog",
|
|
||||||
"pyramid_fanstatic",
|
|
||||||
"pyramid_mako",
|
|
||||||
"pyramid_retry",
|
|
||||||
"pyramid_tm",
|
|
||||||
"rattail[db,bouncer]>=0.20.1",
|
|
||||||
"sa-filters",
|
|
||||||
"simplejson",
|
|
||||||
"transaction",
|
|
||||||
"waitress",
|
|
||||||
"WebHelpers2",
|
|
||||||
"WuttaWeb>=0.21.0",
|
|
||||||
"zope.sqlalchemy>=1.5",
|
|
||||||
]
|
|
||||||
|
|
||||||
|
|
||||||
[project.optional-dependencies]
|
|
||||||
docs = ["Sphinx", "furo"]
|
|
||||||
tests = ["coverage", "mock", "pytest", "pytest-cov"]
|
|
||||||
|
|
||||||
|
|
||||||
[project.entry-points."paste.app_factory"]
|
|
||||||
main = "tailbone.app:main"
|
|
||||||
webapi = "tailbone.webapi:main"
|
|
||||||
|
|
||||||
|
|
||||||
[project.entry-points."rattail.cleaners"]
|
|
||||||
beaker = "tailbone.cleanup:BeakerCleaner"
|
|
||||||
|
|
||||||
|
|
||||||
[project.entry-points."rattail.config.extensions"]
|
|
||||||
tailbone = "tailbone.config:ConfigExtension"
|
|
||||||
|
|
||||||
|
|
||||||
[project.urls]
|
|
||||||
Homepage = "https://rattailproject.org"
|
|
||||||
Repository = "https://forgejo.wuttaproject.org/rattail/tailbone"
|
|
||||||
Issues = "https://forgejo.wuttaproject.org/rattail/tailbone/issues"
|
|
||||||
Changelog = "https://forgejo.wuttaproject.org/rattail/tailbone/src/branch/master/CHANGELOG.md"
|
|
||||||
|
|
||||||
|
|
||||||
[tool.commitizen]
|
|
||||||
version_provider = "pep621"
|
|
||||||
tag_format = "v$version"
|
|
||||||
update_changelog_on_bump = true
|
|
||||||
|
|
||||||
|
|
||||||
[tool.nosetests]
|
|
||||||
nocapture = 1
|
|
||||||
cover-package = "tailbone"
|
|
||||||
cover-erase = 1
|
|
||||||
cover-html = 1
|
|
||||||
cover-html-dir = "htmlcov"
|
|
6
setup.cfg
Normal file
6
setup.cfg
Normal file
|
@ -0,0 +1,6 @@
|
||||||
|
[nosetests]
|
||||||
|
nocapture = 1
|
||||||
|
cover-package = tailbone
|
||||||
|
cover-erase = 1
|
||||||
|
cover-html = 1
|
||||||
|
cover-html-dir = htmlcov
|
171
setup.py
Normal file
171
setup.py
Normal file
|
@ -0,0 +1,171 @@
|
||||||
|
# -*- coding: utf-8; -*-
|
||||||
|
################################################################################
|
||||||
|
#
|
||||||
|
# Rattail -- Retail Software Framework
|
||||||
|
# Copyright © 2010-2018 Lance Edgar
|
||||||
|
#
|
||||||
|
# This file is part of Rattail.
|
||||||
|
#
|
||||||
|
# Rattail is free software: you can redistribute it and/or modify it under the
|
||||||
|
# terms of the GNU General Public License as published by the Free Software
|
||||||
|
# Foundation, either version 3 of the License, or (at your option) any later
|
||||||
|
# version.
|
||||||
|
#
|
||||||
|
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
||||||
|
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
||||||
|
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
||||||
|
# details.
|
||||||
|
#
|
||||||
|
# You should have received a copy of the GNU General Public License along with
|
||||||
|
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
||||||
|
#
|
||||||
|
################################################################################
|
||||||
|
"""
|
||||||
|
Setup script for Tailbone
|
||||||
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
|
import os.path
|
||||||
|
from setuptools import setup, find_packages
|
||||||
|
|
||||||
|
|
||||||
|
here = os.path.abspath(os.path.dirname(__file__))
|
||||||
|
exec(open(os.path.join(here, 'tailbone', '_version.py')).read())
|
||||||
|
README = open(os.path.join(here, 'README.rst')).read()
|
||||||
|
|
||||||
|
|
||||||
|
requires = [
|
||||||
|
#
|
||||||
|
# Version numbers within comments below have specific meanings.
|
||||||
|
# Basically the 'low' value is a "soft low," and 'high' a "soft high."
|
||||||
|
# In other words:
|
||||||
|
#
|
||||||
|
# If either a 'low' or 'high' value exists, the primary point to be
|
||||||
|
# made about the value is that it represents the most current (stable)
|
||||||
|
# version available for the package (assuming typical public access
|
||||||
|
# methods) whenever this project was started and/or documented.
|
||||||
|
# Therefore:
|
||||||
|
#
|
||||||
|
# If a 'low' version is present, you should know that attempts to use
|
||||||
|
# versions of the package significantly older than the 'low' version
|
||||||
|
# may not yield happy results. (A "hard" high limit may or may not be
|
||||||
|
# indicated by a true version requirement.)
|
||||||
|
#
|
||||||
|
# Similarly, if a 'high' version is present, and especially if this
|
||||||
|
# project has laid dormant for a while, you may need to refactor a bit
|
||||||
|
# when attempting to support a more recent version of the package. (A
|
||||||
|
# "hard" low limit should be indicated by a true version requirement
|
||||||
|
# when a 'high' version is present.)
|
||||||
|
#
|
||||||
|
# In any case, developers and other users are encouraged to play
|
||||||
|
# outside the lines with regard to these soft limits. If bugs are
|
||||||
|
# encountered then they should be filed as such.
|
||||||
|
#
|
||||||
|
# package # low high
|
||||||
|
|
||||||
|
# TODO: Pyramid 1.9 looks like it breaks us..? playing it safe for now..
|
||||||
|
'pyramid<1.9', # 1.3b2 1.8.3
|
||||||
|
|
||||||
|
# apparently 2.0 removes the retry support, in which case we then need
|
||||||
|
# pyramid_retry .. but that requires pyramid 1.9 ...
|
||||||
|
'pyramid_tm<2.0', # 0.3 1.1.1
|
||||||
|
|
||||||
|
# TODO: why do we need to cap this? breaks tailbone.db zope stuff somehow
|
||||||
|
'zope.sqlalchemy<1.0', # 0.7 0.7.7
|
||||||
|
|
||||||
|
'ColanderAlchemy', # 0.3.3
|
||||||
|
'deform', # 2.0.4
|
||||||
|
'humanize', # 0.5.1
|
||||||
|
'Mako', # 0.6.2
|
||||||
|
'openpyxl', # 2.4.7
|
||||||
|
'paginate', # 0.5.6
|
||||||
|
'paginate_sqlalchemy', # 0.2.0
|
||||||
|
'passlib', # 1.7.1
|
||||||
|
'pyramid_beaker>=0.6', # 0.6.1
|
||||||
|
'pyramid_deform', # 0.2
|
||||||
|
'pyramid_exclog', # 0.6
|
||||||
|
'pyramid_mako', # 1.0.2
|
||||||
|
'rattail[db,bouncer]', # 0.5.0
|
||||||
|
'six', # 1.10.0
|
||||||
|
'transaction', # 1.2.0
|
||||||
|
'waitress', # 0.8.1
|
||||||
|
'WebHelpers2', # 2.0
|
||||||
|
'webhelpers2_grid', # 0.1
|
||||||
|
'WTForms', # 2.1
|
||||||
|
]
|
||||||
|
|
||||||
|
|
||||||
|
extras = {
|
||||||
|
|
||||||
|
'docs': [
|
||||||
|
#
|
||||||
|
# package # low high
|
||||||
|
|
||||||
|
'Sphinx', # 1.2
|
||||||
|
'sphinx-rtd-theme', # 0.2.4
|
||||||
|
],
|
||||||
|
|
||||||
|
'tests': [
|
||||||
|
#
|
||||||
|
# package # low high
|
||||||
|
|
||||||
|
'coverage', # 3.6
|
||||||
|
'fixture', # 1.5
|
||||||
|
'mock', # 1.0.1
|
||||||
|
'nose', # 1.3.0
|
||||||
|
],
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
setup(
|
||||||
|
name = "Tailbone",
|
||||||
|
version = __version__,
|
||||||
|
author = "Lance Edgar",
|
||||||
|
author_email = "lance@edbob.org",
|
||||||
|
url = "http://rattailproject.org/",
|
||||||
|
license = "GNU GPL v3",
|
||||||
|
description = "Backoffice Web Application for Rattail",
|
||||||
|
long_description = README,
|
||||||
|
|
||||||
|
classifiers = [
|
||||||
|
'Development Status :: 4 - Beta',
|
||||||
|
'Environment :: Web Environment',
|
||||||
|
'Framework :: Pyramid',
|
||||||
|
'Intended Audience :: Developers',
|
||||||
|
'License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)',
|
||||||
|
'Natural Language :: English',
|
||||||
|
'Operating System :: OS Independent',
|
||||||
|
'Programming Language :: Python',
|
||||||
|
'Programming Language :: Python :: 2.7',
|
||||||
|
'Programming Language :: Python :: 3',
|
||||||
|
'Programming Language :: Python :: 3.5',
|
||||||
|
'Topic :: Internet :: WWW/HTTP',
|
||||||
|
'Topic :: Office/Business',
|
||||||
|
'Topic :: Software Development :: Libraries :: Python Modules',
|
||||||
|
],
|
||||||
|
|
||||||
|
install_requires = requires,
|
||||||
|
extras_require = extras,
|
||||||
|
tests_require = ['Tailbone[tests]'],
|
||||||
|
test_suite = 'nose.collector',
|
||||||
|
|
||||||
|
packages = find_packages(exclude=['tests.*', 'tests']),
|
||||||
|
include_package_data = True,
|
||||||
|
zip_safe = False,
|
||||||
|
|
||||||
|
entry_points = {
|
||||||
|
|
||||||
|
'paste.app_factory': [
|
||||||
|
'main = tailbone.app:main',
|
||||||
|
],
|
||||||
|
|
||||||
|
'rattail.config.extensions': [
|
||||||
|
'tailbone = tailbone.config:ConfigExtension',
|
||||||
|
],
|
||||||
|
|
||||||
|
'pyramid.scaffold': [
|
||||||
|
'rattail = tailbone.scaffolds:RattailTemplate',
|
||||||
|
],
|
||||||
|
},
|
||||||
|
)
|
|
@ -1,9 +1,3 @@
|
||||||
# -*- coding: utf-8; -*-
|
# -*- coding: utf-8; -*-
|
||||||
|
|
||||||
try:
|
__version__ = '0.7.27'
|
||||||
from importlib.metadata import version
|
|
||||||
except ImportError:
|
|
||||||
from importlib_metadata import version
|
|
||||||
|
|
||||||
|
|
||||||
__version__ = version('Tailbone')
|
|
||||||
|
|
|
@ -1,40 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2022 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from .core import APIView, api
|
|
||||||
from .master import APIMasterView, SortColumn
|
|
||||||
# TODO: remove this
|
|
||||||
from .master2 import APIMasterView2
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
config.include('tailbone.api.common')
|
|
||||||
config.include('tailbone.api.auth')
|
|
||||||
config.include('tailbone.api.customers')
|
|
||||||
config.include('tailbone.api.upgrades')
|
|
||||||
config.include('tailbone.api.users')
|
|
|
@ -1,229 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Auth Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
|
|
||||||
from tailbone.api import APIView, api
|
|
||||||
from tailbone.db import Session
|
|
||||||
from tailbone.auth import login_user, logout_user
|
|
||||||
|
|
||||||
|
|
||||||
class AuthenticationView(APIView):
|
|
||||||
|
|
||||||
@api
|
|
||||||
def check_session(self):
|
|
||||||
"""
|
|
||||||
View to serve as "no-op" / ping action to check current user's session.
|
|
||||||
This will establish a server-side web session for the user if none
|
|
||||||
exists. Note that this also resets the user's session timer.
|
|
||||||
"""
|
|
||||||
data = {'ok': True, 'permissions': []}
|
|
||||||
if self.request.user:
|
|
||||||
data['user'] = self.get_user_info(self.request.user)
|
|
||||||
data['permissions'] = list(self.request.user_permissions)
|
|
||||||
|
|
||||||
# background color may be set per-request, by some apps
|
|
||||||
if hasattr(self.request, 'background_color') and self.request.background_color:
|
|
||||||
data['background_color'] = self.request.background_color
|
|
||||||
else: # otherwise we use the one from config
|
|
||||||
data['background_color'] = self.rattail_config.get(
|
|
||||||
'tailbone', 'background_color')
|
|
||||||
|
|
||||||
# TODO: this seems the best place to return some global app
|
|
||||||
# settings, but maybe not desirable in all cases..in which
|
|
||||||
# case should caller need to ask for these explicitly? or
|
|
||||||
# make a different call altogether to get them..?
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
customer_handler = app.get_clientele_handler()
|
|
||||||
data['settings'] = {
|
|
||||||
'customer_field_dropdown': customer_handler.choice_uses_dropdown(),
|
|
||||||
}
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
@api
|
|
||||||
def login(self):
|
|
||||||
"""
|
|
||||||
API login view.
|
|
||||||
"""
|
|
||||||
if self.request.method == 'OPTIONS':
|
|
||||||
return self.request.response
|
|
||||||
|
|
||||||
username = self.request.json.get('username')
|
|
||||||
password = self.request.json.get('password')
|
|
||||||
if not (username and password):
|
|
||||||
return {'error': "Invalid username or password"}
|
|
||||||
|
|
||||||
# make sure credentials are valid
|
|
||||||
user = self.authenticate_user(username, password)
|
|
||||||
if not user:
|
|
||||||
return {'error': "Invalid username or password"}
|
|
||||||
|
|
||||||
# is there some reason this user should not login?
|
|
||||||
error = self.why_cant_user_login(user)
|
|
||||||
if error:
|
|
||||||
return {'error': error}
|
|
||||||
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
auth = app.get_auth_handler()
|
|
||||||
|
|
||||||
login_user(self.request, user)
|
|
||||||
return {
|
|
||||||
'ok': True,
|
|
||||||
'user': self.get_user_info(user),
|
|
||||||
'permissions': list(auth.get_permissions(Session(), user)),
|
|
||||||
}
|
|
||||||
|
|
||||||
def authenticate_user(self, username, password):
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
auth = app.get_auth_handler()
|
|
||||||
return auth.authenticate_user(Session(), username, password)
|
|
||||||
|
|
||||||
def why_cant_user_login(self, user):
|
|
||||||
"""
|
|
||||||
This method is given a ``User`` instance, which represents someone who
|
|
||||||
is just now trying to login, and has already cleared the basic hurdle
|
|
||||||
of providing the correct credentials for a user on file. This method
|
|
||||||
is responsible then, for further verification that this user *should*
|
|
||||||
in fact be allowed to login to this app node. If the method determines
|
|
||||||
a reason the user should *not* be allowed to login, then it should
|
|
||||||
return that reason as a simple string.
|
|
||||||
"""
|
|
||||||
|
|
||||||
@api
|
|
||||||
def logout(self):
|
|
||||||
"""
|
|
||||||
API logout view.
|
|
||||||
"""
|
|
||||||
if self.request.method == 'OPTIONS':
|
|
||||||
return self.request.response
|
|
||||||
|
|
||||||
logout_user(self.request)
|
|
||||||
return {'ok': True}
|
|
||||||
|
|
||||||
@api
|
|
||||||
def become_root(self):
|
|
||||||
"""
|
|
||||||
Elevate the current request to 'root' for full system access.
|
|
||||||
"""
|
|
||||||
if not self.request.is_admin:
|
|
||||||
raise self.forbidden()
|
|
||||||
self.request.user.record_event(self.enum.USER_EVENT_BECOME_ROOT)
|
|
||||||
self.request.session['is_root'] = True
|
|
||||||
return {
|
|
||||||
'ok': True,
|
|
||||||
'user': self.get_user_info(self.request.user),
|
|
||||||
}
|
|
||||||
|
|
||||||
@api
|
|
||||||
def stop_root(self):
|
|
||||||
"""
|
|
||||||
Lower the current request from 'root' back to normal access.
|
|
||||||
"""
|
|
||||||
if not self.request.is_admin:
|
|
||||||
raise self.forbidden()
|
|
||||||
self.request.user.record_event(self.enum.USER_EVENT_STOP_ROOT)
|
|
||||||
self.request.session['is_root'] = False
|
|
||||||
return {
|
|
||||||
'ok': True,
|
|
||||||
'user': self.get_user_info(self.request.user),
|
|
||||||
}
|
|
||||||
|
|
||||||
@api
|
|
||||||
def change_password(self):
|
|
||||||
"""
|
|
||||||
View which allows a user to change their password.
|
|
||||||
"""
|
|
||||||
if self.request.method == 'OPTIONS':
|
|
||||||
return self.request.response
|
|
||||||
|
|
||||||
if not self.request.user:
|
|
||||||
raise self.forbidden()
|
|
||||||
|
|
||||||
if self.request.user.prevent_password_change and not self.request.is_root:
|
|
||||||
raise self.forbidden()
|
|
||||||
|
|
||||||
data = self.request.json_body
|
|
||||||
|
|
||||||
# first make sure "current" password is accurate
|
|
||||||
if not self.authenticate_user(self.request.user, data['current_password']):
|
|
||||||
return {'error': "The current/old password you provided is incorrect"}
|
|
||||||
|
|
||||||
# okay then, set new password
|
|
||||||
auth = self.app.get_auth_handler()
|
|
||||||
auth.set_user_password(self.request.user, data['new_password'])
|
|
||||||
return {
|
|
||||||
'ok': True,
|
|
||||||
'user': self.get_user_info(self.request.user),
|
|
||||||
}
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._auth_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _auth_defaults(cls, config):
|
|
||||||
|
|
||||||
# session
|
|
||||||
check_session = Service(name='check_session', path='/session')
|
|
||||||
check_session.add_view('GET', 'check_session', klass=cls)
|
|
||||||
config.add_cornice_service(check_session)
|
|
||||||
|
|
||||||
# login
|
|
||||||
login = Service(name='login', path='/login')
|
|
||||||
login.add_view('POST', 'login', klass=cls)
|
|
||||||
config.add_cornice_service(login)
|
|
||||||
|
|
||||||
# logout
|
|
||||||
logout = Service(name='logout', path='/logout')
|
|
||||||
logout.add_view('POST', 'logout', klass=cls)
|
|
||||||
config.add_cornice_service(logout)
|
|
||||||
|
|
||||||
# become root
|
|
||||||
become_root = Service(name='become_root', path='/become-root')
|
|
||||||
become_root.add_view('POST', 'become_root', klass=cls)
|
|
||||||
config.add_cornice_service(become_root)
|
|
||||||
|
|
||||||
# stop root
|
|
||||||
stop_root = Service(name='stop_root', path='/stop-root')
|
|
||||||
stop_root.add_view('POST', 'stop_root', klass=cls)
|
|
||||||
config.add_cornice_service(stop_root)
|
|
||||||
|
|
||||||
# change password
|
|
||||||
change_password = Service(name='change_password', path='/change-password')
|
|
||||||
change_password.add_view('POST', 'change_password', klass=cls)
|
|
||||||
config.add_cornice_service(change_password)
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
AuthenticationView = kwargs.get('AuthenticationView', base['AuthenticationView'])
|
|
||||||
AuthenticationView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,29 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2019 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Batches
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from .core import APIBatchView, APIBatchRowView, BatchAPIMasterView
|
|
|
@ -1,360 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Batch Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
import logging
|
|
||||||
import warnings
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class APIBatchMixin(object):
|
|
||||||
"""
|
|
||||||
Base class for all API views which are meant to handle "batch" *and/or*
|
|
||||||
"batch row" data.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def get_batch_class(self):
|
|
||||||
model_class = self.get_model_class()
|
|
||||||
if hasattr(model_class, '__batch_class__'):
|
|
||||||
return model_class.__batch_class__
|
|
||||||
return model_class
|
|
||||||
|
|
||||||
def get_handler(self):
|
|
||||||
"""
|
|
||||||
Returns a `BatchHandler` instance for the view. All (?) custom batch
|
|
||||||
API views should define a default handler class; however this may in all
|
|
||||||
(?) cases be overridden by config also. The specific setting required
|
|
||||||
to do so will depend on the 'key' for the type of batch involved, e.g.
|
|
||||||
assuming the 'vendor_catalog' batch:
|
|
||||||
|
|
||||||
.. code-block:: ini
|
|
||||||
|
|
||||||
[rattail.batch]
|
|
||||||
vendor_catalog.handler = myapp.batch.vendorcatalog:CustomCatalogHandler
|
|
||||||
|
|
||||||
Note that the 'key' for a batch is generally the same as its primary
|
|
||||||
table name, although technically it is whatever value returns from the
|
|
||||||
``batch_key`` attribute of the main batch model class.
|
|
||||||
"""
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
key = self.get_batch_class().batch_key
|
|
||||||
return app.get_batch_handler(key, default=self.default_handler_spec)
|
|
||||||
|
|
||||||
|
|
||||||
class APIBatchView(APIBatchMixin, APIMasterView):
|
|
||||||
"""
|
|
||||||
Base class for all API views which are meant to handle "batch" *and/or*
|
|
||||||
"batch row" data.
|
|
||||||
"""
|
|
||||||
supports_toggle_complete = False
|
|
||||||
supports_execute = False
|
|
||||||
|
|
||||||
def __init__(self, request, **kwargs):
|
|
||||||
super(APIBatchView, self).__init__(request, **kwargs)
|
|
||||||
self.batch_handler = self.get_handler()
|
|
||||||
|
|
||||||
@property
|
|
||||||
def handler(self):
|
|
||||||
warnings.warn("the `handler` property is deprecated; "
|
|
||||||
"please use `batch_handler` instead",
|
|
||||||
DeprecationWarning, stacklevel=2)
|
|
||||||
return self.batch_handler
|
|
||||||
|
|
||||||
def normalize(self, batch):
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
created = app.localtime(batch.created, from_utc=True)
|
|
||||||
|
|
||||||
executed = None
|
|
||||||
if batch.executed:
|
|
||||||
executed = app.localtime(batch.executed, from_utc=True)
|
|
||||||
|
|
||||||
return {
|
|
||||||
'uuid': batch.uuid,
|
|
||||||
'_str': str(batch),
|
|
||||||
'id': batch.id,
|
|
||||||
'id_str': batch.id_str,
|
|
||||||
'description': batch.description,
|
|
||||||
'notes': batch.notes,
|
|
||||||
'params': batch.params or {},
|
|
||||||
'rowcount': batch.rowcount,
|
|
||||||
'created': str(created),
|
|
||||||
'created_display': self.pretty_datetime(created),
|
|
||||||
'created_by_uuid': batch.created_by.uuid,
|
|
||||||
'created_by_display': str(batch.created_by),
|
|
||||||
'complete': batch.complete,
|
|
||||||
'status_code': batch.status_code,
|
|
||||||
'status_display': batch.STATUS.get(batch.status_code,
|
|
||||||
str(batch.status_code)),
|
|
||||||
'executed': str(executed) if executed else None,
|
|
||||||
'executed_display': self.pretty_datetime(executed) if executed else None,
|
|
||||||
'executed_by_uuid': batch.executed_by_uuid,
|
|
||||||
'executed_by_display': str(batch.executed_by or ''),
|
|
||||||
'mutable': self.batch_handler.is_mutable(batch),
|
|
||||||
}
|
|
||||||
|
|
||||||
def create_object(self, data):
|
|
||||||
"""
|
|
||||||
Create a new object instance and populate it with the given data.
|
|
||||||
|
|
||||||
Here we'll invoke the handler for actual batch creation, instead of
|
|
||||||
typical logic used for simple records.
|
|
||||||
"""
|
|
||||||
user = self.request.user
|
|
||||||
kwargs = dict(data)
|
|
||||||
kwargs['user'] = user
|
|
||||||
batch = self.batch_handler.make_batch(self.Session(), **kwargs)
|
|
||||||
if self.batch_handler.should_populate(batch):
|
|
||||||
self.batch_handler.do_populate(batch, user)
|
|
||||||
return batch
|
|
||||||
|
|
||||||
def update_object(self, batch, data):
|
|
||||||
"""
|
|
||||||
Logic for updating a main object record.
|
|
||||||
|
|
||||||
Here we want to make sure we set "created by" to the current user, when
|
|
||||||
creating a new batch.
|
|
||||||
"""
|
|
||||||
# we're only concerned with *new* batches here
|
|
||||||
if not batch.uuid:
|
|
||||||
|
|
||||||
# assign creator; initialize row count
|
|
||||||
batch.created_by_uuid = self.request.user.uuid
|
|
||||||
if batch.rowcount is None:
|
|
||||||
batch.rowcount = 0
|
|
||||||
|
|
||||||
# then go ahead with usual logic
|
|
||||||
return super(APIBatchView, self).update_object(batch, data)
|
|
||||||
|
|
||||||
def mark_complete(self):
|
|
||||||
"""
|
|
||||||
Mark the given batch as "complete".
|
|
||||||
"""
|
|
||||||
batch = self.get_object()
|
|
||||||
|
|
||||||
if batch.executed:
|
|
||||||
return {'error': "Batch {} has already been executed: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
if batch.complete:
|
|
||||||
return {'error': "Batch {} is already marked complete: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
batch.complete = True
|
|
||||||
return self._get(obj=batch)
|
|
||||||
|
|
||||||
def mark_incomplete(self):
|
|
||||||
"""
|
|
||||||
Mark the given batch as "incomplete".
|
|
||||||
"""
|
|
||||||
batch = self.get_object()
|
|
||||||
|
|
||||||
if batch.executed:
|
|
||||||
return {'error': "Batch {} has already been executed: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
if not batch.complete:
|
|
||||||
return {'error': "Batch {} is already marked incomplete: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
batch.complete = False
|
|
||||||
return self._get(obj=batch)
|
|
||||||
|
|
||||||
def execute(self):
|
|
||||||
"""
|
|
||||||
Execute the given batch.
|
|
||||||
"""
|
|
||||||
batch = self.get_object()
|
|
||||||
|
|
||||||
if batch.executed:
|
|
||||||
return {'error': "Batch {} has already been executed: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
kwargs = dict(self.request.json_body)
|
|
||||||
kwargs.pop('user', None)
|
|
||||||
kwargs.pop('progress', None)
|
|
||||||
result = self.batch_handler.do_execute(batch, self.request.user, **kwargs)
|
|
||||||
return {'ok': bool(result), 'batch': self.normalize(batch)}
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._batch_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _batch_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
collection_url_prefix = cls.get_collection_url_prefix()
|
|
||||||
object_url_prefix = cls.get_object_url_prefix()
|
|
||||||
|
|
||||||
if cls.supports_toggle_complete:
|
|
||||||
|
|
||||||
# mark complete
|
|
||||||
mark_complete = Service(name='{}.mark_complete'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/mark-complete'.format(object_url_prefix))
|
|
||||||
mark_complete.add_view('POST', 'mark_complete', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(mark_complete)
|
|
||||||
|
|
||||||
# mark incomplete
|
|
||||||
mark_incomplete = Service(name='{}.mark_incomplete'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/mark-incomplete'.format(object_url_prefix))
|
|
||||||
mark_incomplete.add_view('POST', 'mark_incomplete', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(mark_incomplete)
|
|
||||||
|
|
||||||
if cls.supports_execute:
|
|
||||||
|
|
||||||
# execute batch
|
|
||||||
execute = Service(name='{}.execute'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/execute'.format(object_url_prefix))
|
|
||||||
execute.add_view('POST', 'execute', klass=cls,
|
|
||||||
permission='{}.execute'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(execute)
|
|
||||||
|
|
||||||
|
|
||||||
# TODO: deprecate / remove this
|
|
||||||
BatchAPIMasterView = APIBatchView
|
|
||||||
|
|
||||||
|
|
||||||
class APIBatchRowView(APIBatchMixin, APIMasterView):
|
|
||||||
"""
|
|
||||||
Base class for all API views which are meant to handle "batch rows" data.
|
|
||||||
"""
|
|
||||||
editable = False
|
|
||||||
supports_quick_entry = False
|
|
||||||
|
|
||||||
def __init__(self, request, **kwargs):
|
|
||||||
super(APIBatchRowView, self).__init__(request, **kwargs)
|
|
||||||
self.batch_handler = self.get_handler()
|
|
||||||
|
|
||||||
@property
|
|
||||||
def handler(self):
|
|
||||||
warnings.warn("the `handler` property is deprecated; "
|
|
||||||
"please use `batch_handler` instead",
|
|
||||||
DeprecationWarning, stacklevel=2)
|
|
||||||
return self.batch_handler
|
|
||||||
|
|
||||||
def normalize(self, row):
|
|
||||||
batch = row.batch
|
|
||||||
return {
|
|
||||||
'uuid': row.uuid,
|
|
||||||
'_str': str(row),
|
|
||||||
'_parent_str': str(batch),
|
|
||||||
'_parent_uuid': batch.uuid,
|
|
||||||
'batch_uuid': batch.uuid,
|
|
||||||
'batch_id': batch.id,
|
|
||||||
'batch_id_str': batch.id_str,
|
|
||||||
'batch_description': batch.description,
|
|
||||||
'batch_complete': batch.complete,
|
|
||||||
'batch_executed': bool(batch.executed),
|
|
||||||
'batch_mutable': self.batch_handler.is_mutable(batch),
|
|
||||||
'sequence': row.sequence,
|
|
||||||
'status_code': row.status_code,
|
|
||||||
'status_display': row.STATUS.get(row.status_code, str(row.status_code)),
|
|
||||||
}
|
|
||||||
|
|
||||||
def update_object(self, row, data):
|
|
||||||
"""
|
|
||||||
Supplements the default logic as follows:
|
|
||||||
|
|
||||||
Invokes the batch handler's ``refresh_row()`` method after updating the
|
|
||||||
row's field data per usual.
|
|
||||||
"""
|
|
||||||
if not self.batch_handler.is_mutable(row.batch):
|
|
||||||
return {'error': "Batch is not mutable"}
|
|
||||||
|
|
||||||
# update row per usual
|
|
||||||
row = super(APIBatchRowView, self).update_object(row, data)
|
|
||||||
|
|
||||||
# okay now we apply handler refresh logic
|
|
||||||
self.batch_handler.refresh_row(row)
|
|
||||||
return row
|
|
||||||
|
|
||||||
def delete_object(self, row):
|
|
||||||
"""
|
|
||||||
Overrides the default logic as follows:
|
|
||||||
|
|
||||||
Delegates deletion of the row to the batch handler.
|
|
||||||
"""
|
|
||||||
self.batch_handler.do_remove_row(row)
|
|
||||||
|
|
||||||
def quick_entry(self):
|
|
||||||
"""
|
|
||||||
View for handling "quick entry" user input, for a batch.
|
|
||||||
"""
|
|
||||||
data = self.request.json_body
|
|
||||||
|
|
||||||
uuid = data['batch_uuid']
|
|
||||||
batch = self.Session.get(self.get_batch_class(), uuid)
|
|
||||||
if not batch:
|
|
||||||
raise self.notfound()
|
|
||||||
|
|
||||||
entry = data['quick_entry']
|
|
||||||
|
|
||||||
try:
|
|
||||||
row = self.batch_handler.quick_entry(self.Session(), batch, entry)
|
|
||||||
except Exception as error:
|
|
||||||
log.warning("quick entry failed for '%s' batch %s: %s",
|
|
||||||
self.batch_handler.batch_key, batch.id_str, entry,
|
|
||||||
exc_info=True)
|
|
||||||
msg = str(error)
|
|
||||||
if not msg and isinstance(error, NotImplementedError):
|
|
||||||
msg = "Feature is not implemented"
|
|
||||||
return {'error': msg}
|
|
||||||
|
|
||||||
if not row:
|
|
||||||
return {'error': "Could not identify product"}
|
|
||||||
|
|
||||||
self.Session.flush()
|
|
||||||
result = self._get(obj=row)
|
|
||||||
result['ok'] = True
|
|
||||||
return result
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._batch_row_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _batch_row_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
collection_url_prefix = cls.get_collection_url_prefix()
|
|
||||||
|
|
||||||
if cls.supports_quick_entry:
|
|
||||||
|
|
||||||
# quick entry
|
|
||||||
quick_entry = Service(name='{}.quick_entry'.format(route_prefix),
|
|
||||||
path='{}/quick-entry'.format(collection_url_prefix))
|
|
||||||
quick_entry.add_view('POST', 'quick_entry', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(quick_entry)
|
|
|
@ -1,200 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Inventory Batches
|
|
||||||
"""
|
|
||||||
|
|
||||||
import decimal
|
|
||||||
|
|
||||||
import sqlalchemy as sa
|
|
||||||
|
|
||||||
from rattail import pod
|
|
||||||
from rattail.db.model import InventoryBatch, InventoryBatchRow
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
|
|
||||||
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
|
||||||
|
|
||||||
|
|
||||||
class InventoryBatchViews(APIBatchView):
|
|
||||||
|
|
||||||
model_class = InventoryBatch
|
|
||||||
default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler'
|
|
||||||
route_prefix = 'inventory'
|
|
||||||
permission_prefix = 'batch.inventory'
|
|
||||||
collection_url_prefix = '/inventory-batches'
|
|
||||||
object_url_prefix = '/inventory-batch'
|
|
||||||
supports_toggle_complete = True
|
|
||||||
|
|
||||||
def normalize(self, batch):
|
|
||||||
data = super().normalize(batch)
|
|
||||||
|
|
||||||
data['mode'] = batch.mode
|
|
||||||
data['mode_display'] = self.enum.INVENTORY_MODE.get(batch.mode)
|
|
||||||
if data['mode_display'] is None and batch.mode is not None:
|
|
||||||
data['mode_display'] = str(batch.mode)
|
|
||||||
|
|
||||||
data['reason_code'] = batch.reason_code
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
def count_modes(self):
|
|
||||||
"""
|
|
||||||
Retrieve info about the available batch count modes.
|
|
||||||
"""
|
|
||||||
permission_prefix = self.get_permission_prefix()
|
|
||||||
if self.request.is_root:
|
|
||||||
modes = self.batch_handler.get_count_modes()
|
|
||||||
else:
|
|
||||||
modes = self.batch_handler.get_allowed_count_modes(
|
|
||||||
self.Session(), self.request.user,
|
|
||||||
permission_prefix=permission_prefix)
|
|
||||||
return modes
|
|
||||||
|
|
||||||
def adjustment_reasons(self):
|
|
||||||
"""
|
|
||||||
Retrieve info about the available "reasons" for inventory adjustment
|
|
||||||
batches.
|
|
||||||
"""
|
|
||||||
raw_reasons = self.batch_handler.get_adjustment_reasons(self.Session())
|
|
||||||
reasons = []
|
|
||||||
for reason in raw_reasons:
|
|
||||||
reasons.append({
|
|
||||||
'uuid': reason.uuid,
|
|
||||||
'code': reason.code,
|
|
||||||
'description': reason.description,
|
|
||||||
'hidden': reason.hidden,
|
|
||||||
})
|
|
||||||
return reasons
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._batch_defaults(config)
|
|
||||||
cls._inventory_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _inventory_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
collection_url_prefix = cls.get_collection_url_prefix()
|
|
||||||
|
|
||||||
# get count modes
|
|
||||||
count_modes = Service(name='{}.count_modes'.format(route_prefix),
|
|
||||||
path='{}/count-modes'.format(collection_url_prefix))
|
|
||||||
count_modes.add_view('GET', 'count_modes', klass=cls,
|
|
||||||
permission='{}.list'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(count_modes)
|
|
||||||
|
|
||||||
# get adjustment reasons
|
|
||||||
adjustment_reasons = Service(name='{}.adjustment_reasons'.format(route_prefix),
|
|
||||||
path='{}/adjustment-reasons'.format(collection_url_prefix))
|
|
||||||
adjustment_reasons.add_view('GET', 'adjustment_reasons', klass=cls,
|
|
||||||
permission='{}.list'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(adjustment_reasons)
|
|
||||||
|
|
||||||
|
|
||||||
class InventoryBatchRowViews(APIBatchRowView):
|
|
||||||
|
|
||||||
model_class = InventoryBatchRow
|
|
||||||
default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler'
|
|
||||||
route_prefix = 'inventory.rows'
|
|
||||||
permission_prefix = 'batch.inventory'
|
|
||||||
collection_url_prefix = '/inventory-batch-rows'
|
|
||||||
object_url_prefix = '/inventory-batch-row'
|
|
||||||
editable = True
|
|
||||||
supports_quick_entry = True
|
|
||||||
|
|
||||||
def normalize(self, row):
|
|
||||||
batch = row.batch
|
|
||||||
data = super().normalize(row)
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
|
|
||||||
data['item_id'] = row.item_id
|
|
||||||
data['upc'] = str(row.upc)
|
|
||||||
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
|
||||||
data['brand_name'] = row.brand_name
|
|
||||||
data['description'] = row.description
|
|
||||||
data['size'] = row.size
|
|
||||||
data['full_description'] = row.product.full_description if row.product else row.description
|
|
||||||
data['image_url'] = pod.get_image_url(self.rattail_config, row.upc) if row.upc else None
|
|
||||||
data['case_quantity'] = app.render_quantity(row.case_quantity or 1)
|
|
||||||
|
|
||||||
data['cases'] = row.cases
|
|
||||||
data['units'] = row.units
|
|
||||||
data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA'
|
|
||||||
data['quantity_display'] = "{} {}".format(
|
|
||||||
app.render_quantity(row.cases or row.units),
|
|
||||||
'CS' if row.cases else data['unit_uom'])
|
|
||||||
|
|
||||||
data['allow_cases'] = self.batch_handler.allow_cases(batch)
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
def update_object(self, row, data):
|
|
||||||
"""
|
|
||||||
Supplements the default logic as follows:
|
|
||||||
|
|
||||||
Converts certain fields within the data, to proper "native" types.
|
|
||||||
"""
|
|
||||||
data = dict(data)
|
|
||||||
|
|
||||||
# convert some data types as needed
|
|
||||||
if 'cases' in data:
|
|
||||||
if data['cases'] == '':
|
|
||||||
data['cases'] = None
|
|
||||||
elif data['cases']:
|
|
||||||
data['cases'] = decimal.Decimal(data['cases'])
|
|
||||||
if 'units' in data:
|
|
||||||
if data['units'] == '':
|
|
||||||
data['units'] = None
|
|
||||||
elif data['units']:
|
|
||||||
data['units'] = decimal.Decimal(data['units'])
|
|
||||||
|
|
||||||
# update row per usual
|
|
||||||
try:
|
|
||||||
row = super().update_object(row, data)
|
|
||||||
except sa.exc.DataError as error:
|
|
||||||
# detect when user scans barcode for cases/units field
|
|
||||||
if hasattr(error, 'orig'):
|
|
||||||
orig = type(error.orig)
|
|
||||||
if hasattr(orig, '__name__'):
|
|
||||||
# nb. this particular error is from psycopg2
|
|
||||||
if orig.__name__ == 'NumericValueOutOfRange':
|
|
||||||
return {'error': "Numeric value out of range"}
|
|
||||||
raise
|
|
||||||
return row
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
InventoryBatchViews = kwargs.get('InventoryBatchViews', base['InventoryBatchViews'])
|
|
||||||
InventoryBatchViews.defaults(config)
|
|
||||||
|
|
||||||
InventoryBatchRowViews = kwargs.get('InventoryBatchRowViews', base['InventoryBatchRowViews'])
|
|
||||||
InventoryBatchRowViews.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,78 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Label Batches
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
|
||||||
|
|
||||||
|
|
||||||
class LabelBatchViews(APIBatchView):
|
|
||||||
|
|
||||||
model_class = model.LabelBatch
|
|
||||||
default_handler_spec = 'rattail.batch.labels:LabelBatchHandler'
|
|
||||||
route_prefix = 'labelbatchviews'
|
|
||||||
permission_prefix = 'labels.batch'
|
|
||||||
collection_url_prefix = '/label-batches'
|
|
||||||
object_url_prefix = '/label-batch'
|
|
||||||
supports_toggle_complete = True
|
|
||||||
|
|
||||||
|
|
||||||
class LabelBatchRowViews(APIBatchRowView):
|
|
||||||
|
|
||||||
model_class = model.LabelBatchRow
|
|
||||||
default_handler_spec = 'rattail.batch.labels:LabelBatchHandler'
|
|
||||||
route_prefix = 'api.label_batch_rows'
|
|
||||||
permission_prefix = 'labels.batch'
|
|
||||||
collection_url_prefix = '/label-batch-rows'
|
|
||||||
object_url_prefix = '/label-batch-row'
|
|
||||||
supports_quick_entry = True
|
|
||||||
|
|
||||||
def normalize(self, row):
|
|
||||||
batch = row.batch
|
|
||||||
data = super().normalize(row)
|
|
||||||
|
|
||||||
data['item_id'] = row.item_id
|
|
||||||
data['upc'] = str(row.upc)
|
|
||||||
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
|
||||||
data['brand_name'] = row.brand_name
|
|
||||||
data['description'] = row.description
|
|
||||||
data['size'] = row.size
|
|
||||||
data['full_description'] = row.product.full_description if row.product else row.description
|
|
||||||
return data
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
LabelBatchViews = kwargs.get('LabelBatchViews', base['LabelBatchViews'])
|
|
||||||
LabelBatchViews.defaults(config)
|
|
||||||
|
|
||||||
LabelBatchRowViews = kwargs.get('LabelBatchRowViews', base['LabelBatchRowViews'])
|
|
||||||
LabelBatchRowViews.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,318 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Ordering Batches
|
|
||||||
|
|
||||||
These views expose the basic CRUD interface to "ordering" batches, for the web
|
|
||||||
API.
|
|
||||||
"""
|
|
||||||
|
|
||||||
import datetime
|
|
||||||
import logging
|
|
||||||
|
|
||||||
import sqlalchemy as sa
|
|
||||||
|
|
||||||
from rattail.db.model import PurchaseBatch, PurchaseBatchRow
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
|
|
||||||
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class OrderingBatchViews(APIBatchView):
|
|
||||||
|
|
||||||
model_class = PurchaseBatch
|
|
||||||
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
|
||||||
route_prefix = 'orderingbatchviews'
|
|
||||||
permission_prefix = 'ordering'
|
|
||||||
collection_url_prefix = '/ordering-batches'
|
|
||||||
object_url_prefix = '/ordering-batch'
|
|
||||||
supports_toggle_complete = True
|
|
||||||
supports_execute = True
|
|
||||||
|
|
||||||
def base_query(self):
|
|
||||||
"""
|
|
||||||
Modifies the default logic as follows:
|
|
||||||
|
|
||||||
Adds a condition to the query, to ensure only purchase batches with
|
|
||||||
"ordering" mode are returned.
|
|
||||||
"""
|
|
||||||
model = self.model
|
|
||||||
query = super().base_query()
|
|
||||||
query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_ORDERING)
|
|
||||||
return query
|
|
||||||
|
|
||||||
def normalize(self, batch):
|
|
||||||
data = super().normalize(batch)
|
|
||||||
|
|
||||||
data['vendor_uuid'] = batch.vendor.uuid
|
|
||||||
data['vendor_display'] = str(batch.vendor)
|
|
||||||
|
|
||||||
data['department_uuid'] = batch.department_uuid
|
|
||||||
data['department_display'] = str(batch.department) if batch.department else None
|
|
||||||
|
|
||||||
data['po_total_calculated_display'] = "${:0.2f}".format(batch.po_total_calculated or 0)
|
|
||||||
data['ship_method'] = batch.ship_method
|
|
||||||
data['notes_to_vendor'] = batch.notes_to_vendor
|
|
||||||
return data
|
|
||||||
|
|
||||||
def create_object(self, data):
|
|
||||||
"""
|
|
||||||
Modifies the default logic as follows:
|
|
||||||
|
|
||||||
Sets the mode to "ordering" for the new batch.
|
|
||||||
"""
|
|
||||||
data = dict(data)
|
|
||||||
if not data.get('vendor_uuid'):
|
|
||||||
raise ValueError("You must specify the vendor")
|
|
||||||
data['mode'] = self.enum.PURCHASE_BATCH_MODE_ORDERING
|
|
||||||
batch = super().create_object(data)
|
|
||||||
return batch
|
|
||||||
|
|
||||||
def worksheet(self):
|
|
||||||
"""
|
|
||||||
Returns primary data for the Ordering Worksheet view.
|
|
||||||
"""
|
|
||||||
batch = self.get_object()
|
|
||||||
if batch.executed:
|
|
||||||
raise self.forbidden()
|
|
||||||
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
|
|
||||||
# TODO: much of the logic below was copied from the traditional master
|
|
||||||
# view for ordering batches. should maybe let them share it somehow?
|
|
||||||
|
|
||||||
# organize existing batch rows by product
|
|
||||||
order_items = {}
|
|
||||||
for row in batch.active_rows():
|
|
||||||
order_items[row.product_uuid] = row
|
|
||||||
|
|
||||||
# organize vendor catalog costs by dept / subdept
|
|
||||||
departments = {}
|
|
||||||
costs = self.batch_handler.get_order_form_costs(self.Session(), batch.vendor)
|
|
||||||
costs = self.batch_handler.sort_order_form_costs(costs)
|
|
||||||
costs = list(costs) # we must have a stable list for the rest of this
|
|
||||||
self.batch_handler.decorate_order_form_costs(batch, costs)
|
|
||||||
for cost in costs:
|
|
||||||
|
|
||||||
department = cost.product.department
|
|
||||||
if department:
|
|
||||||
department_dict = departments.setdefault(department.uuid, {
|
|
||||||
'uuid': department.uuid,
|
|
||||||
'number': department.number,
|
|
||||||
'name': department.name,
|
|
||||||
})
|
|
||||||
else:
|
|
||||||
if None not in departments:
|
|
||||||
departments[None] = {
|
|
||||||
'uuid': None,
|
|
||||||
'number': None,
|
|
||||||
'name': "",
|
|
||||||
}
|
|
||||||
department_dict = departments[None]
|
|
||||||
|
|
||||||
subdepartments = department_dict.setdefault('subdepartments', {})
|
|
||||||
|
|
||||||
subdepartment = cost.product.subdepartment
|
|
||||||
if subdepartment:
|
|
||||||
subdepartment_dict = subdepartments.setdefault(subdepartment.uuid, {
|
|
||||||
'uuid': subdepartment.uuid,
|
|
||||||
'number': subdepartment.number,
|
|
||||||
'name': subdepartment.name,
|
|
||||||
})
|
|
||||||
else:
|
|
||||||
if None not in subdepartments:
|
|
||||||
subdepartments[None] = {
|
|
||||||
'uuid': None,
|
|
||||||
'number': None,
|
|
||||||
'name': "",
|
|
||||||
}
|
|
||||||
subdepartment_dict = subdepartments[None]
|
|
||||||
|
|
||||||
subdept_costs = subdepartment_dict.setdefault('costs', [])
|
|
||||||
product = cost.product
|
|
||||||
subdept_costs.append({
|
|
||||||
'uuid': cost.uuid,
|
|
||||||
'upc': str(product.upc),
|
|
||||||
'upc_pretty': product.upc.pretty() if product.upc else None,
|
|
||||||
'brand_name': product.brand.name if product.brand else None,
|
|
||||||
'description': product.description,
|
|
||||||
'size': product.size,
|
|
||||||
'case_size': cost.case_size,
|
|
||||||
'uom_display': "LB" if product.weighed else "EA",
|
|
||||||
'vendor_item_code': cost.code,
|
|
||||||
'preference': cost.preference,
|
|
||||||
'preferred': cost.preference == 1,
|
|
||||||
'unit_cost': cost.unit_cost,
|
|
||||||
'unit_cost_display': "${:0.2f}".format(cost.unit_cost) if cost.unit_cost is not None else "",
|
|
||||||
# TODO
|
|
||||||
# 'cases_ordered': None,
|
|
||||||
# 'units_ordered': None,
|
|
||||||
# 'po_total': None,
|
|
||||||
# 'po_total_display': None,
|
|
||||||
})
|
|
||||||
|
|
||||||
# sort the (sub)department groupings
|
|
||||||
sorted_departments = []
|
|
||||||
for dept in sorted(departments.values(), key=lambda d: d['name']):
|
|
||||||
dept['subdepartments'] = sorted(dept['subdepartments'].values(),
|
|
||||||
key=lambda s: s['name'])
|
|
||||||
sorted_departments.append(dept)
|
|
||||||
|
|
||||||
# fetch recent purchase history, sort/pad for template convenience
|
|
||||||
history = self.batch_handler.get_order_form_history(batch, costs, 6)
|
|
||||||
for i in range(6 - len(history)):
|
|
||||||
history.append(None)
|
|
||||||
history = list(reversed(history))
|
|
||||||
# must convert some date objects to string, for JSON sake
|
|
||||||
for h in history:
|
|
||||||
if not h:
|
|
||||||
continue
|
|
||||||
purchase = h.get('purchase')
|
|
||||||
if purchase:
|
|
||||||
dt = purchase.get('date_ordered')
|
|
||||||
if dt and isinstance(dt, datetime.date):
|
|
||||||
purchase['date_ordered'] = app.render_date(dt)
|
|
||||||
dt = purchase.get('date_received')
|
|
||||||
if dt and isinstance(dt, datetime.date):
|
|
||||||
purchase['date_received'] = app.render_date(dt)
|
|
||||||
|
|
||||||
return {
|
|
||||||
'batch': self.normalize(batch),
|
|
||||||
'departments': departments,
|
|
||||||
'sorted_departments': sorted_departments,
|
|
||||||
'history': history,
|
|
||||||
}
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._batch_defaults(config)
|
|
||||||
cls._ordering_batch_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _ordering_batch_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
object_url_prefix = cls.get_object_url_prefix()
|
|
||||||
|
|
||||||
# worksheet
|
|
||||||
worksheet = Service(name='{}.worksheet'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/worksheet'.format(object_url_prefix))
|
|
||||||
worksheet.add_view('GET', 'worksheet', klass=cls,
|
|
||||||
permission='{}.worksheet'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(worksheet)
|
|
||||||
|
|
||||||
|
|
||||||
class OrderingBatchRowViews(APIBatchRowView):
|
|
||||||
|
|
||||||
model_class = PurchaseBatchRow
|
|
||||||
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
|
||||||
route_prefix = 'ordering.rows'
|
|
||||||
permission_prefix = 'ordering'
|
|
||||||
collection_url_prefix = '/ordering-batch-rows'
|
|
||||||
object_url_prefix = '/ordering-batch-row'
|
|
||||||
supports_quick_entry = True
|
|
||||||
editable = True
|
|
||||||
|
|
||||||
def normalize(self, row):
|
|
||||||
data = super().normalize(row)
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
batch = row.batch
|
|
||||||
|
|
||||||
data['item_id'] = row.item_id
|
|
||||||
data['upc'] = str(row.upc)
|
|
||||||
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
|
||||||
data['brand_name'] = row.brand_name
|
|
||||||
data['description'] = row.description
|
|
||||||
data['size'] = row.size
|
|
||||||
data['full_description'] = row.product.full_description if row.product else row.description
|
|
||||||
|
|
||||||
# # only provide image url if so configured
|
|
||||||
# if self.rattail_config.getbool('rattail.batch', 'purchase.mobile_images', default=True):
|
|
||||||
# data['image_url'] = pod.get_image_url(self.rattail_config, row.upc) if row.upc else None
|
|
||||||
|
|
||||||
# unit_uom can vary by product
|
|
||||||
data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA'
|
|
||||||
|
|
||||||
data['case_quantity'] = row.case_quantity
|
|
||||||
data['cases_ordered'] = row.cases_ordered
|
|
||||||
data['units_ordered'] = row.units_ordered
|
|
||||||
data['cases_ordered_display'] = app.render_quantity(row.cases_ordered or 0, empty_zero=False)
|
|
||||||
data['units_ordered_display'] = app.render_quantity(row.units_ordered or 0, empty_zero=False)
|
|
||||||
|
|
||||||
data['po_unit_cost'] = row.po_unit_cost
|
|
||||||
data['po_unit_cost_display'] = "${:0.2f}".format(row.po_unit_cost) if row.po_unit_cost is not None else None
|
|
||||||
data['po_total_calculated'] = row.po_total_calculated
|
|
||||||
data['po_total_calculated_display'] = "${:0.2f}".format(row.po_total_calculated) if row.po_total_calculated is not None else None
|
|
||||||
data['status_code'] = row.status_code
|
|
||||||
data['status_display'] = row.STATUS.get(row.status_code, str(row.status_code))
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
def update_object(self, row, data):
|
|
||||||
"""
|
|
||||||
Overrides the default logic as follows:
|
|
||||||
|
|
||||||
So far, we only allow updating the ``cases_ordered`` and/or
|
|
||||||
``units_ordered`` quantities; therefore ``data`` should have one or
|
|
||||||
both of those keys.
|
|
||||||
|
|
||||||
This data is then passed to the
|
|
||||||
:meth:`~rattail:rattail.batch.purchase.PurchaseBatchHandler.update_row_quantity()`
|
|
||||||
method of the batch handler.
|
|
||||||
|
|
||||||
Note that the "normal" logic for this method is not invoked at all.
|
|
||||||
"""
|
|
||||||
if not self.batch_handler.is_mutable(row.batch):
|
|
||||||
return {'error': "Batch is not mutable"}
|
|
||||||
|
|
||||||
try:
|
|
||||||
self.batch_handler.update_row_quantity(row, **data)
|
|
||||||
self.Session.flush()
|
|
||||||
except Exception as error:
|
|
||||||
log.warning("update_row_quantity failed", exc_info=True)
|
|
||||||
if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'):
|
|
||||||
error = str(error.orig)
|
|
||||||
else:
|
|
||||||
error = str(error)
|
|
||||||
return {'error': error}
|
|
||||||
|
|
||||||
return row
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
OrderingBatchViews = kwargs.get('OrderingBatchViews', base['OrderingBatchViews'])
|
|
||||||
OrderingBatchViews.defaults(config)
|
|
||||||
|
|
||||||
OrderingBatchRowViews = kwargs.get('OrderingBatchRowViews', base['OrderingBatchRowViews'])
|
|
||||||
OrderingBatchRowViews.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,492 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Receiving Batches
|
|
||||||
"""
|
|
||||||
|
|
||||||
import logging
|
|
||||||
|
|
||||||
import humanize
|
|
||||||
import sqlalchemy as sa
|
|
||||||
|
|
||||||
from rattail.db.model import PurchaseBatch, PurchaseBatchRow
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
from deform import widget as dfwidget
|
|
||||||
|
|
||||||
from tailbone import forms
|
|
||||||
from tailbone.api.batch import APIBatchView, APIBatchRowView
|
|
||||||
from tailbone.forms.receiving import ReceiveRow
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class ReceivingBatchViews(APIBatchView):
|
|
||||||
|
|
||||||
model_class = PurchaseBatch
|
|
||||||
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
|
||||||
route_prefix = 'receivingbatchviews'
|
|
||||||
permission_prefix = 'receiving'
|
|
||||||
collection_url_prefix = '/receiving-batches'
|
|
||||||
object_url_prefix = '/receiving-batch'
|
|
||||||
supports_toggle_complete = True
|
|
||||||
supports_execute = True
|
|
||||||
|
|
||||||
def base_query(self):
|
|
||||||
model = self.app.model
|
|
||||||
query = super().base_query()
|
|
||||||
query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_RECEIVING)
|
|
||||||
return query
|
|
||||||
|
|
||||||
def normalize(self, batch):
|
|
||||||
data = super().normalize(batch)
|
|
||||||
|
|
||||||
data['vendor_uuid'] = batch.vendor.uuid
|
|
||||||
data['vendor_display'] = str(batch.vendor)
|
|
||||||
|
|
||||||
data['department_uuid'] = batch.department_uuid
|
|
||||||
data['department_display'] = str(batch.department) if batch.department else None
|
|
||||||
|
|
||||||
data['po_number'] = batch.po_number
|
|
||||||
data['po_total'] = batch.po_total
|
|
||||||
data['invoice_total'] = batch.invoice_total
|
|
||||||
data['invoice_total_calculated'] = batch.invoice_total_calculated
|
|
||||||
|
|
||||||
data['can_auto_receive'] = self.batch_handler.can_auto_receive(batch)
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
def create_object(self, data):
|
|
||||||
data = dict(data)
|
|
||||||
|
|
||||||
# all about receiving mode here
|
|
||||||
data['mode'] = self.enum.PURCHASE_BATCH_MODE_RECEIVING
|
|
||||||
|
|
||||||
# assume "receive from PO" if given a PO key
|
|
||||||
if data.get('purchase_key'):
|
|
||||||
data['workflow'] = 'from_po'
|
|
||||||
|
|
||||||
return super().create_object(data)
|
|
||||||
|
|
||||||
def auto_receive(self):
|
|
||||||
"""
|
|
||||||
View which handles auto-marking as received, all items within
|
|
||||||
a pending batch.
|
|
||||||
"""
|
|
||||||
batch = self.get_object()
|
|
||||||
self.batch_handler.auto_receive_all_items(batch)
|
|
||||||
return self._get(obj=batch)
|
|
||||||
|
|
||||||
def mark_receiving_complete(self):
|
|
||||||
"""
|
|
||||||
Mark the given batch as "receiving complete".
|
|
||||||
"""
|
|
||||||
batch = self.get_object()
|
|
||||||
|
|
||||||
if batch.executed:
|
|
||||||
return {'error': "Batch {} has already been executed: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
if batch.complete:
|
|
||||||
return {'error': "Batch {} is already marked complete: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
if batch.receiving_complete:
|
|
||||||
return {'error': "Receiving is already complete for batch {}: {}".format(
|
|
||||||
batch.id_str, batch.description)}
|
|
||||||
|
|
||||||
batch.receiving_complete = True
|
|
||||||
return self._get(obj=batch)
|
|
||||||
|
|
||||||
def eligible_purchases(self):
|
|
||||||
model = self.app.model
|
|
||||||
uuid = self.request.params.get('vendor_uuid')
|
|
||||||
vendor = self.Session.get(model.Vendor, uuid) if uuid else None
|
|
||||||
if not vendor:
|
|
||||||
return {'error': "Vendor not found"}
|
|
||||||
|
|
||||||
purchases = self.batch_handler.get_eligible_purchases(
|
|
||||||
vendor, self.enum.PURCHASE_BATCH_MODE_RECEIVING)
|
|
||||||
|
|
||||||
purchases = [self.normalize_eligible_purchase(p)
|
|
||||||
for p in purchases]
|
|
||||||
|
|
||||||
return {'purchases': purchases}
|
|
||||||
|
|
||||||
def normalize_eligible_purchase(self, purchase):
|
|
||||||
return self.batch_handler.normalize_eligible_purchase(purchase)
|
|
||||||
|
|
||||||
def render_eligible_purchase(self, purchase):
|
|
||||||
return self.batch_handler.render_eligible_purchase(purchase)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._batch_defaults(config)
|
|
||||||
cls._receiving_batch_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _receiving_batch_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
collection_url_prefix = cls.get_collection_url_prefix()
|
|
||||||
object_url_prefix = cls.get_object_url_prefix()
|
|
||||||
|
|
||||||
# auto_receive
|
|
||||||
auto_receive = Service(name='{}.auto_receive'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/auto-receive'.format(object_url_prefix))
|
|
||||||
auto_receive.add_view('GET', 'auto_receive', klass=cls,
|
|
||||||
permission='{}.auto_receive'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(auto_receive)
|
|
||||||
|
|
||||||
# mark_receiving_complete
|
|
||||||
mark_receiving_complete = Service(name='{}.mark_receiving_complete'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/mark-receiving-complete'.format(object_url_prefix))
|
|
||||||
mark_receiving_complete.add_view('POST', 'mark_receiving_complete', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(mark_receiving_complete)
|
|
||||||
|
|
||||||
# eligible purchases
|
|
||||||
eligible_purchases = Service(name='{}.eligible_purchases'.format(route_prefix),
|
|
||||||
path='{}/eligible-purchases'.format(collection_url_prefix))
|
|
||||||
eligible_purchases.add_view('GET', 'eligible_purchases', klass=cls,
|
|
||||||
permission='{}.create'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(eligible_purchases)
|
|
||||||
|
|
||||||
|
|
||||||
class ReceivingBatchRowViews(APIBatchRowView):
|
|
||||||
|
|
||||||
model_class = PurchaseBatchRow
|
|
||||||
default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler'
|
|
||||||
route_prefix = 'receiving.rows'
|
|
||||||
permission_prefix = 'receiving'
|
|
||||||
collection_url_prefix = '/receiving-batch-rows'
|
|
||||||
object_url_prefix = '/receiving-batch-row'
|
|
||||||
supports_quick_entry = True
|
|
||||||
|
|
||||||
def make_filter_spec(self):
|
|
||||||
model = self.app.model
|
|
||||||
filters = super().make_filter_spec()
|
|
||||||
if filters:
|
|
||||||
|
|
||||||
# must translate certain convenience filters
|
|
||||||
orig_filters, filters = filters, []
|
|
||||||
for filtr in orig_filters:
|
|
||||||
|
|
||||||
# # is_received
|
|
||||||
# # NOTE: this is only relevant for truck dump or "from scratch"
|
|
||||||
# if filtr['field'] == 'is_received' and filtr['op'] == 'eq' and filtr['value'] is True:
|
|
||||||
# filters.extend([
|
|
||||||
# {'or': [
|
|
||||||
# {'field': 'cases_received', 'op': '!=', 'value': 0},
|
|
||||||
# {'field': 'units_received', 'op': '!=', 'value': 0},
|
|
||||||
# ]},
|
|
||||||
# ])
|
|
||||||
|
|
||||||
# is_incomplete
|
|
||||||
if filtr['field'] == 'is_incomplete' and filtr['op'] == 'eq' and filtr['value'] is True:
|
|
||||||
# looking for any rows with "ordered" quantity, but where the
|
|
||||||
# status does *not* signify a "settled" row so to speak
|
|
||||||
# TODO: would be nice if we had a simple flag to leverage?
|
|
||||||
filters.extend([
|
|
||||||
{'or': [
|
|
||||||
{'field': 'cases_ordered', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'units_ordered', 'op': '!=', 'value': 0},
|
|
||||||
]},
|
|
||||||
{'field': 'status_code', 'op': 'not_in', 'value': [
|
|
||||||
model.PurchaseBatchRow.STATUS_OK,
|
|
||||||
model.PurchaseBatchRow.STATUS_PRODUCT_NOT_FOUND,
|
|
||||||
model.PurchaseBatchRow.STATUS_CASE_QUANTITY_DIFFERS,
|
|
||||||
]},
|
|
||||||
])
|
|
||||||
|
|
||||||
# is_invalid
|
|
||||||
elif filtr['field'] == 'is_invalid' and filtr['op'] == 'eq' and filtr['value'] is True:
|
|
||||||
filters.extend([
|
|
||||||
{'field': 'status_code', 'op': 'in', 'value': [
|
|
||||||
model.PurchaseBatchRow.STATUS_PRODUCT_NOT_FOUND,
|
|
||||||
model.PurchaseBatchRow.STATUS_COST_NOT_FOUND,
|
|
||||||
model.PurchaseBatchRow.STATUS_CASE_QUANTITY_UNKNOWN,
|
|
||||||
model.PurchaseBatchRow.STATUS_CASE_QUANTITY_DIFFERS,
|
|
||||||
]},
|
|
||||||
])
|
|
||||||
|
|
||||||
# is_unexpected
|
|
||||||
elif filtr['field'] == 'is_unexpected' and filtr['op'] == 'eq' and filtr['value'] is True:
|
|
||||||
# looking for any rows which do *not* have "ordered/shipped" quantity
|
|
||||||
filters.extend([
|
|
||||||
{'and': [
|
|
||||||
{'or': [
|
|
||||||
{'field': 'cases_ordered', 'op': 'is_null'},
|
|
||||||
{'field': 'cases_ordered', 'op': '==', 'value': 0},
|
|
||||||
]},
|
|
||||||
{'or': [
|
|
||||||
{'field': 'units_ordered', 'op': 'is_null'},
|
|
||||||
{'field': 'units_ordered', 'op': '==', 'value': 0},
|
|
||||||
]},
|
|
||||||
{'or': [
|
|
||||||
{'field': 'cases_shipped', 'op': 'is_null'},
|
|
||||||
{'field': 'cases_shipped', 'op': '==', 'value': 0},
|
|
||||||
]},
|
|
||||||
{'or': [
|
|
||||||
{'field': 'units_shipped', 'op': 'is_null'},
|
|
||||||
{'field': 'units_shipped', 'op': '==', 'value': 0},
|
|
||||||
]},
|
|
||||||
{'or': [
|
|
||||||
# but "unexpected" also implies we have some confirmed amount(s)
|
|
||||||
{'field': 'cases_received', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'units_received', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'cases_damaged', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'units_damaged', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'cases_expired', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'units_expired', 'op': '!=', 'value': 0},
|
|
||||||
]},
|
|
||||||
]},
|
|
||||||
])
|
|
||||||
|
|
||||||
# is_damaged
|
|
||||||
elif filtr['field'] == 'is_damaged' and filtr['op'] == 'eq' and filtr['value'] is True:
|
|
||||||
filters.extend([
|
|
||||||
{'or': [
|
|
||||||
{'field': 'cases_damaged', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'units_damaged', 'op': '!=', 'value': 0},
|
|
||||||
]},
|
|
||||||
])
|
|
||||||
|
|
||||||
# is_expired
|
|
||||||
elif filtr['field'] == 'is_expired' and filtr['op'] == 'eq' and filtr['value'] is True:
|
|
||||||
filters.extend([
|
|
||||||
{'or': [
|
|
||||||
{'field': 'cases_expired', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'units_expired', 'op': '!=', 'value': 0},
|
|
||||||
]},
|
|
||||||
])
|
|
||||||
|
|
||||||
# is_missing
|
|
||||||
elif filtr['field'] == 'is_missing' and filtr['op'] == 'eq' and filtr['value'] is True:
|
|
||||||
filters.extend([
|
|
||||||
{'or': [
|
|
||||||
{'field': 'cases_missing', 'op': '!=', 'value': 0},
|
|
||||||
{'field': 'units_missing', 'op': '!=', 'value': 0},
|
|
||||||
]},
|
|
||||||
])
|
|
||||||
|
|
||||||
else: # just some filter, use as-is
|
|
||||||
filters.append(filtr)
|
|
||||||
|
|
||||||
return filters
|
|
||||||
|
|
||||||
def normalize(self, row):
|
|
||||||
data = super().normalize(row)
|
|
||||||
model = self.app.model
|
|
||||||
|
|
||||||
batch = row.batch
|
|
||||||
prodder = self.app.get_products_handler()
|
|
||||||
|
|
||||||
data['product_uuid'] = row.product_uuid
|
|
||||||
data['item_id'] = row.item_id
|
|
||||||
data['upc'] = str(row.upc)
|
|
||||||
data['upc_pretty'] = row.upc.pretty() if row.upc else None
|
|
||||||
data['brand_name'] = row.brand_name
|
|
||||||
data['description'] = row.description
|
|
||||||
data['size'] = row.size
|
|
||||||
data['full_description'] = row.product.full_description if row.product else row.description
|
|
||||||
|
|
||||||
# only provide image url if so configured
|
|
||||||
if self.rattail_config.getbool('rattail.batch', 'purchase.mobile_images', default=True):
|
|
||||||
data['image_url'] = prodder.get_image_url(product=row.product, upc=row.upc)
|
|
||||||
|
|
||||||
# unit_uom can vary by product
|
|
||||||
data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA'
|
|
||||||
|
|
||||||
data['case_quantity'] = row.case_quantity
|
|
||||||
data['order_quantities_known'] = batch.order_quantities_known
|
|
||||||
|
|
||||||
data['cases_ordered'] = row.cases_ordered
|
|
||||||
data['units_ordered'] = row.units_ordered
|
|
||||||
|
|
||||||
data['cases_shipped'] = row.cases_shipped
|
|
||||||
data['units_shipped'] = row.units_shipped
|
|
||||||
|
|
||||||
data['cases_received'] = row.cases_received
|
|
||||||
data['units_received'] = row.units_received
|
|
||||||
|
|
||||||
data['cases_damaged'] = row.cases_damaged
|
|
||||||
data['units_damaged'] = row.units_damaged
|
|
||||||
|
|
||||||
data['cases_expired'] = row.cases_expired
|
|
||||||
data['units_expired'] = row.units_expired
|
|
||||||
|
|
||||||
data['cases_missing'] = row.cases_missing
|
|
||||||
data['units_missing'] = row.units_missing
|
|
||||||
|
|
||||||
cases, units = self.batch_handler.get_unconfirmed_counts(row)
|
|
||||||
data['cases_unconfirmed'] = cases
|
|
||||||
data['units_unconfirmed'] = units
|
|
||||||
|
|
||||||
data['po_unit_cost'] = row.po_unit_cost
|
|
||||||
data['po_total'] = row.po_total
|
|
||||||
|
|
||||||
data['invoice_number'] = row.invoice_number
|
|
||||||
data['invoice_unit_cost'] = row.invoice_unit_cost
|
|
||||||
data['invoice_total'] = row.invoice_total
|
|
||||||
data['invoice_total_calculated'] = row.invoice_total_calculated
|
|
||||||
|
|
||||||
data['allow_cases'] = self.batch_handler.allow_cases()
|
|
||||||
|
|
||||||
data['quick_receive'] = self.rattail_config.getbool(
|
|
||||||
'rattail.batch', 'purchase.mobile_quick_receive',
|
|
||||||
default=True)
|
|
||||||
|
|
||||||
if batch.order_quantities_known:
|
|
||||||
data['quick_receive_all'] = self.rattail_config.getbool(
|
|
||||||
'rattail.batch', 'purchase.mobile_quick_receive_all',
|
|
||||||
default=False)
|
|
||||||
|
|
||||||
# TODO: this was copied from regular view receive_row() method; should merge
|
|
||||||
if data['quick_receive'] and data.get('quick_receive_all'):
|
|
||||||
if data['allow_cases']:
|
|
||||||
data['quick_receive_uom'] = 'CS'
|
|
||||||
raise NotImplementedError("TODO: add CS support for quick_receive_all")
|
|
||||||
else:
|
|
||||||
data['quick_receive_uom'] = data['unit_uom']
|
|
||||||
accounted_for = self.batch_handler.get_units_accounted_for(row)
|
|
||||||
remainder = self.batch_handler.get_units_ordered(row) - accounted_for
|
|
||||||
|
|
||||||
if accounted_for:
|
|
||||||
# some product accounted for; button should receive "remainder" only
|
|
||||||
if remainder:
|
|
||||||
remainder = self.app.render_quantity(remainder)
|
|
||||||
data['quick_receive_quantity'] = remainder
|
|
||||||
data['quick_receive_text'] = "Receive Remainder ({} {})".format(
|
|
||||||
remainder, data['unit_uom'])
|
|
||||||
else:
|
|
||||||
# unless there is no remainder, in which case disable it
|
|
||||||
data['quick_receive'] = False
|
|
||||||
|
|
||||||
else: # nothing yet accounted for, button should receive "all"
|
|
||||||
if not remainder:
|
|
||||||
log.warning("quick receive remainder is empty for row %s", row.uuid)
|
|
||||||
remainder = self.app.render_quantity(remainder)
|
|
||||||
data['quick_receive_quantity'] = remainder
|
|
||||||
data['quick_receive_text'] = "Receive ALL ({} {})".format(
|
|
||||||
remainder, data['unit_uom'])
|
|
||||||
|
|
||||||
data['unexpected_alert'] = None
|
|
||||||
if batch.order_quantities_known and not row.cases_ordered and not row.units_ordered:
|
|
||||||
warn = True
|
|
||||||
if batch.is_truck_dump_parent() and row.product:
|
|
||||||
uuids = [child.uuid for child in batch.truck_dump_children]
|
|
||||||
if uuids:
|
|
||||||
count = self.Session.query(model.PurchaseBatchRow)\
|
|
||||||
.filter(model.PurchaseBatchRow.batch_uuid.in_(uuids))\
|
|
||||||
.filter(model.PurchaseBatchRow.product == row.product)\
|
|
||||||
.count()
|
|
||||||
if count:
|
|
||||||
warn = False
|
|
||||||
if warn:
|
|
||||||
data['unexpected_alert'] = "This item was NOT on the original purchase order."
|
|
||||||
|
|
||||||
# TODO: surely the caller of API should determine this flag?
|
|
||||||
# maybe alert user if they've already received some of this product
|
|
||||||
alert_received = self.rattail_config.getbool('tailbone', 'receiving.alert_already_received',
|
|
||||||
default=False)
|
|
||||||
if alert_received:
|
|
||||||
data['received_alert'] = None
|
|
||||||
if self.batch_handler.get_units_confirmed(row):
|
|
||||||
msg = "You have already received some of this product; last update was {}.".format(
|
|
||||||
humanize.naturaltime(self.app.make_utc() - row.modified))
|
|
||||||
data['received_alert'] = msg
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
def receive(self):
|
|
||||||
"""
|
|
||||||
View which handles "receiving" against a particular batch row.
|
|
||||||
"""
|
|
||||||
model = self.app.model
|
|
||||||
|
|
||||||
# first do basic input validation
|
|
||||||
schema = ReceiveRow().bind(session=self.Session())
|
|
||||||
form = forms.Form(schema=schema, request=self.request)
|
|
||||||
# TODO: this seems hacky, but avoids "complex" date value parsing
|
|
||||||
form.set_widget('expiration_date', dfwidget.TextInputWidget())
|
|
||||||
if not form.validate():
|
|
||||||
log.warning("form did not validate: %s",
|
|
||||||
form.make_deform_form().error)
|
|
||||||
return {'error': "Form did not validate"}
|
|
||||||
|
|
||||||
# fetch / validate row object
|
|
||||||
row = self.Session.get(model.PurchaseBatchRow, form.validated['row'])
|
|
||||||
if row is not self.get_object():
|
|
||||||
return {'error': "Specified row does not match the route!"}
|
|
||||||
|
|
||||||
# handler takes care of the row receiving logic for us
|
|
||||||
kwargs = dict(form.validated)
|
|
||||||
del kwargs['row']
|
|
||||||
try:
|
|
||||||
self.batch_handler.receive_row(row, **kwargs)
|
|
||||||
self.Session.flush()
|
|
||||||
except Exception as error:
|
|
||||||
log.warning("receive() failed", exc_info=True)
|
|
||||||
if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'):
|
|
||||||
error = str(error.orig)
|
|
||||||
else:
|
|
||||||
error = str(error)
|
|
||||||
return {'error': error}
|
|
||||||
|
|
||||||
return self._get(obj=row)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._batch_row_defaults(config)
|
|
||||||
cls._receiving_batch_row_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _receiving_batch_row_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
object_url_prefix = cls.get_object_url_prefix()
|
|
||||||
|
|
||||||
# receive (row)
|
|
||||||
receive = Service(name='{}.receive'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/receive'.format(object_url_prefix))
|
|
||||||
receive.add_view('POST', 'receive', klass=cls,
|
|
||||||
permission='{}.edit_row'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(receive)
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
ReceivingBatchViews = kwargs.get('ReceivingBatchViews', base['ReceivingBatchViews'])
|
|
||||||
ReceivingBatchViews.defaults(config)
|
|
||||||
|
|
||||||
ReceivingBatchRowViews = kwargs.get('ReceivingBatchRowViews', base['ReceivingBatchRowViews'])
|
|
||||||
ReceivingBatchRowViews.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,159 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - "Common" Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from collections import OrderedDict
|
|
||||||
|
|
||||||
from rattail.util import get_pkg_version
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
from cornice.service import get_services
|
|
||||||
from cornice_swagger import CorniceSwagger
|
|
||||||
|
|
||||||
from tailbone import forms
|
|
||||||
from tailbone.forms.common import Feedback
|
|
||||||
from tailbone.api import APIView, api
|
|
||||||
from tailbone.db import Session
|
|
||||||
|
|
||||||
|
|
||||||
class CommonView(APIView):
|
|
||||||
"""
|
|
||||||
Misc. "common" views for the API.
|
|
||||||
|
|
||||||
.. attribute:: feedback_email_key
|
|
||||||
|
|
||||||
This is the email key which will be used when sending "user feedback"
|
|
||||||
email. Default value is ``'user_feedback'``.
|
|
||||||
"""
|
|
||||||
feedback_email_key = 'user_feedback'
|
|
||||||
|
|
||||||
@api
|
|
||||||
def about(self):
|
|
||||||
"""
|
|
||||||
Generic view to show "about project" info page.
|
|
||||||
"""
|
|
||||||
packages = self.get_packages()
|
|
||||||
return {
|
|
||||||
'project_title': self.get_project_title(),
|
|
||||||
'project_version': self.get_project_version(),
|
|
||||||
'packages': packages,
|
|
||||||
'package_names': list(packages),
|
|
||||||
}
|
|
||||||
|
|
||||||
def get_project_title(self):
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
return app.get_title()
|
|
||||||
|
|
||||||
def get_project_version(self):
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
return app.get_version()
|
|
||||||
|
|
||||||
def get_packages(self):
|
|
||||||
"""
|
|
||||||
Should return the full set of packages which should be displayed on the
|
|
||||||
'about' page.
|
|
||||||
"""
|
|
||||||
return OrderedDict([
|
|
||||||
('rattail', get_pkg_version('rattail')),
|
|
||||||
('Tailbone', get_pkg_version('Tailbone')),
|
|
||||||
])
|
|
||||||
|
|
||||||
@api
|
|
||||||
def feedback(self):
|
|
||||||
"""
|
|
||||||
View to handle user feedback form submits.
|
|
||||||
"""
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
model = self.model
|
|
||||||
# TODO: this logic was copied from tailbone.views.common and is largely
|
|
||||||
# identical; perhaps should merge somehow?
|
|
||||||
schema = Feedback().bind(session=Session())
|
|
||||||
form = forms.Form(schema=schema, request=self.request)
|
|
||||||
if form.validate():
|
|
||||||
data = dict(form.validated)
|
|
||||||
|
|
||||||
# figure out who the sending user is, if any
|
|
||||||
if self.request.user:
|
|
||||||
data['user'] = self.request.user
|
|
||||||
elif data['user']:
|
|
||||||
data['user'] = Session.get(model.User, data['user'])
|
|
||||||
|
|
||||||
# TODO: should provide URL to view user
|
|
||||||
if data['user']:
|
|
||||||
data['user_url'] = '#' # TODO: could get from config?
|
|
||||||
|
|
||||||
data['client_ip'] = self.request.client_addr
|
|
||||||
email_key = data['email_key'] or self.feedback_email_key
|
|
||||||
app.send_email(email_key, data=data)
|
|
||||||
return {'ok': True}
|
|
||||||
|
|
||||||
return {'error': "Form did not validate!"}
|
|
||||||
|
|
||||||
def swagger(self):
|
|
||||||
doc = CorniceSwagger(get_services())
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
spec = doc.generate(f"{app.get_node_title()} API docs",
|
|
||||||
app.get_version(),
|
|
||||||
base_path='/api') # TODO
|
|
||||||
return spec
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._common_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _common_defaults(cls, config):
|
|
||||||
rattail_config = config.registry.settings.get('rattail_config')
|
|
||||||
app = rattail_config.get_app()
|
|
||||||
|
|
||||||
# about
|
|
||||||
about = Service(name='about', path='/about')
|
|
||||||
about.add_view('GET', 'about', klass=cls)
|
|
||||||
config.add_cornice_service(about)
|
|
||||||
|
|
||||||
# feedback
|
|
||||||
feedback = Service(name='feedback', path='/feedback')
|
|
||||||
feedback.add_view('POST', 'feedback', klass=cls,
|
|
||||||
permission='common.feedback')
|
|
||||||
config.add_cornice_service(feedback)
|
|
||||||
|
|
||||||
# swagger
|
|
||||||
swagger = Service(name='swagger',
|
|
||||||
path='/swagger.json',
|
|
||||||
description=f"OpenAPI documentation for {app.get_title()}")
|
|
||||||
swagger.add_view('GET', 'swagger', klass=cls,
|
|
||||||
permission='common.api_swagger')
|
|
||||||
config.add_cornice_service(swagger)
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
CommonView = kwargs.get('CommonView', base['CommonView'])
|
|
||||||
CommonView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,125 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Core Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from tailbone.views import View
|
|
||||||
|
|
||||||
|
|
||||||
def api(view_meth):
|
|
||||||
"""
|
|
||||||
Common decorator for all API views. Ideally this would not be needed..but
|
|
||||||
for now, alas, it is.
|
|
||||||
"""
|
|
||||||
def wrapped(view, *args, **kwargs):
|
|
||||||
|
|
||||||
# TODO: why doesn't this work here...? (instead we have to repeat this
|
|
||||||
# code in lots of other places)
|
|
||||||
# if view.request.method == 'OPTIONS':
|
|
||||||
# return view.request.response
|
|
||||||
|
|
||||||
# invoke the view logic first, since presumably it may involve a
|
|
||||||
# redirect in which case we don't really need to add the CSRF token.
|
|
||||||
# main known use case for this is the /logout endpoint - if that gets
|
|
||||||
# hit then the "current" (old) session will be destroyed, in which case
|
|
||||||
# we can't use the token from that, but instead must generate a new one.
|
|
||||||
result = view_meth(view, *args, **kwargs)
|
|
||||||
|
|
||||||
# explicitly set CSRF token cookie, unless OPTIONS request
|
|
||||||
# TODO: why doesn't pyramid do this for us again?
|
|
||||||
if view.request.method != 'OPTIONS':
|
|
||||||
view.request.response.set_cookie(name='XSRF-TOKEN',
|
|
||||||
value=view.request.session.get_csrf_token())
|
|
||||||
|
|
||||||
return result
|
|
||||||
|
|
||||||
return wrapped
|
|
||||||
|
|
||||||
|
|
||||||
class APIView(View):
|
|
||||||
"""
|
|
||||||
Base class for all API views.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def pretty_datetime(self, dt):
|
|
||||||
if not dt:
|
|
||||||
return ""
|
|
||||||
return dt.strftime('%Y-%m-%d @ %I:%M %p')
|
|
||||||
|
|
||||||
def get_user_info(self, user):
|
|
||||||
"""
|
|
||||||
This method is present on *all* API views, and is meant to provide a
|
|
||||||
single means of obtaining "common" user info, for return to the caller.
|
|
||||||
Such info may be returned in several places, e.g. upon login but also
|
|
||||||
in the "check session" call, or e.g. as part of a broader return value
|
|
||||||
from any other call.
|
|
||||||
|
|
||||||
:returns: Dictionary of user info data, ready for JSON serialization.
|
|
||||||
|
|
||||||
Note that you should *not* (usually) override this method in any view,
|
|
||||||
but instead configure a "supplemental" function which can then add or
|
|
||||||
replace info entries. Config for that looks like e.g.:
|
|
||||||
|
|
||||||
.. code-block:: ini
|
|
||||||
|
|
||||||
[tailbone.api]
|
|
||||||
extra_user_info = poser.web.api.util:extra_user_info
|
|
||||||
|
|
||||||
Note that the above config assumes a simple *function* defined in your
|
|
||||||
``util`` module; such a function would look like e.g.::
|
|
||||||
|
|
||||||
def extra_user_info(request, user, **info):
|
|
||||||
# add favorite color
|
|
||||||
info['favorite_color'] = 'green'
|
|
||||||
# override display name
|
|
||||||
info['display_name'] = "TODO"
|
|
||||||
# remove short_name
|
|
||||||
info.pop('short_name', None)
|
|
||||||
return info
|
|
||||||
"""
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
auth = app.get_auth_handler()
|
|
||||||
|
|
||||||
# basic / default info
|
|
||||||
is_admin = auth.user_is_admin(user)
|
|
||||||
employee = app.get_employee(user)
|
|
||||||
info = {
|
|
||||||
'uuid': user.uuid,
|
|
||||||
'username': user.username,
|
|
||||||
'display_name': user.display_name,
|
|
||||||
'short_name': auth.get_short_display_name(user),
|
|
||||||
'is_admin': is_admin,
|
|
||||||
'is_root': is_admin and self.request.session.get('is_root', False),
|
|
||||||
'employee_uuid': employee.uuid if employee else None,
|
|
||||||
'email_address': app.get_contact_email_address(user),
|
|
||||||
}
|
|
||||||
|
|
||||||
# maybe get/use "extra" info
|
|
||||||
extra = self.rattail_config.get('tailbone.api', 'extra_user_info',
|
|
||||||
usedb=False)
|
|
||||||
if extra:
|
|
||||||
extra = app.load_object(extra)
|
|
||||||
info = extra(self.request, user, **info)
|
|
||||||
|
|
||||||
return info
|
|
|
@ -1,60 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Customer Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
class CustomerView(APIMasterView):
|
|
||||||
"""
|
|
||||||
API views for Customer data
|
|
||||||
"""
|
|
||||||
model_class = model.Customer
|
|
||||||
collection_url_prefix = '/customers'
|
|
||||||
object_url_prefix = '/customer'
|
|
||||||
supports_autocomplete = True
|
|
||||||
autocomplete_fieldname = 'name'
|
|
||||||
|
|
||||||
def normalize(self, customer):
|
|
||||||
return {
|
|
||||||
'uuid': customer.uuid,
|
|
||||||
'_str': str(customer),
|
|
||||||
'id': customer.id,
|
|
||||||
'number': customer.number,
|
|
||||||
'name': customer.name,
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
CustomerView = kwargs.get('CustomerView', base['CustomerView'])
|
|
||||||
CustomerView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,36 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Essential views for convenient includes
|
|
||||||
"""
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
mod = lambda spec: kwargs.get(spec, spec)
|
|
||||||
|
|
||||||
config.include(mod('tailbone.api.auth'))
|
|
||||||
config.include(mod('tailbone.api.common'))
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,618 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Master View
|
|
||||||
"""
|
|
||||||
|
|
||||||
import json
|
|
||||||
|
|
||||||
from rattail.db.util import get_fieldnames
|
|
||||||
|
|
||||||
from cornice import resource, Service
|
|
||||||
|
|
||||||
from tailbone.api import APIView
|
|
||||||
from tailbone.db import Session
|
|
||||||
from tailbone.util import SortColumn
|
|
||||||
|
|
||||||
|
|
||||||
class APIMasterView(APIView):
|
|
||||||
"""
|
|
||||||
Base class for data model REST API views.
|
|
||||||
"""
|
|
||||||
listable = True
|
|
||||||
creatable = True
|
|
||||||
viewable = True
|
|
||||||
editable = True
|
|
||||||
deletable = True
|
|
||||||
supports_autocomplete = False
|
|
||||||
supports_download = False
|
|
||||||
supports_rawbytes = False
|
|
||||||
|
|
||||||
@property
|
|
||||||
def Session(self):
|
|
||||||
return Session
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_model_class(cls):
|
|
||||||
if hasattr(cls, 'model_class'):
|
|
||||||
return cls.model_class
|
|
||||||
raise NotImplementedError("must set `model_class` for {}".format(cls.__name__))
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_normalized_model_name(cls):
|
|
||||||
if hasattr(cls, 'normalized_model_name'):
|
|
||||||
return cls.normalized_model_name
|
|
||||||
return cls.get_model_class().__name__.lower()
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_route_prefix(cls):
|
|
||||||
"""
|
|
||||||
Returns a prefix which (by default) applies to all routes provided by
|
|
||||||
this view class.
|
|
||||||
"""
|
|
||||||
prefix = getattr(cls, 'route_prefix', None)
|
|
||||||
if prefix:
|
|
||||||
return prefix
|
|
||||||
model_name = cls.get_normalized_model_name()
|
|
||||||
return '{}s'.format(model_name)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_permission_prefix(cls):
|
|
||||||
"""
|
|
||||||
Returns a prefix which (by default) applies to all permissions
|
|
||||||
leveraged by this view class.
|
|
||||||
"""
|
|
||||||
prefix = getattr(cls, 'permission_prefix', None)
|
|
||||||
if prefix:
|
|
||||||
return prefix
|
|
||||||
return cls.get_route_prefix()
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_collection_url_prefix(cls):
|
|
||||||
"""
|
|
||||||
Returns a prefix which (by default) applies to all "collection" URLs
|
|
||||||
provided by this view class.
|
|
||||||
"""
|
|
||||||
prefix = getattr(cls, 'collection_url_prefix', None)
|
|
||||||
if prefix:
|
|
||||||
return prefix
|
|
||||||
return '/{}'.format(cls.get_route_prefix())
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_object_url_prefix(cls):
|
|
||||||
"""
|
|
||||||
Returns a prefix which (by default) applies to all "object" URLs
|
|
||||||
provided by this view class.
|
|
||||||
"""
|
|
||||||
prefix = getattr(cls, 'object_url_prefix', None)
|
|
||||||
if prefix:
|
|
||||||
return prefix
|
|
||||||
return '/{}'.format(cls.get_route_prefix())
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_object_key(cls):
|
|
||||||
if hasattr(cls, 'object_key'):
|
|
||||||
return cls.object_key
|
|
||||||
return cls.get_normalized_model_name()
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def get_collection_key(cls):
|
|
||||||
if hasattr(cls, 'collection_key'):
|
|
||||||
return cls.collection_key
|
|
||||||
return '{}s'.format(cls.get_object_key())
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def establish_method(cls, method_name):
|
|
||||||
"""
|
|
||||||
Establish the given HTTP method for this Cornice Resource.
|
|
||||||
|
|
||||||
Cornice will auto-register any class methods for a resource, if they
|
|
||||||
are named according to what it expects (i.e. 'get', 'collection_get'
|
|
||||||
etc.). Tailbone API tries to make things automagical for the sake of
|
|
||||||
e.g. Poser logic, but in this case if we predefine all of these methods
|
|
||||||
and then some subclass view wants to *not* allow one, it's not clear
|
|
||||||
how to "undefine" it per se. Or at least, the more straightforward
|
|
||||||
thing (I think) is to not define such a method in the first place, if
|
|
||||||
it was not wanted.
|
|
||||||
|
|
||||||
Enter ``establish_method()``, which is what finally "defines" each
|
|
||||||
resource method according to what the subclass has declared via its
|
|
||||||
various attributes (:attr:`creatable`, :attr:`deletable` etc.).
|
|
||||||
|
|
||||||
Note that you will not likely have any need to use this
|
|
||||||
``establish_method()`` yourself! But we describe its purpose here, for
|
|
||||||
clarity.
|
|
||||||
"""
|
|
||||||
def method(self):
|
|
||||||
internal_method = getattr(self, '_{}'.format(method_name))
|
|
||||||
return internal_method()
|
|
||||||
|
|
||||||
setattr(cls, method_name, method)
|
|
||||||
|
|
||||||
def make_filter_spec(self):
|
|
||||||
if not self.request.GET.has_key('filters'):
|
|
||||||
return []
|
|
||||||
|
|
||||||
filters = json.loads(self.request.GET.getone('filters'))
|
|
||||||
return filters
|
|
||||||
|
|
||||||
def make_sort_spec(self):
|
|
||||||
|
|
||||||
# we prefer a "native sort"
|
|
||||||
if self.request.GET.has_key('nativeSort'):
|
|
||||||
return json.loads(self.request.GET.getone('nativeSort'))
|
|
||||||
|
|
||||||
# these params are based on 'vuetable-2'
|
|
||||||
# https://www.vuetable.com/guide/sorting.html#initial-sorting-order
|
|
||||||
if 'sort' in self.request.params:
|
|
||||||
sort = self.request.params['sort']
|
|
||||||
sortkey, sortdir = sort.split('|')
|
|
||||||
if sortdir != 'desc':
|
|
||||||
sortdir = 'asc'
|
|
||||||
return [
|
|
||||||
{
|
|
||||||
# 'model': self.model_class.__name__,
|
|
||||||
'field': sortkey,
|
|
||||||
'direction': sortdir,
|
|
||||||
},
|
|
||||||
]
|
|
||||||
|
|
||||||
# these params are based on 'vue-tables-2'
|
|
||||||
# https://github.com/matfish2/vue-tables-2#server-side
|
|
||||||
if 'orderBy' in self.request.params and 'ascending' in self.request.params:
|
|
||||||
sortcol = self.interpret_sortcol(self.request.params['orderBy'])
|
|
||||||
if sortcol:
|
|
||||||
spec = {
|
|
||||||
'field': sortcol.field_name,
|
|
||||||
'direction': 'asc' if self.config.parse_bool(self.request.params['ascending']) else 'desc',
|
|
||||||
}
|
|
||||||
if sortcol.model_name:
|
|
||||||
spec['model'] = sortcol.model_name
|
|
||||||
return [spec]
|
|
||||||
|
|
||||||
def interpret_sortcol(self, order_by):
|
|
||||||
"""
|
|
||||||
This must return a ``SortColumn`` object based on parsing of the given
|
|
||||||
``order_by`` string, which is "raw" as received from the client.
|
|
||||||
|
|
||||||
Please override as necessary, but in all cases you should invoke
|
|
||||||
:meth:`sortcol()` to obtain your return value. Default behavior
|
|
||||||
for this method is to simply do (only) that::
|
|
||||||
|
|
||||||
return self.sortcol(order_by)
|
|
||||||
|
|
||||||
Note that you can also return ``None`` here, if the given ``order_by``
|
|
||||||
string does not represent a valid sort.
|
|
||||||
"""
|
|
||||||
return self.sortcol(order_by)
|
|
||||||
|
|
||||||
def sortcol(self, field_name, model_name=None):
|
|
||||||
"""
|
|
||||||
Return a simple ``SortColumn`` object which denotes the field and
|
|
||||||
optionally, the model, to be used when sorting.
|
|
||||||
"""
|
|
||||||
if not model_name:
|
|
||||||
model_name = self.model_class.__name__
|
|
||||||
return SortColumn(field_name, model_name)
|
|
||||||
|
|
||||||
def join_for_sort_spec(self, query, sort_spec):
|
|
||||||
"""
|
|
||||||
This should apply any joins needed on the given query, to accommodate
|
|
||||||
requested sorting as per ``sort_spec`` - which will be non-empty but
|
|
||||||
otherwise no claims are made regarding its contents.
|
|
||||||
|
|
||||||
Please override as necessary, but in all cases you should return a
|
|
||||||
query, either untouched or else with join(s) applied.
|
|
||||||
"""
|
|
||||||
model_name = sort_spec[0].get('model')
|
|
||||||
return self.join_for_sort_model(query, model_name)
|
|
||||||
|
|
||||||
def join_for_sort_model(self, query, model_name):
|
|
||||||
"""
|
|
||||||
This should apply any joins needed on the given query, to accommodate
|
|
||||||
requested sorting on a field associated with the given model.
|
|
||||||
|
|
||||||
Please override as necessary, but in all cases you should return a
|
|
||||||
query, either untouched or else with join(s) applied.
|
|
||||||
"""
|
|
||||||
return query
|
|
||||||
|
|
||||||
def make_pagination_spec(self):
|
|
||||||
|
|
||||||
# these params are based on 'vuetable-2'
|
|
||||||
# https://github.com/ratiw/vuetable-2-tutorial/wiki/prerequisite#sample-api-endpoint
|
|
||||||
if 'page' in self.request.params and 'per_page' in self.request.params:
|
|
||||||
page = self.request.params['page']
|
|
||||||
per_page = self.request.params['per_page']
|
|
||||||
if page.isdigit() and per_page.isdigit():
|
|
||||||
return int(page), int(per_page)
|
|
||||||
|
|
||||||
# these params are based on 'vue-tables-2'
|
|
||||||
# https://github.com/matfish2/vue-tables-2#server-side
|
|
||||||
if 'page' in self.request.params and 'limit' in self.request.params:
|
|
||||||
page = self.request.params['page']
|
|
||||||
limit = self.request.params['limit']
|
|
||||||
if page.isdigit() and limit.isdigit():
|
|
||||||
return int(page), int(limit)
|
|
||||||
|
|
||||||
def base_query(self):
|
|
||||||
cls = self.get_model_class()
|
|
||||||
query = self.Session.query(cls)
|
|
||||||
return query
|
|
||||||
|
|
||||||
def get_fieldnames(self):
|
|
||||||
if not hasattr(self, '_fieldnames'):
|
|
||||||
self._fieldnames = get_fieldnames(
|
|
||||||
self.rattail_config, self.model_class,
|
|
||||||
columns=True, proxies=True, relations=False)
|
|
||||||
return self._fieldnames
|
|
||||||
|
|
||||||
def normalize(self, obj):
|
|
||||||
data = {'_str': str(obj)}
|
|
||||||
|
|
||||||
for field in self.get_fieldnames():
|
|
||||||
data[field] = getattr(obj, field)
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
def _collection_get(self):
|
|
||||||
from sa_filters import apply_filters, apply_sort, apply_pagination
|
|
||||||
|
|
||||||
query = self.base_query()
|
|
||||||
context = {}
|
|
||||||
|
|
||||||
# maybe filter query
|
|
||||||
filter_spec = self.make_filter_spec()
|
|
||||||
if filter_spec:
|
|
||||||
query = apply_filters(query, filter_spec)
|
|
||||||
|
|
||||||
# maybe sort query
|
|
||||||
sort_spec = self.make_sort_spec()
|
|
||||||
if sort_spec:
|
|
||||||
query = self.join_for_sort_spec(query, sort_spec)
|
|
||||||
query = apply_sort(query, sort_spec)
|
|
||||||
|
|
||||||
# maybe paginate query
|
|
||||||
pagination_spec = self.make_pagination_spec()
|
|
||||||
if pagination_spec:
|
|
||||||
number, size = pagination_spec
|
|
||||||
query, pagination = apply_pagination(query, page_number=number, page_size=size)
|
|
||||||
|
|
||||||
# these properties are based on 'vuetable-2'
|
|
||||||
# https://www.vuetable.com/guide/pagination.html#how-the-pagination-component-works
|
|
||||||
context['total'] = pagination.total_results
|
|
||||||
context['per_page'] = pagination.page_size
|
|
||||||
context['current_page'] = pagination.page_number
|
|
||||||
context['last_page'] = pagination.num_pages
|
|
||||||
context['from'] = pagination.page_size * (pagination.page_number - 1) + 1
|
|
||||||
to = pagination.page_size * (pagination.page_number - 1) + pagination.page_size
|
|
||||||
if to > pagination.total_results:
|
|
||||||
context['to'] = pagination.total_results
|
|
||||||
else:
|
|
||||||
context['to'] = to
|
|
||||||
|
|
||||||
# these properties are based on 'vue-tables-2'
|
|
||||||
# https://github.com/matfish2/vue-tables-2#server-side
|
|
||||||
context['count'] = pagination.total_results
|
|
||||||
|
|
||||||
objects = [self.normalize(obj) for obj in query]
|
|
||||||
|
|
||||||
# TODO: test this for ratbob!
|
|
||||||
context[self.get_collection_key()] = objects
|
|
||||||
|
|
||||||
# these properties are based on 'vue-tables-2'
|
|
||||||
# https://github.com/matfish2/vue-tables-2#server-side
|
|
||||||
context['data'] = objects
|
|
||||||
if 'count' not in context:
|
|
||||||
context['count'] = len(objects)
|
|
||||||
|
|
||||||
return context
|
|
||||||
|
|
||||||
def get_object(self, uuid=None):
|
|
||||||
if not uuid:
|
|
||||||
uuid = self.request.matchdict['uuid']
|
|
||||||
|
|
||||||
obj = self.Session.get(self.get_model_class(), uuid)
|
|
||||||
if obj:
|
|
||||||
return obj
|
|
||||||
|
|
||||||
raise self.notfound()
|
|
||||||
|
|
||||||
def _get(self, obj=None, uuid=None):
|
|
||||||
if not obj:
|
|
||||||
obj = self.get_object(uuid=uuid)
|
|
||||||
key = self.get_object_key()
|
|
||||||
normal = self.normalize(obj)
|
|
||||||
return {key: normal, 'data': normal}
|
|
||||||
|
|
||||||
def _collection_post(self):
|
|
||||||
"""
|
|
||||||
Default method for actually processing a POST request for the
|
|
||||||
collection, aka. "create new object".
|
|
||||||
"""
|
|
||||||
# assume our data comes only from request JSON body
|
|
||||||
data = self.request.json_body
|
|
||||||
|
|
||||||
# add instance to session, and return data for it
|
|
||||||
try:
|
|
||||||
obj = self.create_object(data)
|
|
||||||
except Exception as error:
|
|
||||||
return self.json_response({'error': str(error)})
|
|
||||||
else:
|
|
||||||
self.Session.flush()
|
|
||||||
return self._get(obj)
|
|
||||||
|
|
||||||
def create_object(self, data):
|
|
||||||
"""
|
|
||||||
Create a new object instance and populate it with the given data.
|
|
||||||
|
|
||||||
Note that this method by default will only populate *simple* fields, so
|
|
||||||
you may need to subclass and override to add more complex field logic.
|
|
||||||
"""
|
|
||||||
# create new instance of model class
|
|
||||||
cls = self.get_model_class()
|
|
||||||
obj = cls()
|
|
||||||
|
|
||||||
# "update" new object with given data
|
|
||||||
obj = self.update_object(obj, data)
|
|
||||||
|
|
||||||
# that's all we can do here, subclass must override if more needed
|
|
||||||
self.Session.add(obj)
|
|
||||||
return obj
|
|
||||||
|
|
||||||
def _post(self, uuid=None):
|
|
||||||
"""
|
|
||||||
Default method for actually processing a POST request for an object,
|
|
||||||
aka. "update existing object".
|
|
||||||
"""
|
|
||||||
if not uuid:
|
|
||||||
uuid = self.request.matchdict['uuid']
|
|
||||||
obj = self.Session.get(self.get_model_class(), uuid)
|
|
||||||
if not obj:
|
|
||||||
raise self.notfound()
|
|
||||||
|
|
||||||
# assume our data comes only from request JSON body
|
|
||||||
data = self.request.json_body
|
|
||||||
|
|
||||||
# try to update data for object, returning error as necessary
|
|
||||||
obj = self.update_object(obj, data)
|
|
||||||
if isinstance(obj, dict) and 'error' in obj:
|
|
||||||
return {'error': obj['error']}
|
|
||||||
|
|
||||||
# return data for object
|
|
||||||
self.Session.flush()
|
|
||||||
return self._get(obj)
|
|
||||||
|
|
||||||
def update_object(self, obj, data):
|
|
||||||
"""
|
|
||||||
Update the given object instance with the given data.
|
|
||||||
|
|
||||||
Note that this method by default will only update *simple* fields, so
|
|
||||||
you may need to subclass and override to add more complex field logic.
|
|
||||||
"""
|
|
||||||
# set values for simple fields only
|
|
||||||
for key, value in data.items():
|
|
||||||
if hasattr(obj, key):
|
|
||||||
# TODO: what about datetime, decimal etc.?
|
|
||||||
setattr(obj, key, value)
|
|
||||||
|
|
||||||
# that's all we can do here, subclass must override if more needed
|
|
||||||
return obj
|
|
||||||
|
|
||||||
##############################
|
|
||||||
# delete
|
|
||||||
##############################
|
|
||||||
|
|
||||||
def _delete(self):
|
|
||||||
"""
|
|
||||||
View to handle DELETE action for an existing record/object.
|
|
||||||
"""
|
|
||||||
obj = self.get_object()
|
|
||||||
self.delete_object(obj)
|
|
||||||
|
|
||||||
def delete_object(self, obj):
|
|
||||||
"""
|
|
||||||
Delete the object, or mark it as deleted, or whatever you need to do.
|
|
||||||
"""
|
|
||||||
# flush immediately to force any pending integrity errors etc.
|
|
||||||
self.Session.delete(obj)
|
|
||||||
self.Session.flush()
|
|
||||||
|
|
||||||
##############################
|
|
||||||
# download
|
|
||||||
##############################
|
|
||||||
|
|
||||||
def download(self):
|
|
||||||
"""
|
|
||||||
GET view allowing for download of a single file, which is attached to a
|
|
||||||
given record.
|
|
||||||
"""
|
|
||||||
obj = self.get_object()
|
|
||||||
|
|
||||||
filename = self.request.GET.get('filename', None)
|
|
||||||
if not filename:
|
|
||||||
raise self.notfound()
|
|
||||||
path = self.download_path(obj, filename)
|
|
||||||
|
|
||||||
response = self.file_response(path)
|
|
||||||
return response
|
|
||||||
|
|
||||||
def download_path(self, obj, filename):
|
|
||||||
"""
|
|
||||||
Should return absolute path on disk, for the given object and filename.
|
|
||||||
Result will be used to return a file response to client.
|
|
||||||
"""
|
|
||||||
raise NotImplementedError
|
|
||||||
|
|
||||||
def rawbytes(self):
|
|
||||||
"""
|
|
||||||
GET view allowing for direct access to the raw bytes of a file, which
|
|
||||||
is attached to a given record. Basically the same as 'download' except
|
|
||||||
this does not come as an attachment.
|
|
||||||
"""
|
|
||||||
obj = self.get_object()
|
|
||||||
|
|
||||||
# TODO: is this really needed?
|
|
||||||
# filename = self.request.GET.get('filename', None)
|
|
||||||
# if filename:
|
|
||||||
# path = self.download_path(obj, filename)
|
|
||||||
# return self.file_response(path, attachment=False)
|
|
||||||
|
|
||||||
return self.rawbytes_response(obj)
|
|
||||||
|
|
||||||
def rawbytes_response(self, obj):
|
|
||||||
raise NotImplementedError
|
|
||||||
|
|
||||||
##############################
|
|
||||||
# autocomplete
|
|
||||||
##############################
|
|
||||||
|
|
||||||
def autocomplete(self):
|
|
||||||
"""
|
|
||||||
View which accepts a single ``term`` param, and returns a list of
|
|
||||||
autocomplete results to match.
|
|
||||||
"""
|
|
||||||
term = self.request.params.get('term', '').strip()
|
|
||||||
term = self.prepare_autocomplete_term(term)
|
|
||||||
if not term:
|
|
||||||
return []
|
|
||||||
|
|
||||||
results = self.get_autocomplete_data(term)
|
|
||||||
return [{'label': self.autocomplete_display(x),
|
|
||||||
'value': self.autocomplete_value(x)}
|
|
||||||
for x in results]
|
|
||||||
|
|
||||||
@property
|
|
||||||
def autocomplete_fieldname(self):
|
|
||||||
raise NotImplementedError("You must define `autocomplete_fieldname` "
|
|
||||||
"attribute for API view class: {}".format(
|
|
||||||
self.__class__))
|
|
||||||
|
|
||||||
def autocomplete_display(self, obj):
|
|
||||||
return getattr(obj, self.autocomplete_fieldname)
|
|
||||||
|
|
||||||
def autocomplete_value(self, obj):
|
|
||||||
return obj.uuid
|
|
||||||
|
|
||||||
def get_autocomplete_data(self, term):
|
|
||||||
query = self.make_autocomplete_query(term)
|
|
||||||
return query.all()
|
|
||||||
|
|
||||||
def make_autocomplete_query(self, term):
|
|
||||||
model_class = self.get_model_class()
|
|
||||||
query = self.Session.query(model_class)
|
|
||||||
query = self.filter_autocomplete_query(query)
|
|
||||||
|
|
||||||
field = getattr(model_class, self.autocomplete_fieldname)
|
|
||||||
query = query.filter(field.ilike('%%%s%%' % term))\
|
|
||||||
.order_by(field)
|
|
||||||
|
|
||||||
return query
|
|
||||||
|
|
||||||
def filter_autocomplete_query(self, query):
|
|
||||||
return query
|
|
||||||
|
|
||||||
def prepare_autocomplete_term(self, term):
|
|
||||||
"""
|
|
||||||
If necessary, massage the incoming search term for use with the
|
|
||||||
autocomplete query.
|
|
||||||
"""
|
|
||||||
return term
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
collection_url_prefix = cls.get_collection_url_prefix()
|
|
||||||
object_url_prefix = cls.get_object_url_prefix()
|
|
||||||
|
|
||||||
# first, the primary resource API
|
|
||||||
|
|
||||||
# list/search
|
|
||||||
if cls.listable:
|
|
||||||
cls.establish_method('collection_get')
|
|
||||||
resource.add_view(cls.collection_get, permission='{}.list'.format(permission_prefix))
|
|
||||||
|
|
||||||
# create
|
|
||||||
if cls.creatable:
|
|
||||||
cls.establish_method('collection_post')
|
|
||||||
if hasattr(cls, 'permission_to_create'):
|
|
||||||
permission = cls.permission_to_create
|
|
||||||
else:
|
|
||||||
permission = '{}.create'.format(permission_prefix)
|
|
||||||
resource.add_view(cls.collection_post, permission=permission)
|
|
||||||
|
|
||||||
# view
|
|
||||||
if cls.viewable:
|
|
||||||
cls.establish_method('get')
|
|
||||||
resource.add_view(cls.get, permission='{}.view'.format(permission_prefix))
|
|
||||||
|
|
||||||
# edit
|
|
||||||
if cls.editable:
|
|
||||||
cls.establish_method('post')
|
|
||||||
resource.add_view(cls.post, permission='{}.edit'.format(permission_prefix))
|
|
||||||
|
|
||||||
# delete
|
|
||||||
if cls.deletable:
|
|
||||||
cls.establish_method('delete')
|
|
||||||
resource.add_view(cls.delete, permission='{}.delete'.format(permission_prefix))
|
|
||||||
|
|
||||||
# register primary resource API via cornice
|
|
||||||
object_resource = resource.add_resource(
|
|
||||||
cls,
|
|
||||||
collection_path=collection_url_prefix,
|
|
||||||
# TODO: probably should allow for other (composite?) key fields
|
|
||||||
path='{}/{{uuid}}'.format(object_url_prefix))
|
|
||||||
config.add_cornice_resource(object_resource)
|
|
||||||
|
|
||||||
# now for some more "custom" things, which are still somewhat generic
|
|
||||||
|
|
||||||
# autocomplete
|
|
||||||
if cls.supports_autocomplete:
|
|
||||||
autocomplete = Service(name='{}.autocomplete'.format(route_prefix),
|
|
||||||
path='{}/autocomplete'.format(collection_url_prefix))
|
|
||||||
autocomplete.add_view('GET', 'autocomplete', klass=cls,
|
|
||||||
permission='{}.list'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(autocomplete)
|
|
||||||
|
|
||||||
# download
|
|
||||||
if cls.supports_download:
|
|
||||||
download = Service(name='{}.download'.format(route_prefix),
|
|
||||||
# TODO: probably should allow for other (composite?) key fields
|
|
||||||
path='{}/{{uuid}}/download'.format(object_url_prefix))
|
|
||||||
download.add_view('GET', 'download', klass=cls,
|
|
||||||
permission='{}.download'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(download)
|
|
||||||
|
|
||||||
# rawbytes
|
|
||||||
if cls.supports_rawbytes:
|
|
||||||
rawbytes = Service(name='{}.rawbytes'.format(route_prefix),
|
|
||||||
# TODO: probably should allow for other (composite?) key fields
|
|
||||||
path='{}/{{uuid}}/rawbytes'.format(object_url_prefix))
|
|
||||||
rawbytes.add_view('GET', 'rawbytes', klass=cls,
|
|
||||||
permission='{}.download'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(rawbytes)
|
|
|
@ -1,43 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2022 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Master View (v2)
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import warnings
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
class APIMasterView2(APIMasterView):
|
|
||||||
"""
|
|
||||||
Base class for data model REST API views.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, request, context=None):
|
|
||||||
warnings.warn("APIMasterView2 class is deprecated; please use "
|
|
||||||
"APIMasterView instead",
|
|
||||||
DeprecationWarning, stacklevel=2)
|
|
||||||
super(APIMasterView2, self).__init__(request, context=context)
|
|
|
@ -1,59 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Person Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
class PersonView(APIMasterView):
|
|
||||||
"""
|
|
||||||
API views for Person data
|
|
||||||
"""
|
|
||||||
model_class = model.Person
|
|
||||||
permission_prefix = 'people'
|
|
||||||
collection_url_prefix = '/people'
|
|
||||||
object_url_prefix = '/person'
|
|
||||||
|
|
||||||
def normalize(self, person):
|
|
||||||
return {
|
|
||||||
'uuid': person.uuid,
|
|
||||||
'_str': str(person),
|
|
||||||
'first_name': person.first_name,
|
|
||||||
'last_name': person.last_name,
|
|
||||||
'display_name': person.display_name,
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
PersonView = kwargs.get('PersonView', base['PersonView'])
|
|
||||||
PersonView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,220 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Product Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
import logging
|
|
||||||
|
|
||||||
import sqlalchemy as sa
|
|
||||||
from sqlalchemy import orm
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class ProductView(APIMasterView):
|
|
||||||
"""
|
|
||||||
API views for Product data
|
|
||||||
"""
|
|
||||||
model_class = model.Product
|
|
||||||
collection_url_prefix = '/products'
|
|
||||||
object_url_prefix = '/product'
|
|
||||||
supports_autocomplete = True
|
|
||||||
|
|
||||||
def __init__(self, request, context=None):
|
|
||||||
super(ProductView, self).__init__(request, context=context)
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
self.products_handler = app.get_products_handler()
|
|
||||||
|
|
||||||
def normalize(self, product):
|
|
||||||
|
|
||||||
# get what we can from handler
|
|
||||||
data = self.products_handler.normalize_product(product, fields=[
|
|
||||||
'brand_name',
|
|
||||||
'full_description',
|
|
||||||
'department_name',
|
|
||||||
'unit_price_display',
|
|
||||||
'sale_price',
|
|
||||||
'sale_price_display',
|
|
||||||
'sale_ends',
|
|
||||||
'sale_ends_display',
|
|
||||||
'tpr_price',
|
|
||||||
'tpr_price_display',
|
|
||||||
'tpr_ends',
|
|
||||||
'tpr_ends_display',
|
|
||||||
'current_price',
|
|
||||||
'current_price_display',
|
|
||||||
'current_ends',
|
|
||||||
'current_ends_display',
|
|
||||||
'vendor_name',
|
|
||||||
'costs',
|
|
||||||
'image_url',
|
|
||||||
])
|
|
||||||
|
|
||||||
# but must supplement
|
|
||||||
cost = product.cost
|
|
||||||
data.update({
|
|
||||||
'upc': str(product.upc),
|
|
||||||
'scancode': product.scancode,
|
|
||||||
'item_id': product.item_id,
|
|
||||||
'item_type': product.item_type,
|
|
||||||
'status_code': product.status_code,
|
|
||||||
'default_unit_cost': cost.unit_cost if cost else None,
|
|
||||||
'default_unit_cost_display': "${:0.2f}".format(cost.unit_cost) if cost and cost.unit_cost is not None else None,
|
|
||||||
})
|
|
||||||
|
|
||||||
return data
|
|
||||||
|
|
||||||
def make_autocomplete_query(self, term):
|
|
||||||
query = self.Session.query(model.Product)\
|
|
||||||
.outerjoin(model.Brand)\
|
|
||||||
.filter(sa.or_(
|
|
||||||
model.Brand.name.ilike('%{}%'.format(term)),
|
|
||||||
model.Product.description.ilike('%{}%'.format(term))))
|
|
||||||
|
|
||||||
if not self.request.has_perm('products.view_deleted'):
|
|
||||||
query = query.filter(model.Product.deleted == False)
|
|
||||||
|
|
||||||
query = query.order_by(model.Brand.name,
|
|
||||||
model.Product.description)\
|
|
||||||
.options(orm.joinedload(model.Product.brand))
|
|
||||||
return query
|
|
||||||
|
|
||||||
def autocomplete_display(self, product):
|
|
||||||
return product.full_description
|
|
||||||
|
|
||||||
def quick_lookup(self):
|
|
||||||
"""
|
|
||||||
View for handling "quick lookup" user input, for index page.
|
|
||||||
"""
|
|
||||||
data = self.request.GET
|
|
||||||
entry = data['entry']
|
|
||||||
|
|
||||||
product = self.products_handler.locate_product_for_entry(self.Session(),
|
|
||||||
entry)
|
|
||||||
if not product:
|
|
||||||
return {'error': "Product not found"}
|
|
||||||
|
|
||||||
return {'ok': True,
|
|
||||||
'product': self.normalize(product)}
|
|
||||||
|
|
||||||
def label_profiles(self):
|
|
||||||
"""
|
|
||||||
Returns the set of label profiles available for use with
|
|
||||||
printing label for product.
|
|
||||||
"""
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
label_handler = app.get_label_handler()
|
|
||||||
model = self.model
|
|
||||||
|
|
||||||
profiles = []
|
|
||||||
for profile in label_handler.get_label_profiles(self.Session()):
|
|
||||||
profiles.append({
|
|
||||||
'uuid': profile.uuid,
|
|
||||||
'description': profile.description,
|
|
||||||
})
|
|
||||||
|
|
||||||
return {'label_profiles': profiles}
|
|
||||||
|
|
||||||
def print_labels(self):
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
label_handler = app.get_label_handler()
|
|
||||||
model = self.model
|
|
||||||
data = self.request.json_body
|
|
||||||
|
|
||||||
uuid = data.get('label_profile_uuid')
|
|
||||||
profile = self.Session.get(model.LabelProfile, uuid) if uuid else None
|
|
||||||
if not profile:
|
|
||||||
return {'error': "Label profile not found"}
|
|
||||||
|
|
||||||
uuid = data.get('product_uuid')
|
|
||||||
product = self.Session.get(model.Product, uuid) if uuid else None
|
|
||||||
if not product:
|
|
||||||
return {'error': "Product not found"}
|
|
||||||
|
|
||||||
try:
|
|
||||||
quantity = int(data.get('quantity'))
|
|
||||||
except:
|
|
||||||
return {'error': "Quantity must be integer"}
|
|
||||||
|
|
||||||
printer = label_handler.get_printer(profile)
|
|
||||||
if not printer:
|
|
||||||
return {'error': "Couldn't get printer from label profile"}
|
|
||||||
|
|
||||||
try:
|
|
||||||
printer.print_labels([({'product': product}, quantity)])
|
|
||||||
except Exception as error:
|
|
||||||
log.warning("error occurred while printing labels", exc_info=True)
|
|
||||||
return {'error': str(error)}
|
|
||||||
|
|
||||||
return {'ok': True}
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._product_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _product_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
collection_url_prefix = cls.get_collection_url_prefix()
|
|
||||||
|
|
||||||
# quick lookup
|
|
||||||
quick_lookup = Service(name='{}.quick_lookup'.format(route_prefix),
|
|
||||||
path='{}/quick-lookup'.format(collection_url_prefix))
|
|
||||||
quick_lookup.add_view('GET', 'quick_lookup', klass=cls,
|
|
||||||
permission='{}.list'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(quick_lookup)
|
|
||||||
|
|
||||||
# label profiles
|
|
||||||
label_profiles = Service(name=f'{route_prefix}.label_profiles',
|
|
||||||
path=f'{collection_url_prefix}/label-profiles')
|
|
||||||
label_profiles.add_view('GET', 'label_profiles', klass=cls,
|
|
||||||
permission=f'{permission_prefix}.print_labels')
|
|
||||||
config.add_cornice_service(label_profiles)
|
|
||||||
|
|
||||||
# print labels
|
|
||||||
print_labels = Service(name='{}.print_labels'.format(route_prefix),
|
|
||||||
path='{}/print-labels'.format(collection_url_prefix))
|
|
||||||
print_labels.add_view('POST', 'print_labels', klass=cls,
|
|
||||||
permission='{}.print_labels'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(print_labels)
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
ProductView = kwargs.get('ProductView', base['ProductView'])
|
|
||||||
ProductView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,64 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Upgrade Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
class UpgradeView(APIMasterView):
|
|
||||||
"""
|
|
||||||
REST API views for Upgrade model.
|
|
||||||
"""
|
|
||||||
model_class = model.Upgrade
|
|
||||||
collection_url_prefix = '/upgrades'
|
|
||||||
object_url_prefix = '/upgrades'
|
|
||||||
|
|
||||||
def normalize(self, upgrade):
|
|
||||||
data = {
|
|
||||||
'created': upgrade.created.isoformat(),
|
|
||||||
'description': upgrade.description,
|
|
||||||
'enabled': upgrade.enabled,
|
|
||||||
'executed': upgrade.executed.isoformat() if upgrade.executed else None,
|
|
||||||
# 'executed_by':
|
|
||||||
}
|
|
||||||
if upgrade.status_code is None:
|
|
||||||
data['status_code'] = None
|
|
||||||
else:
|
|
||||||
data['status_code'] = self.enum.UPGRADE_STATUS.get(upgrade.status_code,
|
|
||||||
str(upgrade.status_code))
|
|
||||||
return data
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
UpgradeView = kwargs.get('UpgradeView', base['UpgradeView'])
|
|
||||||
UpgradeView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,71 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - User Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
class UserView(APIMasterView):
|
|
||||||
"""
|
|
||||||
API views for User data
|
|
||||||
"""
|
|
||||||
model_class = model.User
|
|
||||||
collection_url_prefix = '/users'
|
|
||||||
object_url_prefix = '/user'
|
|
||||||
|
|
||||||
def normalize(self, user):
|
|
||||||
return {
|
|
||||||
'uuid': user.uuid,
|
|
||||||
'username': user.username,
|
|
||||||
'person_display_name': (user.person.display_name or '') if user.person else '',
|
|
||||||
'active': user.active,
|
|
||||||
}
|
|
||||||
|
|
||||||
def interpret_sortcol(self, order_by):
|
|
||||||
if order_by == 'person_display_name':
|
|
||||||
return self.sortcol('Person', 'display_name')
|
|
||||||
return self.sortcol(order_by)
|
|
||||||
|
|
||||||
def join_for_sort_model(self, query, model_name):
|
|
||||||
if model_name == 'Person':
|
|
||||||
query = query.outerjoin(model.Person)
|
|
||||||
return query
|
|
||||||
|
|
||||||
def update_object(self, user, data):
|
|
||||||
# TODO: should ensure prevent_password_change is respected
|
|
||||||
return super(UserView, self).update_object(user, data)
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
UserView = kwargs.get('UserView', base['UserView'])
|
|
||||||
UserView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,57 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Vendor Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
class VendorView(APIMasterView):
|
|
||||||
|
|
||||||
model_class = model.Vendor
|
|
||||||
collection_url_prefix = '/vendors'
|
|
||||||
object_url_prefix = '/vendor'
|
|
||||||
supports_autocomplete = True
|
|
||||||
autocomplete_fieldname = 'name'
|
|
||||||
|
|
||||||
def normalize(self, vendor):
|
|
||||||
return {
|
|
||||||
'uuid': vendor.uuid,
|
|
||||||
'_str': str(vendor),
|
|
||||||
'id': vendor.id,
|
|
||||||
'name': vendor.name,
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
VendorView = kwargs.get('VendorView', base['VendorView'])
|
|
||||||
VendorView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,234 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Web API - Work Order Views
|
|
||||||
"""
|
|
||||||
|
|
||||||
import datetime
|
|
||||||
|
|
||||||
from rattail.db.model import WorkOrder
|
|
||||||
|
|
||||||
from cornice import Service
|
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
|
||||||
|
|
||||||
|
|
||||||
class WorkOrderView(APIMasterView):
|
|
||||||
|
|
||||||
model_class = WorkOrder
|
|
||||||
collection_url_prefix = '/workorders'
|
|
||||||
object_url_prefix = '/workorder'
|
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
app = self.get_rattail_app()
|
|
||||||
self.workorder_handler = app.get_workorder_handler()
|
|
||||||
|
|
||||||
def normalize(self, workorder):
|
|
||||||
data = super().normalize(workorder)
|
|
||||||
data.update({
|
|
||||||
'customer_name': workorder.customer.name,
|
|
||||||
'status_label': self.enum.WORKORDER_STATUS[workorder.status_code],
|
|
||||||
'date_submitted': str(workorder.date_submitted or ''),
|
|
||||||
'date_received': str(workorder.date_received or ''),
|
|
||||||
'date_released': str(workorder.date_released or ''),
|
|
||||||
'date_delivered': str(workorder.date_delivered or ''),
|
|
||||||
})
|
|
||||||
return data
|
|
||||||
|
|
||||||
def create_object(self, data):
|
|
||||||
|
|
||||||
# invoke the handler instead of normal API CRUD logic
|
|
||||||
workorder = self.workorder_handler.make_workorder(self.Session(), **data)
|
|
||||||
return workorder
|
|
||||||
|
|
||||||
def update_object(self, workorder, data):
|
|
||||||
date_fields = [
|
|
||||||
'date_submitted',
|
|
||||||
'date_received',
|
|
||||||
'date_released',
|
|
||||||
'date_delivered',
|
|
||||||
]
|
|
||||||
|
|
||||||
# coerce date field values to proper datetime.date objects
|
|
||||||
for field in date_fields:
|
|
||||||
if field in data:
|
|
||||||
if data[field] == '':
|
|
||||||
data[field] = None
|
|
||||||
elif not isinstance(data[field], datetime.date):
|
|
||||||
date = datetime.datetime.strptime(data[field], '%Y-%m-%d').date()
|
|
||||||
data[field] = date
|
|
||||||
|
|
||||||
# coerce status code value to proper integer
|
|
||||||
if 'status_code' in data:
|
|
||||||
data['status_code'] = int(data['status_code'])
|
|
||||||
|
|
||||||
return super().update_object(workorder, data)
|
|
||||||
|
|
||||||
def status_codes(self):
|
|
||||||
"""
|
|
||||||
Retrieve all info about possible work order status codes.
|
|
||||||
"""
|
|
||||||
return self.workorder_handler.status_codes()
|
|
||||||
|
|
||||||
def receive(self):
|
|
||||||
"""
|
|
||||||
Sets work order status to "received".
|
|
||||||
"""
|
|
||||||
workorder = self.get_object()
|
|
||||||
self.workorder_handler.receive(workorder)
|
|
||||||
self.Session.flush()
|
|
||||||
return self.normalize(workorder)
|
|
||||||
|
|
||||||
def await_estimate(self):
|
|
||||||
"""
|
|
||||||
Sets work order status to "awaiting estimate confirmation".
|
|
||||||
"""
|
|
||||||
workorder = self.get_object()
|
|
||||||
self.workorder_handler.await_estimate(workorder)
|
|
||||||
self.Session.flush()
|
|
||||||
return self.normalize(workorder)
|
|
||||||
|
|
||||||
def await_parts(self):
|
|
||||||
"""
|
|
||||||
Sets work order status to "awaiting parts".
|
|
||||||
"""
|
|
||||||
workorder = self.get_object()
|
|
||||||
self.workorder_handler.await_parts(workorder)
|
|
||||||
self.Session.flush()
|
|
||||||
return self.normalize(workorder)
|
|
||||||
|
|
||||||
def work_on_it(self):
|
|
||||||
"""
|
|
||||||
Sets work order status to "working on it".
|
|
||||||
"""
|
|
||||||
workorder = self.get_object()
|
|
||||||
self.workorder_handler.work_on_it(workorder)
|
|
||||||
self.Session.flush()
|
|
||||||
return self.normalize(workorder)
|
|
||||||
|
|
||||||
def release(self):
|
|
||||||
"""
|
|
||||||
Sets work order status to "released".
|
|
||||||
"""
|
|
||||||
workorder = self.get_object()
|
|
||||||
self.workorder_handler.release(workorder)
|
|
||||||
self.Session.flush()
|
|
||||||
return self.normalize(workorder)
|
|
||||||
|
|
||||||
def deliver(self):
|
|
||||||
"""
|
|
||||||
Sets work order status to "delivered".
|
|
||||||
"""
|
|
||||||
workorder = self.get_object()
|
|
||||||
self.workorder_handler.deliver(workorder)
|
|
||||||
self.Session.flush()
|
|
||||||
return self.normalize(workorder)
|
|
||||||
|
|
||||||
def cancel(self):
|
|
||||||
"""
|
|
||||||
Sets work order status to "canceled".
|
|
||||||
"""
|
|
||||||
workorder = self.get_object()
|
|
||||||
self.workorder_handler.cancel(workorder)
|
|
||||||
self.Session.flush()
|
|
||||||
return self.normalize(workorder)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def defaults(cls, config):
|
|
||||||
cls._defaults(config)
|
|
||||||
cls._workorder_defaults(config)
|
|
||||||
|
|
||||||
@classmethod
|
|
||||||
def _workorder_defaults(cls, config):
|
|
||||||
route_prefix = cls.get_route_prefix()
|
|
||||||
permission_prefix = cls.get_permission_prefix()
|
|
||||||
collection_url_prefix = cls.get_collection_url_prefix()
|
|
||||||
object_url_prefix = cls.get_object_url_prefix()
|
|
||||||
|
|
||||||
# status codes
|
|
||||||
status_codes = Service(name='{}.status_codes'.format(route_prefix),
|
|
||||||
path='{}/status-codes'.format(collection_url_prefix))
|
|
||||||
status_codes.add_view('GET', 'status_codes', klass=cls,
|
|
||||||
permission='{}.list'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(status_codes)
|
|
||||||
|
|
||||||
# receive
|
|
||||||
receive = Service(name='{}.receive'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/receive'.format(object_url_prefix))
|
|
||||||
receive.add_view('POST', 'receive', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(receive)
|
|
||||||
|
|
||||||
# await estimate confirmation
|
|
||||||
await_estimate = Service(name='{}.await_estimate'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/await-estimate'.format(object_url_prefix))
|
|
||||||
await_estimate.add_view('POST', 'await_estimate', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(await_estimate)
|
|
||||||
|
|
||||||
# await parts
|
|
||||||
await_parts = Service(name='{}.await_parts'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/await-parts'.format(object_url_prefix))
|
|
||||||
await_parts.add_view('POST', 'await_parts', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(await_parts)
|
|
||||||
|
|
||||||
# work on it
|
|
||||||
work_on_it = Service(name='{}.work_on_it'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/work-on-it'.format(object_url_prefix))
|
|
||||||
work_on_it.add_view('POST', 'work_on_it', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(work_on_it)
|
|
||||||
|
|
||||||
# release
|
|
||||||
release = Service(name='{}.release'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/release'.format(object_url_prefix))
|
|
||||||
release.add_view('POST', 'release', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(release)
|
|
||||||
|
|
||||||
# deliver
|
|
||||||
deliver = Service(name='{}.deliver'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/deliver'.format(object_url_prefix))
|
|
||||||
deliver.add_view('POST', 'deliver', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(deliver)
|
|
||||||
|
|
||||||
# cancel
|
|
||||||
cancel = Service(name='{}.cancel'.format(route_prefix),
|
|
||||||
path='{}/{{uuid}}/cancel'.format(object_url_prefix))
|
|
||||||
cancel.add_view('POST', 'cancel', klass=cls,
|
|
||||||
permission='{}.edit'.format(permission_prefix))
|
|
||||||
config.add_cornice_service(cancel)
|
|
||||||
|
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
|
||||||
base = globals()
|
|
||||||
|
|
||||||
WorkOrderView = kwargs.get('WorkOrderView', base['WorkOrderView'])
|
|
||||||
WorkOrderView.defaults(config)
|
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
254
tailbone/app.py
254
tailbone/app.py
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,23 +24,24 @@
|
||||||
Application Entry Point
|
Application Entry Point
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import os
|
import os
|
||||||
|
import warnings
|
||||||
|
|
||||||
from sqlalchemy.orm import sessionmaker, scoped_session
|
import sqlalchemy as sa
|
||||||
|
|
||||||
from wuttjamaican.util import parse_list
|
|
||||||
|
|
||||||
|
import rattail.db
|
||||||
from rattail.config import make_config
|
from rattail.config import make_config
|
||||||
from rattail.exceptions import ConfigurationError
|
from rattail.exceptions import ConfigurationError
|
||||||
|
from rattail.db.config import get_engines, configure_versioning
|
||||||
|
from rattail.db.types import GPCType
|
||||||
|
|
||||||
from pyramid.config import Configurator
|
from pyramid.config import Configurator
|
||||||
from zope.sqlalchemy import register
|
from pyramid.authentication import SessionAuthenticationPolicy
|
||||||
|
|
||||||
import tailbone.db
|
import tailbone.db
|
||||||
from tailbone.auth import TailboneSecurityPolicy
|
from tailbone.auth import TailboneAuthorizationPolicy
|
||||||
from tailbone.config import csrf_token_name, csrf_header_name
|
|
||||||
from tailbone.util import get_effective_theme, get_theme_template_path
|
|
||||||
from tailbone.providers import get_all_providers
|
|
||||||
|
|
||||||
|
|
||||||
def make_rattail_config(settings):
|
def make_rattail_config(settings):
|
||||||
|
@ -58,44 +59,36 @@ def make_rattail_config(settings):
|
||||||
"to the path of your config file. Lame, but necessary.")
|
"to the path of your config file. Lame, but necessary.")
|
||||||
rattail_config = make_config(path)
|
rattail_config = make_config(path)
|
||||||
settings['rattail_config'] = rattail_config
|
settings['rattail_config'] = rattail_config
|
||||||
|
rattail_config.configure_logging()
|
||||||
|
|
||||||
# nb. this is for compaibility with wuttaweb
|
rattail_engines = settings.get('rattail_engines')
|
||||||
settings['wutta_config'] = rattail_config
|
if not rattail_engines:
|
||||||
|
|
||||||
# must import all sqlalchemy models before things get rolling,
|
# Load all Rattail database engines from config, and store in settings
|
||||||
# otherwise can have errors about continuum TransactionMeta class
|
# dict. This is necessary e.g. in the case of a host server, to have
|
||||||
# not yet mapped, when relevant pages are first requested...
|
# access to its subordinate store servers.
|
||||||
# cf. https://docs.pylonsproject.org/projects/pyramid_cookbook/en/latest/database/sqlalchemy.html#importing-all-sqlalchemy-models
|
rattail_engines = get_engines(rattail_config)
|
||||||
# hat tip to https://stackoverflow.com/a/59241485
|
settings['rattail_engines'] = rattail_engines
|
||||||
if getattr(rattail_config, 'tempmon_engine', None):
|
|
||||||
from rattail_tempmon.db import model as tempmon_model, Session as TempmonSession
|
|
||||||
tempmon_session = TempmonSession()
|
|
||||||
tempmon_session.query(tempmon_model.Appliance).first()
|
|
||||||
tempmon_session.close()
|
|
||||||
|
|
||||||
# configure database sessions
|
# Configure the database session classes. Note that most of the time we'll
|
||||||
if hasattr(rattail_config, 'appdb_engine'):
|
# be using the Tailbone Session, but occasionally (e.g. within batch
|
||||||
tailbone.db.Session.configure(bind=rattail_config.appdb_engine)
|
# processing threads) we want the Rattail Session. The reason is that
|
||||||
if hasattr(rattail_config, 'trainwreck_engine'):
|
# during normal request processing, the Tailbone Session is preferable as
|
||||||
tailbone.db.TrainwreckSession.configure(bind=rattail_config.trainwreck_engine)
|
# it includes Zope Transaction magic. Within an explicitly-spawned thread
|
||||||
|
# however, this is *not* desirable.
|
||||||
|
rattail.db.Session.configure(bind=rattail_engines['default'])
|
||||||
|
tailbone.db.Session.configure(bind=rattail_engines['default'])
|
||||||
if hasattr(rattail_config, 'tempmon_engine'):
|
if hasattr(rattail_config, 'tempmon_engine'):
|
||||||
tailbone.db.TempmonSession.configure(bind=rattail_config.tempmon_engine)
|
tailbone.db.TempmonSession.configure(bind=rattail_config.tempmon_engine)
|
||||||
|
if hasattr(rattail_config, 'trainwreck_engine'):
|
||||||
# maybe set "future" behavior for SQLAlchemy
|
tailbone.db.TrainwreckSession.configure(bind=rattail_config.trainwreck_engine)
|
||||||
if rattail_config.getbool('rattail.db', 'sqlalchemy_future_mode', usedb=False):
|
|
||||||
tailbone.db.Session.configure(future=True)
|
|
||||||
|
|
||||||
# create session wrappers for each "extra" Trainwreck engine
|
|
||||||
for key, engine in rattail_config.trainwreck_engines.items():
|
|
||||||
if key != 'default':
|
|
||||||
Session = scoped_session(sessionmaker(bind=engine))
|
|
||||||
register(Session)
|
|
||||||
tailbone.db.ExtraTrainwreckSessions[key] = Session
|
|
||||||
|
|
||||||
# Make sure rattail config object uses our scoped session, to avoid
|
# Make sure rattail config object uses our scoped session, to avoid
|
||||||
# unnecessary connections (and pooling limits).
|
# unnecessary connections (and pooling limits).
|
||||||
rattail_config._session_factory = lambda: (tailbone.db.Session(), False)
|
rattail_config._session_factory = lambda: (tailbone.db.Session(), False)
|
||||||
|
|
||||||
|
# Configure (or not) Continuum versioning.
|
||||||
|
configure_versioning(rattail_config)
|
||||||
return rattail_config
|
return rattail_config
|
||||||
|
|
||||||
|
|
||||||
|
@ -105,12 +98,7 @@ def provide_postgresql_settings(settings):
|
||||||
this enables retrying transactions a second time, in an attempt to
|
this enables retrying transactions a second time, in an attempt to
|
||||||
gracefully handle database restarts.
|
gracefully handle database restarts.
|
||||||
"""
|
"""
|
||||||
try:
|
settings.setdefault('tm.attempts', 2)
|
||||||
import pyramid_retry
|
|
||||||
except ImportError:
|
|
||||||
settings.setdefault('tm.attempts', 2)
|
|
||||||
else:
|
|
||||||
settings.setdefault('retry.attempts', 2)
|
|
||||||
|
|
||||||
|
|
||||||
class Root(dict):
|
class Root(dict):
|
||||||
|
@ -128,197 +116,34 @@ def make_pyramid_config(settings, configure_csrf=True):
|
||||||
"""
|
"""
|
||||||
Make a Pyramid config object from the given settings.
|
Make a Pyramid config object from the given settings.
|
||||||
"""
|
"""
|
||||||
rattail_config = settings['rattail_config']
|
|
||||||
|
|
||||||
config = settings.pop('pyramid_config', None)
|
config = settings.pop('pyramid_config', None)
|
||||||
if config:
|
if config:
|
||||||
config.set_root_factory(Root)
|
config.set_root_factory(Root)
|
||||||
else:
|
else:
|
||||||
|
|
||||||
# declare this web app of the "classic" variety
|
|
||||||
settings.setdefault('tailbone.classic', 'true')
|
|
||||||
|
|
||||||
# we want the new themes feature!
|
|
||||||
establish_theme(settings)
|
|
||||||
|
|
||||||
settings.setdefault('fanstatic.versioning', 'true')
|
|
||||||
settings.setdefault('pyramid_deform.template_search_path', 'tailbone:templates/deform')
|
settings.setdefault('pyramid_deform.template_search_path', 'tailbone:templates/deform')
|
||||||
config = Configurator(settings=settings, root_factory=Root)
|
config = Configurator(settings=settings, root_factory=Root)
|
||||||
|
|
||||||
# add rattail config directly to registry, for access throughout the app
|
|
||||||
config.registry['rattail_config'] = rattail_config
|
|
||||||
|
|
||||||
# configure user authorization / authentication
|
# configure user authorization / authentication
|
||||||
config.set_security_policy(TailboneSecurityPolicy())
|
config.set_authorization_policy(TailboneAuthorizationPolicy())
|
||||||
|
config.set_authentication_policy(SessionAuthenticationPolicy())
|
||||||
|
|
||||||
# maybe require CSRF token protection
|
# always require CSRF token protection
|
||||||
if configure_csrf:
|
if configure_csrf:
|
||||||
config.set_default_csrf_options(require_csrf=True,
|
config.set_default_csrf_options(require_csrf=True, token='_csrf')
|
||||||
token=csrf_token_name(rattail_config),
|
|
||||||
header=csrf_header_name(rattail_config))
|
|
||||||
|
|
||||||
# Bring in some Pyramid goodies.
|
# Bring in some Pyramid goodies.
|
||||||
config.include('tailbone.beaker')
|
config.include('tailbone.beaker')
|
||||||
config.include('pyramid_deform')
|
config.include('pyramid_deform')
|
||||||
config.include('pyramid_fanstatic')
|
|
||||||
config.include('pyramid_mako')
|
config.include('pyramid_mako')
|
||||||
config.include('pyramid_tm')
|
config.include('pyramid_tm')
|
||||||
|
|
||||||
# TODO: this may be a good idea some day, if wanting to leverage
|
# Add some permissions magic.
|
||||||
# deform resources for component JS? cf. also base.mako template
|
config.add_directive('add_tailbone_permission_group', 'tailbone.auth.add_permission_group')
|
||||||
# # override default script mapping for deform
|
config.add_directive('add_tailbone_permission', 'tailbone.auth.add_permission')
|
||||||
# from deform import Field
|
|
||||||
# from deform.widget import ResourceRegistry, default_resources
|
|
||||||
# registry = ResourceRegistry(use_defaults=False)
|
|
||||||
# for key in default_resources:
|
|
||||||
# registry.set_js_resources(key, None, {'js': []})
|
|
||||||
# Field.set_default_resource_registry(registry)
|
|
||||||
|
|
||||||
# bring in the pyramid_retry logic, if available
|
|
||||||
# TODO: pretty soon we can require this package, hopefully..
|
|
||||||
try:
|
|
||||||
import pyramid_retry
|
|
||||||
except ImportError:
|
|
||||||
pass
|
|
||||||
else:
|
|
||||||
config.include('pyramid_retry')
|
|
||||||
|
|
||||||
# fetch all tailbone providers
|
|
||||||
providers = get_all_providers(rattail_config)
|
|
||||||
for provider in providers.values():
|
|
||||||
|
|
||||||
# configure DB sessions associated with transaction manager
|
|
||||||
provider.configure_db_sessions(rattail_config, config)
|
|
||||||
|
|
||||||
# add any static includes
|
|
||||||
includes = provider.get_static_includes()
|
|
||||||
if includes:
|
|
||||||
for spec in includes:
|
|
||||||
config.include(spec)
|
|
||||||
|
|
||||||
# add some permissions magic
|
|
||||||
config.add_directive('add_wutta_permission_group',
|
|
||||||
'wuttaweb.auth.add_permission_group')
|
|
||||||
config.add_directive('add_wutta_permission',
|
|
||||||
'wuttaweb.auth.add_permission')
|
|
||||||
# TODO: deprecate / remove these
|
|
||||||
config.add_directive('add_tailbone_permission_group',
|
|
||||||
'wuttaweb.auth.add_permission_group')
|
|
||||||
config.add_directive('add_tailbone_permission',
|
|
||||||
'wuttaweb.auth.add_permission')
|
|
||||||
|
|
||||||
# and some similar magic for certain master views
|
|
||||||
config.add_directive('add_tailbone_index_page', 'tailbone.app.add_index_page')
|
|
||||||
config.add_directive('add_tailbone_config_page', 'tailbone.app.add_config_page')
|
|
||||||
config.add_directive('add_tailbone_model_view', 'tailbone.app.add_model_view')
|
|
||||||
config.add_directive('add_tailbone_view_supplement', 'tailbone.app.add_view_supplement')
|
|
||||||
|
|
||||||
config.add_directive('add_tailbone_websocket', 'tailbone.app.add_websocket')
|
|
||||||
|
|
||||||
return config
|
return config
|
||||||
|
|
||||||
|
|
||||||
def add_websocket(config, name, view, attr=None):
|
|
||||||
"""
|
|
||||||
Register a websocket entry point for the app.
|
|
||||||
"""
|
|
||||||
def action():
|
|
||||||
rattail_config = config.registry.settings['rattail_config']
|
|
||||||
rattail_app = rattail_config.get_app()
|
|
||||||
|
|
||||||
if isinstance(view, str):
|
|
||||||
view_callable = rattail_app.load_object(view)
|
|
||||||
else:
|
|
||||||
view_callable = view
|
|
||||||
view_callable = view_callable(config)
|
|
||||||
if attr:
|
|
||||||
view_callable = getattr(view_callable, attr)
|
|
||||||
|
|
||||||
# register route
|
|
||||||
path = '/ws/{}'.format(name)
|
|
||||||
route_name = 'ws.{}'.format(name)
|
|
||||||
config.add_route(route_name, path, static=True)
|
|
||||||
|
|
||||||
# register view callable
|
|
||||||
websockets = config.registry.setdefault('tailbone_websockets', {})
|
|
||||||
websockets[path] = view_callable
|
|
||||||
|
|
||||||
config.action('tailbone-add-websocket-{}'.format(name), action,
|
|
||||||
# nb. since this action adds routes, it must happen
|
|
||||||
# sooner in the order than it normally would, hence
|
|
||||||
# we declare that
|
|
||||||
order=-20)
|
|
||||||
|
|
||||||
|
|
||||||
def add_index_page(config, route_name, label, permission):
|
|
||||||
"""
|
|
||||||
Register a config page for the app.
|
|
||||||
"""
|
|
||||||
def action():
|
|
||||||
pages = config.get_settings().get('tailbone_index_pages', [])
|
|
||||||
pages.append({'label': label, 'route': route_name,
|
|
||||||
'permission': permission})
|
|
||||||
config.add_settings({'tailbone_index_pages': pages})
|
|
||||||
config.action(None, action)
|
|
||||||
|
|
||||||
|
|
||||||
def add_config_page(config, route_name, label, permission):
|
|
||||||
"""
|
|
||||||
Register a config page for the app.
|
|
||||||
"""
|
|
||||||
def action():
|
|
||||||
pages = config.get_settings().get('tailbone_config_pages', [])
|
|
||||||
pages.append({'label': label, 'route': route_name,
|
|
||||||
'permission': permission})
|
|
||||||
config.add_settings({'tailbone_config_pages': pages})
|
|
||||||
config.action(None, action)
|
|
||||||
|
|
||||||
|
|
||||||
def add_model_view(config, model_name, label, route_prefix, permission_prefix):
|
|
||||||
"""
|
|
||||||
Register a model view for the app.
|
|
||||||
"""
|
|
||||||
def action():
|
|
||||||
all_views = config.get_settings().get('tailbone_model_views', {})
|
|
||||||
|
|
||||||
model_views = all_views.setdefault(model_name, [])
|
|
||||||
model_views.append({
|
|
||||||
'label': label,
|
|
||||||
'route_prefix': route_prefix,
|
|
||||||
'permission_prefix': permission_prefix,
|
|
||||||
})
|
|
||||||
|
|
||||||
config.add_settings({'tailbone_model_views': all_views})
|
|
||||||
|
|
||||||
config.action(None, action)
|
|
||||||
|
|
||||||
|
|
||||||
def add_view_supplement(config, route_prefix, cls):
|
|
||||||
"""
|
|
||||||
Register a master view supplement for the app.
|
|
||||||
"""
|
|
||||||
def action():
|
|
||||||
supplements = config.get_settings().get('tailbone_view_supplements', {})
|
|
||||||
supplements.setdefault(route_prefix, []).append(cls)
|
|
||||||
config.add_settings({'tailbone_view_supplements': supplements})
|
|
||||||
config.action(None, action)
|
|
||||||
|
|
||||||
|
|
||||||
def establish_theme(settings):
|
|
||||||
rattail_config = settings['rattail_config']
|
|
||||||
|
|
||||||
theme = get_effective_theme(rattail_config)
|
|
||||||
settings['tailbone.theme'] = theme
|
|
||||||
|
|
||||||
directories = settings['mako.directories']
|
|
||||||
if isinstance(directories, str):
|
|
||||||
directories = parse_list(directories)
|
|
||||||
|
|
||||||
path = get_theme_template_path(rattail_config)
|
|
||||||
directories.insert(0, path)
|
|
||||||
settings['mako.directories'] = directories
|
|
||||||
|
|
||||||
|
|
||||||
def configure_postgresql(pyramid_config):
|
def configure_postgresql(pyramid_config):
|
||||||
"""
|
"""
|
||||||
Add some PostgreSQL-specific tweaks to the final app config. Specifically,
|
Add some PostgreSQL-specific tweaks to the final app config. Specifically,
|
||||||
|
@ -332,8 +157,7 @@ def main(global_config, **settings):
|
||||||
"""
|
"""
|
||||||
This function returns a Pyramid WSGI application.
|
This function returns a Pyramid WSGI application.
|
||||||
"""
|
"""
|
||||||
settings.setdefault('mako.directories', ['tailbone:templates',
|
settings.setdefault('mako.directories', ['tailbone:templates'])
|
||||||
'wuttaweb:templates'])
|
|
||||||
rattail_config = make_rattail_config(settings)
|
rattail_config = make_rattail_config(settings)
|
||||||
pyramid_config = make_pyramid_config(settings)
|
pyramid_config = make_pyramid_config(settings)
|
||||||
pyramid_config.include('tailbone')
|
pyramid_config.include('tailbone')
|
||||||
|
|
110
tailbone/asgi.py
110
tailbone/asgi.py
|
@ -1,110 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
ASGI App Utilities
|
|
||||||
"""
|
|
||||||
|
|
||||||
import os
|
|
||||||
import configparser
|
|
||||||
import logging
|
|
||||||
|
|
||||||
from rattail.util import load_object
|
|
||||||
|
|
||||||
from asgiref.wsgi import WsgiToAsgi
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class TailboneWsgiToAsgi(WsgiToAsgi):
|
|
||||||
"""
|
|
||||||
Custom WSGI -> ASGI wrapper, to add routing for websockets.
|
|
||||||
"""
|
|
||||||
|
|
||||||
async def __call__(self, scope, *args, **kwargs):
|
|
||||||
protocol = scope['type']
|
|
||||||
path = scope['path']
|
|
||||||
|
|
||||||
# strip off the root path, if non-empty. needed for serving
|
|
||||||
# under /poser or anything other than true site root
|
|
||||||
root_path = scope['root_path']
|
|
||||||
if root_path and path.startswith(root_path):
|
|
||||||
path = path[len(root_path):]
|
|
||||||
|
|
||||||
if protocol == 'websocket':
|
|
||||||
websockets = self.wsgi_application.registry.get(
|
|
||||||
'tailbone_websockets', {})
|
|
||||||
if path in websockets:
|
|
||||||
await websockets[path](scope, *args, **kwargs)
|
|
||||||
|
|
||||||
try:
|
|
||||||
await super().__call__(scope, *args, **kwargs)
|
|
||||||
except ValueError as e:
|
|
||||||
# The developer may wish to improve handling of this exception.
|
|
||||||
# See https://github.com/Pylons/pyramid_cookbook/issues/225 and
|
|
||||||
# https://asgi.readthedocs.io/en/latest/specs/www.html#websocket
|
|
||||||
pass
|
|
||||||
except Exception as e:
|
|
||||||
raise e
|
|
||||||
|
|
||||||
|
|
||||||
def make_asgi_app(main_app=None):
|
|
||||||
"""
|
|
||||||
This function returns an ASGI application.
|
|
||||||
"""
|
|
||||||
path = os.environ.get('TAILBONE_ASGI_CONFIG')
|
|
||||||
if not path:
|
|
||||||
raise RuntimeError("You must define TAILBONE_ASGI_CONFIG env variable.")
|
|
||||||
|
|
||||||
# make a config parser good enough to load pyramid settings
|
|
||||||
configdir = os.path.dirname(path)
|
|
||||||
parser = configparser.ConfigParser(defaults={'__file__': path,
|
|
||||||
'here': configdir})
|
|
||||||
|
|
||||||
# read the config file
|
|
||||||
parser.read(path)
|
|
||||||
|
|
||||||
# parse the settings needed for pyramid app
|
|
||||||
settings = dict(parser.items('app:main'))
|
|
||||||
|
|
||||||
if isinstance(main_app, str):
|
|
||||||
make_wsgi_app = load_object(main_app)
|
|
||||||
elif callable(main_app):
|
|
||||||
make_wsgi_app = main_app
|
|
||||||
else:
|
|
||||||
if main_app:
|
|
||||||
log.warning("specified main app of unknown type: %s", main_app)
|
|
||||||
make_wsgi_app = load_object('tailbone.app:main')
|
|
||||||
|
|
||||||
# construct a pyramid app "per usual"
|
|
||||||
app = make_wsgi_app({}, **settings)
|
|
||||||
|
|
||||||
# then wrap it with ASGI
|
|
||||||
return TailboneWsgiToAsgi(app)
|
|
||||||
|
|
||||||
|
|
||||||
def asgi_main():
|
|
||||||
"""
|
|
||||||
This function returns an ASGI application.
|
|
||||||
"""
|
|
||||||
return make_asgi_app()
|
|
110
tailbone/auth.py
110
tailbone/auth.py
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,31 +24,32 @@
|
||||||
Authentication & Authorization
|
Authentication & Authorization
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import logging
|
import logging
|
||||||
import re
|
|
||||||
|
|
||||||
from wuttjamaican.util import UNSPECIFIED
|
from rattail import enum
|
||||||
|
from rattail.util import prettify, NOTSET
|
||||||
|
|
||||||
from pyramid.security import remember, forget
|
from zope.interface import implementer
|
||||||
|
from pyramid.interfaces import IAuthorizationPolicy
|
||||||
|
from pyramid.security import remember, forget, Everyone, Authenticated
|
||||||
|
|
||||||
from wuttaweb.auth import WuttaSecurityPolicy
|
|
||||||
from tailbone.db import Session
|
from tailbone.db import Session
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
log = logging.getLogger(__name__)
|
||||||
|
|
||||||
|
|
||||||
def login_user(request, user, timeout=UNSPECIFIED):
|
def login_user(request, user, timeout=NOTSET):
|
||||||
"""
|
"""
|
||||||
Perform the steps necessary to login the given user. Note that this
|
Perform the steps necessary to login the given user. Note that this
|
||||||
returns a ``headers`` dict which you should pass to the redirect.
|
returns a ``headers`` dict which you should pass to the redirect.
|
||||||
"""
|
"""
|
||||||
config = request.rattail_config
|
user.record_event(enum.USER_EVENT_LOGIN)
|
||||||
app = config.get_app()
|
|
||||||
user.record_event(app.enum.USER_EVENT_LOGIN)
|
|
||||||
headers = remember(request, user.uuid)
|
headers = remember(request, user.uuid)
|
||||||
if timeout is UNSPECIFIED:
|
if timeout is NOTSET:
|
||||||
timeout = session_timeout_for_user(config, user)
|
timeout = session_timeout_for_user(user)
|
||||||
log.debug("setting session timeout for '{}' to {}".format(user.username, timeout))
|
log.debug("setting session timeout for '{}' to {}".format(user.username, timeout))
|
||||||
set_session_timeout(request, timeout)
|
set_session_timeout(request, timeout)
|
||||||
return headers
|
return headers
|
||||||
|
@ -59,28 +60,24 @@ def logout_user(request):
|
||||||
Perform the logout action for the given request. Note that this returns a
|
Perform the logout action for the given request. Note that this returns a
|
||||||
``headers`` dict which you should pass to the redirect.
|
``headers`` dict which you should pass to the redirect.
|
||||||
"""
|
"""
|
||||||
app = request.rattail_config.get_app()
|
|
||||||
user = request.user
|
user = request.user
|
||||||
if user:
|
if user:
|
||||||
user.record_event(app.enum.USER_EVENT_LOGOUT)
|
user.record_event(enum.USER_EVENT_LOGOUT)
|
||||||
request.session.delete()
|
request.session.delete()
|
||||||
request.session.invalidate()
|
request.session.invalidate()
|
||||||
headers = forget(request)
|
headers = forget(request)
|
||||||
return headers
|
return headers
|
||||||
|
|
||||||
|
|
||||||
def session_timeout_for_user(config, user):
|
def session_timeout_for_user(user):
|
||||||
"""
|
"""
|
||||||
Returns the "max" session timeout for the user, according to roles
|
Returns the "max" session timeout for the user, according to roles
|
||||||
"""
|
"""
|
||||||
app = config.get_app()
|
from rattail.db.auth import authenticated_role
|
||||||
auth = app.get_auth_handler()
|
|
||||||
|
|
||||||
authenticated = auth.get_role_authenticated(Session())
|
roles = user.roles + [authenticated_role(Session())]
|
||||||
roles = user.roles + [authenticated]
|
|
||||||
timeouts = [role.session_timeout for role in roles
|
timeouts = [role.session_timeout for role in roles
|
||||||
if role.session_timeout is not None]
|
if role.session_timeout is not None]
|
||||||
|
|
||||||
if timeouts and 0 not in timeouts:
|
if timeouts and 0 not in timeouts:
|
||||||
return max(timeouts)
|
return max(timeouts)
|
||||||
|
|
||||||
|
@ -92,42 +89,53 @@ def set_session_timeout(request, timeout):
|
||||||
request.session['_timeout'] = timeout or None
|
request.session['_timeout'] = timeout or None
|
||||||
|
|
||||||
|
|
||||||
class TailboneSecurityPolicy(WuttaSecurityPolicy):
|
@implementer(IAuthorizationPolicy)
|
||||||
|
class TailboneAuthorizationPolicy(object):
|
||||||
|
|
||||||
def __init__(self, db_session=None, api_mode=False, **kwargs):
|
def permits(self, context, principals, permission):
|
||||||
kwargs['db_session'] = db_session or Session()
|
from rattail.db import model
|
||||||
super().__init__(**kwargs)
|
from rattail.db.auth import has_permission
|
||||||
self.api_mode = api_mode
|
|
||||||
|
|
||||||
def load_identity(self, request):
|
for userid in principals:
|
||||||
config = request.registry.settings.get('rattail_config')
|
if userid not in (Everyone, Authenticated):
|
||||||
app = config.get_app()
|
if context.request.user and context.request.user.uuid == userid:
|
||||||
user = None
|
return context.request.has_perm(permission)
|
||||||
|
else:
|
||||||
|
assert False # should no longer happen..right?
|
||||||
|
user = Session.query(model.User).get(userid)
|
||||||
|
if user:
|
||||||
|
if has_permission(Session(), user, permission):
|
||||||
|
return True
|
||||||
|
if Everyone in principals:
|
||||||
|
return has_permission(Session(), None, permission)
|
||||||
|
return False
|
||||||
|
|
||||||
if self.api_mode:
|
def principals_allowed_by_permission(self, context, permission):
|
||||||
|
raise NotImplementedError
|
||||||
|
|
||||||
# determine/load user from header token if present
|
|
||||||
credentials = request.headers.get('Authorization')
|
|
||||||
if credentials:
|
|
||||||
match = re.match(r'^Bearer (\S+)$', credentials)
|
|
||||||
if match:
|
|
||||||
token = match.group(1)
|
|
||||||
auth = app.get_auth_handler()
|
|
||||||
user = auth.authenticate_user_token(self.db_session, token)
|
|
||||||
|
|
||||||
if not user:
|
def add_permission_group(config, key, label=None, overwrite=True):
|
||||||
|
"""
|
||||||
|
Add a permission group to the app configuration.
|
||||||
|
"""
|
||||||
|
def action():
|
||||||
|
perms = config.get_settings().get('tailbone_permissions', {})
|
||||||
|
if key not in perms or overwrite:
|
||||||
|
group = perms.setdefault(key, {'key': key})
|
||||||
|
group['label'] = label or prettify(key)
|
||||||
|
config.add_settings({'tailbone_permissions': perms})
|
||||||
|
config.action(None, action)
|
||||||
|
|
||||||
# fetch user uuid from current session
|
|
||||||
uuid = self.session_helper.authenticated_userid(request)
|
|
||||||
if not uuid:
|
|
||||||
return
|
|
||||||
|
|
||||||
# fetch user object from db
|
def add_permission(config, groupkey, key, label=None):
|
||||||
model = app.model
|
"""
|
||||||
user = self.db_session.get(model.User, uuid)
|
Add a permission to the app configuration.
|
||||||
if not user:
|
"""
|
||||||
return
|
def action():
|
||||||
|
perms = config.get_settings().get('tailbone_permissions', {})
|
||||||
# this user is responsible for data changes in current request
|
group = perms.setdefault(groupkey, {'key': groupkey})
|
||||||
self.db_session.set_continuum_user(user)
|
group.setdefault('label', prettify(groupkey))
|
||||||
return user
|
perm = group.setdefault('perms', {}).setdefault(key, {'key': key})
|
||||||
|
perm['label'] = label or prettify(key)
|
||||||
|
config.add_settings({'tailbone_permissions': perms})
|
||||||
|
config.action(None, action)
|
||||||
|
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8; -*-
|
# -*- coding: utf-8 -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -27,12 +27,10 @@ Note that most of the code for this module was copied from the beaker and
|
||||||
pyramid_beaker projects.
|
pyramid_beaker projects.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import time
|
import time
|
||||||
from pkg_resources import parse_version
|
|
||||||
|
|
||||||
from rattail.util import get_pkg_version
|
|
||||||
|
|
||||||
import beaker
|
|
||||||
from beaker.session import Session
|
from beaker.session import Session
|
||||||
from beaker.util import coerce_session_params
|
from beaker.util import coerce_session_params
|
||||||
from pyramid.settings import asbool
|
from pyramid.settings import asbool
|
||||||
|
@ -47,10 +45,6 @@ class TailboneSession(Session):
|
||||||
|
|
||||||
def load(self):
|
def load(self):
|
||||||
"Loads the data from this session from persistent storage"
|
"Loads the data from this session from persistent storage"
|
||||||
|
|
||||||
# are we using older version of beaker?
|
|
||||||
old_beaker = parse_version(get_pkg_version('beaker')) < parse_version('1.12')
|
|
||||||
|
|
||||||
self.namespace = self.namespace_class(self.id,
|
self.namespace = self.namespace_class(self.id,
|
||||||
data_dir=self.data_dir,
|
data_dir=self.data_dir,
|
||||||
digest_filenames=False,
|
digest_filenames=False,
|
||||||
|
@ -66,12 +60,8 @@ class TailboneSession(Session):
|
||||||
try:
|
try:
|
||||||
session_data = self.namespace['session']
|
session_data = self.namespace['session']
|
||||||
|
|
||||||
if old_beaker:
|
if (session_data is not None and self.encrypt_key):
|
||||||
if (session_data is not None and self.encrypt_key):
|
session_data = self._decrypt_data(session_data)
|
||||||
session_data = self._decrypt_data(session_data)
|
|
||||||
else: # beaker >= 1.12
|
|
||||||
if session_data is not None:
|
|
||||||
session_data = self._decrypt_data(session_data)
|
|
||||||
|
|
||||||
# Memcached always returns a key, its None when its not
|
# Memcached always returns a key, its None when its not
|
||||||
# present
|
# present
|
||||||
|
@ -100,7 +90,6 @@ class TailboneSession(Session):
|
||||||
# for this module entirely...
|
# for this module entirely...
|
||||||
timeout = session_data.get('_timeout', self.timeout)
|
timeout = session_data.get('_timeout', self.timeout)
|
||||||
if timeout is not None and \
|
if timeout is not None and \
|
||||||
'_accessed_time' in session_data and \
|
|
||||||
now - session_data['_accessed_time'] > timeout:
|
now - session_data['_accessed_time'] > timeout:
|
||||||
timed_out = True
|
timed_out = True
|
||||||
else:
|
else:
|
||||||
|
@ -114,6 +103,9 @@ class TailboneSession(Session):
|
||||||
# Update the current _accessed_time
|
# Update the current _accessed_time
|
||||||
session_data['_accessed_time'] = now
|
session_data['_accessed_time'] = now
|
||||||
|
|
||||||
|
# Set the path if applicable
|
||||||
|
if '_path' in session_data:
|
||||||
|
self._path = session_data['_path']
|
||||||
self.update(session_data)
|
self.update(session_data)
|
||||||
self.accessed_dict = session_data.copy()
|
self.accessed_dict = session_data.copy()
|
||||||
finally:
|
finally:
|
||||||
|
|
|
@ -1,80 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2022 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Cleanup logic
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
import os
|
|
||||||
import logging
|
|
||||||
import time
|
|
||||||
|
|
||||||
from rattail.cleanup import Cleaner
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class BeakerCleaner(Cleaner):
|
|
||||||
"""
|
|
||||||
Cleanup logic for old Beaker session files.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def get_session_dir(self):
|
|
||||||
session_dir = self.config.get('rattail.cleanup', 'beaker.session_dir')
|
|
||||||
if session_dir and os.path.isdir(session_dir):
|
|
||||||
return session_dir
|
|
||||||
|
|
||||||
session_dir = os.path.join(self.config.appdir(), 'sessions')
|
|
||||||
if os.path.isdir(session_dir):
|
|
||||||
return session_dir
|
|
||||||
|
|
||||||
def cleanup(self, session, dry_run=False, progress=None, **kwargs):
|
|
||||||
session_dir = self.get_session_dir()
|
|
||||||
if not session_dir:
|
|
||||||
return
|
|
||||||
|
|
||||||
data_dir = os.path.join(session_dir, 'data')
|
|
||||||
lock_dir = os.path.join(session_dir, 'lock')
|
|
||||||
|
|
||||||
# looking for files older than X days
|
|
||||||
days = self.config.getint('rattail.cleanup',
|
|
||||||
'beaker.session_cutoff_days',
|
|
||||||
default=30)
|
|
||||||
cutoff = time.time() - 3600 * 24 * days
|
|
||||||
|
|
||||||
for topdir in (data_dir, lock_dir):
|
|
||||||
if not os.path.isdir(topdir):
|
|
||||||
continue
|
|
||||||
|
|
||||||
for dirpath, dirnames, filenames in os.walk(topdir):
|
|
||||||
for fname in filenames:
|
|
||||||
path = os.path.join(dirpath, fname)
|
|
||||||
ts = os.path.getmtime(path)
|
|
||||||
if ts <= cutoff:
|
|
||||||
if dry_run:
|
|
||||||
log.debug("would delete file: %s", path)
|
|
||||||
else:
|
|
||||||
os.remove(path)
|
|
||||||
log.debug("deleted file: %s", path)
|
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8; -*-
|
# -*- coding: utf-8 -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,16 +24,15 @@
|
||||||
Rattail config extension for Tailbone
|
Rattail config extension for Tailbone
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import warnings
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
from wuttjamaican.conf import WuttaConfigExtension
|
|
||||||
|
|
||||||
|
from rattail.config import ConfigExtension as BaseExtension
|
||||||
from rattail.db.config import configure_session
|
from rattail.db.config import configure_session
|
||||||
|
|
||||||
from tailbone.db import Session
|
from tailbone.db import Session
|
||||||
|
|
||||||
|
|
||||||
class ConfigExtension(WuttaConfigExtension):
|
class ConfigExtension(BaseExtension):
|
||||||
"""
|
"""
|
||||||
Rattail config extension for Tailbone. Does the following:
|
Rattail config extension for Tailbone. Does the following:
|
||||||
|
|
||||||
|
@ -48,31 +47,3 @@ class ConfigExtension(WuttaConfigExtension):
|
||||||
def configure(self, config):
|
def configure(self, config):
|
||||||
Session.configure(rattail_config=config)
|
Session.configure(rattail_config=config)
|
||||||
configure_session(config, Session)
|
configure_session(config, Session)
|
||||||
|
|
||||||
# provide default theme selection
|
|
||||||
config.setdefault('tailbone', 'themes.keys', 'default, butterball')
|
|
||||||
config.setdefault('tailbone', 'themes.expose_picker', 'true')
|
|
||||||
|
|
||||||
# override oruga detection
|
|
||||||
config.setdefault('wuttaweb.oruga_detector.spec', 'tailbone.util:should_use_oruga')
|
|
||||||
|
|
||||||
|
|
||||||
def csrf_token_name(config):
|
|
||||||
return config.get('tailbone', 'csrf_token_name', default='_csrf')
|
|
||||||
|
|
||||||
|
|
||||||
def csrf_header_name(config):
|
|
||||||
return config.get('tailbone', 'csrf_header_name', default='X-CSRF-TOKEN')
|
|
||||||
|
|
||||||
|
|
||||||
def global_help_url(config):
|
|
||||||
return config.get('tailbone', 'global_help_url')
|
|
||||||
|
|
||||||
|
|
||||||
def protected_usernames(config):
|
|
||||||
return config.getlist('tailbone', 'protected_usernames')
|
|
||||||
|
|
||||||
|
|
||||||
def should_expose_websockets(config):
|
|
||||||
return config.getbool('tailbone', 'expose_websockets',
|
|
||||||
usedb=False, default=False)
|
|
||||||
|
|
143
tailbone/db.py
143
tailbone/db.py
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8; -*-
|
# -*- coding: utf-8 -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,9 +21,11 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Database sessions etc.
|
Database Stuff
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import sqlalchemy as sa
|
import sqlalchemy as sa
|
||||||
from zope.sqlalchemy import datamanager
|
from zope.sqlalchemy import datamanager
|
||||||
import sqlalchemy_continuum as continuum
|
import sqlalchemy_continuum as continuum
|
||||||
|
@ -33,37 +35,24 @@ from rattail.db import SessionBase
|
||||||
from rattail.db.continuum import versioning_manager
|
from rattail.db.continuum import versioning_manager
|
||||||
|
|
||||||
|
|
||||||
Session = scoped_session(sessionmaker(class_=SessionBase, rattail_config=None, expire_on_commit=False))
|
Session = scoped_session(sessionmaker(class_=SessionBase, rattail_config=None, rattail_record_changes=False, expire_on_commit=False))
|
||||||
|
|
||||||
# not necessarily used, but here if you need it
|
# not necessarily used, but here if you need it
|
||||||
TempmonSession = scoped_session(sessionmaker())
|
TempmonSession = scoped_session(sessionmaker())
|
||||||
TrainwreckSession = scoped_session(sessionmaker())
|
TrainwreckSession = scoped_session(sessionmaker())
|
||||||
|
|
||||||
# empty dict for now, this must populated on app startup (if needed)
|
|
||||||
ExtraTrainwreckSessions = {}
|
|
||||||
|
|
||||||
|
|
||||||
class TailboneSessionDataManager(datamanager.SessionDataManager):
|
class TailboneSessionDataManager(datamanager.SessionDataManager):
|
||||||
"""
|
"""Integrate a top level sqlalchemy session transaction into a zope transaction
|
||||||
Integrate a top level sqlalchemy session transaction into a zope
|
|
||||||
transaction
|
|
||||||
|
|
||||||
One phase variant.
|
One phase variant.
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
|
This class appears to be necessary in order for the Continuum
|
||||||
This class appears to be necessary in order for the
|
integration to work alongside the Zope transaction integration.
|
||||||
SQLAlchemy-Continuum integration to work alongside the Zope
|
|
||||||
transaction integration.
|
|
||||||
|
|
||||||
It subclasses
|
|
||||||
``zope.sqlalchemy.datamanager.SessionDataManager`` but injects
|
|
||||||
some SQLAlchemy-Continuum logic within :meth:`tpc_vote()`, and
|
|
||||||
is sort of monkey-patched into the mix.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def tpc_vote(self, trans):
|
def tpc_vote(self, trans):
|
||||||
""" """
|
|
||||||
# for a one phase data manager commit last in tpc_vote
|
# for a one phase data manager commit last in tpc_vote
|
||||||
if self.tx is not None: # there may have been no work to do
|
if self.tx is not None: # there may have been no work to do
|
||||||
|
|
||||||
|
@ -75,42 +64,25 @@ class TailboneSessionDataManager(datamanager.SessionDataManager):
|
||||||
self._finish('committed')
|
self._finish('committed')
|
||||||
|
|
||||||
|
|
||||||
def join_transaction(
|
def join_transaction(session, initial_state=datamanager.STATUS_ACTIVE, transaction_manager=datamanager.zope_transaction.manager, keep_session=False):
|
||||||
session,
|
"""Join a session to a transaction using the appropriate datamanager.
|
||||||
initial_state=datamanager.STATUS_ACTIVE,
|
|
||||||
transaction_manager=datamanager.zope_transaction.manager,
|
|
||||||
keep_session=False,
|
|
||||||
):
|
|
||||||
"""
|
|
||||||
Join a session to a transaction using the appropriate datamanager.
|
|
||||||
|
|
||||||
It is safe to call this multiple times, if the session is already
|
It is safe to call this multiple times, if the session is already joined
|
||||||
joined then it just returns.
|
then it just returns.
|
||||||
|
|
||||||
`initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or
|
`initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or STATUS_READONLY
|
||||||
STATUS_READONLY
|
|
||||||
|
|
||||||
If using the default initial status of STATUS_ACTIVE, you must
|
If using the default initial status of STATUS_ACTIVE, you must ensure that
|
||||||
ensure that mark_changed(session) is called when data is written
|
mark_changed(session) is called when data is written to the database.
|
||||||
to the database.
|
|
||||||
|
|
||||||
The ZopeTransactionExtesion SessionExtension can be used to ensure
|
The ZopeTransactionExtesion SessionExtension can be used to ensure that this is
|
||||||
that this is called automatically after session write operations.
|
called automatically after session write operations.
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
|
This function is copied from upstream, and tweaked so that our custom
|
||||||
This function appears to be necessary in order for the
|
:class:`TailboneSessionDataManager` will be used.
|
||||||
SQLAlchemy-Continuum integration to work alongside the Zope
|
|
||||||
transaction integration.
|
|
||||||
|
|
||||||
It overrides ``zope.sqlalchemy.datamanager.join_transaction()``
|
|
||||||
to ensure the custom :class:`TailboneSessionDataManager` is
|
|
||||||
used, and is sort of monkey-patched into the mix.
|
|
||||||
"""
|
"""
|
||||||
# the upstream internals of this function has changed a little over time.
|
if datamanager._SESSION_STATE.get(id(session), None) is None:
|
||||||
# unfortunately for us, that means we must include each variant here.
|
|
||||||
|
|
||||||
if datamanager._SESSION_STATE.get(session, None) is None:
|
|
||||||
if session.twophase:
|
if session.twophase:
|
||||||
DataManager = datamanager.TwoPhaseSessionDataManager
|
DataManager = datamanager.TwoPhaseSessionDataManager
|
||||||
else:
|
else:
|
||||||
|
@ -118,73 +90,43 @@ def join_transaction(
|
||||||
DataManager(session, initial_state, transaction_manager, keep_session=keep_session)
|
DataManager(session, initial_state, transaction_manager, keep_session=keep_session)
|
||||||
|
|
||||||
|
|
||||||
class ZopeTransactionEvents(datamanager.ZopeTransactionEvents):
|
class ZopeTransactionExtension(datamanager.ZopeTransactionExtension):
|
||||||
"""
|
"""Record that a flush has occurred on a session's connection. This allows
|
||||||
Record that a flush has occurred on a session's connection. This
|
the DataManager to rollback rather than commit on read only transactions.
|
||||||
allows the DataManager to rollback rather than commit on read only
|
|
||||||
transactions.
|
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
|
This class is copied from upstream, and tweaked so that our custom
|
||||||
This class appears to be necessary in order for the
|
:func:`join_transaction()` will be used.
|
||||||
SQLAlchemy-Continuum integration to work alongside the Zope
|
|
||||||
transaction integration.
|
|
||||||
|
|
||||||
It subclasses
|
|
||||||
``zope.sqlalchemy.datamanager.ZopeTransactionEvents`` but
|
|
||||||
overrides various methods to ensure the custom
|
|
||||||
:func:`join_transaction()` is called, and is sort of
|
|
||||||
monkey-patched into the mix.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def after_begin(self, session, transaction, connection):
|
def after_begin(self, session, transaction, connection):
|
||||||
""" """
|
join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session)
|
||||||
join_transaction(session, self.initial_state,
|
|
||||||
self.transaction_manager, self.keep_session)
|
|
||||||
|
|
||||||
def after_attach(self, session, instance):
|
def after_attach(self, session, instance):
|
||||||
""" """
|
join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session)
|
||||||
join_transaction(session, self.initial_state,
|
|
||||||
self.transaction_manager, self.keep_session)
|
|
||||||
|
|
||||||
def join_transaction(self, session):
|
|
||||||
""" """
|
|
||||||
join_transaction(session, self.initial_state,
|
|
||||||
self.transaction_manager, self.keep_session)
|
|
||||||
|
|
||||||
|
|
||||||
def register(
|
def register(session, initial_state=datamanager.STATUS_ACTIVE,
|
||||||
session,
|
transaction_manager=datamanager.zope_transaction.manager, keep_session=False):
|
||||||
initial_state=datamanager.STATUS_ACTIVE,
|
"""Register ZopeTransaction listener events on the
|
||||||
transaction_manager=datamanager.zope_transaction.manager,
|
given Session or Session factory/class.
|
||||||
keep_session=False,
|
|
||||||
):
|
|
||||||
"""
|
|
||||||
Register ZopeTransaction listener events on the given Session or
|
|
||||||
Session factory/class.
|
|
||||||
|
|
||||||
This function requires at least SQLAlchemy 0.7 and makes use of
|
This function requires at least SQLAlchemy 0.7 and makes use
|
||||||
the newer sqlalchemy.event package in order to register event
|
of the newer sqlalchemy.event package in order to register event listeners
|
||||||
listeners on the given Session.
|
on the given Session.
|
||||||
|
|
||||||
The session argument here may be a Session class or subclass, a
|
The session argument here may be a Session class or subclass, a
|
||||||
sessionmaker or scoped_session instance, or a specific Session
|
sessionmaker or scoped_session instance, or a specific Session instance.
|
||||||
instance. Event listening will be specific to the scope of the
|
Event listening will be specific to the scope of the type of argument
|
||||||
type of argument passed, including specificity to its subclass as
|
passed, including specificity to its subclass as well as its identity.
|
||||||
well as its identity.
|
|
||||||
|
|
||||||
.. note::
|
.. note::
|
||||||
|
This function is copied from upstream, and tweaked so that our custom
|
||||||
This function appears to be necessary in order for the
|
:class:`ZopeTransactionExtension` will be used.
|
||||||
SQLAlchemy-Continuum integration to work alongside the Zope
|
|
||||||
transaction integration.
|
|
||||||
|
|
||||||
It overrides ``zope.sqlalchemy.datamanager.regsiter()`` to
|
|
||||||
ensure the custom :class:`ZopeTransactionEvents` is used.
|
|
||||||
"""
|
"""
|
||||||
from sqlalchemy import event
|
from sqlalchemy import event
|
||||||
|
|
||||||
ext = ZopeTransactionEvents(
|
ext = ZopeTransactionExtension(
|
||||||
initial_state=initial_state,
|
initial_state=initial_state,
|
||||||
transaction_manager=transaction_manager,
|
transaction_manager=transaction_manager,
|
||||||
keep_session=keep_session,
|
keep_session=keep_session,
|
||||||
|
@ -197,9 +139,6 @@ def register(
|
||||||
event.listen(session, "after_bulk_delete", ext.after_bulk_delete)
|
event.listen(session, "after_bulk_delete", ext.after_bulk_delete)
|
||||||
event.listen(session, "before_commit", ext.before_commit)
|
event.listen(session, "before_commit", ext.before_commit)
|
||||||
|
|
||||||
if datamanager.SA_GE_14:
|
|
||||||
event.listen(session, "do_orm_execute", ext.do_orm_execute)
|
|
||||||
|
|
||||||
|
|
||||||
register(Session)
|
register(Session)
|
||||||
register(TempmonSession)
|
register(TempmonSession)
|
||||||
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,8 +24,7 @@
|
||||||
Tools for displaying data diffs
|
Tools for displaying data diffs
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import sqlalchemy as sa
|
from __future__ import unicode_literals, absolute_import
|
||||||
import sqlalchemy_continuum as continuum
|
|
||||||
|
|
||||||
from pyramid.renderers import render
|
from pyramid.renderers import render
|
||||||
from webhelpers2.html import HTML
|
from webhelpers2.html import HTML
|
||||||
|
@ -34,43 +33,16 @@ from webhelpers2.html import HTML
|
||||||
class Diff(object):
|
class Diff(object):
|
||||||
"""
|
"""
|
||||||
Core diff class. In sore need of documentation.
|
Core diff class. In sore need of documentation.
|
||||||
|
|
||||||
You must provide the old and new data sets, and the set of
|
|
||||||
relevant fields as well, if they cannot be easily introspected.
|
|
||||||
|
|
||||||
:param old_data: Dict of "old" data values.
|
|
||||||
|
|
||||||
:param new_data: Dict of "old" data values.
|
|
||||||
|
|
||||||
:param fields: Sequence of relevant field names. Note that
|
|
||||||
both data dicts are expected to have keys which match these
|
|
||||||
field names. If you do not specify the fields then they
|
|
||||||
will (hopefully) be introspected from the old or new data
|
|
||||||
sets; however this will not work if they are both empty.
|
|
||||||
|
|
||||||
:param monospace: If true, this flag will cause the value
|
|
||||||
columns to be rendered in monospace font. This is assumed
|
|
||||||
to be helpful when comparing "raw" data values which are
|
|
||||||
shown as e.g. ``repr(val)``.
|
|
||||||
|
|
||||||
:param enums: Optional dict of enums for use when displaying field
|
|
||||||
values. If specified, keys should be field names and values
|
|
||||||
should be enum dicts.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, old_data, new_data, columns=None, fields=None, enums=None,
|
def __init__(self, old_data, new_data, columns=None, fields=None, render_field=None, render_value=None, monospace=False):
|
||||||
render_field=None, render_value=None, nature='dirty',
|
|
||||||
monospace=False, extra_row_attrs=None):
|
|
||||||
self.old_data = old_data
|
self.old_data = old_data
|
||||||
self.new_data = new_data
|
self.new_data = new_data
|
||||||
self.columns = columns or ["field name", "old value", "new value"]
|
self.columns = columns or ["field name", "old value", "new value"]
|
||||||
self.fields = fields or self.make_fields()
|
self.fields = fields or self.make_fields()
|
||||||
self.enums = enums or {}
|
|
||||||
self._render_field = render_field or self.render_field_default
|
self._render_field = render_field or self.render_field_default
|
||||||
self.render_value = render_value or self.render_value_default
|
self.render_value = render_value or self.render_value_default
|
||||||
self.nature = nature
|
|
||||||
self.monospace = monospace
|
self.monospace = monospace
|
||||||
self.extra_row_attrs = extra_row_attrs
|
|
||||||
|
|
||||||
def make_fields(self):
|
def make_fields(self):
|
||||||
return sorted(set(self.old_data) | set(self.new_data), key=lambda x: x.lower())
|
return sorted(set(self.old_data) | set(self.new_data), key=lambda x: x.lower())
|
||||||
|
@ -89,32 +61,6 @@ class Diff(object):
|
||||||
context['diff'] = self
|
context['diff'] = self
|
||||||
return HTML.literal(render(template, context))
|
return HTML.literal(render(template, context))
|
||||||
|
|
||||||
def get_row_attrs(self, field):
|
|
||||||
"""
|
|
||||||
Returns a *rendered* set of extra attributes for the ``<tr>`` element
|
|
||||||
for the given field. May be an empty string, or a snippet of HTML
|
|
||||||
attribute syntax, e.g.:
|
|
||||||
|
|
||||||
.. code-block:: none
|
|
||||||
|
|
||||||
class="diff" foo="bar"
|
|
||||||
|
|
||||||
If you wish to supply additional attributes, please define
|
|
||||||
:attr:`extra_row_attrs`, which can be either a static dict, or a
|
|
||||||
callable returning a dict.
|
|
||||||
"""
|
|
||||||
attrs = {}
|
|
||||||
if self.values_differ(field):
|
|
||||||
attrs['class'] = 'diff'
|
|
||||||
|
|
||||||
if self.extra_row_attrs:
|
|
||||||
if callable(self.extra_row_attrs):
|
|
||||||
attrs.update(self.extra_row_attrs(field, attrs))
|
|
||||||
else:
|
|
||||||
attrs.update(self.extra_row_attrs)
|
|
||||||
|
|
||||||
return HTML.render_attrs(attrs)
|
|
||||||
|
|
||||||
def render_field(self, field):
|
def render_field(self, field):
|
||||||
return self._render_field(field, self)
|
return self._render_field(field, self)
|
||||||
|
|
||||||
|
@ -131,161 +77,3 @@ class Diff(object):
|
||||||
def render_new_value(self, field):
|
def render_new_value(self, field):
|
||||||
value = self.new_value(field)
|
value = self.new_value(field)
|
||||||
return self.render_value(field, value)
|
return self.render_value(field, value)
|
||||||
|
|
||||||
|
|
||||||
class VersionDiff(Diff):
|
|
||||||
"""
|
|
||||||
Special diff class, for use with version history views. Note that
|
|
||||||
while based on :class:`Diff`, this class uses a different
|
|
||||||
signature for the constructor.
|
|
||||||
|
|
||||||
:param version: Reference to a Continuum version record (object).
|
|
||||||
|
|
||||||
:param \*args: Typical usage will not require positional args
|
|
||||||
beyond the ``version`` param, in which case ``old_data`` and
|
|
||||||
``new_data`` params will be auto-determined based on the
|
|
||||||
``version``. But if you specify positional args then nothing
|
|
||||||
automatic is done, they are passed as-is to the parent
|
|
||||||
:class:`Diff` constructor.
|
|
||||||
|
|
||||||
:param \*\*kwargs: Remaining kwargs are passed as-is to the
|
|
||||||
:class:`Diff` constructor.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, version, *args, **kwargs):
|
|
||||||
self.version = version
|
|
||||||
self.mapper = sa.inspect(continuum.parent_class(type(self.version)))
|
|
||||||
self.version_mapper = sa.inspect(type(self.version))
|
|
||||||
self.title = kwargs.pop('title', None)
|
|
||||||
|
|
||||||
if 'nature' not in kwargs:
|
|
||||||
if version.previous and version.operation_type == continuum.Operation.DELETE:
|
|
||||||
kwargs['nature'] = 'deleted'
|
|
||||||
elif version.previous:
|
|
||||||
kwargs['nature'] = 'dirty'
|
|
||||||
else:
|
|
||||||
kwargs['nature'] = 'new'
|
|
||||||
|
|
||||||
if 'fields' not in kwargs:
|
|
||||||
kwargs['fields'] = self.get_default_fields()
|
|
||||||
|
|
||||||
if not args:
|
|
||||||
old_data = {}
|
|
||||||
new_data = {}
|
|
||||||
for field in kwargs['fields']:
|
|
||||||
if version.previous:
|
|
||||||
old_data[field] = getattr(version.previous, field)
|
|
||||||
new_data[field] = getattr(version, field)
|
|
||||||
args = (old_data, new_data)
|
|
||||||
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
|
|
||||||
def get_default_fields(self):
|
|
||||||
fields = sorted(self.version_mapper.columns.keys())
|
|
||||||
|
|
||||||
unwanted = [
|
|
||||||
'transaction_id',
|
|
||||||
'end_transaction_id',
|
|
||||||
'operation_type',
|
|
||||||
]
|
|
||||||
|
|
||||||
return [field for field in fields
|
|
||||||
if field not in unwanted]
|
|
||||||
|
|
||||||
def render_version_value(self, field, value, version):
|
|
||||||
"""
|
|
||||||
Render the cell value text for the given version/field info.
|
|
||||||
|
|
||||||
Note that this method is used to render both sides of the diff
|
|
||||||
(before and after values).
|
|
||||||
|
|
||||||
:param field: Name of the field, as string.
|
|
||||||
|
|
||||||
:param value: Raw value for the field, as obtained from ``version``.
|
|
||||||
|
|
||||||
:param version: Reference to the Continuum version object.
|
|
||||||
|
|
||||||
:returns: Rendered text as string, or ``None``.
|
|
||||||
"""
|
|
||||||
text = HTML.tag('span', c=[repr(value)],
|
|
||||||
style='font-family: monospace;')
|
|
||||||
|
|
||||||
# assume the enum display is all we need, if enum exists for the field
|
|
||||||
if field in self.enums:
|
|
||||||
|
|
||||||
# but skip the enum display if None
|
|
||||||
display = self.enums[field].get(value)
|
|
||||||
if display is None and value is None:
|
|
||||||
return text
|
|
||||||
|
|
||||||
# otherwise show enum display to the right of raw value
|
|
||||||
display = self.enums[field].get(value, str(value))
|
|
||||||
return HTML.tag('span', c=[
|
|
||||||
text,
|
|
||||||
HTML.tag('span', c=[display],
|
|
||||||
style='margin-left: 2rem; font-style: italic; font-weight: bold;'),
|
|
||||||
])
|
|
||||||
|
|
||||||
# next we look for a relationship and may render the foreign object
|
|
||||||
for prop in self.mapper.relationships:
|
|
||||||
if prop.uselist:
|
|
||||||
continue
|
|
||||||
|
|
||||||
for col in prop.local_columns:
|
|
||||||
if col.name != field:
|
|
||||||
continue
|
|
||||||
|
|
||||||
if not hasattr(version, prop.key):
|
|
||||||
continue
|
|
||||||
|
|
||||||
if col in self.mapper.primary_key:
|
|
||||||
continue
|
|
||||||
|
|
||||||
ref = getattr(version, prop.key)
|
|
||||||
if ref:
|
|
||||||
ref = getattr(ref, 'version_parent', None)
|
|
||||||
if ref:
|
|
||||||
return HTML.tag('span', c=[
|
|
||||||
text,
|
|
||||||
HTML.tag('span', c=[str(ref)],
|
|
||||||
style='margin-left: 2rem; font-style: italic; font-weight: bold;'),
|
|
||||||
])
|
|
||||||
|
|
||||||
return text
|
|
||||||
|
|
||||||
def render_old_value(self, field):
|
|
||||||
if self.nature == 'new':
|
|
||||||
return ''
|
|
||||||
value = self.old_value(field)
|
|
||||||
return self.render_version_value(field, value, self.version.previous)
|
|
||||||
|
|
||||||
def render_new_value(self, field):
|
|
||||||
if self.nature == 'deleted':
|
|
||||||
return ''
|
|
||||||
value = self.new_value(field)
|
|
||||||
return self.render_version_value(field, value, self.version)
|
|
||||||
|
|
||||||
def as_struct(self):
|
|
||||||
values = {}
|
|
||||||
for field in self.fields:
|
|
||||||
values[field] = {'before': self.render_old_value(field),
|
|
||||||
'after': self.render_new_value(field)}
|
|
||||||
|
|
||||||
operation = None
|
|
||||||
if self.version.operation_type == continuum.Operation.INSERT:
|
|
||||||
operation = 'INSERT'
|
|
||||||
elif self.version.operation_type == continuum.Operation.UPDATE:
|
|
||||||
operation = 'UPDATE'
|
|
||||||
elif self.version.operation_type == continuum.Operation.DELETE:
|
|
||||||
operation = 'DELETE'
|
|
||||||
else:
|
|
||||||
operation = self.version.operation_type
|
|
||||||
|
|
||||||
return {
|
|
||||||
'key': id(self.version),
|
|
||||||
'model_title': self.title,
|
|
||||||
'operation': operation,
|
|
||||||
'diff_class': self.nature,
|
|
||||||
'fields': self.fields,
|
|
||||||
'values': values,
|
|
||||||
}
|
|
||||||
|
|
|
@ -1,49 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Exceptions
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.exceptions import RattailError
|
|
||||||
|
|
||||||
|
|
||||||
class TailboneError(RattailError):
|
|
||||||
"""
|
|
||||||
Base class for all Tailbone exceptions.
|
|
||||||
"""
|
|
||||||
|
|
||||||
|
|
||||||
class TailboneJSONFieldError(TailboneError):
|
|
||||||
"""
|
|
||||||
Error raised when JSON serialization of a form field results in an error.
|
|
||||||
This is just a simple wrapper, to make the error message more helpful for
|
|
||||||
the developer.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, field, error):
|
|
||||||
self.field = field
|
|
||||||
self.error = error
|
|
||||||
|
|
||||||
def __str__(self):
|
|
||||||
return ("Failed to serialize field '{}' as JSON! "
|
|
||||||
"Original error was: {}".format(self.field, self.error))
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,7 +24,8 @@
|
||||||
Forms Library
|
Forms Library
|
||||||
"""
|
"""
|
||||||
|
|
||||||
# nb. import widgets before types, b/c types may refer to widgets
|
from __future__ import unicode_literals, absolute_import
|
||||||
from . import widgets
|
|
||||||
from . import types
|
from . import types
|
||||||
from .core import Form, SimpleFileImport
|
from . import widgets
|
||||||
|
from .core import Form
|
||||||
|
|
|
@ -1,62 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Common Forms
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
import colander
|
|
||||||
|
|
||||||
|
|
||||||
@colander.deferred
|
|
||||||
def validate_user(node, kw):
|
|
||||||
session = kw['session']
|
|
||||||
def validate(node, value):
|
|
||||||
user = session.get(model.User, value)
|
|
||||||
if not user:
|
|
||||||
raise colander.Invalid(node, "User not found")
|
|
||||||
return user.uuid
|
|
||||||
return validate
|
|
||||||
|
|
||||||
|
|
||||||
class Feedback(colander.Schema):
|
|
||||||
"""
|
|
||||||
Form schema for user feedback.
|
|
||||||
"""
|
|
||||||
email_key = colander.SchemaNode(colander.String(),
|
|
||||||
missing=colander.null)
|
|
||||||
|
|
||||||
referrer = colander.SchemaNode(colander.String())
|
|
||||||
|
|
||||||
user = colander.SchemaNode(colander.String(),
|
|
||||||
missing=colander.null,
|
|
||||||
validator=validate_user)
|
|
||||||
|
|
||||||
user_name = colander.SchemaNode(colander.String(),
|
|
||||||
missing=colander.null)
|
|
||||||
|
|
||||||
please_reply_to = colander.SchemaNode(colander.String(),
|
|
||||||
missing=colander.null)
|
|
||||||
|
|
||||||
message = colander.SchemaNode(colander.String())
|
|
File diff suppressed because it is too large
Load diff
|
@ -1,68 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Forms for Receiving
|
|
||||||
"""
|
|
||||||
|
|
||||||
from rattail.db import model
|
|
||||||
|
|
||||||
import colander
|
|
||||||
|
|
||||||
|
|
||||||
@colander.deferred
|
|
||||||
def valid_purchase_batch_row(node, kw):
|
|
||||||
session = kw['session']
|
|
||||||
def validate(node, value):
|
|
||||||
row = session.get(model.PurchaseBatchRow, value)
|
|
||||||
if not row:
|
|
||||||
raise colander.Invalid(node, "Batch row not found")
|
|
||||||
if row.batch.executed:
|
|
||||||
raise colander.Invalid(node, "Batch has already been executed")
|
|
||||||
return row.uuid
|
|
||||||
return validate
|
|
||||||
|
|
||||||
|
|
||||||
class ReceiveRow(colander.MappingSchema):
|
|
||||||
|
|
||||||
row = colander.SchemaNode(colander.String(),
|
|
||||||
validator=valid_purchase_batch_row)
|
|
||||||
|
|
||||||
mode = colander.SchemaNode(colander.String(),
|
|
||||||
validator=colander.OneOf([
|
|
||||||
'received',
|
|
||||||
'damaged',
|
|
||||||
'expired',
|
|
||||||
'missing',
|
|
||||||
# 'mispick',
|
|
||||||
]))
|
|
||||||
|
|
||||||
cases = colander.SchemaNode(colander.Decimal(),
|
|
||||||
missing=colander.null)
|
|
||||||
|
|
||||||
units = colander.SchemaNode(colander.Decimal(),
|
|
||||||
missing=colander.null)
|
|
||||||
|
|
||||||
expiration_date = colander.SchemaNode(colander.Date(),
|
|
||||||
missing=colander.null)
|
|
||||||
|
|
||||||
quick_receive = colander.SchemaNode(colander.Boolean())
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
# Copyright © 2010-2018 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,9 +24,11 @@
|
||||||
Form Schema Types
|
Form Schema Types
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import re
|
import re
|
||||||
import datetime
|
|
||||||
import json
|
import six
|
||||||
|
|
||||||
from rattail.db import model
|
from rattail.db import model
|
||||||
from rattail.gpc import GPC
|
from rattail.gpc import GPC
|
||||||
|
@ -34,7 +36,6 @@ from rattail.gpc import GPC
|
||||||
import colander
|
import colander
|
||||||
|
|
||||||
from tailbone.db import Session
|
from tailbone.db import Session
|
||||||
from tailbone.forms import widgets
|
|
||||||
|
|
||||||
|
|
||||||
class JQueryTime(colander.Time):
|
class JQueryTime(colander.Time):
|
||||||
|
@ -54,94 +55,12 @@ class JQueryTime(colander.Time):
|
||||||
]
|
]
|
||||||
for fmt in formats:
|
for fmt in formats:
|
||||||
try:
|
try:
|
||||||
return datetime.datetime.strptime(cstruct, fmt).time()
|
return colander.timeparse(cstruct, fmt)
|
||||||
except ValueError:
|
except ValueError:
|
||||||
pass
|
pass
|
||||||
|
|
||||||
# re-try first format, for "better" error message
|
# re-try first format, for "better" error message
|
||||||
return datetime.datetime.strptime(cstruct, formats[0]).time()
|
return colander.timeparse(cstruct, formats[0])
|
||||||
|
|
||||||
|
|
||||||
class DateTimeBoolean(colander.Boolean):
|
|
||||||
"""
|
|
||||||
Schema type which presents the user with a "boolean" whereas the underlying
|
|
||||||
node is really a datetime (assumed to be "naive" UTC, and allow nulls).
|
|
||||||
"""
|
|
||||||
|
|
||||||
def deserialize(self, node, cstruct):
|
|
||||||
value = super(DateTimeBoolean, self).deserialize(node, cstruct)
|
|
||||||
if value: # else return None
|
|
||||||
return datetime.datetime.utcnow()
|
|
||||||
|
|
||||||
|
|
||||||
class FalafelDateTime(colander.DateTime):
|
|
||||||
"""
|
|
||||||
Custom schema node type for rattail UTC datetimes
|
|
||||||
"""
|
|
||||||
widget_maker = widgets.FalafelDateTimeWidget
|
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
|
||||||
request = kwargs.pop('request')
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
self.request = request
|
|
||||||
|
|
||||||
def serialize(self, node, appstruct):
|
|
||||||
if not appstruct:
|
|
||||||
return {}
|
|
||||||
|
|
||||||
# cant use isinstance; dt subs date
|
|
||||||
if type(appstruct) is datetime.date:
|
|
||||||
appstruct = datetime.datetime.combine(appstruct, datetime.time())
|
|
||||||
|
|
||||||
if not isinstance(appstruct, datetime.datetime):
|
|
||||||
raise colander.Invalid(node, f'"{appstruct}" is not a datetime object')
|
|
||||||
|
|
||||||
if appstruct.tzinfo is None:
|
|
||||||
appstruct = appstruct.replace(tzinfo=self.default_tzinfo)
|
|
||||||
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
dt = app.localtime(appstruct, from_utc=True)
|
|
||||||
|
|
||||||
return {
|
|
||||||
'date': str(dt.date()),
|
|
||||||
'time': str(dt.time()),
|
|
||||||
}
|
|
||||||
|
|
||||||
def deserialize(self, node, cstruct):
|
|
||||||
if not cstruct:
|
|
||||||
return colander.null
|
|
||||||
|
|
||||||
if not cstruct['date'] and not cstruct['time']:
|
|
||||||
return colander.null
|
|
||||||
|
|
||||||
try:
|
|
||||||
date = datetime.datetime.strptime(cstruct['date'], '%Y-%m-%d').date()
|
|
||||||
except:
|
|
||||||
node.raise_invalid("Missing or invalid date")
|
|
||||||
|
|
||||||
try:
|
|
||||||
time = datetime.datetime.strptime(cstruct['time'], '%H:%M:%S').time()
|
|
||||||
except:
|
|
||||||
node.raise_invalid("Missing or invalid time")
|
|
||||||
|
|
||||||
result = datetime.datetime.combine(date, time)
|
|
||||||
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
result = app.localtime(result)
|
|
||||||
result = app.make_utc(result)
|
|
||||||
return result
|
|
||||||
|
|
||||||
|
|
||||||
class FalafelTime(colander.Time):
|
|
||||||
"""
|
|
||||||
Custom schema node type for simple time fields
|
|
||||||
"""
|
|
||||||
widget_maker = widgets.FalafelTimeWidget
|
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
|
||||||
request = kwargs.pop('request')
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
self.request = request
|
|
||||||
|
|
||||||
|
|
||||||
class GPCType(colander.SchemaType):
|
class GPCType(colander.SchemaType):
|
||||||
|
@ -152,7 +71,7 @@ class GPCType(colander.SchemaType):
|
||||||
def serialize(self, node, appstruct):
|
def serialize(self, node, appstruct):
|
||||||
if appstruct is colander.null:
|
if appstruct is colander.null:
|
||||||
return colander.null
|
return colander.null
|
||||||
return str(appstruct)
|
return six.text_type(appstruct)
|
||||||
|
|
||||||
def deserialize(self, node, cstruct):
|
def deserialize(self, node, cstruct):
|
||||||
if not cstruct:
|
if not cstruct:
|
||||||
|
@ -163,17 +82,7 @@ class GPCType(colander.SchemaType):
|
||||||
try:
|
try:
|
||||||
return GPC(digits)
|
return GPC(digits)
|
||||||
except Exception as err:
|
except Exception as err:
|
||||||
raise colander.Invalid(node, str(err))
|
raise colander.Invalid(node, six.text_type(err))
|
||||||
|
|
||||||
|
|
||||||
class ProductQuantity(colander.MappingSchema):
|
|
||||||
"""
|
|
||||||
Combo schema type for product cases and units; useful for inventory,
|
|
||||||
ordering, receiving etc. Meant to be used with the ``CasesUnitsWidget``.
|
|
||||||
"""
|
|
||||||
cases = colander.SchemaNode(colander.Decimal(), missing=colander.null)
|
|
||||||
|
|
||||||
units = colander.SchemaNode(colander.Decimal(), missing=colander.null)
|
|
||||||
|
|
||||||
|
|
||||||
class ModelType(colander.SchemaType):
|
class ModelType(colander.SchemaType):
|
||||||
|
@ -201,12 +110,12 @@ class ModelType(colander.SchemaType):
|
||||||
def serialize(self, node, appstruct):
|
def serialize(self, node, appstruct):
|
||||||
if appstruct is colander.null:
|
if appstruct is colander.null:
|
||||||
return colander.null
|
return colander.null
|
||||||
return str(appstruct)
|
return six.text_type(appstruct)
|
||||||
|
|
||||||
def deserialize(self, node, cstruct):
|
def deserialize(self, node, cstruct):
|
||||||
if not cstruct:
|
if not cstruct:
|
||||||
return None
|
return None
|
||||||
obj = self.session.get(self.model_class, cstruct)
|
obj = self.session.query(self.model_class).get(cstruct)
|
||||||
if not obj:
|
if not obj:
|
||||||
raise colander.Invalid(node, "{} not found".format(self.model_title))
|
raise colander.Invalid(node, "{} not found".format(self.model_title))
|
||||||
return obj
|
return obj
|
||||||
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2018 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,24 +24,23 @@
|
||||||
Form Widgets
|
Form Widgets
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import json
|
import json
|
||||||
import datetime
|
import datetime
|
||||||
import decimal
|
|
||||||
import re
|
import six
|
||||||
|
|
||||||
import colander
|
import colander
|
||||||
from deform import widget as dfwidget
|
from deform import widget as dfwidget
|
||||||
from webhelpers2.html import tags, HTML
|
from webhelpers2.html import tags, HTML
|
||||||
|
|
||||||
from tailbone.db import Session
|
|
||||||
|
|
||||||
|
|
||||||
class ReadonlyWidget(dfwidget.HiddenWidget):
|
class ReadonlyWidget(dfwidget.HiddenWidget):
|
||||||
|
|
||||||
readonly = True
|
readonly = True
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
def serialize(self, field, cstruct, **kw):
|
||||||
""" """
|
|
||||||
if cstruct in (colander.null, None):
|
if cstruct in (colander.null, None):
|
||||||
cstruct = ''
|
cstruct = ''
|
||||||
# TODO: is this hacky?
|
# TODO: is this hacky?
|
||||||
|
@ -56,150 +55,14 @@ class NumberInputWidget(dfwidget.TextInputWidget):
|
||||||
autocomplete = 'off'
|
autocomplete = 'off'
|
||||||
|
|
||||||
|
|
||||||
class NumericInputWidget(NumberInputWidget):
|
|
||||||
"""
|
|
||||||
This widget uses a ``<numeric-input>`` component, which will
|
|
||||||
leverage the ``numeric.js`` functions to ensure user doesn't enter
|
|
||||||
any non-numeric values. Note that this still uses a normal "text"
|
|
||||||
input on the HTML side, as opposed to a "number" input, since the
|
|
||||||
latter is a bit ugly IMHO.
|
|
||||||
"""
|
|
||||||
template = 'numericinput'
|
|
||||||
allow_enter = True
|
|
||||||
|
|
||||||
|
|
||||||
class PercentInputWidget(dfwidget.TextInputWidget):
|
|
||||||
"""
|
|
||||||
Custom text input widget, used for "percent" type fields. This widget
|
|
||||||
assumes that the underlying storage for the value is a "traditional"
|
|
||||||
percent value, e.g. ``0.36135`` - but the UI should represent this as a
|
|
||||||
"human-friendly" value, e.g. ``36.135 %``.
|
|
||||||
"""
|
|
||||||
template = 'percentinput'
|
|
||||||
autocomplete = 'off'
|
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
|
||||||
""" """
|
|
||||||
if cstruct not in (colander.null, None):
|
|
||||||
# convert "traditional" value to "human-friendly"
|
|
||||||
value = decimal.Decimal(cstruct) * 100
|
|
||||||
value = value.quantize(decimal.Decimal('0.001'))
|
|
||||||
cstruct = str(value)
|
|
||||||
return super().serialize(field, cstruct, **kw)
|
|
||||||
|
|
||||||
def deserialize(self, field, pstruct):
|
|
||||||
""" """
|
|
||||||
pstruct = super().deserialize(field, pstruct)
|
|
||||||
if pstruct is colander.null:
|
|
||||||
return colander.null
|
|
||||||
# convert "human-friendly" value to "traditional"
|
|
||||||
try:
|
|
||||||
value = decimal.Decimal(pstruct)
|
|
||||||
except decimal.InvalidOperation:
|
|
||||||
raise colander.Invalid(field.schema, "Invalid decimal string: {}".format(pstruct))
|
|
||||||
value = value.quantize(decimal.Decimal('0.00001'))
|
|
||||||
value /= 100
|
|
||||||
return str(value)
|
|
||||||
|
|
||||||
|
|
||||||
class CasesUnitsWidget(dfwidget.Widget):
|
|
||||||
"""
|
|
||||||
Widget for collecting case and/or unit quantities. Most useful when you
|
|
||||||
need to ensure user provides cases *or* units but not both.
|
|
||||||
"""
|
|
||||||
template = 'cases_units'
|
|
||||||
amount_required = False
|
|
||||||
one_amount_only = False
|
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
|
||||||
""" """
|
|
||||||
if cstruct in (colander.null, None):
|
|
||||||
cstruct = ''
|
|
||||||
readonly = kw.get('readonly', self.readonly)
|
|
||||||
kw['cases'] = cstruct['cases'] or ''
|
|
||||||
kw['units'] = cstruct['units'] or ''
|
|
||||||
template = readonly and self.readonly_template or self.template
|
|
||||||
values = self.get_template_values(field, cstruct, kw)
|
|
||||||
return field.renderer(template, **values)
|
|
||||||
|
|
||||||
def deserialize(self, field, pstruct):
|
|
||||||
""" """
|
|
||||||
from tailbone.forms.types import ProductQuantity
|
|
||||||
|
|
||||||
if pstruct is colander.null:
|
|
||||||
return colander.null
|
|
||||||
|
|
||||||
schema = ProductQuantity()
|
|
||||||
try:
|
|
||||||
validated = schema.deserialize(pstruct)
|
|
||||||
except colander.Invalid as exc:
|
|
||||||
raise colander.Invalid(field.schema, "Invalid pstruct: %s" % exc)
|
|
||||||
|
|
||||||
if self.amount_required and not (validated['cases'] or validated['units']):
|
|
||||||
raise colander.Invalid(field.schema, "Must provide case or unit amount",
|
|
||||||
value=validated)
|
|
||||||
|
|
||||||
if self.amount_required and self.one_amount_only and validated['cases'] and validated['units']:
|
|
||||||
raise colander.Invalid(field.schema, "Must provide case *or* unit amount, "
|
|
||||||
"but *not* both", value=validated)
|
|
||||||
|
|
||||||
return validated
|
|
||||||
|
|
||||||
|
|
||||||
class DynamicCheckboxWidget(dfwidget.CheckboxWidget):
|
|
||||||
"""
|
|
||||||
This checkbox widget can be "dynamic" in the sense that form logic can
|
|
||||||
control its value and state.
|
|
||||||
"""
|
|
||||||
template = 'checkbox_dynamic'
|
|
||||||
|
|
||||||
|
|
||||||
# TODO: deprecate / remove this
|
|
||||||
class PlainSelectWidget(dfwidget.SelectWidget):
|
class PlainSelectWidget(dfwidget.SelectWidget):
|
||||||
template = 'select_plain'
|
template = 'select_plain'
|
||||||
|
|
||||||
|
|
||||||
class CustomSelectWidget(dfwidget.SelectWidget):
|
|
||||||
"""
|
|
||||||
This widget is mostly for convenience. You can set extra kwargs for the
|
|
||||||
:meth:`serialize()` method, e.g.::
|
|
||||||
|
|
||||||
widget.set_template_values(foo='bar')
|
|
||||||
"""
|
|
||||||
|
|
||||||
def set_template_values(self, **kw):
|
|
||||||
if not hasattr(self, 'extra_template_values'):
|
|
||||||
self.extra_template_values = {}
|
|
||||||
self.extra_template_values.update(kw)
|
|
||||||
|
|
||||||
def get_template_values(self, field, cstruct, kw):
|
|
||||||
values = super().get_template_values(field, cstruct, kw)
|
|
||||||
if hasattr(self, 'extra_template_values'):
|
|
||||||
values.update(self.extra_template_values)
|
|
||||||
return values
|
|
||||||
|
|
||||||
|
|
||||||
class DynamicSelectWidget(CustomSelectWidget):
|
|
||||||
"""
|
|
||||||
This is a "normal" select widget, but instead of (or in addition to) its
|
|
||||||
values being set when constructed, they must be assigned dynamically in
|
|
||||||
real-time, e.g. based on other user selections.
|
|
||||||
|
|
||||||
Really all this widget "does" is render some Vue.js-compatible HTML, but
|
|
||||||
the page which contains the widget is ultimately responsible for wiring up
|
|
||||||
the logic for things to work right.
|
|
||||||
"""
|
|
||||||
template = 'select_dynamic'
|
|
||||||
|
|
||||||
|
|
||||||
class JQuerySelectWidget(dfwidget.SelectWidget):
|
class JQuerySelectWidget(dfwidget.SelectWidget):
|
||||||
template = 'select_jquery'
|
template = 'select_jquery'
|
||||||
|
|
||||||
|
|
||||||
class PlainDateWidget(dfwidget.DateInputWidget):
|
|
||||||
template = 'date_plain'
|
|
||||||
|
|
||||||
|
|
||||||
class JQueryDateWidget(dfwidget.DateInputWidget):
|
class JQueryDateWidget(dfwidget.DateInputWidget):
|
||||||
"""
|
"""
|
||||||
Uses the jQuery datepicker UI widget, instead of whatever it is deform uses
|
Uses the jQuery datepicker UI widget, instead of whatever it is deform uses
|
||||||
|
@ -216,7 +79,6 @@ class JQueryDateWidget(dfwidget.DateInputWidget):
|
||||||
)
|
)
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
def serialize(self, field, cstruct, **kw):
|
||||||
""" """
|
|
||||||
if cstruct in (colander.null, None):
|
if cstruct in (colander.null, None):
|
||||||
cstruct = ''
|
cstruct = ''
|
||||||
readonly = kw.get('readonly', self.readonly)
|
readonly = kw.get('readonly', self.readonly)
|
||||||
|
@ -244,48 +106,6 @@ class JQueryTimeWidget(dfwidget.TimeInputWidget):
|
||||||
)
|
)
|
||||||
|
|
||||||
|
|
||||||
class FalafelDateTimeWidget(dfwidget.DateTimeInputWidget):
|
|
||||||
"""
|
|
||||||
Custom widget for rattail UTC datetimes
|
|
||||||
"""
|
|
||||||
template = 'datetime_falafel'
|
|
||||||
|
|
||||||
new_pattern = re.compile(r'^\d\d?:\d\d:\d\d [AP]M$')
|
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
|
||||||
""" """
|
|
||||||
readonly = kw.get('readonly', self.readonly)
|
|
||||||
values = self.get_template_values(field, cstruct, kw)
|
|
||||||
template = self.readonly_template if readonly else self.template
|
|
||||||
return field.renderer(template, **values)
|
|
||||||
|
|
||||||
def deserialize(self, field, pstruct):
|
|
||||||
""" """
|
|
||||||
if pstruct == '':
|
|
||||||
return colander.null
|
|
||||||
|
|
||||||
# nb. we now allow '4:20:00 PM' on the widget side, but the
|
|
||||||
# true node needs it to be '16:20:00' instead
|
|
||||||
if self.new_pattern.match(pstruct['time']):
|
|
||||||
time = datetime.datetime.strptime(pstruct['time'], '%I:%M:%S %p')
|
|
||||||
pstruct['time'] = time.strftime('%H:%M:%S')
|
|
||||||
|
|
||||||
return pstruct
|
|
||||||
|
|
||||||
|
|
||||||
class FalafelTimeWidget(dfwidget.TimeInputWidget):
|
|
||||||
"""
|
|
||||||
Custom widget for simple time fields
|
|
||||||
"""
|
|
||||||
template = 'time_falafel'
|
|
||||||
|
|
||||||
def deserialize(self, field, pstruct):
|
|
||||||
""" """
|
|
||||||
if pstruct == '':
|
|
||||||
return colander.null
|
|
||||||
return pstruct
|
|
||||||
|
|
||||||
|
|
||||||
class JQueryAutocompleteWidget(dfwidget.AutocompleteInputWidget):
|
class JQueryAutocompleteWidget(dfwidget.AutocompleteInputWidget):
|
||||||
"""
|
"""
|
||||||
Uses the jQuery autocomplete plugin, instead of whatever it is deform uses
|
Uses the jQuery autocomplete plugin, instead of whatever it is deform uses
|
||||||
|
@ -294,13 +114,9 @@ class JQueryAutocompleteWidget(dfwidget.AutocompleteInputWidget):
|
||||||
template = 'autocomplete_jquery'
|
template = 'autocomplete_jquery'
|
||||||
requirements = None
|
requirements = None
|
||||||
field_display = ""
|
field_display = ""
|
||||||
assigned_label = None
|
|
||||||
service_url = None
|
service_url = None
|
||||||
cleared_callback = None
|
cleared_callback = None
|
||||||
selected_callback = None
|
selected_callback = None
|
||||||
input_callback = None
|
|
||||||
new_label_callback = None
|
|
||||||
ref = None
|
|
||||||
|
|
||||||
default_options = (
|
default_options = (
|
||||||
('autoFocus', True),
|
('autoFocus', True),
|
||||||
|
@ -308,7 +124,6 @@ class JQueryAutocompleteWidget(dfwidget.AutocompleteInputWidget):
|
||||||
options = None
|
options = None
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
def serialize(self, field, cstruct, **kw):
|
||||||
""" """
|
|
||||||
if 'delay' in kw or getattr(self, 'delay', None):
|
if 'delay' in kw or getattr(self, 'delay', None):
|
||||||
raise ValueError(
|
raise ValueError(
|
||||||
'AutocompleteWidget does not support *delay* parameter '
|
'AutocompleteWidget does not support *delay* parameter '
|
||||||
|
@ -327,333 +142,7 @@ class JQueryAutocompleteWidget(dfwidget.AutocompleteInputWidget):
|
||||||
kw['options'] = json.dumps(options)
|
kw['options'] = json.dumps(options)
|
||||||
kw['field_display'] = self.field_display
|
kw['field_display'] = self.field_display
|
||||||
kw['cleared_callback'] = self.cleared_callback
|
kw['cleared_callback'] = self.cleared_callback
|
||||||
kw['assigned_label'] = self.assigned_label
|
|
||||||
kw['input_callback'] = self.input_callback
|
|
||||||
kw['new_label_callback'] = self.new_label_callback
|
|
||||||
kw['ref'] = self.ref
|
|
||||||
kw.setdefault('selected_callback', self.selected_callback)
|
kw.setdefault('selected_callback', self.selected_callback)
|
||||||
tmpl_values = self.get_template_values(field, cstruct, kw)
|
tmpl_values = self.get_template_values(field, cstruct, kw)
|
||||||
template = readonly and self.readonly_template or self.template
|
template = readonly and self.readonly_template or self.template
|
||||||
return field.renderer(template, **tmpl_values)
|
return field.renderer(template, **tmpl_values)
|
||||||
|
|
||||||
|
|
||||||
class FileUploadWidget(dfwidget.FileUploadWidget):
|
|
||||||
"""
|
|
||||||
Widget to handle file upload. Must override to add ``use_oruga``
|
|
||||||
to field template context.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
|
||||||
self.request = kwargs.pop('request')
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
|
|
||||||
def get_template_values(self, field, cstruct, kw):
|
|
||||||
values = super().get_template_values(field, cstruct, kw)
|
|
||||||
if self.request:
|
|
||||||
values['use_oruga'] = self.request.use_oruga
|
|
||||||
return values
|
|
||||||
|
|
||||||
|
|
||||||
class MultiFileUploadWidget(dfwidget.FileUploadWidget):
|
|
||||||
"""
|
|
||||||
Widget to handle multiple (arbitrary number) of file uploads.
|
|
||||||
"""
|
|
||||||
template = 'multi_file_upload'
|
|
||||||
requirements = ()
|
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
|
||||||
""" """
|
|
||||||
if cstruct in (colander.null, None):
|
|
||||||
cstruct = []
|
|
||||||
|
|
||||||
if cstruct:
|
|
||||||
for fileinfo in cstruct:
|
|
||||||
uid = fileinfo['uid']
|
|
||||||
if uid not in self.tmpstore:
|
|
||||||
self.tmpstore[uid] = fileinfo
|
|
||||||
|
|
||||||
readonly = kw.get("readonly", self.readonly)
|
|
||||||
template = readonly and self.readonly_template or self.template
|
|
||||||
values = self.get_template_values(field, cstruct, kw)
|
|
||||||
return field.renderer(template, **values)
|
|
||||||
|
|
||||||
def deserialize(self, field, pstruct):
|
|
||||||
""" """
|
|
||||||
if pstruct is colander.null:
|
|
||||||
return colander.null
|
|
||||||
|
|
||||||
# TODO: why is this a thing? pstruct == [b'']
|
|
||||||
if len(pstruct) == 1 and pstruct[0] == b'':
|
|
||||||
return colander.null
|
|
||||||
|
|
||||||
files_data = []
|
|
||||||
for upload in pstruct:
|
|
||||||
|
|
||||||
data = self.deserialize_upload(upload)
|
|
||||||
if data:
|
|
||||||
files_data.append(data)
|
|
||||||
|
|
||||||
if not files_data:
|
|
||||||
return colander.null
|
|
||||||
|
|
||||||
return files_data
|
|
||||||
|
|
||||||
def deserialize_upload(self, upload):
|
|
||||||
""" """
|
|
||||||
# nb. this logic was copied from parent class and adapted
|
|
||||||
# to allow for multiple files. needs some more love.
|
|
||||||
|
|
||||||
uid = None # TODO?
|
|
||||||
|
|
||||||
if hasattr(upload, "file"):
|
|
||||||
# the upload control had a file selected
|
|
||||||
data = dfwidget.filedict()
|
|
||||||
data["fp"] = upload.file
|
|
||||||
filename = upload.filename
|
|
||||||
# sanitize IE whole-path filenames
|
|
||||||
filename = filename[filename.rfind("\\") + 1 :].strip()
|
|
||||||
data["filename"] = filename
|
|
||||||
data["mimetype"] = upload.type
|
|
||||||
data["size"] = upload.length
|
|
||||||
if uid is None:
|
|
||||||
# no previous file exists
|
|
||||||
while 1:
|
|
||||||
uid = self.random_id()
|
|
||||||
if self.tmpstore.get(uid) is None:
|
|
||||||
data["uid"] = uid
|
|
||||||
self.tmpstore[uid] = data
|
|
||||||
preview_url = self.tmpstore.preview_url(uid)
|
|
||||||
self.tmpstore[uid]["preview_url"] = preview_url
|
|
||||||
break
|
|
||||||
else:
|
|
||||||
# a previous file exists
|
|
||||||
data["uid"] = uid
|
|
||||||
self.tmpstore[uid] = data
|
|
||||||
preview_url = self.tmpstore.preview_url(uid)
|
|
||||||
self.tmpstore[uid]["preview_url"] = preview_url
|
|
||||||
else:
|
|
||||||
# the upload control had no file selected
|
|
||||||
if uid is None:
|
|
||||||
# no previous file exists
|
|
||||||
return colander.null
|
|
||||||
else:
|
|
||||||
# a previous file should exist
|
|
||||||
data = self.tmpstore.get(uid)
|
|
||||||
# but if it doesn't, don't blow up
|
|
||||||
if data is None:
|
|
||||||
return colander.null
|
|
||||||
return data
|
|
||||||
|
|
||||||
|
|
||||||
def make_customer_widget(request, **kwargs):
|
|
||||||
"""
|
|
||||||
Make a customer widget; will be either autocomplete or dropdown
|
|
||||||
depending on config.
|
|
||||||
"""
|
|
||||||
# use autocomplete widget by default
|
|
||||||
factory = CustomerAutocompleteWidget
|
|
||||||
|
|
||||||
# caller may request dropdown widget
|
|
||||||
if kwargs.pop('dropdown', False):
|
|
||||||
factory = CustomerDropdownWidget
|
|
||||||
|
|
||||||
else: # or, config may say to use dropdown
|
|
||||||
if request.rattail_config.getbool(
|
|
||||||
'rattail', 'customers.choice_uses_dropdown',
|
|
||||||
default=False):
|
|
||||||
factory = CustomerDropdownWidget
|
|
||||||
|
|
||||||
# instantiate whichever
|
|
||||||
return factory(request, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class CustomerAutocompleteWidget(JQueryAutocompleteWidget):
|
|
||||||
"""
|
|
||||||
Autocomplete widget for a
|
|
||||||
:class:`~rattail:rattail.db.model.customers.Customer` reference
|
|
||||||
field.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, request, *args, **kwargs):
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
self.request = request
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
model = app.model
|
|
||||||
|
|
||||||
# must figure out URL providing autocomplete service
|
|
||||||
if 'service_url' not in kwargs:
|
|
||||||
|
|
||||||
# caller can just pass 'url' instead of 'service_url'
|
|
||||||
if 'url' in kwargs:
|
|
||||||
self.service_url = kwargs['url']
|
|
||||||
|
|
||||||
else: # use default url
|
|
||||||
self.service_url = self.request.route_url('customers.autocomplete')
|
|
||||||
|
|
||||||
# TODO
|
|
||||||
if 'input_callback' not in kwargs:
|
|
||||||
if 'input_handler' in kwargs:
|
|
||||||
self.input_callback = input_handler
|
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
|
||||||
""" """
|
|
||||||
# fetch customer to provide button label, if we have a value
|
|
||||||
if cstruct:
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
model = app.model
|
|
||||||
customer = Session.get(model.Customer, cstruct)
|
|
||||||
if customer:
|
|
||||||
self.field_display = str(customer)
|
|
||||||
|
|
||||||
return super().serialize(
|
|
||||||
field, cstruct, **kw)
|
|
||||||
|
|
||||||
|
|
||||||
class CustomerDropdownWidget(dfwidget.SelectWidget):
|
|
||||||
"""
|
|
||||||
Dropdown widget for a
|
|
||||||
:class:`~rattail:rattail.db.model.customers.Customer` reference
|
|
||||||
field.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, request, *args, **kwargs):
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
self.request = request
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
|
|
||||||
# must figure out dropdown values, if they weren't given
|
|
||||||
if 'values' not in kwargs:
|
|
||||||
|
|
||||||
# use what caller gave us, if they did
|
|
||||||
if 'customers' in kwargs:
|
|
||||||
customers = kwargs['customers']
|
|
||||||
if callable(customers):
|
|
||||||
customers = customers()
|
|
||||||
|
|
||||||
else: # default customer list
|
|
||||||
customers = app.get_clientele_handler()\
|
|
||||||
.get_all_customers(Session())
|
|
||||||
|
|
||||||
# convert customer list to option values
|
|
||||||
self.values = [(c.uuid, c.name)
|
|
||||||
for c in customers]
|
|
||||||
|
|
||||||
|
|
||||||
class DepartmentWidget(dfwidget.SelectWidget):
|
|
||||||
"""
|
|
||||||
Custom select widget for a Department reference field.
|
|
||||||
|
|
||||||
Constructor accepts the normal ``values`` kwarg but if not
|
|
||||||
provided then the widget will fetch department list from Rattail
|
|
||||||
DB.
|
|
||||||
|
|
||||||
Constructor also accepts ``required`` kwarg, which defaults to
|
|
||||||
true unless specified.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, request, **kwargs):
|
|
||||||
|
|
||||||
if 'values' not in kwargs:
|
|
||||||
app = request.rattail_config.get_app()
|
|
||||||
model = app.model
|
|
||||||
departments = Session.query(model.Department)\
|
|
||||||
.order_by(model.Department.number)
|
|
||||||
values = [(dept.uuid, str(dept))
|
|
||||||
for dept in departments]
|
|
||||||
if not kwargs.pop('required', True):
|
|
||||||
values.insert(0, ('', "(none)"))
|
|
||||||
kwargs['values'] = values
|
|
||||||
|
|
||||||
super().__init__(**kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
def make_vendor_widget(request, **kwargs):
|
|
||||||
"""
|
|
||||||
Make a vendor widget; will be either autocomplete or dropdown
|
|
||||||
depending on config.
|
|
||||||
"""
|
|
||||||
# use autocomplete widget by default
|
|
||||||
factory = VendorAutocompleteWidget
|
|
||||||
|
|
||||||
# caller may request dropdown widget
|
|
||||||
if kwargs.pop('dropdown', False):
|
|
||||||
factory = VendorDropdownWidget
|
|
||||||
|
|
||||||
else: # or, config may say to use dropdown
|
|
||||||
app = request.rattail_config.get_app()
|
|
||||||
vendor_handler = app.get_vendor_handler()
|
|
||||||
if vendor_handler.choice_uses_dropdown():
|
|
||||||
factory = VendorDropdownWidget
|
|
||||||
|
|
||||||
# instantiate whichever
|
|
||||||
return factory(request, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class VendorAutocompleteWidget(JQueryAutocompleteWidget):
|
|
||||||
"""
|
|
||||||
Autocomplete widget for a Vendor reference field.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, request, *args, **kwargs):
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
self.request = request
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
model = app.model
|
|
||||||
|
|
||||||
# must figure out URL providing autocomplete service
|
|
||||||
if 'service_url' not in kwargs:
|
|
||||||
|
|
||||||
# caller can just pass 'url' instead of 'service_url'
|
|
||||||
if 'url' in kwargs:
|
|
||||||
self.service_url = kwargs['url']
|
|
||||||
|
|
||||||
else: # use default url
|
|
||||||
self.service_url = self.request.route_url('vendors.autocomplete')
|
|
||||||
|
|
||||||
# # TODO
|
|
||||||
# if 'input_callback' not in kwargs:
|
|
||||||
# if 'input_handler' in kwargs:
|
|
||||||
# self.input_callback = input_handler
|
|
||||||
|
|
||||||
def serialize(self, field, cstruct, **kw):
|
|
||||||
""" """
|
|
||||||
# fetch vendor to provide button label, if we have a value
|
|
||||||
if cstruct:
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
model = app.model
|
|
||||||
vendor = Session.get(model.Vendor, cstruct)
|
|
||||||
if vendor:
|
|
||||||
self.field_display = str(vendor)
|
|
||||||
|
|
||||||
return super().serialize(
|
|
||||||
field, cstruct, **kw)
|
|
||||||
|
|
||||||
|
|
||||||
class VendorDropdownWidget(dfwidget.SelectWidget):
|
|
||||||
"""
|
|
||||||
Dropdown widget for a Vendor reference field.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, request, *args, **kwargs):
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
self.request = request
|
|
||||||
|
|
||||||
# must figure out dropdown values, if they weren't given
|
|
||||||
if 'values' not in kwargs:
|
|
||||||
|
|
||||||
# use what caller gave us, if they did
|
|
||||||
if 'vendors' in kwargs:
|
|
||||||
vendors = kwargs['vendors']
|
|
||||||
if callable(vendors):
|
|
||||||
vendors = vendors()
|
|
||||||
|
|
||||||
else: # default vendor list
|
|
||||||
app = self.request.rattail_config.get_app()
|
|
||||||
model = app.model
|
|
||||||
vendors = Session.query(model.Vendor)\
|
|
||||||
.order_by(model.Vendor.name)\
|
|
||||||
.all()
|
|
||||||
|
|
||||||
# convert vendor list to option values
|
|
||||||
self.values = [(c.uuid, c.name)
|
|
||||||
for c in vendors]
|
|
||||||
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2021 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -28,3 +28,4 @@ from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
from . import filters
|
from . import filters
|
||||||
from .core import Grid, GridAction
|
from .core import Grid, GridAction
|
||||||
|
from .mobile import MobileGrid
|
||||||
|
|
File diff suppressed because it is too large
Load diff
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2018 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,15 +24,16 @@
|
||||||
Grid Filters
|
Grid Filters
|
||||||
"""
|
"""
|
||||||
|
|
||||||
import re
|
from __future__ import unicode_literals, absolute_import
|
||||||
import datetime
|
|
||||||
import decimal
|
|
||||||
import logging
|
|
||||||
from collections import OrderedDict
|
|
||||||
|
|
||||||
|
import datetime
|
||||||
|
import logging
|
||||||
|
|
||||||
|
import six
|
||||||
import sqlalchemy as sa
|
import sqlalchemy as sa
|
||||||
|
|
||||||
from rattail.gpc import GPC
|
from rattail.gpc import GPC
|
||||||
|
from rattail.util import OrderedDict
|
||||||
from rattail.core import UNSPECIFIED
|
from rattail.core import UNSPECIFIED
|
||||||
from rattail.time import localtime, make_utc
|
from rattail.time import localtime, make_utc
|
||||||
from rattail.util import prettify
|
from rattail.util import prettify
|
||||||
|
@ -50,7 +51,6 @@ class FilterValueRenderer(object):
|
||||||
"""
|
"""
|
||||||
Base class for all filter renderers.
|
Base class for all filter renderers.
|
||||||
"""
|
"""
|
||||||
data_type = 'string'
|
|
||||||
|
|
||||||
@property
|
@property
|
||||||
def name(self):
|
def name(self):
|
||||||
|
@ -74,7 +74,6 @@ class NumericValueRenderer(FilterValueRenderer):
|
||||||
"""
|
"""
|
||||||
Input renderer for numeric values.
|
Input renderer for numeric values.
|
||||||
"""
|
"""
|
||||||
data_type = 'number'
|
|
||||||
|
|
||||||
def render(self, value=None, **kwargs):
|
def render(self, value=None, **kwargs):
|
||||||
kwargs.setdefault('step', '0.001')
|
kwargs.setdefault('step', '0.001')
|
||||||
|
@ -85,7 +84,6 @@ class DateValueRenderer(FilterValueRenderer):
|
||||||
"""
|
"""
|
||||||
Input renderer for date values.
|
Input renderer for date values.
|
||||||
"""
|
"""
|
||||||
data_type = 'date'
|
|
||||||
|
|
||||||
def render(self, value=None, **kwargs):
|
def render(self, value=None, **kwargs):
|
||||||
kwargs['data-datepicker'] = 'true'
|
kwargs['data-datepicker'] = 'true'
|
||||||
|
@ -96,7 +94,6 @@ class ChoiceValueRenderer(FilterValueRenderer):
|
||||||
"""
|
"""
|
||||||
Renders value input as a dropdown/selectmenu of available choices.
|
Renders value input as a dropdown/selectmenu of available choices.
|
||||||
"""
|
"""
|
||||||
data_type = 'choice'
|
|
||||||
|
|
||||||
def __init__(self, options):
|
def __init__(self, options):
|
||||||
self.options = options
|
self.options = options
|
||||||
|
@ -111,11 +108,8 @@ class EnumValueRenderer(ChoiceValueRenderer):
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, enum):
|
def __init__(self, enum):
|
||||||
if isinstance(enum, OrderedDict):
|
sorted_keys = sorted(enum, key=lambda k: enum[k].lower())
|
||||||
sorted_keys = list(enum.keys())
|
self.options = [tags.Option(enum[k], six.text_type(k)) for k in sorted_keys]
|
||||||
else:
|
|
||||||
sorted_keys = sorted(enum, key=lambda k: enum[k].lower())
|
|
||||||
self.options = [tags.Option(enum[k], str(k)) for k in sorted_keys]
|
|
||||||
|
|
||||||
|
|
||||||
class GridFilter(object):
|
class GridFilter(object):
|
||||||
|
@ -127,69 +121,37 @@ class GridFilter(object):
|
||||||
'is_any': "is any",
|
'is_any': "is any",
|
||||||
'equal': "equal to",
|
'equal': "equal to",
|
||||||
'not_equal': "not equal to",
|
'not_equal': "not equal to",
|
||||||
'equal_any_of': "equal to any of",
|
|
||||||
'greater_than': "greater than",
|
'greater_than': "greater than",
|
||||||
'greater_equal': "greater than or equal to",
|
'greater_equal': "greater than or equal to",
|
||||||
'less_than': "less than",
|
'less_than': "less than",
|
||||||
'less_equal': "less than or equal to",
|
'less_equal': "less than or equal to",
|
||||||
'is_empty': "is empty",
|
|
||||||
'is_not_empty': "is not empty",
|
|
||||||
'between': "between",
|
|
||||||
'is_null': "is null",
|
'is_null': "is null",
|
||||||
'is_not_null': "is not null",
|
'is_not_null': "is not null",
|
||||||
'is_true': "is true",
|
'is_true': "is true",
|
||||||
'is_false': "is false",
|
'is_false': "is false",
|
||||||
'is_false_null': "is false or null",
|
|
||||||
'is_empty_or_null': "is either empty or null",
|
|
||||||
'contains': "contains",
|
'contains': "contains",
|
||||||
'does_not_contain': "does not contain",
|
'does_not_contain': "does not contain",
|
||||||
'contains_any_of': "contains any of",
|
|
||||||
'is_me': "is me",
|
'is_me': "is me",
|
||||||
'is_not_me': "is not me",
|
'is_not_me': "is not me",
|
||||||
}
|
}
|
||||||
|
|
||||||
valueless_verbs = [
|
valueless_verbs = ['is_any', 'is_null', 'is_not_null', 'is_true', 'is_false',
|
||||||
'is_any',
|
'is_me', 'is_not_me']
|
||||||
'is_empty',
|
|
||||||
'is_not_empty',
|
|
||||||
'is_null',
|
|
||||||
'is_not_null',
|
|
||||||
'is_true',
|
|
||||||
'is_false',
|
|
||||||
'is_false_null',
|
|
||||||
'is_empty_or_null',
|
|
||||||
'is_me',
|
|
||||||
'is_not_me',
|
|
||||||
]
|
|
||||||
|
|
||||||
multiple_value_verbs = [
|
|
||||||
'equal_any_of',
|
|
||||||
'contains_any_of',
|
|
||||||
]
|
|
||||||
|
|
||||||
value_renderer_factory = DefaultValueRenderer
|
value_renderer_factory = DefaultValueRenderer
|
||||||
data_type = 'string' # default, but will be set from value renderer
|
|
||||||
choices = {}
|
|
||||||
|
|
||||||
def __init__(self, key, config=None, label=None, verbs=None,
|
def __init__(self, key, label=None, verbs=None, value_enum=None, value_renderer=None,
|
||||||
value_enum=None, value_renderer=None,
|
|
||||||
default_active=False, default_verb=None, default_value=None,
|
default_active=False, default_verb=None, default_value=None,
|
||||||
encode_values=False, value_encoding='utf-8', **kwargs):
|
encode_values=False, value_encoding='utf-8', **kwargs):
|
||||||
self.key = key
|
self.key = key
|
||||||
self.config = config
|
|
||||||
self.label = label or prettify(key)
|
self.label = label or prettify(key)
|
||||||
|
self.verbs = verbs or self.get_default_verbs()
|
||||||
if value_renderer:
|
if value_renderer:
|
||||||
self.set_value_renderer(value_renderer)
|
self.set_value_renderer(value_renderer)
|
||||||
elif value_enum:
|
elif value_enum:
|
||||||
self.set_choices(value_enum)
|
self.set_value_renderer(EnumValueRenderer(value_enum))
|
||||||
else:
|
else:
|
||||||
self.set_value_renderer(self.value_renderer_factory)
|
self.set_value_renderer(self.value_renderer_factory)
|
||||||
|
|
||||||
# nb. do this after setting choices, if applicable, since that
|
|
||||||
# could change default verbs
|
|
||||||
self.verbs = verbs or self.get_default_verbs()
|
|
||||||
|
|
||||||
self.default_active = default_active
|
self.default_active = default_active
|
||||||
self.default_verb = default_verb
|
self.default_verb = default_verb
|
||||||
self.default_value = default_value
|
self.default_value = default_value
|
||||||
|
@ -215,48 +177,6 @@ class GridFilter(object):
|
||||||
return verbs
|
return verbs
|
||||||
return ['equal', 'not_equal', 'is_null', 'is_not_null', 'is_any']
|
return ['equal', 'not_equal', 'is_null', 'is_not_null', 'is_any']
|
||||||
|
|
||||||
def normalize_choices(self, choices):
|
|
||||||
"""
|
|
||||||
Normalize a set of "choices" to a format suitable for use with the
|
|
||||||
filter.
|
|
||||||
|
|
||||||
:param choices: A collection of "choices" in one of the following
|
|
||||||
formats:
|
|
||||||
|
|
||||||
* simple list, each value of which should be a string, which is
|
|
||||||
assumed to be able to serve as both key and value (ordering of
|
|
||||||
choices will be preserved)
|
|
||||||
* simple dict, keys and values of which will define the choices
|
|
||||||
(note that the final choices will be sorted by key!)
|
|
||||||
* OrderedDict, keys and values of which will define the choices
|
|
||||||
(ordering of choices will be preserved)
|
|
||||||
"""
|
|
||||||
if isinstance(choices, OrderedDict):
|
|
||||||
normalized = choices
|
|
||||||
|
|
||||||
elif isinstance(choices, dict):
|
|
||||||
normalized = OrderedDict([
|
|
||||||
(key, choices[key])
|
|
||||||
for key in sorted(choices)])
|
|
||||||
|
|
||||||
elif isinstance(choices, list):
|
|
||||||
normalized = OrderedDict([
|
|
||||||
(key, key)
|
|
||||||
for key in choices])
|
|
||||||
|
|
||||||
return normalized
|
|
||||||
|
|
||||||
def set_choices(self, choices):
|
|
||||||
"""
|
|
||||||
Set the value choices for the filter. Note that this also will set the
|
|
||||||
value renderer to one which supports choices.
|
|
||||||
|
|
||||||
:param choices: A collection of "choices" which will be normalized by
|
|
||||||
way of :meth:`normalize_choices()`.
|
|
||||||
"""
|
|
||||||
self.choices = self.normalize_choices(choices)
|
|
||||||
self.set_value_renderer(ChoiceValueRenderer(self.choices))
|
|
||||||
|
|
||||||
def set_value_renderer(self, renderer):
|
def set_value_renderer(self, renderer):
|
||||||
"""
|
"""
|
||||||
Set the value renderer for the filter, post-construction.
|
Set the value renderer for the filter, post-construction.
|
||||||
|
@ -265,7 +185,6 @@ class GridFilter(object):
|
||||||
renderer = renderer()
|
renderer = renderer()
|
||||||
renderer.filter = self
|
renderer.filter = self
|
||||||
self.value_renderer = renderer
|
self.value_renderer = renderer
|
||||||
self.data_type = renderer.data_type
|
|
||||||
|
|
||||||
def filter(self, data, verb=None, value=UNSPECIFIED):
|
def filter(self, data, verb=None, value=UNSPECIFIED):
|
||||||
"""
|
"""
|
||||||
|
@ -277,15 +196,14 @@ class GridFilter(object):
|
||||||
value = self.get_value(value)
|
value = self.get_value(value)
|
||||||
filtr = getattr(self, 'filter_{0}'.format(verb), None)
|
filtr = getattr(self, 'filter_{0}'.format(verb), None)
|
||||||
if not filtr:
|
if not filtr:
|
||||||
log.warning("unknown filter verb: %s", verb)
|
raise ValueError("Unknown filter verb: {0}".format(repr(verb)))
|
||||||
return data
|
|
||||||
return filtr(data, value)
|
return filtr(data, value)
|
||||||
|
|
||||||
def get_value(self, value=UNSPECIFIED):
|
def get_value(self, value=UNSPECIFIED):
|
||||||
return value if value is not UNSPECIFIED else self.value
|
return value if value is not UNSPECIFIED else self.value
|
||||||
|
|
||||||
def encode_value(self, value):
|
def encode_value(self, value):
|
||||||
if self.encode_values and isinstance(value, str):
|
if self.encode_values and isinstance(value, six.string_types):
|
||||||
return value.encode('utf-8')
|
return value.encode('utf-8')
|
||||||
return value
|
return value
|
||||||
|
|
||||||
|
@ -307,6 +225,18 @@ class GridFilter(object):
|
||||||
return self.value_renderer.render(value=value, **kwargs)
|
return self.value_renderer.render(value=value, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
|
class MobileFilter(GridFilter):
|
||||||
|
"""
|
||||||
|
Base class for mobile grid filters.
|
||||||
|
"""
|
||||||
|
default_verbs = ['equal']
|
||||||
|
|
||||||
|
def __init__(self, key, **kwargs):
|
||||||
|
kwargs.setdefault('default_active', True)
|
||||||
|
kwargs.setdefault('default_verb', 'equal')
|
||||||
|
super(MobileFilter, self).__init__(key, **kwargs)
|
||||||
|
|
||||||
|
|
||||||
class AlchemyGridFilter(GridFilter):
|
class AlchemyGridFilter(GridFilter):
|
||||||
"""
|
"""
|
||||||
Base class for SQLAlchemy grid filters.
|
Base class for SQLAlchemy grid filters.
|
||||||
|
@ -314,7 +244,7 @@ class AlchemyGridFilter(GridFilter):
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
def __init__(self, *args, **kwargs):
|
||||||
self.column = kwargs.pop('column')
|
self.column = kwargs.pop('column')
|
||||||
super().__init__(*args, **kwargs)
|
super(AlchemyGridFilter, self).__init__(*args, **kwargs)
|
||||||
|
|
||||||
def filter_equal(self, query, value):
|
def filter_equal(self, query, value):
|
||||||
"""
|
"""
|
||||||
|
@ -338,38 +268,6 @@ class AlchemyGridFilter(GridFilter):
|
||||||
self.column != self.encode_value(value),
|
self.column != self.encode_value(value),
|
||||||
))
|
))
|
||||||
|
|
||||||
def filter_equal_any_of(self, query, value):
|
|
||||||
"""
|
|
||||||
This filter expects "multiple values" separated by newline
|
|
||||||
character, and will add an "OR" condition with each value
|
|
||||||
being checked separately. For instance if the user submits a
|
|
||||||
"value" like this:
|
|
||||||
|
|
||||||
.. code-block:: none
|
|
||||||
|
|
||||||
foo bar
|
|
||||||
baz
|
|
||||||
|
|
||||||
This will result in SQL condition like this:
|
|
||||||
|
|
||||||
.. code-block:: sql
|
|
||||||
|
|
||||||
name = 'foo bar' OR name = 'baz'
|
|
||||||
"""
|
|
||||||
if not value:
|
|
||||||
return query
|
|
||||||
|
|
||||||
values = value.split('\n')
|
|
||||||
values = [value for value in values if value]
|
|
||||||
if not values:
|
|
||||||
return query
|
|
||||||
|
|
||||||
conditions = []
|
|
||||||
for value in values:
|
|
||||||
conditions.append(self.column == self.encode_value(value))
|
|
||||||
|
|
||||||
return query.filter(sa.or_(*conditions))
|
|
||||||
|
|
||||||
def filter_is_null(self, query, value):
|
def filter_is_null(self, query, value):
|
||||||
"""
|
"""
|
||||||
Filter data with an 'IS NULL' query. Note that this filter does not
|
Filter data with an 'IS NULL' query. Note that this filter does not
|
||||||
|
@ -416,47 +314,6 @@ class AlchemyGridFilter(GridFilter):
|
||||||
return query
|
return query
|
||||||
return query.filter(self.column <= self.encode_value(value))
|
return query.filter(self.column <= self.encode_value(value))
|
||||||
|
|
||||||
def filter_between(self, query, value):
|
|
||||||
"""
|
|
||||||
Filter data with a "between" query. Really this uses ">=" and
|
|
||||||
"<=" (inclusive) logic instead of SQL "between" keyword.
|
|
||||||
"""
|
|
||||||
if value is None or value == '':
|
|
||||||
return query
|
|
||||||
|
|
||||||
if '|' not in value:
|
|
||||||
return query
|
|
||||||
|
|
||||||
values = value.split('|')
|
|
||||||
if len(values) != 2:
|
|
||||||
return query
|
|
||||||
|
|
||||||
start_value, end_value = values
|
|
||||||
|
|
||||||
# we'll only filter if we have start and/or end value
|
|
||||||
if not start_value and not end_value:
|
|
||||||
return query
|
|
||||||
|
|
||||||
return self.filter_for_range(query, start_value, end_value)
|
|
||||||
|
|
||||||
def filter_for_range(self, query, start_value, end_value):
|
|
||||||
"""
|
|
||||||
This method should actually apply filter(s) to the query,
|
|
||||||
according to the given value range. Subclasses may override
|
|
||||||
this logic.
|
|
||||||
"""
|
|
||||||
if start_value:
|
|
||||||
if self.value_invalid(start_value):
|
|
||||||
return query
|
|
||||||
query = query.filter(self.column >= self.encode_value(start_value))
|
|
||||||
|
|
||||||
if end_value:
|
|
||||||
if self.value_invalid(end_value):
|
|
||||||
return query
|
|
||||||
query = query.filter(self.column <= self.encode_value(end_value))
|
|
||||||
|
|
||||||
return query
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyStringFilter(AlchemyGridFilter):
|
class AlchemyStringFilter(AlchemyGridFilter):
|
||||||
"""
|
"""
|
||||||
|
@ -467,17 +324,8 @@ class AlchemyStringFilter(AlchemyGridFilter):
|
||||||
"""
|
"""
|
||||||
Expose contains / does-not-contain verbs in addition to core.
|
Expose contains / does-not-contain verbs in addition to core.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
if self.choices:
|
|
||||||
return ['equal', 'not_equal', 'is_null', 'is_not_null', 'is_any']
|
|
||||||
|
|
||||||
return ['contains', 'does_not_contain',
|
return ['contains', 'does_not_contain',
|
||||||
'contains_any_of',
|
'equal', 'not_equal', 'is_null', 'is_not_null', 'is_any']
|
||||||
'equal', 'not_equal', 'equal_any_of',
|
|
||||||
'is_empty', 'is_not_empty',
|
|
||||||
'is_null', 'is_not_null',
|
|
||||||
'is_empty_or_null',
|
|
||||||
'is_any']
|
|
||||||
|
|
||||||
def filter_contains(self, query, value):
|
def filter_contains(self, query, value):
|
||||||
"""
|
"""
|
||||||
|
@ -485,13 +333,9 @@ class AlchemyStringFilter(AlchemyGridFilter):
|
||||||
"""
|
"""
|
||||||
if value is None or value == '':
|
if value is None or value == '':
|
||||||
return query
|
return query
|
||||||
|
return query.filter(sa.and_(
|
||||||
criteria = []
|
*[self.column.ilike(self.encode_value('%{}%'.format(v)))
|
||||||
for val in value.split():
|
for v in value.split()]))
|
||||||
val = val.replace('_', r'\_')
|
|
||||||
val = self.encode_value(f'%{val}%')
|
|
||||||
criteria.append(self.column.ilike(val))
|
|
||||||
return query.filter(sa.and_(*criteria))
|
|
||||||
|
|
||||||
def filter_does_not_contain(self, query, value):
|
def filter_does_not_contain(self, query, value):
|
||||||
"""
|
"""
|
||||||
|
@ -500,65 +344,14 @@ class AlchemyStringFilter(AlchemyGridFilter):
|
||||||
if value is None or value == '':
|
if value is None or value == '':
|
||||||
return query
|
return query
|
||||||
|
|
||||||
criteria = []
|
|
||||||
for val in value.split():
|
|
||||||
val = val.replace('_', r'\_')
|
|
||||||
val = self.encode_value(f'%{val}%')
|
|
||||||
criteria.append(~self.column.ilike(val))
|
|
||||||
|
|
||||||
# When saying something is 'not like' something else, we must also
|
# When saying something is 'not like' something else, we must also
|
||||||
# include things which are nothing at all, in our result set.
|
# include things which are nothing at all, in our result set.
|
||||||
return query.filter(sa.or_(
|
return query.filter(sa.or_(
|
||||||
self.column == None,
|
self.column == None,
|
||||||
sa.and_(*criteria)))
|
sa.and_(
|
||||||
|
*[~self.column.ilike(self.encode_value('%{}%'.format(v)))
|
||||||
def filter_contains_any_of(self, query, value):
|
for v in value.split()]),
|
||||||
"""
|
))
|
||||||
This filter expects "multiple values" separated by newline character,
|
|
||||||
and will add an "OR" condition with each value being checked via
|
|
||||||
"ILIKE". For instance if the user submits a "value" like this:
|
|
||||||
|
|
||||||
.. code-block:: none
|
|
||||||
|
|
||||||
foo bar
|
|
||||||
baz
|
|
||||||
|
|
||||||
This will result in SQL condition like this:
|
|
||||||
|
|
||||||
.. code-block:: sql
|
|
||||||
|
|
||||||
(name ILIKE '%foo%' AND name ILIKE '%bar%') OR name ILIKE '%baz%'
|
|
||||||
"""
|
|
||||||
if not value:
|
|
||||||
return query
|
|
||||||
|
|
||||||
values = value.split('\n')
|
|
||||||
values = [value for value in values if value]
|
|
||||||
if not values:
|
|
||||||
return query
|
|
||||||
|
|
||||||
conditions = []
|
|
||||||
for value in values:
|
|
||||||
criteria = []
|
|
||||||
for val in value.split():
|
|
||||||
val = val.replace('_', r'\_')
|
|
||||||
val = self.encode_value(f'%{val}%')
|
|
||||||
criteria.append(self.column.ilike(val))
|
|
||||||
conditions.append(sa.and_(*criteria))
|
|
||||||
|
|
||||||
return query.filter(sa.or_(*conditions))
|
|
||||||
|
|
||||||
def filter_is_empty(self, query, value):
|
|
||||||
return query.filter(sa.func.ltrim(sa.func.rtrim(self.column)) == self.encode_value(''))
|
|
||||||
|
|
||||||
def filter_is_not_empty(self, query, value):
|
|
||||||
return query.filter(sa.func.ltrim(sa.func.rtrim(self.column)) != self.encode_value(''))
|
|
||||||
|
|
||||||
def filter_is_empty_or_null(self, query, value):
|
|
||||||
return query.filter(
|
|
||||||
sa.or_(
|
|
||||||
sa.func.ltrim(sa.func.rtrim(self.column)) == self.encode_value(''),
|
|
||||||
self.column == None))
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyEmptyStringFilter(AlchemyStringFilter):
|
class AlchemyEmptyStringFilter(AlchemyStringFilter):
|
||||||
|
@ -570,13 +363,13 @@ class AlchemyEmptyStringFilter(AlchemyStringFilter):
|
||||||
return query.filter(
|
return query.filter(
|
||||||
sa.or_(
|
sa.or_(
|
||||||
self.column == None,
|
self.column == None,
|
||||||
sa.func.ltrim(sa.func.rtrim(self.column)) == self.encode_value('')))
|
sa.func.trim(self.column) == self.encode_value('')))
|
||||||
|
|
||||||
def filter_is_not_null(self, query, value):
|
def filter_is_not_null(self, query, value):
|
||||||
return query.filter(
|
return query.filter(
|
||||||
sa.and_(
|
sa.and_(
|
||||||
self.column != None,
|
self.column != None,
|
||||||
sa.func.ltrim(sa.func.rtrim(self.column)) != self.encode_value('')))
|
sa.func.trim(self.column) != self.encode_value('')))
|
||||||
|
|
||||||
|
|
||||||
class AlchemyByteStringFilter(AlchemyStringFilter):
|
class AlchemyByteStringFilter(AlchemyStringFilter):
|
||||||
|
@ -588,8 +381,8 @@ class AlchemyByteStringFilter(AlchemyStringFilter):
|
||||||
value_encoding = 'utf-8'
|
value_encoding = 'utf-8'
|
||||||
|
|
||||||
def get_value(self, value=UNSPECIFIED):
|
def get_value(self, value=UNSPECIFIED):
|
||||||
value = super().get_value(value)
|
value = super(AlchemyByteStringFilter, self).get_value(value)
|
||||||
if isinstance(value, str):
|
if isinstance(value, six.text_type):
|
||||||
value = value.encode(self.value_encoding)
|
value = value.encode(self.value_encoding)
|
||||||
return value
|
return value
|
||||||
|
|
||||||
|
@ -599,13 +392,8 @@ class AlchemyByteStringFilter(AlchemyStringFilter):
|
||||||
"""
|
"""
|
||||||
if value is None or value == '':
|
if value is None or value == '':
|
||||||
return query
|
return query
|
||||||
|
return query.filter(sa.and_(
|
||||||
criteria = []
|
*[self.column.ilike(b'%{}%'.format(v)) for v in value.split()]))
|
||||||
for val in value.split():
|
|
||||||
val = val.replace('_', r'\_')
|
|
||||||
val = b'%{}%'.format(val)
|
|
||||||
criteria.append(self.column.ilike(val))
|
|
||||||
return query.filters(sa.and_(*criteria))
|
|
||||||
|
|
||||||
def filter_does_not_contain(self, query, value):
|
def filter_does_not_contain(self, query, value):
|
||||||
"""
|
"""
|
||||||
|
@ -614,16 +402,13 @@ class AlchemyByteStringFilter(AlchemyStringFilter):
|
||||||
if value is None or value == '':
|
if value is None or value == '':
|
||||||
return query
|
return query
|
||||||
|
|
||||||
for val in value.split():
|
|
||||||
val = val.replace('_', '\_')
|
|
||||||
val = b'%{}%'.format(val)
|
|
||||||
criteria.append(~self.column.ilike(val))
|
|
||||||
|
|
||||||
# When saying something is 'not like' something else, we must also
|
# When saying something is 'not like' something else, we must also
|
||||||
# include things which are nothing at all, in our result set.
|
# include things which are nothing at all, in our result set.
|
||||||
return query.filter(sa.or_(
|
return query.filter(sa.or_(
|
||||||
self.column == None,
|
self.column == None,
|
||||||
sa.and_(*criteria)))
|
sa.and_(
|
||||||
|
*[~self.column.ilike(b'%{}%'.format(v)) for v in value.split()]),
|
||||||
|
))
|
||||||
|
|
||||||
|
|
||||||
class AlchemyNumericFilter(AlchemyGridFilter):
|
class AlchemyNumericFilter(AlchemyGridFilter):
|
||||||
|
@ -632,11 +417,9 @@ class AlchemyNumericFilter(AlchemyGridFilter):
|
||||||
"""
|
"""
|
||||||
value_renderer_factory = NumericValueRenderer
|
value_renderer_factory = NumericValueRenderer
|
||||||
|
|
||||||
def default_verbs(self):
|
# expose greater-than / less-than verbs in addition to core
|
||||||
# expose greater-than / less-than verbs in addition to core
|
default_verbs = ['equal', 'not_equal', 'greater_than', 'greater_equal',
|
||||||
return ['equal', 'not_equal', 'greater_than', 'greater_equal',
|
'less_than', 'less_equal', 'is_null', 'is_not_null', 'is_any']
|
||||||
'less_than', 'less_equal', 'between',
|
|
||||||
'is_null', 'is_not_null', 'is_any']
|
|
||||||
|
|
||||||
# TODO: what follows "works" in that it prevents an error...but from the
|
# TODO: what follows "works" in that it prevents an error...but from the
|
||||||
# user's perspective it still fails silently...need to improve on front-end
|
# user's perspective it still fails silently...need to improve on front-end
|
||||||
|
@ -645,69 +428,43 @@ class AlchemyNumericFilter(AlchemyGridFilter):
|
||||||
# term for integer field...
|
# term for integer field...
|
||||||
|
|
||||||
def value_invalid(self, value):
|
def value_invalid(self, value):
|
||||||
|
return bool(value and len(six.text_type(value)) > 8)
|
||||||
# first just make sure it's somewhat numeric
|
|
||||||
try:
|
|
||||||
self.parse_decimal(value)
|
|
||||||
except decimal.InvalidOperation:
|
|
||||||
return True
|
|
||||||
|
|
||||||
return bool(value and len(str(value)) > 8)
|
|
||||||
|
|
||||||
def parse_decimal(self, value):
|
|
||||||
if value:
|
|
||||||
value = value.replace(',', '')
|
|
||||||
return decimal.Decimal(value)
|
|
||||||
|
|
||||||
def encode_value(self, value):
|
|
||||||
if value:
|
|
||||||
value = str(self.parse_decimal(value))
|
|
||||||
return super().encode_value(value)
|
|
||||||
|
|
||||||
def filter_equal(self, query, value):
|
def filter_equal(self, query, value):
|
||||||
if self.value_invalid(value):
|
if self.value_invalid(value):
|
||||||
return query
|
return query
|
||||||
return super().filter_equal(query, value)
|
return super(AlchemyNumericFilter, self).filter_equal(query, value)
|
||||||
|
|
||||||
def filter_not_equal(self, query, value):
|
def filter_not_equal(self, query, value):
|
||||||
if self.value_invalid(value):
|
if self.value_invalid(value):
|
||||||
return query
|
return query
|
||||||
return super().filter_not_equal(query, value)
|
return super(AlchemyNumericFilter, self).filter_not_equal(query, value)
|
||||||
|
|
||||||
def filter_greater_than(self, query, value):
|
def filter_greater_than(self, query, value):
|
||||||
if self.value_invalid(value):
|
if self.value_invalid(value):
|
||||||
return query
|
return query
|
||||||
return super().filter_greater_than(query, value)
|
return super(AlchemyNumericFilter, self).filter_greater_than(query, value)
|
||||||
|
|
||||||
def filter_greater_equal(self, query, value):
|
def filter_greater_equal(self, query, value):
|
||||||
if self.value_invalid(value):
|
if self.value_invalid(value):
|
||||||
return query
|
return query
|
||||||
return super().filter_greater_equal(query, value)
|
return super(AlchemyNumericFilter, self).filter_greater_equal(query, value)
|
||||||
|
|
||||||
def filter_less_than(self, query, value):
|
def filter_less_than(self, query, value):
|
||||||
if self.value_invalid(value):
|
if self.value_invalid(value):
|
||||||
return query
|
return query
|
||||||
return super().filter_less_than(query, value)
|
return super(AlchemyNumericFilter, self).filter_less_than(query, value)
|
||||||
|
|
||||||
def filter_less_equal(self, query, value):
|
def filter_less_equal(self, query, value):
|
||||||
if self.value_invalid(value):
|
if self.value_invalid(value):
|
||||||
return query
|
return query
|
||||||
return super().filter_less_equal(query, value)
|
return super(AlchemyNumericFilter, self).filter_less_equal(query, value)
|
||||||
|
|
||||||
|
|
||||||
class AlchemyIntegerFilter(AlchemyNumericFilter):
|
class AlchemyIntegerFilter(AlchemyNumericFilter):
|
||||||
"""
|
"""
|
||||||
Integer filter for SQLAlchemy.
|
Integer filter for SQLAlchemy.
|
||||||
"""
|
"""
|
||||||
bigint = False
|
|
||||||
|
|
||||||
def default_verbs(self):
|
|
||||||
|
|
||||||
# limited verbs if choices are defined
|
|
||||||
if self.choices:
|
|
||||||
return ['equal', 'not_equal', 'is_null', 'is_not_null', 'is_any']
|
|
||||||
|
|
||||||
return super().default_verbs()
|
|
||||||
|
|
||||||
def value_invalid(self, value):
|
def value_invalid(self, value):
|
||||||
if value:
|
if value:
|
||||||
|
@ -715,25 +472,12 @@ class AlchemyIntegerFilter(AlchemyNumericFilter):
|
||||||
return True
|
return True
|
||||||
if not value.isdigit():
|
if not value.isdigit():
|
||||||
return True
|
return True
|
||||||
# normal Integer columns have a max value, beyond which PG
|
# TODO: this one is to avoid DataError from PG, but perhaps that
|
||||||
# will throw an error if we try to query for larger values
|
# isn't a good enough reason to make this global logic?
|
||||||
# TODO: this seems hacky, how to better handle it?
|
if int(value) > 2147483647:
|
||||||
if not self.bigint and int(value) > 2147483647:
|
|
||||||
return True
|
return True
|
||||||
return False
|
return False
|
||||||
|
|
||||||
def encode_value(self, value):
|
|
||||||
# ensure we pass integer value to sqlalchemy, so it does not try to
|
|
||||||
# encode it as a string etc.
|
|
||||||
return int(value)
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyBigIntegerFilter(AlchemyIntegerFilter):
|
|
||||||
"""
|
|
||||||
BigInteger filter for SQLAlchemy.
|
|
||||||
"""
|
|
||||||
bigint = True
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyBooleanFilter(AlchemyGridFilter):
|
class AlchemyBooleanFilter(AlchemyGridFilter):
|
||||||
"""
|
"""
|
||||||
|
@ -760,16 +504,7 @@ class AlchemyNullableBooleanFilter(AlchemyBooleanFilter):
|
||||||
"""
|
"""
|
||||||
Boolean filter for SQLAlchemy which is NULL-aware.
|
Boolean filter for SQLAlchemy which is NULL-aware.
|
||||||
"""
|
"""
|
||||||
default_verbs = ['is_true', 'is_false', 'is_false_null',
|
default_verbs = ['is_true', 'is_false', 'is_null', 'is_not_null', 'is_any']
|
||||||
'is_null', 'is_not_null', 'is_any']
|
|
||||||
|
|
||||||
def filter_is_false_null(self, query, value):
|
|
||||||
"""
|
|
||||||
Filter data with an "is false or null" query. Note that this filter
|
|
||||||
does not use the value for anything.
|
|
||||||
"""
|
|
||||||
return query.filter(sa.or_(self.column == False,
|
|
||||||
self.column == None))
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyDateFilter(AlchemyGridFilter):
|
class AlchemyDateFilter(AlchemyGridFilter):
|
||||||
|
@ -785,7 +520,6 @@ class AlchemyDateFilter(AlchemyGridFilter):
|
||||||
'greater_equal': "on or after",
|
'greater_equal': "on or after",
|
||||||
'less_than': "before",
|
'less_than': "before",
|
||||||
'less_equal': "on or before",
|
'less_equal': "on or before",
|
||||||
'between': "between",
|
|
||||||
'is_null': "is null",
|
'is_null': "is null",
|
||||||
'is_not_null': "is not null",
|
'is_not_null': "is not null",
|
||||||
'is_any': "is any",
|
'is_any': "is any",
|
||||||
|
@ -795,27 +529,14 @@ class AlchemyDateFilter(AlchemyGridFilter):
|
||||||
"""
|
"""
|
||||||
Expose greater-than / less-than verbs in addition to core.
|
Expose greater-than / less-than verbs in addition to core.
|
||||||
"""
|
"""
|
||||||
return [
|
return ['equal', 'not_equal', 'greater_than', 'greater_equal',
|
||||||
'equal',
|
'less_than', 'less_equal', 'is_null', 'is_not_null', 'is_any']
|
||||||
'not_equal',
|
|
||||||
'greater_than',
|
|
||||||
'greater_equal',
|
|
||||||
'less_than',
|
|
||||||
'less_equal',
|
|
||||||
'between',
|
|
||||||
'is_null',
|
|
||||||
'is_not_null',
|
|
||||||
'is_any',
|
|
||||||
]
|
|
||||||
|
|
||||||
def make_date(self, value):
|
def make_date(self, value):
|
||||||
"""
|
"""
|
||||||
Convert user input to a proper ``datetime.date`` object.
|
Convert user input to a proper ``datetime.date`` object.
|
||||||
"""
|
"""
|
||||||
if value:
|
if value:
|
||||||
if isinstance(value, datetime.date):
|
|
||||||
return value
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
dt = datetime.datetime.strptime(value, '%Y-%m-%d')
|
dt = datetime.datetime.strptime(value, '%Y-%m-%d')
|
||||||
except ValueError:
|
except ValueError:
|
||||||
|
@ -823,87 +544,6 @@ class AlchemyDateFilter(AlchemyGridFilter):
|
||||||
else:
|
else:
|
||||||
return dt.date()
|
return dt.date()
|
||||||
|
|
||||||
def filter_equal(self, query, value):
|
|
||||||
date = self.make_date(value)
|
|
||||||
if not date:
|
|
||||||
return query
|
|
||||||
|
|
||||||
return query.filter(self.column == self.encode_value(date))
|
|
||||||
|
|
||||||
def filter_not_equal(self, query, value):
|
|
||||||
date = self.make_date(value)
|
|
||||||
if not date:
|
|
||||||
return query
|
|
||||||
|
|
||||||
return query.filter(sa.or_(
|
|
||||||
self.column == None,
|
|
||||||
self.column != self.encode_value(date),
|
|
||||||
))
|
|
||||||
|
|
||||||
def filter_greater_than(self, query, value):
|
|
||||||
date = self.make_date(value)
|
|
||||||
if not date:
|
|
||||||
return query
|
|
||||||
return query.filter(self.column > self.encode_value(date))
|
|
||||||
|
|
||||||
def filter_greater_equal(self, query, value):
|
|
||||||
date = self.make_date(value)
|
|
||||||
if not date:
|
|
||||||
return query
|
|
||||||
return query.filter(self.column >= self.encode_value(date))
|
|
||||||
|
|
||||||
def filter_less_than(self, query, value):
|
|
||||||
date = self.make_date(value)
|
|
||||||
if not date:
|
|
||||||
return query
|
|
||||||
return query.filter(self.column < self.encode_value(date))
|
|
||||||
|
|
||||||
def filter_less_equal(self, query, value):
|
|
||||||
date = self.make_date(value)
|
|
||||||
if not date:
|
|
||||||
return query
|
|
||||||
return query.filter(self.column <= self.encode_value(date))
|
|
||||||
|
|
||||||
# TODO: this should be merged into parent class
|
|
||||||
def filter_between(self, query, value):
|
|
||||||
"""
|
|
||||||
Filter data with a "between" query. Really this uses ">=" and "<="
|
|
||||||
(inclusive) logic instead of SQL "between" keyword.
|
|
||||||
"""
|
|
||||||
if value is None or value == '':
|
|
||||||
return query
|
|
||||||
|
|
||||||
if '|' not in value:
|
|
||||||
return query
|
|
||||||
|
|
||||||
values = value.split('|')
|
|
||||||
if len(values) != 2:
|
|
||||||
return query
|
|
||||||
|
|
||||||
start_date, end_date = values
|
|
||||||
if start_date:
|
|
||||||
start_date = self.make_date(start_date)
|
|
||||||
if end_date:
|
|
||||||
end_date = self.make_date(end_date)
|
|
||||||
|
|
||||||
# we'll only filter if we have start and/or end date
|
|
||||||
if not start_date and not end_date:
|
|
||||||
return query
|
|
||||||
|
|
||||||
return self.filter_date_range(query, start_date, end_date)
|
|
||||||
|
|
||||||
# TODO: this should be merged into parent class
|
|
||||||
def filter_date_range(self, query, start_date, end_date):
|
|
||||||
"""
|
|
||||||
This method should actually apply filter(s) to the query, according to
|
|
||||||
the given date range. Subclasses may override this logic.
|
|
||||||
"""
|
|
||||||
if start_date:
|
|
||||||
query = query.filter(self.column >= start_date)
|
|
||||||
if end_date:
|
|
||||||
query = query.filter(self.column <= end_date)
|
|
||||||
return query
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyDateTimeFilter(AlchemyDateFilter):
|
class AlchemyDateTimeFilter(AlchemyDateFilter):
|
||||||
"""
|
"""
|
||||||
|
@ -993,17 +633,6 @@ class AlchemyDateTimeFilter(AlchemyDateFilter):
|
||||||
time = make_utc(localtime(self.config, time))
|
time = make_utc(localtime(self.config, time))
|
||||||
return query.filter(self.column < time)
|
return query.filter(self.column < time)
|
||||||
|
|
||||||
def filter_date_range(self, query, start_date, end_date):
|
|
||||||
if start_date:
|
|
||||||
start_time = datetime.datetime.combine(start_date, datetime.time(0))
|
|
||||||
start_time = localtime(self.config, start_time)
|
|
||||||
query = query.filter(self.column >= make_utc(start_time))
|
|
||||||
if end_date:
|
|
||||||
end_time = datetime.datetime.combine(end_date + datetime.timedelta(days=1), datetime.time(0))
|
|
||||||
end_time = localtime(self.config, end_time)
|
|
||||||
query = query.filter(self.column <= make_utc(end_time))
|
|
||||||
return query
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyLocalDateTimeFilter(AlchemyDateTimeFilter):
|
class AlchemyLocalDateTimeFilter(AlchemyDateTimeFilter):
|
||||||
"""
|
"""
|
||||||
|
@ -1094,36 +723,19 @@ class AlchemyLocalDateTimeFilter(AlchemyDateTimeFilter):
|
||||||
time = localtime(self.config, time, tzinfo=False)
|
time = localtime(self.config, time, tzinfo=False)
|
||||||
return query.filter(self.column < time)
|
return query.filter(self.column < time)
|
||||||
|
|
||||||
def filter_date_range(self, query, start_date, end_date):
|
|
||||||
if start_date:
|
|
||||||
start_time = datetime.datetime.combine(start_date, datetime.time(0))
|
|
||||||
start_time = localtime(self.config, start_time, tzinfo=False)
|
|
||||||
query = query.filter(self.column >= start_time)
|
|
||||||
if end_date:
|
|
||||||
end_time = datetime.datetime.combine(end_date + datetime.timedelta(days=1), datetime.time(0))
|
|
||||||
end_time = localtime(self.config, end_time, tzinfo=False)
|
|
||||||
query = query.filter(self.column <= end_time)
|
|
||||||
return query
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyGPCFilter(AlchemyGridFilter):
|
class AlchemyGPCFilter(AlchemyGridFilter):
|
||||||
"""
|
"""
|
||||||
GPC filter for SQLAlchemy.
|
GPC filter for SQLAlchemy.
|
||||||
"""
|
"""
|
||||||
default_verbs = ['equal', 'not_equal', 'equal_any_of',
|
default_verbs = ['equal', 'not_equal']
|
||||||
'is_null', 'is_not_null']
|
|
||||||
|
|
||||||
def filter_equal(self, query, value):
|
def filter_equal(self, query, value):
|
||||||
"""
|
"""
|
||||||
Filter data with an equal ('=') query.
|
Filter data with an equal ('=') query.
|
||||||
"""
|
"""
|
||||||
if value is None:
|
if value is None or value == '':
|
||||||
return query
|
return query
|
||||||
|
|
||||||
value = value.strip()
|
|
||||||
if not value:
|
|
||||||
return query
|
|
||||||
|
|
||||||
try:
|
try:
|
||||||
return query.filter(self.column.in_((
|
return query.filter(self.column.in_((
|
||||||
GPC(value),
|
GPC(value),
|
||||||
|
@ -1133,13 +745,9 @@ class AlchemyGPCFilter(AlchemyGridFilter):
|
||||||
|
|
||||||
def filter_not_equal(self, query, value):
|
def filter_not_equal(self, query, value):
|
||||||
"""
|
"""
|
||||||
Filter data with a not equal ('!=') query.
|
Filter data with a not eqaul ('!=') query.
|
||||||
"""
|
"""
|
||||||
if value is None:
|
if value is None or value == '':
|
||||||
return query
|
|
||||||
|
|
||||||
value = value.strip()
|
|
||||||
if not value:
|
|
||||||
return query
|
return query
|
||||||
|
|
||||||
# When saying something is 'not equal' to something else, we must also
|
# When saying something is 'not equal' to something else, we must also
|
||||||
|
@ -1153,114 +761,12 @@ class AlchemyGPCFilter(AlchemyGridFilter):
|
||||||
except ValueError:
|
except ValueError:
|
||||||
return query
|
return query
|
||||||
|
|
||||||
def filter_equal_any_of(self, query, value):
|
|
||||||
"""
|
|
||||||
This filter expects "multiple values" separated by newline character,
|
|
||||||
and will add an "OR" condition with each value being checked via
|
|
||||||
"ILIKE". For instance if the user submits a "value" like this:
|
|
||||||
|
|
||||||
.. code-block:: none
|
|
||||||
|
|
||||||
07430500132
|
|
||||||
07430500116
|
|
||||||
|
|
||||||
This will result in SQL condition like this:
|
|
||||||
|
|
||||||
.. code-block:: sql
|
|
||||||
|
|
||||||
(upc IN (7430500132, 74305001321)) OR (upc IN (7430500116, 74305001161))
|
|
||||||
"""
|
|
||||||
if not value:
|
|
||||||
return query
|
|
||||||
|
|
||||||
values = value.split('\n')
|
|
||||||
values = [value for value in values if value]
|
|
||||||
if not values:
|
|
||||||
return query
|
|
||||||
|
|
||||||
conditions = []
|
|
||||||
for value in values:
|
|
||||||
try:
|
|
||||||
clause = self.column.in_((
|
|
||||||
GPC(value),
|
|
||||||
GPC(value, calc_check_digit='upc')))
|
|
||||||
except ValueError:
|
|
||||||
pass
|
|
||||||
else:
|
|
||||||
conditions.append(clause)
|
|
||||||
|
|
||||||
if not conditions:
|
|
||||||
return query
|
|
||||||
|
|
||||||
return query.filter(sa.or_(*conditions))
|
|
||||||
|
|
||||||
|
|
||||||
class AlchemyPhoneNumberFilter(AlchemyStringFilter):
|
|
||||||
"""
|
|
||||||
Special string filter, with logic to deal with phone numbers.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def parse_value(self, value):
|
|
||||||
newvalue = None
|
|
||||||
|
|
||||||
# first we try to split according to typical 7- or 10-digit number
|
|
||||||
digits = re.sub(r'\D', '', value or '')
|
|
||||||
if len(digits) == 7:
|
|
||||||
newvalue = "{} {}".format(digits[:3], digits[3:])
|
|
||||||
elif len(digits) == 10:
|
|
||||||
newvalue = "{} {} {}".format(digits[:3], digits[3:6], digits[6:])
|
|
||||||
|
|
||||||
# if that didn't work, we can also try to split by grouped digits
|
|
||||||
if not newvalue and value:
|
|
||||||
parts = re.split(r'\D+', value)
|
|
||||||
newvalue = ' '.join(parts)
|
|
||||||
|
|
||||||
return newvalue or value
|
|
||||||
|
|
||||||
def filter_contains(self, query, value):
|
|
||||||
"""
|
|
||||||
Try to parse the value into "parts" of a phone number, then do a normal
|
|
||||||
'ILIKE' query with those parts.
|
|
||||||
"""
|
|
||||||
value = self.parse_value(value)
|
|
||||||
return super().filter_contains(query, value)
|
|
||||||
|
|
||||||
def filter_does_not_contain(self, query, value):
|
|
||||||
"""
|
|
||||||
Try to parse the value into "parts" of a phone number, then do a normal
|
|
||||||
'NOT ILIKE' query with those parts.
|
|
||||||
"""
|
|
||||||
value = self.parse_value(value)
|
|
||||||
return super().filter_does_not_contain(query, value)
|
|
||||||
|
|
||||||
|
|
||||||
class GridFilterSet(OrderedDict):
|
class GridFilterSet(OrderedDict):
|
||||||
"""
|
"""
|
||||||
Collection class for :class:`GridFilter` instances.
|
Collection class for :class:`GridFilter` instances.
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def move_before(self, key, refkey):
|
|
||||||
"""
|
|
||||||
Rearrange underlying key sorting, such that the given ``key`` comes
|
|
||||||
just *before* the given ``refkey``.
|
|
||||||
"""
|
|
||||||
# first must work out the new order for all keys
|
|
||||||
newkeys = []
|
|
||||||
for k in self.keys():
|
|
||||||
if k == key:
|
|
||||||
continue
|
|
||||||
if k == refkey:
|
|
||||||
newkeys.append(key)
|
|
||||||
newkeys.append(refkey)
|
|
||||||
else:
|
|
||||||
newkeys.append(k)
|
|
||||||
|
|
||||||
# then effectively replace dict contents, using new order
|
|
||||||
items = dict(self)
|
|
||||||
self.clear()
|
|
||||||
for k in newkeys:
|
|
||||||
self[k] = items[k]
|
|
||||||
|
|
||||||
|
|
||||||
class GridFiltersForm(forms.Form):
|
class GridFiltersForm(forms.Form):
|
||||||
"""
|
"""
|
||||||
|
@ -1275,7 +781,7 @@ class GridFiltersForm(forms.Form):
|
||||||
node = colander.SchemaNode(colander.String(), name=key)
|
node = colander.SchemaNode(colander.String(), name=key)
|
||||||
schema.add(node)
|
schema.add(node)
|
||||||
kwargs['schema'] = schema
|
kwargs['schema'] = schema
|
||||||
super().__init__(**kwargs)
|
super(GridFiltersForm, self).__init__(**kwargs)
|
||||||
|
|
||||||
def iter_filters(self):
|
def iter_filters(self):
|
||||||
return self.filters.values()
|
return self.filters.values()
|
||||||
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2022 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,30 +21,33 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Trainwreck "default" views (i.e. assuming "default" schema)
|
Mobile Grids
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
from rattail.trainwreck.db.model import defaults as trainwreck
|
from pyramid.renderers import render
|
||||||
|
|
||||||
from tailbone.views.trainwreck import base
|
from .core import Grid
|
||||||
|
|
||||||
|
|
||||||
class TransactionView(base.TransactionView):
|
class MobileGrid(Grid):
|
||||||
"""
|
"""
|
||||||
Master view for Trainwreck transactions
|
Base class for all mobile grids
|
||||||
"""
|
"""
|
||||||
model_class = trainwreck.Transaction
|
|
||||||
model_row_class = trainwreck.TransactionItem
|
|
||||||
|
|
||||||
|
def render_filters(self, template='/mobile/grids/filters_simple.mako', **kwargs):
|
||||||
|
context = kwargs
|
||||||
|
context['request'] = self.request
|
||||||
|
context['grid'] = self
|
||||||
|
return render(template, context)
|
||||||
|
|
||||||
def defaults(config, **kwargs):
|
def render_grid(self, template='/mobile/grids/grid.mako', **kwargs):
|
||||||
base = globals()
|
context = kwargs
|
||||||
|
context['grid'] = self
|
||||||
|
return render(template, context)
|
||||||
|
|
||||||
TransactionView = kwargs.get('TransactionView', base['TransactionView'])
|
def render_complete(self, template='/mobile/grids/complete.mako', **kwargs):
|
||||||
TransactionView.defaults(config)
|
context = kwargs
|
||||||
|
context['grid'] = self
|
||||||
|
return render(template, context)
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -1,82 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Tailbone Handler
|
|
||||||
"""
|
|
||||||
|
|
||||||
import warnings
|
|
||||||
|
|
||||||
from mako.lookup import TemplateLookup
|
|
||||||
|
|
||||||
from rattail.app import GenericHandler
|
|
||||||
from rattail.files import resource_path
|
|
||||||
|
|
||||||
from tailbone.providers import get_all_providers
|
|
||||||
|
|
||||||
|
|
||||||
class TailboneHandler(GenericHandler):
|
|
||||||
"""
|
|
||||||
Base class and default implementation for Tailbone handler.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
|
|
||||||
# TODO: make templates dir configurable?
|
|
||||||
templates = [resource_path('rattail:templates/web')]
|
|
||||||
self.templates = TemplateLookup(directories=templates)
|
|
||||||
|
|
||||||
def get_menu_handler(self, **kwargs):
|
|
||||||
"""
|
|
||||||
DEPRECATED; use
|
|
||||||
:meth:`wuttaweb.handler.WebHandler.get_menu_handler()`
|
|
||||||
instead.
|
|
||||||
"""
|
|
||||||
warnings.warn("TailboneHandler.get_menu_handler() is deprecated; "
|
|
||||||
"please use WebHandler.get_menu_handler() instead",
|
|
||||||
DeprecationWarning, stacklevel=2)
|
|
||||||
|
|
||||||
if not hasattr(self, 'menu_handler'):
|
|
||||||
spec = self.config.get('tailbone.menus', 'handler',
|
|
||||||
default='tailbone.menus:MenuHandler')
|
|
||||||
Handler = self.app.load_object(spec)
|
|
||||||
self.menu_handler = Handler(self.config)
|
|
||||||
self.menu_handler.tb = self
|
|
||||||
return self.menu_handler
|
|
||||||
|
|
||||||
def iter_providers(self):
|
|
||||||
"""
|
|
||||||
Returns an iterator over all registered Tailbone providers.
|
|
||||||
"""
|
|
||||||
providers = get_all_providers(self.config)
|
|
||||||
return providers.values()
|
|
||||||
|
|
||||||
def write_model_view(self, data, path, **kwargs):
|
|
||||||
"""
|
|
||||||
Write code for a new model view, based on the given data dict,
|
|
||||||
to the given path.
|
|
||||||
"""
|
|
||||||
template = self.templates.get_template('/new-model-view.mako')
|
|
||||||
content = template.render(**data)
|
|
||||||
with open(path, 'wt') as f:
|
|
||||||
f.write(content)
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,21 +24,18 @@
|
||||||
Template Context Helpers
|
Template Context Helpers
|
||||||
"""
|
"""
|
||||||
|
|
||||||
# start off with all from wuttaweb
|
from __future__ import unicode_literals, absolute_import
|
||||||
from wuttaweb.helpers import *
|
|
||||||
|
|
||||||
import os
|
|
||||||
import datetime
|
import datetime
|
||||||
from decimal import Decimal
|
from decimal import Decimal
|
||||||
from collections import OrderedDict
|
|
||||||
|
|
||||||
from rattail.time import localtime, make_utc
|
from rattail.time import localtime, make_utc
|
||||||
from rattail.util import pretty_quantity, pretty_hours, hours_as_decimal
|
from rattail.util import pretty_quantity, pretty_hours
|
||||||
from rattail.db.util import maxlen
|
|
||||||
|
|
||||||
from tailbone.util import (pretty_datetime, raw_datetime,
|
from webhelpers2.html import *
|
||||||
render_markdown,
|
from webhelpers2.html.tags import *
|
||||||
route_exists)
|
|
||||||
|
from tailbone.util import csrf_token, pretty_datetime
|
||||||
|
|
||||||
|
|
||||||
def pretty_date(date):
|
def pretty_date(date):
|
||||||
|
|
|
@ -1,772 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
App Menus
|
|
||||||
"""
|
|
||||||
|
|
||||||
import logging
|
|
||||||
import warnings
|
|
||||||
|
|
||||||
from rattail.util import prettify, simple_error
|
|
||||||
|
|
||||||
from webhelpers2.html import tags, HTML
|
|
||||||
|
|
||||||
from wuttaweb.menus import MenuHandler as WuttaMenuHandler
|
|
||||||
|
|
||||||
from tailbone.db import Session
|
|
||||||
|
|
||||||
|
|
||||||
log = logging.getLogger(__name__)
|
|
||||||
|
|
||||||
|
|
||||||
class TailboneMenuHandler(WuttaMenuHandler):
|
|
||||||
"""
|
|
||||||
Base class and default implementation for menu handler.
|
|
||||||
"""
|
|
||||||
|
|
||||||
##############################
|
|
||||||
# internal methods
|
|
||||||
##############################
|
|
||||||
|
|
||||||
def _is_allowed(self, request, item):
|
|
||||||
"""
|
|
||||||
TODO: must override this until wuttaweb has proper user auth checks
|
|
||||||
"""
|
|
||||||
perm = item.get('perm')
|
|
||||||
if perm:
|
|
||||||
return request.has_perm(perm)
|
|
||||||
return True
|
|
||||||
|
|
||||||
def _make_raw_menus(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
We are overriding this to allow for making dynamic menus from
|
|
||||||
config/settings. Which may or may not be a good idea..
|
|
||||||
"""
|
|
||||||
# first try to make menus from config, but this is highly
|
|
||||||
# susceptible to failure, so try to warn user of problems
|
|
||||||
try:
|
|
||||||
menus = self._make_menus_from_config(request)
|
|
||||||
if menus:
|
|
||||||
return menus
|
|
||||||
except Exception as error:
|
|
||||||
|
|
||||||
# TODO: these messages show up multiple times on some pages?!
|
|
||||||
# that must mean the BeforeRender event is firing multiple
|
|
||||||
# times..but why?? seems like there is only 1 request...
|
|
||||||
log.warning("failed to make menus from config", exc_info=True)
|
|
||||||
request.session.flash(simple_error(error), 'error')
|
|
||||||
request.session.flash("Menu config is invalid! Reverting to menus "
|
|
||||||
"defined in code!", 'warning')
|
|
||||||
msg = HTML.literal('Please edit your {} ASAP.'.format(
|
|
||||||
tags.link_to("Menu Config", request.route_url('configure_menus'))))
|
|
||||||
request.session.flash(msg, 'warning')
|
|
||||||
|
|
||||||
# okay, no config, so menus will be built from code
|
|
||||||
return self.make_menus(request, **kwargs)
|
|
||||||
|
|
||||||
def _make_menus_from_config(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Try to build a complete menu set from config/settings.
|
|
||||||
|
|
||||||
This will look in the DB settings table, or config file, for
|
|
||||||
menu data. If found, it constructs menus from that data.
|
|
||||||
"""
|
|
||||||
# bail unless config defines top-level menu keys
|
|
||||||
main_keys = self.config.getlist('tailbone.menu', 'menus')
|
|
||||||
if not main_keys:
|
|
||||||
return
|
|
||||||
|
|
||||||
model = self.app.model
|
|
||||||
menus = []
|
|
||||||
|
|
||||||
# menu definition can come either from config file or db
|
|
||||||
# settings, but if the latter then we want to optimize with
|
|
||||||
# one big query
|
|
||||||
if self.config.getbool('tailbone.menu', 'from_settings',
|
|
||||||
default=False):
|
|
||||||
|
|
||||||
# fetch all menu-related settings at once
|
|
||||||
query = Session().query(model.Setting)\
|
|
||||||
.filter(model.Setting.name.like('tailbone.menu.%'))
|
|
||||||
settings = self.app.cache_model(Session(), model.Setting,
|
|
||||||
query=query, key='name',
|
|
||||||
normalizer=lambda s: s.value)
|
|
||||||
for key in main_keys:
|
|
||||||
menus.append(self._make_single_menu_from_settings(request, key, settings))
|
|
||||||
|
|
||||||
else: # read from config file only
|
|
||||||
for key in main_keys:
|
|
||||||
menus.append(self._make_single_menu_from_config(request, key))
|
|
||||||
|
|
||||||
return menus
|
|
||||||
|
|
||||||
def _make_single_menu_from_config(self, request, key, **kwargs):
|
|
||||||
"""
|
|
||||||
Makes a single top-level menu dict from config file. Note
|
|
||||||
that this will read from config file(s) *only* and avoids
|
|
||||||
querying the database, for efficiency.
|
|
||||||
"""
|
|
||||||
menu = {
|
|
||||||
'key': key,
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [],
|
|
||||||
}
|
|
||||||
|
|
||||||
# title
|
|
||||||
title = self.config.get('tailbone.menu',
|
|
||||||
'menu.{}.label'.format(key),
|
|
||||||
usedb=False)
|
|
||||||
menu['title'] = title or prettify(key)
|
|
||||||
|
|
||||||
# items
|
|
||||||
item_keys = self.config.getlist('tailbone.menu',
|
|
||||||
'menu.{}.items'.format(key),
|
|
||||||
usedb=False)
|
|
||||||
for item_key in item_keys:
|
|
||||||
item = {}
|
|
||||||
|
|
||||||
if item_key == 'SEP':
|
|
||||||
item['type'] = 'sep'
|
|
||||||
|
|
||||||
else:
|
|
||||||
item['type'] = 'item'
|
|
||||||
item['key'] = item_key
|
|
||||||
|
|
||||||
# title
|
|
||||||
title = self.config.get('tailbone.menu',
|
|
||||||
'menu.{}.item.{}.label'.format(key, item_key),
|
|
||||||
usedb=False)
|
|
||||||
item['title'] = title or prettify(item_key)
|
|
||||||
|
|
||||||
# route
|
|
||||||
route = self.config.get('tailbone.menu',
|
|
||||||
'menu.{}.item.{}.route'.format(key, item_key),
|
|
||||||
usedb=False)
|
|
||||||
if route:
|
|
||||||
item['route'] = route
|
|
||||||
item['url'] = request.route_url(route)
|
|
||||||
|
|
||||||
else:
|
|
||||||
|
|
||||||
# url
|
|
||||||
url = self.config.get('tailbone.menu',
|
|
||||||
'menu.{}.item.{}.url'.format(key, item_key),
|
|
||||||
usedb=False)
|
|
||||||
if not url:
|
|
||||||
url = request.route_url(item_key)
|
|
||||||
elif url.startswith('route:'):
|
|
||||||
url = request.route_url(url[6:])
|
|
||||||
item['url'] = url
|
|
||||||
|
|
||||||
# perm
|
|
||||||
perm = self.config.get('tailbone.menu',
|
|
||||||
'menu.{}.item.{}.perm'.format(key, item_key),
|
|
||||||
usedb=False)
|
|
||||||
item['perm'] = perm or '{}.list'.format(item_key)
|
|
||||||
|
|
||||||
menu['items'].append(item)
|
|
||||||
|
|
||||||
return menu
|
|
||||||
|
|
||||||
def _make_single_menu_from_settings(self, request, key, settings, **kwargs):
|
|
||||||
"""
|
|
||||||
Makes a single top-level menu dict from DB settings.
|
|
||||||
"""
|
|
||||||
menu = {
|
|
||||||
'key': key,
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [],
|
|
||||||
}
|
|
||||||
|
|
||||||
# title
|
|
||||||
title = settings.get('tailbone.menu.menu.{}.label'.format(key))
|
|
||||||
menu['title'] = title or prettify(key)
|
|
||||||
|
|
||||||
# items
|
|
||||||
item_keys = self.config.parse_list(
|
|
||||||
settings.get('tailbone.menu.menu.{}.items'.format(key)))
|
|
||||||
for item_key in item_keys:
|
|
||||||
item = {}
|
|
||||||
|
|
||||||
if item_key == 'SEP':
|
|
||||||
item['type'] = 'sep'
|
|
||||||
|
|
||||||
else:
|
|
||||||
item['type'] = 'item'
|
|
||||||
item['key'] = item_key
|
|
||||||
|
|
||||||
# title
|
|
||||||
title = settings.get('tailbone.menu.menu.{}.item.{}.label'.format(
|
|
||||||
key, item_key))
|
|
||||||
item['title'] = title or prettify(item_key)
|
|
||||||
|
|
||||||
# route
|
|
||||||
route = settings.get('tailbone.menu.menu.{}.item.{}.route'.format(
|
|
||||||
key, item_key))
|
|
||||||
if route:
|
|
||||||
item['route'] = route
|
|
||||||
item['url'] = request.route_url(route)
|
|
||||||
|
|
||||||
else:
|
|
||||||
|
|
||||||
# url
|
|
||||||
url = settings.get('tailbone.menu.menu.{}.item.{}.url'.format(
|
|
||||||
key, item_key))
|
|
||||||
if not url:
|
|
||||||
url = request.route_url(item_key)
|
|
||||||
if url.startswith('route:'):
|
|
||||||
url = request.route_url(url[6:])
|
|
||||||
item['url'] = url
|
|
||||||
|
|
||||||
# perm
|
|
||||||
perm = settings.get('tailbone.menu.menu.{}.item.{}.perm'.format(
|
|
||||||
key, item_key))
|
|
||||||
item['perm'] = perm or '{}.list'.format(item_key)
|
|
||||||
|
|
||||||
menu['items'].append(item)
|
|
||||||
|
|
||||||
return menu
|
|
||||||
|
|
||||||
##############################
|
|
||||||
# menu defaults
|
|
||||||
##############################
|
|
||||||
|
|
||||||
def make_menus(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Make the full set of menus for the app.
|
|
||||||
|
|
||||||
This method provides a semi-sane menu set by default, but it
|
|
||||||
is expected for most apps to override it.
|
|
||||||
"""
|
|
||||||
menus = [
|
|
||||||
self.make_custorders_menu(request),
|
|
||||||
self.make_people_menu(request),
|
|
||||||
self.make_products_menu(request),
|
|
||||||
self.make_vendors_menu(request),
|
|
||||||
]
|
|
||||||
|
|
||||||
integration_menus = self.make_integration_menus(request)
|
|
||||||
if integration_menus:
|
|
||||||
menus.extend(integration_menus)
|
|
||||||
|
|
||||||
menus.extend([
|
|
||||||
self.make_reports_menu(request, include_trainwreck=True),
|
|
||||||
self.make_batches_menu(request),
|
|
||||||
self.make_admin_menu(request, include_stores=True),
|
|
||||||
])
|
|
||||||
|
|
||||||
return menus
|
|
||||||
|
|
||||||
def make_integration_menus(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Make a set of menus for all registered system integrations.
|
|
||||||
"""
|
|
||||||
tb = self.app.get_tailbone_handler()
|
|
||||||
menus = []
|
|
||||||
for provider in tb.iter_providers():
|
|
||||||
menu = provider.make_integration_menu(request)
|
|
||||||
if menu:
|
|
||||||
menus.append(menu)
|
|
||||||
menus.sort(key=lambda menu: menu['title'].lower())
|
|
||||||
return menus
|
|
||||||
|
|
||||||
def make_custorders_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical Customer Orders menu
|
|
||||||
"""
|
|
||||||
return {
|
|
||||||
'title': "Orders",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [
|
|
||||||
{
|
|
||||||
'title': "New Customer Order",
|
|
||||||
'route': 'custorders.create',
|
|
||||||
'perm': 'custorders.create',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "All New Orders",
|
|
||||||
'route': 'new_custorders',
|
|
||||||
'perm': 'new_custorders.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "All Customer Orders",
|
|
||||||
'route': 'custorders',
|
|
||||||
'perm': 'custorders.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "All Order Items",
|
|
||||||
'route': 'custorders.items',
|
|
||||||
'perm': 'custorders.items.list',
|
|
||||||
},
|
|
||||||
],
|
|
||||||
}
|
|
||||||
|
|
||||||
def make_people_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical People menu
|
|
||||||
"""
|
|
||||||
return {
|
|
||||||
'title': "People",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [
|
|
||||||
{
|
|
||||||
'title': "Members",
|
|
||||||
'route': 'members',
|
|
||||||
'perm': 'members.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Member Equity Payments",
|
|
||||||
'route': 'member_equity_payments',
|
|
||||||
'perm': 'member_equity_payments.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Membership Types",
|
|
||||||
'route': 'membership_types',
|
|
||||||
'perm': 'membership_types.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Customers",
|
|
||||||
'route': 'customers',
|
|
||||||
'perm': 'customers.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Customer Shoppers",
|
|
||||||
'route': 'customer_shoppers',
|
|
||||||
'perm': 'customer_shoppers.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Customer Groups",
|
|
||||||
'route': 'customergroups',
|
|
||||||
'perm': 'customergroups.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Pending Customers",
|
|
||||||
'route': 'pending_customers',
|
|
||||||
'perm': 'pending_customers.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Employees",
|
|
||||||
'route': 'employees',
|
|
||||||
'perm': 'employees.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "All People",
|
|
||||||
'route': 'people',
|
|
||||||
'perm': 'people.list',
|
|
||||||
},
|
|
||||||
],
|
|
||||||
}
|
|
||||||
|
|
||||||
def make_products_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical Products menu
|
|
||||||
"""
|
|
||||||
return {
|
|
||||||
'title': "Products",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [
|
|
||||||
{
|
|
||||||
'title': "Products",
|
|
||||||
'route': 'products',
|
|
||||||
'perm': 'products.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Product Costs",
|
|
||||||
'route': 'product_costs',
|
|
||||||
'perm': 'product_costs.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Departments",
|
|
||||||
'route': 'departments',
|
|
||||||
'perm': 'departments.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Subdepartments",
|
|
||||||
'route': 'subdepartments',
|
|
||||||
'perm': 'subdepartments.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Brands",
|
|
||||||
'route': 'brands',
|
|
||||||
'perm': 'brands.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Categories",
|
|
||||||
'route': 'categories',
|
|
||||||
'perm': 'categories.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Families",
|
|
||||||
'route': 'families',
|
|
||||||
'perm': 'families.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Report Codes",
|
|
||||||
'route': 'reportcodes',
|
|
||||||
'perm': 'reportcodes.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Units of Measure",
|
|
||||||
'route': 'uoms',
|
|
||||||
'perm': 'uoms.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Pending Products",
|
|
||||||
'route': 'pending_products',
|
|
||||||
'perm': 'pending_products.list',
|
|
||||||
},
|
|
||||||
],
|
|
||||||
}
|
|
||||||
|
|
||||||
def make_vendors_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical Vendors menu
|
|
||||||
"""
|
|
||||||
return {
|
|
||||||
'title': "Vendors",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [
|
|
||||||
{
|
|
||||||
'title': "Vendors",
|
|
||||||
'route': 'vendors',
|
|
||||||
'perm': 'vendors.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Product Costs",
|
|
||||||
'route': 'product_costs',
|
|
||||||
'perm': 'product_costs.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Ordering",
|
|
||||||
'route': 'ordering',
|
|
||||||
'perm': 'ordering.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Receiving",
|
|
||||||
'route': 'receiving',
|
|
||||||
'perm': 'receiving.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Invoice Costing",
|
|
||||||
'route': 'invoice_costing',
|
|
||||||
'perm': 'invoice_costing.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Purchases",
|
|
||||||
'route': 'purchases',
|
|
||||||
'perm': 'purchases.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Credits",
|
|
||||||
'route': 'purchases.credits',
|
|
||||||
'perm': 'purchases.credits.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Catalog Batches",
|
|
||||||
'route': 'vendorcatalogs',
|
|
||||||
'perm': 'vendorcatalogs.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Sample Files",
|
|
||||||
'route': 'vendorsamplefiles',
|
|
||||||
'perm': 'vendorsamplefiles.list',
|
|
||||||
},
|
|
||||||
],
|
|
||||||
}
|
|
||||||
|
|
||||||
def make_batches_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical Batches menu
|
|
||||||
"""
|
|
||||||
return {
|
|
||||||
'title': "Batches",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [
|
|
||||||
{
|
|
||||||
'title': "Handheld",
|
|
||||||
'route': 'batch.handheld',
|
|
||||||
'perm': 'batch.handheld.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Inventory",
|
|
||||||
'route': 'batch.inventory',
|
|
||||||
'perm': 'batch.inventory.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Import / Export",
|
|
||||||
'route': 'batch.importer',
|
|
||||||
'perm': 'batch.importer.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "POS",
|
|
||||||
'route': 'batch.pos',
|
|
||||||
'perm': 'batch.pos.list',
|
|
||||||
},
|
|
||||||
],
|
|
||||||
}
|
|
||||||
|
|
||||||
def make_reports_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical Reports menu
|
|
||||||
"""
|
|
||||||
items = [
|
|
||||||
{
|
|
||||||
'title': "New Report",
|
|
||||||
'route': 'report_output.create',
|
|
||||||
'perm': 'report_output.create',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Generated Reports",
|
|
||||||
'route': 'report_output',
|
|
||||||
'perm': 'report_output.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Problem Reports",
|
|
||||||
'route': 'problem_reports',
|
|
||||||
'perm': 'problem_reports.list',
|
|
||||||
},
|
|
||||||
]
|
|
||||||
|
|
||||||
if kwargs.get('include_poser', False):
|
|
||||||
items.extend([
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Poser Reports",
|
|
||||||
'route': 'poser_reports',
|
|
||||||
'perm': 'poser_reports.list',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
if kwargs.get('include_worksheets', False):
|
|
||||||
items.extend([
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Ordering Worksheet",
|
|
||||||
'route': 'reports.ordering',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Inventory Worksheet",
|
|
||||||
'route': 'reports.inventory',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
if kwargs.get('include_trainwreck', False):
|
|
||||||
items.extend([
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Trainwreck",
|
|
||||||
'route': 'trainwreck.transactions',
|
|
||||||
'perm': 'trainwreck.transactions.list',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
return {
|
|
||||||
'title': "Reports",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': items,
|
|
||||||
}
|
|
||||||
|
|
||||||
def make_tempmon_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical TempMon menu
|
|
||||||
"""
|
|
||||||
return {
|
|
||||||
'title': "TempMon",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': [
|
|
||||||
{
|
|
||||||
'title': "Dashboard",
|
|
||||||
'route': 'tempmon.dashboard',
|
|
||||||
'perm': 'tempmon.appliances.dashboard',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Appliances",
|
|
||||||
'route': 'tempmon.appliances',
|
|
||||||
'perm': 'tempmon.appliances.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Clients",
|
|
||||||
'route': 'tempmon.clients',
|
|
||||||
'perm': 'tempmon.clients.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Probes",
|
|
||||||
'route': 'tempmon.probes',
|
|
||||||
'perm': 'tempmon.probes.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Readings",
|
|
||||||
'route': 'tempmon.readings',
|
|
||||||
'perm': 'tempmon.readings.list',
|
|
||||||
},
|
|
||||||
],
|
|
||||||
}
|
|
||||||
|
|
||||||
def make_admin_menu(self, request, **kwargs):
|
|
||||||
"""
|
|
||||||
Generate a typical Admin menu
|
|
||||||
"""
|
|
||||||
items = []
|
|
||||||
|
|
||||||
include_stores = kwargs.get('include_stores', True)
|
|
||||||
include_tenders = kwargs.get('include_tenders', True)
|
|
||||||
|
|
||||||
if include_stores or include_tenders:
|
|
||||||
|
|
||||||
if include_stores:
|
|
||||||
items.extend([
|
|
||||||
{
|
|
||||||
'title': "Stores",
|
|
||||||
'route': 'stores',
|
|
||||||
'perm': 'stores.list',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
if include_tenders:
|
|
||||||
items.extend([
|
|
||||||
{
|
|
||||||
'title': "Tenders",
|
|
||||||
'route': 'tenders',
|
|
||||||
'perm': 'tenders.list',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
items.append({'type': 'sep'})
|
|
||||||
|
|
||||||
items.extend([
|
|
||||||
{
|
|
||||||
'title': "Users",
|
|
||||||
'route': 'users',
|
|
||||||
'perm': 'users.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Roles",
|
|
||||||
'route': 'roles',
|
|
||||||
'perm': 'roles.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Raw Permissions",
|
|
||||||
'route': 'permissions',
|
|
||||||
'perm': 'permissions.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "Email Settings",
|
|
||||||
'route': 'emailprofiles',
|
|
||||||
'perm': 'emailprofiles.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Email Attempts",
|
|
||||||
'route': 'email_attempts',
|
|
||||||
'perm': 'email_attempts.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "DataSync Status",
|
|
||||||
'route': 'datasync.status',
|
|
||||||
'perm': 'datasync.status',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "DataSync Changes",
|
|
||||||
'route': 'datasyncchanges',
|
|
||||||
'perm': 'datasync_changes.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Importing / Exporting",
|
|
||||||
'route': 'importing',
|
|
||||||
'perm': 'importing.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Luigi Tasks",
|
|
||||||
'route': 'luigi',
|
|
||||||
'perm': 'luigi.list',
|
|
||||||
},
|
|
||||||
{'type': 'sep'},
|
|
||||||
{
|
|
||||||
'title': "App Info",
|
|
||||||
'route': 'appinfo',
|
|
||||||
'perm': 'appinfo.list',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
if kwargs.get('include_label_settings', False):
|
|
||||||
items.extend([
|
|
||||||
{
|
|
||||||
'title': "Label Settings",
|
|
||||||
'route': 'labelprofiles',
|
|
||||||
'perm': 'labelprofiles.list',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
items.extend([
|
|
||||||
{
|
|
||||||
'title': "Raw Settings",
|
|
||||||
'route': 'settings',
|
|
||||||
'perm': 'settings.list',
|
|
||||||
},
|
|
||||||
{
|
|
||||||
'title': "Upgrades",
|
|
||||||
'route': 'upgrades',
|
|
||||||
'perm': 'upgrades.list',
|
|
||||||
},
|
|
||||||
])
|
|
||||||
|
|
||||||
return {
|
|
||||||
'title': "Admin",
|
|
||||||
'type': 'menu',
|
|
||||||
'items': items,
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
class MenuHandler(TailboneMenuHandler):
|
|
||||||
|
|
||||||
def __init__(self, *args, **kwargs):
|
|
||||||
warnings.warn("tailbone.menus.MenuHandler is deprecated; "
|
|
||||||
"please use tailbone.menus.TailboneMenuHandler instead",
|
|
||||||
DeprecationWarning, stacklevel=2)
|
|
||||||
super().__init__(*args, **kwargs)
|
|
||||||
|
|
||||||
|
|
||||||
class NullMenuHandler(WuttaMenuHandler):
|
|
||||||
"""
|
|
||||||
Null menu handler which uses an empty menu set.
|
|
||||||
|
|
||||||
.. note:
|
|
||||||
|
|
||||||
This class shouldn't even exist, but for the moment, it is
|
|
||||||
useful to configure non-traditional (e.g. API) web apps to use
|
|
||||||
this, in order to avoid most of the overhead.
|
|
||||||
"""
|
|
||||||
|
|
||||||
def make_menus(self, request, **kwargs):
|
|
||||||
return []
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2022 Lance Edgar
|
# Copyright © 2010-2018 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -27,33 +27,22 @@ Progress Indicator
|
||||||
from __future__ import unicode_literals, absolute_import
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
import os
|
import os
|
||||||
import warnings
|
|
||||||
|
|
||||||
from rattail.progress import ProgressBase
|
from rattail.progress import ProgressBase
|
||||||
|
|
||||||
from beaker.session import Session
|
from beaker.session import Session
|
||||||
|
|
||||||
|
|
||||||
def get_basic_session(config, request={}, **kwargs):
|
|
||||||
"""
|
|
||||||
Create/get a "basic" Beaker session object.
|
|
||||||
"""
|
|
||||||
kwargs['use_cookies'] = False
|
|
||||||
session = Session(request, **kwargs)
|
|
||||||
return session
|
|
||||||
|
|
||||||
|
|
||||||
def get_progress_session(request, key, **kwargs):
|
def get_progress_session(request, key, **kwargs):
|
||||||
"""
|
"""
|
||||||
Create/get a Beaker session object, to be used for progress.
|
Create/get a Beaker session object, to be used for progress.
|
||||||
"""
|
"""
|
||||||
kwargs['id'] = '{}.progress.{}'.format(request.session.id, key)
|
id = '{}.progress.{}'.format(request.session.id, key)
|
||||||
|
kwargs['use_cookies'] = False
|
||||||
if kwargs.get('type') == 'file':
|
if kwargs.get('type') == 'file':
|
||||||
warnings.warn("Passing a 'type' kwarg to get_progress_session() "
|
|
||||||
"is deprecated...i think",
|
|
||||||
DeprecationWarning, stacklevel=2)
|
|
||||||
kwargs['data_dir'] = os.path.join(request.rattail_config.appdir(), 'sessions')
|
kwargs['data_dir'] = os.path.join(request.rattail_config.appdir(), 'sessions')
|
||||||
return get_basic_session(request.rattail_config, request, **kwargs)
|
session = Session(request, id, **kwargs)
|
||||||
|
return session
|
||||||
|
|
||||||
|
|
||||||
class SessionProgress(ProgressBase):
|
class SessionProgress(ProgressBase):
|
||||||
|
@ -63,20 +52,11 @@ class SessionProgress(ProgressBase):
|
||||||
This class is only responsible for keeping the progress *data* current. It
|
This class is only responsible for keeping the progress *data* current. It
|
||||||
is the responsibility of some client-side AJAX (etc.) to consume the data
|
is the responsibility of some client-side AJAX (etc.) to consume the data
|
||||||
for display to the user.
|
for display to the user.
|
||||||
|
|
||||||
:param ws: If true, then websockets are assumed, and the progress will
|
|
||||||
behave accordingly. The default is false, "traditional" behavior.
|
|
||||||
"""
|
"""
|
||||||
|
|
||||||
def __init__(self, request, key, session_type=None, ws=False):
|
def __init__(self, request, key, session_type=None):
|
||||||
self.key = key
|
self.key = key
|
||||||
self.ws = ws
|
self.session = get_progress_session(request, key, type=session_type)
|
||||||
|
|
||||||
if self.ws:
|
|
||||||
self.session = get_basic_session(request.rattail_config, id=key)
|
|
||||||
else:
|
|
||||||
self.session = get_progress_session(request, key, type=session_type)
|
|
||||||
|
|
||||||
self.canceled = False
|
self.canceled = False
|
||||||
self.clear()
|
self.clear()
|
||||||
|
|
||||||
|
|
|
@ -1,62 +0,0 @@
|
||||||
# -*- coding: utf-8; -*-
|
|
||||||
################################################################################
|
|
||||||
#
|
|
||||||
# Rattail -- Retail Software Framework
|
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
|
||||||
#
|
|
||||||
# This file is part of Rattail.
|
|
||||||
#
|
|
||||||
# Rattail is free software: you can redistribute it and/or modify it under the
|
|
||||||
# terms of the GNU General Public License as published by the Free Software
|
|
||||||
# Foundation, either version 3 of the License, or (at your option) any later
|
|
||||||
# version.
|
|
||||||
#
|
|
||||||
# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY
|
|
||||||
# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS
|
|
||||||
# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more
|
|
||||||
# details.
|
|
||||||
#
|
|
||||||
# You should have received a copy of the GNU General Public License along with
|
|
||||||
# Rattail. If not, see <http://www.gnu.org/licenses/>.
|
|
||||||
#
|
|
||||||
################################################################################
|
|
||||||
"""
|
|
||||||
Providers for Tailbone features
|
|
||||||
"""
|
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
|
||||||
|
|
||||||
from rattail.util import load_entry_points
|
|
||||||
|
|
||||||
|
|
||||||
class TailboneProvider(object):
|
|
||||||
"""
|
|
||||||
Base class for Tailbone providers. These are responsible for
|
|
||||||
declaring which things a given project makes available to the app.
|
|
||||||
(Or at least the things which should be easily configurable.)
|
|
||||||
"""
|
|
||||||
|
|
||||||
def __init__(self, config):
|
|
||||||
self.config = config
|
|
||||||
|
|
||||||
def configure_db_sessions(self, rattail_config, pyramid_config):
|
|
||||||
pass
|
|
||||||
|
|
||||||
def get_static_includes(self):
|
|
||||||
pass
|
|
||||||
|
|
||||||
def get_provided_views(self):
|
|
||||||
return {}
|
|
||||||
|
|
||||||
def make_integration_menu(self, request, **kwargs):
|
|
||||||
pass
|
|
||||||
|
|
||||||
|
|
||||||
def get_all_providers(config):
|
|
||||||
"""
|
|
||||||
Returns a dict of all registered providers.
|
|
||||||
"""
|
|
||||||
providers = load_entry_points('tailbone.providers')
|
|
||||||
for key in list(providers):
|
|
||||||
providers[key] = providers[key](config)
|
|
||||||
return providers
|
|
|
@ -111,7 +111,7 @@
|
||||||
<td class="brand">${cost.product.brand or ''}</td>
|
<td class="brand">${cost.product.brand or ''}</td>
|
||||||
<td class="desc">${cost.product.description}</td>
|
<td class="desc">${cost.product.description}</td>
|
||||||
<td class="size">${cost.product.size or ''}</td>
|
<td class="size">${cost.product.size or ''}</td>
|
||||||
<td class="case-qty">${app.render_quantity(cost.case_size)} ${"LB" if cost.product.weighed else "EA"}</td>
|
<td class="case-qty">${cost.case_size} ${"LB" if cost.product.weighed else "EA"}</td>
|
||||||
<td class="code">${cost.code or ''}</td>
|
<td class="code">${cost.code or ''}</td>
|
||||||
<td class="preferred">${'X' if cost.preference == 1 else ''}</td>
|
<td class="preferred">${'X' if cost.preference == 1 else ''}</td>
|
||||||
% for i in range(14):
|
% for i in range(14):
|
||||||
|
|
|
@ -1,8 +1,8 @@
|
||||||
# -*- coding: utf-8; -*-
|
# -*- coding: utf-8 -*-
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2023 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -21,31 +21,25 @@
|
||||||
#
|
#
|
||||||
################################################################################
|
################################################################################
|
||||||
"""
|
"""
|
||||||
Tailbone Web API - Label Views
|
Pyramid scaffold templates
|
||||||
"""
|
"""
|
||||||
|
|
||||||
from __future__ import unicode_literals, absolute_import
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
from rattail.db.model import LabelProfile
|
from rattail.files import resource_path
|
||||||
|
from rattail.util import prettify
|
||||||
|
|
||||||
from tailbone.api import APIMasterView
|
from pyramid.scaffolds import PyramidTemplate
|
||||||
|
|
||||||
|
|
||||||
class LabelProfileView(APIMasterView):
|
class RattailTemplate(PyramidTemplate):
|
||||||
"""
|
_template_dir = resource_path('rattail:data/project')
|
||||||
API views for Label Profile data
|
summary = "Starter project based on Rattail / Tailbone"
|
||||||
"""
|
|
||||||
model_class = LabelProfile
|
|
||||||
collection_url_prefix = '/label-profiles'
|
|
||||||
object_url_prefix = '/label-profile'
|
|
||||||
|
|
||||||
|
def pre(self, command, output_dir, vars):
|
||||||
def defaults(config, **kwargs):
|
"""
|
||||||
base = globals()
|
Adds some more variables to the template context.
|
||||||
|
"""
|
||||||
LabelProfileView = kwargs.get('LabelProfileView', base['LabelProfileView'])
|
vars['project_title'] = prettify(vars['project'])
|
||||||
LabelProfileView.defaults(config)
|
vars['package_title'] = vars['package'].capitalize()
|
||||||
|
return super(RattailTemplate, self).pre(command, output_dir, vars)
|
||||||
|
|
||||||
def includeme(config):
|
|
||||||
defaults(config)
|
|
|
@ -2,7 +2,7 @@
|
||||||
################################################################################
|
################################################################################
|
||||||
#
|
#
|
||||||
# Rattail -- Retail Software Framework
|
# Rattail -- Retail Software Framework
|
||||||
# Copyright © 2010-2024 Lance Edgar
|
# Copyright © 2010-2017 Lance Edgar
|
||||||
#
|
#
|
||||||
# This file is part of Rattail.
|
# This file is part of Rattail.
|
||||||
#
|
#
|
||||||
|
@ -24,8 +24,9 @@
|
||||||
Static Assets
|
Static Assets
|
||||||
"""
|
"""
|
||||||
|
|
||||||
|
from __future__ import unicode_literals, absolute_import
|
||||||
|
|
||||||
|
|
||||||
def includeme(config):
|
def includeme(config):
|
||||||
config.include('wuttaweb.static')
|
|
||||||
config.add_static_view('tailbone', 'tailbone:static')
|
config.add_static_view('tailbone', 'tailbone:static')
|
||||||
config.add_static_view('deform', 'deform:static')
|
config.add_static_view('deform', 'deform:static')
|
||||||
|
|
|
@ -1,14 +1,115 @@
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* General
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
* {
|
||||||
|
margin: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
body {
|
||||||
|
font-family: Verdana, Arial, sans-serif;
|
||||||
|
font-size: 11pt;
|
||||||
|
}
|
||||||
|
|
||||||
|
a {
|
||||||
|
color: #0972a5;
|
||||||
|
text-decoration: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
a:hover {
|
||||||
|
text-decoration: underline;
|
||||||
|
}
|
||||||
|
|
||||||
|
h1 {
|
||||||
|
margin-bottom: 15px;
|
||||||
|
}
|
||||||
|
|
||||||
|
h2 {
|
||||||
|
font-size: 12pt;
|
||||||
|
margin: 20px auto 10px auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
li {
|
||||||
|
line-height: 2em;
|
||||||
|
}
|
||||||
|
|
||||||
|
p {
|
||||||
|
margin-bottom: 5px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.left {
|
||||||
|
float: left;
|
||||||
|
text-align: left;
|
||||||
|
}
|
||||||
|
|
||||||
|
.right {
|
||||||
|
text-align: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
.wrapper {
|
||||||
|
overflow: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.buttons {
|
||||||
|
clear: both;
|
||||||
|
margin-top: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.dialog {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.flash-message {
|
||||||
|
background-color: #dddddd;
|
||||||
|
margin-bottom: 8px;
|
||||||
|
padding: 3px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.flash-messages div.ui-state-highlight {
|
||||||
|
padding: .3em;
|
||||||
|
margin-bottom: 8px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.error-messages div.ui-state-error {
|
||||||
|
padding: .3em;
|
||||||
|
margin-bottom: 8px;
|
||||||
|
}
|
||||||
|
|
||||||
|
.flash-messages,
|
||||||
|
.error-messages {
|
||||||
|
margin: 0.5em 0 0 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.error {
|
||||||
|
color: #dd6666;
|
||||||
|
font-weight: bold;
|
||||||
|
padding: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.error li {
|
||||||
|
list-style-type: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* jQuery UI tweaks
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
ul.ui-menu {
|
||||||
|
max-height: 30em;
|
||||||
|
}
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* tweaks for root user
|
* tweaks for root user
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
.navbar .navbar-end .navbar-link.root-user,
|
.menubar .root-user .ui-button-text,
|
||||||
.navbar .navbar-end .navbar-link.root-user:hover,
|
.menubar .root-user.ui-menu-item a {
|
||||||
.navbar .navbar-end .navbar-link.root-user.is_active,
|
|
||||||
.navbar .navbar-end .navbar-item.root-user,
|
|
||||||
.navbar .navbar-end .navbar-item.root-user:hover,
|
|
||||||
.navbar .navbar-end .navbar-item.root-user.is_active {
|
|
||||||
background-color: red;
|
background-color: red;
|
||||||
|
color: black;
|
||||||
font-weight: bold;
|
font-weight: bold;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.menubar .root-user.ui-menu-item a {
|
||||||
|
padding-left: 1em;
|
||||||
|
}
|
||||||
|
|
|
@ -1,74 +0,0 @@
|
||||||
pre { line-height: 125%; }
|
|
||||||
td.linenos pre { color: #000000; background-color: #f0f0f0; padding-left: 5px; padding-right: 5px; }
|
|
||||||
span.linenos { color: #000000; background-color: #f0f0f0; padding-left: 5px; padding-right: 5px; }
|
|
||||||
td.linenos pre.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; }
|
|
||||||
span.linenos.special { color: #000000; background-color: #ffffc0; padding-left: 5px; padding-right: 5px; }
|
|
||||||
.codehilite .hll { background-color: #ffffcc }
|
|
||||||
.codehilite { background: #f8f8f8; }
|
|
||||||
.codehilite .c { color: #408080; font-style: italic } /* Comment */
|
|
||||||
.codehilite .err { border: 1px solid #FF0000 } /* Error */
|
|
||||||
.codehilite .k { color: #008000; font-weight: bold } /* Keyword */
|
|
||||||
.codehilite .o { color: #666666 } /* Operator */
|
|
||||||
.codehilite .ch { color: #408080; font-style: italic } /* Comment.Hashbang */
|
|
||||||
.codehilite .cm { color: #408080; font-style: italic } /* Comment.Multiline */
|
|
||||||
.codehilite .cp { color: #BC7A00 } /* Comment.Preproc */
|
|
||||||
.codehilite .cpf { color: #408080; font-style: italic } /* Comment.PreprocFile */
|
|
||||||
.codehilite .c1 { color: #408080; font-style: italic } /* Comment.Single */
|
|
||||||
.codehilite .cs { color: #408080; font-style: italic } /* Comment.Special */
|
|
||||||
.codehilite .gd { color: #A00000 } /* Generic.Deleted */
|
|
||||||
.codehilite .ge { font-style: italic } /* Generic.Emph */
|
|
||||||
.codehilite .gr { color: #FF0000 } /* Generic.Error */
|
|
||||||
.codehilite .gh { color: #000080; font-weight: bold } /* Generic.Heading */
|
|
||||||
.codehilite .gi { color: #00A000 } /* Generic.Inserted */
|
|
||||||
.codehilite .go { color: #888888 } /* Generic.Output */
|
|
||||||
.codehilite .gp { color: #000080; font-weight: bold } /* Generic.Prompt */
|
|
||||||
.codehilite .gs { font-weight: bold } /* Generic.Strong */
|
|
||||||
.codehilite .gu { color: #800080; font-weight: bold } /* Generic.Subheading */
|
|
||||||
.codehilite .gt { color: #0044DD } /* Generic.Traceback */
|
|
||||||
.codehilite .kc { color: #008000; font-weight: bold } /* Keyword.Constant */
|
|
||||||
.codehilite .kd { color: #008000; font-weight: bold } /* Keyword.Declaration */
|
|
||||||
.codehilite .kn { color: #008000; font-weight: bold } /* Keyword.Namespace */
|
|
||||||
.codehilite .kp { color: #008000 } /* Keyword.Pseudo */
|
|
||||||
.codehilite .kr { color: #008000; font-weight: bold } /* Keyword.Reserved */
|
|
||||||
.codehilite .kt { color: #B00040 } /* Keyword.Type */
|
|
||||||
.codehilite .m { color: #666666 } /* Literal.Number */
|
|
||||||
.codehilite .s { color: #BA2121 } /* Literal.String */
|
|
||||||
.codehilite .na { color: #7D9029 } /* Name.Attribute */
|
|
||||||
.codehilite .nb { color: #008000 } /* Name.Builtin */
|
|
||||||
.codehilite .nc { color: #0000FF; font-weight: bold } /* Name.Class */
|
|
||||||
.codehilite .no { color: #880000 } /* Name.Constant */
|
|
||||||
.codehilite .nd { color: #AA22FF } /* Name.Decorator */
|
|
||||||
.codehilite .ni { color: #999999; font-weight: bold } /* Name.Entity */
|
|
||||||
.codehilite .ne { color: #D2413A; font-weight: bold } /* Name.Exception */
|
|
||||||
.codehilite .nf { color: #0000FF } /* Name.Function */
|
|
||||||
.codehilite .nl { color: #A0A000 } /* Name.Label */
|
|
||||||
.codehilite .nn { color: #0000FF; font-weight: bold } /* Name.Namespace */
|
|
||||||
.codehilite .nt { color: #008000; font-weight: bold } /* Name.Tag */
|
|
||||||
.codehilite .nv { color: #19177C } /* Name.Variable */
|
|
||||||
.codehilite .ow { color: #AA22FF; font-weight: bold } /* Operator.Word */
|
|
||||||
.codehilite .w { color: #bbbbbb } /* Text.Whitespace */
|
|
||||||
.codehilite .mb { color: #666666 } /* Literal.Number.Bin */
|
|
||||||
.codehilite .mf { color: #666666 } /* Literal.Number.Float */
|
|
||||||
.codehilite .mh { color: #666666 } /* Literal.Number.Hex */
|
|
||||||
.codehilite .mi { color: #666666 } /* Literal.Number.Integer */
|
|
||||||
.codehilite .mo { color: #666666 } /* Literal.Number.Oct */
|
|
||||||
.codehilite .sa { color: #BA2121 } /* Literal.String.Affix */
|
|
||||||
.codehilite .sb { color: #BA2121 } /* Literal.String.Backtick */
|
|
||||||
.codehilite .sc { color: #BA2121 } /* Literal.String.Char */
|
|
||||||
.codehilite .dl { color: #BA2121 } /* Literal.String.Delimiter */
|
|
||||||
.codehilite .sd { color: #BA2121; font-style: italic } /* Literal.String.Doc */
|
|
||||||
.codehilite .s2 { color: #BA2121 } /* Literal.String.Double */
|
|
||||||
.codehilite .se { color: #BB6622; font-weight: bold } /* Literal.String.Escape */
|
|
||||||
.codehilite .sh { color: #BA2121 } /* Literal.String.Heredoc */
|
|
||||||
.codehilite .si { color: #BB6688; font-weight: bold } /* Literal.String.Interpol */
|
|
||||||
.codehilite .sx { color: #008000 } /* Literal.String.Other */
|
|
||||||
.codehilite .sr { color: #BB6688 } /* Literal.String.Regex */
|
|
||||||
.codehilite .s1 { color: #BA2121 } /* Literal.String.Single */
|
|
||||||
.codehilite .ss { color: #19177C } /* Literal.String.Symbol */
|
|
||||||
.codehilite .bp { color: #008000 } /* Name.Builtin.Pseudo */
|
|
||||||
.codehilite .fm { color: #0000FF } /* Name.Function.Magic */
|
|
||||||
.codehilite .vc { color: #19177C } /* Name.Variable.Class */
|
|
||||||
.codehilite .vg { color: #19177C } /* Name.Variable.Global */
|
|
||||||
.codehilite .vi { color: #19177C } /* Name.Variable.Instance */
|
|
||||||
.codehilite .vm { color: #19177C } /* Name.Variable.Magic */
|
|
||||||
.codehilite .il { color: #666666 } /* Literal.Number.Integer.Long */
|
|
|
@ -10,10 +10,6 @@ table.diff {
|
||||||
min-width: 80%;
|
min-width: 80%;
|
||||||
}
|
}
|
||||||
|
|
||||||
.ui-dialog-content table.diff {
|
|
||||||
color: black;
|
|
||||||
}
|
|
||||||
|
|
||||||
table.diff th,
|
table.diff th,
|
||||||
table.diff td {
|
table.diff td {
|
||||||
border-bottom: 1px solid Black;
|
border-bottom: 1px solid Black;
|
||||||
|
|
|
@ -1,18 +1,28 @@
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* Grid Filters
|
* Filters
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
.filters .filter-fieldname .field,
|
div.filters form {
|
||||||
.filters .filter-fieldname .field label {
|
margin-bottom: 10px;
|
||||||
width: 100%;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
.filters .filter-fieldname .field label {
|
div.filters div.filter {
|
||||||
justify-content: left;
|
margin-bottom: 10px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.filters .filter-verb .select,
|
div.filters div.filter label {
|
||||||
.filters .filter-verb .select select {
|
margin-right: 8px;
|
||||||
width: 100%;
|
}
|
||||||
|
|
||||||
|
div.filters div.filter select.filter-type {
|
||||||
|
margin-right: 8px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.filters div.filter div.value {
|
||||||
|
display: inline;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.filters div.buttons * {
|
||||||
|
margin-right: 8px;
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,37 +1,50 @@
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* forms
|
* Form Wrapper
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
/* note that this should only apply to "normal" primary forms */
|
div.form-wrapper {
|
||||||
/* TODO: replace this with bulma equivalent */
|
overflow: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* Context Menu
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
div.form-wrapper ul.context-menu {
|
||||||
|
float: right;
|
||||||
|
list-style-type: none;
|
||||||
|
margin: 0px;
|
||||||
|
text-align: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.form-wrapper ul.context-menu li {
|
||||||
|
line-height: 2em;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* Forms
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
div.form,
|
||||||
|
div.fieldset-form,
|
||||||
|
div.fieldset {
|
||||||
|
clear: left;
|
||||||
|
float: left;
|
||||||
|
margin-top: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
.form {
|
.form {
|
||||||
padding-left: 5em;
|
padding-left: 5em;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* note that this should only apply to "normal" primary forms */
|
|
||||||
.form-wrapper .form .field.is-horizontal .field-label .label {
|
|
||||||
text-align: left;
|
|
||||||
white-space: nowrap;
|
|
||||||
width: 18em;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* note that this should only apply to "normal" primary forms */
|
|
||||||
.form-wrapper .form .field.is-horizontal .field-body {
|
|
||||||
min-width: 30em;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* note that this should only apply to "normal" primary forms */
|
|
||||||
.form-wrapper .form .field.is-horizontal .field-body .select,
|
|
||||||
.form-wrapper .form .field.is-horizontal .field-body .select select {
|
|
||||||
width: 100%;
|
|
||||||
}
|
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* field-wrappers
|
* Fieldsets
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
/* TODO: replace this with bulma equivalent */
|
|
||||||
.field-wrapper {
|
.field-wrapper {
|
||||||
clear: both;
|
clear: both;
|
||||||
min-height: 30px;
|
min-height: 30px;
|
||||||
|
@ -39,12 +52,16 @@
|
||||||
margin: 15px;
|
margin: 15px;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* TODO: replace this with bulma equivalent */
|
.field-wrapper.with-error {
|
||||||
|
background-color: #ddcccc;
|
||||||
|
border: 2px solid #dd6666;
|
||||||
|
padding-bottom: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
.field-wrapper .field-row {
|
.field-wrapper .field-row {
|
||||||
display: table-row;
|
display: table-row;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* TODO: replace this with bulma equivalent */
|
|
||||||
.field-wrapper label {
|
.field-wrapper label {
|
||||||
display: table-cell;
|
display: table-cell;
|
||||||
vertical-align: top;
|
vertical-align: top;
|
||||||
|
@ -54,8 +71,58 @@
|
||||||
white-space: nowrap;
|
white-space: nowrap;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* TODO: replace this with bulma equivalent */
|
.field-wrapper.with-error label {
|
||||||
|
padding-left: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-wrapper .field-error {
|
||||||
|
padding: 1em 0 0.5em 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-wrapper .field-error .error-msg {
|
||||||
|
color: #dd6666;
|
||||||
|
font-weight: bold;
|
||||||
|
}
|
||||||
|
|
||||||
.field-wrapper .field {
|
.field-wrapper .field {
|
||||||
display: table-cell;
|
display: table-cell;
|
||||||
line-height: 25px;
|
line-height: 25px;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
.field-wrapper .field input[type=text],
|
||||||
|
.field-wrapper .field input[type=password],
|
||||||
|
.field-wrapper .field select,
|
||||||
|
.field-wrapper .field textarea {
|
||||||
|
width: 320px;
|
||||||
|
}
|
||||||
|
|
||||||
|
label input[type="checkbox"],
|
||||||
|
label input[type="radio"] {
|
||||||
|
margin-right: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field ul {
|
||||||
|
margin: 0px;
|
||||||
|
padding-left: 15px;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* Buttons
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
div.buttons {
|
||||||
|
clear: both;
|
||||||
|
margin: 10px 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* Email Profile forms
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
.field-wrapper.description .field {
|
||||||
|
/* NOTE: This was added specifically for email settings (description), who
|
||||||
|
knows what else it breaks...hopefully nothing. */
|
||||||
|
width: 800px;
|
||||||
|
}
|
||||||
|
|
|
@ -22,14 +22,10 @@
|
||||||
}
|
}
|
||||||
|
|
||||||
.grid-wrapper .grid-header #context-menu {
|
.grid-wrapper .grid-header #context-menu {
|
||||||
|
float: none;
|
||||||
margin: 0;
|
margin: 0;
|
||||||
}
|
}
|
||||||
|
|
||||||
.grid-tools {
|
|
||||||
display: flex;
|
|
||||||
gap: 0.5rem;
|
|
||||||
}
|
|
||||||
|
|
||||||
.grid-wrapper .grid-header td.tools {
|
.grid-wrapper .grid-header td.tools {
|
||||||
margin: 0;
|
margin: 0;
|
||||||
padding: 0;
|
padding: 0;
|
||||||
|
@ -266,10 +262,6 @@
|
||||||
* main actions
|
* main actions
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
a.grid-action {
|
|
||||||
white-space: nowrap;
|
|
||||||
}
|
|
||||||
|
|
||||||
.grid .actions {
|
.grid .actions {
|
||||||
width: 1px;
|
width: 1px;
|
||||||
}
|
}
|
||||||
|
|
|
@ -1,49 +0,0 @@
|
||||||
|
|
||||||
/********************************************************************************
|
|
||||||
* grids.rowstatus.css
|
|
||||||
*
|
|
||||||
* Add "row status" styles for grid tables.
|
|
||||||
********************************************************************************/
|
|
||||||
|
|
||||||
/**************************************************
|
|
||||||
* grid rows with "warning" status
|
|
||||||
**************************************************/
|
|
||||||
|
|
||||||
tr.warning {
|
|
||||||
background-color: #fcc;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/**************************************************
|
|
||||||
* grid rows with "notice" status
|
|
||||||
**************************************************/
|
|
||||||
|
|
||||||
tr.notice {
|
|
||||||
background-color: #fe8;
|
|
||||||
}
|
|
||||||
|
|
||||||
|
|
||||||
/**************************************************
|
|
||||||
* grid rows which are "checked" (selected)
|
|
||||||
**************************************************/
|
|
||||||
|
|
||||||
/* TODO: this references some color values, whereas it would be preferable
|
|
||||||
* to refer to some sort of "state" instead, color of which was
|
|
||||||
* configurable. b/c these are just the default Buefy theme colors. */
|
|
||||||
|
|
||||||
tr.is-checked {
|
|
||||||
background-color: #7957d5;
|
|
||||||
color: white;
|
|
||||||
}
|
|
||||||
|
|
||||||
tr.is-checked:hover {
|
|
||||||
color: #363636;
|
|
||||||
}
|
|
||||||
|
|
||||||
tr.is-checked a {
|
|
||||||
color: white;
|
|
||||||
}
|
|
||||||
|
|
||||||
tr.is-checked:hover a {
|
|
||||||
color: #7957d5;
|
|
||||||
}
|
|
40
tailbone/static/css/jquery.loadmask.css
Normal file
40
tailbone/static/css/jquery.loadmask.css
Normal file
|
@ -0,0 +1,40 @@
|
||||||
|
.loadmask {
|
||||||
|
z-index: 100;
|
||||||
|
position: absolute;
|
||||||
|
top:0;
|
||||||
|
left:0;
|
||||||
|
-moz-opacity: 0.5;
|
||||||
|
opacity: .50;
|
||||||
|
filter: alpha(opacity=50);
|
||||||
|
background-color: #CCC;
|
||||||
|
width: 100%;
|
||||||
|
height: 100%;
|
||||||
|
zoom: 1;
|
||||||
|
}
|
||||||
|
.loadmask-msg {
|
||||||
|
z-index: 20001;
|
||||||
|
position: absolute;
|
||||||
|
top: 0;
|
||||||
|
left: 0;
|
||||||
|
border:1px solid #6593cf;
|
||||||
|
background: #c3daf9;
|
||||||
|
padding:2px;
|
||||||
|
}
|
||||||
|
.loadmask-msg div {
|
||||||
|
padding:5px 10px 5px 25px;
|
||||||
|
background: #fbfbfb url('../img/loading.gif') no-repeat 5px 5px;
|
||||||
|
line-height: 16px;
|
||||||
|
border:1px solid #a3bad9;
|
||||||
|
color:#222;
|
||||||
|
font:normal 11px tahoma, arial, helvetica, sans-serif;
|
||||||
|
cursor:wait;
|
||||||
|
}
|
||||||
|
.masked {
|
||||||
|
overflow: hidden !important;
|
||||||
|
}
|
||||||
|
.masked-relative {
|
||||||
|
position: relative !important;
|
||||||
|
}
|
||||||
|
.masked-hidden {
|
||||||
|
visibility: hidden !important;
|
||||||
|
}
|
69
tailbone/static/css/jquery.tagit.css
Normal file
69
tailbone/static/css/jquery.tagit.css
Normal file
|
@ -0,0 +1,69 @@
|
||||||
|
ul.tagit {
|
||||||
|
padding: 1px 5px;
|
||||||
|
overflow: auto;
|
||||||
|
margin-left: inherit; /* usually we don't want the regular ul margins. */
|
||||||
|
margin-right: inherit;
|
||||||
|
}
|
||||||
|
ul.tagit li {
|
||||||
|
display: block;
|
||||||
|
float: left;
|
||||||
|
margin: 2px 5px 2px 0;
|
||||||
|
}
|
||||||
|
ul.tagit li.tagit-choice {
|
||||||
|
position: relative;
|
||||||
|
line-height: inherit;
|
||||||
|
}
|
||||||
|
input.tagit-hidden-field {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
ul.tagit li.tagit-choice-read-only {
|
||||||
|
padding: .2em .5em .2em .5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.tagit li.tagit-choice-editable {
|
||||||
|
padding: .2em 18px .2em .5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.tagit li.tagit-new {
|
||||||
|
padding: .25em 4px .25em 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.tagit li.tagit-choice a.tagit-label {
|
||||||
|
cursor: pointer;
|
||||||
|
text-decoration: none;
|
||||||
|
}
|
||||||
|
ul.tagit li.tagit-choice .tagit-close {
|
||||||
|
cursor: pointer;
|
||||||
|
position: absolute;
|
||||||
|
right: .1em;
|
||||||
|
top: 50%;
|
||||||
|
margin-top: -8px;
|
||||||
|
line-height: 17px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* used for some custom themes that don't need image icons */
|
||||||
|
ul.tagit li.tagit-choice .tagit-close .text-icon {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
ul.tagit li.tagit-choice input {
|
||||||
|
display: block;
|
||||||
|
float: left;
|
||||||
|
margin: 2px 5px 2px 0;
|
||||||
|
}
|
||||||
|
ul.tagit input[type="text"] {
|
||||||
|
-moz-box-sizing: border-box;
|
||||||
|
-webkit-box-sizing: border-box;
|
||||||
|
box-sizing: border-box;
|
||||||
|
|
||||||
|
-moz-box-shadow: none;
|
||||||
|
-webkit-box-shadow: none;
|
||||||
|
box-shadow: none;
|
||||||
|
|
||||||
|
border: none;
|
||||||
|
margin: 0;
|
||||||
|
padding: 0;
|
||||||
|
width: inherit;
|
||||||
|
background-color: inherit;
|
||||||
|
outline: none;
|
||||||
|
}
|
15
tailbone/static/css/jquery.ui.menubar.css
vendored
Normal file
15
tailbone/static/css/jquery.ui.menubar.css
vendored
Normal file
|
@ -0,0 +1,15 @@
|
||||||
|
/*
|
||||||
|
* jQuery UI Menubar @VERSION
|
||||||
|
*
|
||||||
|
* Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
|
||||||
|
* Dual licensed under the MIT or GPL Version 2 licenses.
|
||||||
|
* http://jquery.org/license
|
||||||
|
*/
|
||||||
|
.ui-menubar { list-style: none; margin: 0; padding-left: 0; }
|
||||||
|
|
||||||
|
.ui-menubar-item { float: left; }
|
||||||
|
|
||||||
|
.ui-menubar .ui-button { float: left; font-weight: normal; border-top-width: 0 !important; border-bottom-width: 0 !important; margin: 0; outline: none; }
|
||||||
|
.ui-menubar .ui-menubar-link { border-right: 1px dashed transparent; border-left: 1px dashed transparent; }
|
||||||
|
|
||||||
|
.ui-menubar .ui-menu { width: 200px; position: absolute; z-index: 9999; font-weight: normal; }
|
14
tailbone/static/css/jquery.ui.tailbone.css
vendored
Normal file
14
tailbone/static/css/jquery.ui.tailbone.css
vendored
Normal file
|
@ -0,0 +1,14 @@
|
||||||
|
|
||||||
|
/**********************************************************************
|
||||||
|
* jquery.ui.tailbone.css
|
||||||
|
*
|
||||||
|
* jQuery UI tweaks for Tailbone
|
||||||
|
**********************************************************************/
|
||||||
|
|
||||||
|
.ui-widget {
|
||||||
|
font-size: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.ui-menu-item a {
|
||||||
|
display: block;
|
||||||
|
}
|
57
tailbone/static/css/jquery.ui.timepicker.css
vendored
Normal file
57
tailbone/static/css/jquery.ui.timepicker.css
vendored
Normal file
|
@ -0,0 +1,57 @@
|
||||||
|
/*
|
||||||
|
* Timepicker stylesheet
|
||||||
|
* Highly inspired from datepicker
|
||||||
|
* FG - Nov 2010 - Web3R
|
||||||
|
*
|
||||||
|
* version 0.0.3 : Fixed some settings, more dynamic
|
||||||
|
* version 0.0.4 : Removed width:100% on tables
|
||||||
|
* version 0.1.1 : set width 0 on tables to fix an ie6 bug
|
||||||
|
*/
|
||||||
|
|
||||||
|
.ui-timepicker-inline { display: inline; }
|
||||||
|
|
||||||
|
#ui-timepicker-div { padding: 0.2em; }
|
||||||
|
.ui-timepicker-table { display: inline-table; width: 0; }
|
||||||
|
.ui-timepicker-table table { margin:0.15em 0 0 0; border-collapse: collapse; }
|
||||||
|
|
||||||
|
.ui-timepicker-hours, .ui-timepicker-minutes { padding: 0.2em; }
|
||||||
|
|
||||||
|
.ui-timepicker-table .ui-timepicker-title { line-height: 1.8em; text-align: center; }
|
||||||
|
.ui-timepicker-table td { padding: 0.1em; width: 2.2em; }
|
||||||
|
.ui-timepicker-table th.periods { padding: 0.1em; width: 2.2em; }
|
||||||
|
|
||||||
|
/* span for disabled cells */
|
||||||
|
.ui-timepicker-table td span {
|
||||||
|
display:block;
|
||||||
|
padding:0.2em 0.3em 0.2em 0.5em;
|
||||||
|
width: 1.2em;
|
||||||
|
|
||||||
|
text-align:right;
|
||||||
|
text-decoration:none;
|
||||||
|
}
|
||||||
|
/* anchors for clickable cells */
|
||||||
|
.ui-timepicker-table td a {
|
||||||
|
display:block;
|
||||||
|
padding:0.2em 0.3em 0.2em 0.5em;
|
||||||
|
width: 1.2em;
|
||||||
|
cursor: pointer;
|
||||||
|
text-align:right;
|
||||||
|
text-decoration:none;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/* buttons and button pane styling */
|
||||||
|
.ui-timepicker .ui-timepicker-buttonpane {
|
||||||
|
background-image: none; margin: .7em 0 0 0; padding:0 .2em; border-left: 0; border-right: 0; border-bottom: 0;
|
||||||
|
}
|
||||||
|
.ui-timepicker .ui-timepicker-buttonpane button { margin: .5em .2em .4em; cursor: pointer; padding: .2em .6em .3em .6em; width:auto; overflow:visible; }
|
||||||
|
/* The close button */
|
||||||
|
.ui-timepicker .ui-timepicker-close { float: right }
|
||||||
|
|
||||||
|
/* the now button */
|
||||||
|
.ui-timepicker .ui-timepicker-now { float: left; }
|
||||||
|
|
||||||
|
/* the deselect button */
|
||||||
|
.ui-timepicker .ui-timepicker-deselect { float: left; }
|
||||||
|
|
||||||
|
|
|
@ -1,158 +1,243 @@
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* main layout
|
* Main Layout
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
body {
|
html, body, #body-wrapper {
|
||||||
display: flex;
|
height: 100%;
|
||||||
flex-direction: column;
|
}
|
||||||
min-height: 100vh;
|
|
||||||
|
body > #body-wrapper {
|
||||||
|
height: auto;
|
||||||
|
min-height: 100%;
|
||||||
|
}
|
||||||
|
|
||||||
|
#body-wrapper {
|
||||||
|
margin: 0 1em;
|
||||||
|
width: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
#header {
|
||||||
|
height: 50px;
|
||||||
|
line-height: 50px;
|
||||||
|
}
|
||||||
|
|
||||||
|
#body {
|
||||||
|
padding-top: 10px;
|
||||||
|
padding-bottom: 5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
#footer {
|
||||||
|
clear: both;
|
||||||
|
margin-top: -4em;
|
||||||
|
text-align: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* Header
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
#header h1 {
|
||||||
|
float: left;
|
||||||
|
font-size: 25px;
|
||||||
|
margin: 0px;
|
||||||
|
}
|
||||||
|
|
||||||
|
#header h1.title {
|
||||||
|
font-size: 20px;
|
||||||
|
margin-left: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
#header div.login {
|
||||||
|
float: right;
|
||||||
|
}
|
||||||
|
|
||||||
|
.global .title {
|
||||||
|
margin-left: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* new stuff from 'better' theme begins here */
|
||||||
|
|
||||||
|
header .global {
|
||||||
|
background-color: #eaeaea;
|
||||||
|
height: 60px;
|
||||||
|
}
|
||||||
|
|
||||||
|
header .global a.home,
|
||||||
|
header .global a.global,
|
||||||
|
header .global span.global {
|
||||||
|
display: block;
|
||||||
|
float: left;
|
||||||
|
font-size: 2em;
|
||||||
|
font-weight: bold;
|
||||||
|
line-height: 60px;
|
||||||
|
margin-left: 10px;
|
||||||
|
}
|
||||||
|
|
||||||
|
header .global a.home img {
|
||||||
|
display: block;
|
||||||
|
float: left;
|
||||||
|
padding: 5px 5px 5px 30px;
|
||||||
|
}
|
||||||
|
|
||||||
|
header .global .grid-nav {
|
||||||
|
display: inline-block;
|
||||||
|
font-size: 16px;
|
||||||
|
font-weight: bold;
|
||||||
|
line-height: 60px;
|
||||||
|
margin-left: 5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
header .global .grid-nav .ui-button,
|
||||||
|
header .global .grid-nav span.viewing {
|
||||||
|
margin-left: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
header .global .feedback {
|
||||||
|
float: right;
|
||||||
|
line-height: 60px;
|
||||||
|
margin-right: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
header .page {
|
||||||
|
border-bottom: 1px solid lightgrey;
|
||||||
|
padding: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
header .page h1 {
|
||||||
|
margin: 0;
|
||||||
|
padding: 0 0 0 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* Logo
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
#logo {
|
||||||
|
display: block;
|
||||||
|
margin: 40px auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
|
||||||
|
/****************************************
|
||||||
|
* content
|
||||||
|
****************************************/
|
||||||
|
|
||||||
|
body > #body-wrapper {
|
||||||
|
margin: 0px;
|
||||||
|
position: relative;
|
||||||
}
|
}
|
||||||
|
|
||||||
.content-wrapper {
|
.content-wrapper {
|
||||||
display: flex;
|
height: 100%;
|
||||||
flex: 1;
|
padding-bottom: 30px;
|
||||||
flex-direction: column;
|
|
||||||
justify-content: space-between;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#scrollpane {
|
||||||
/******************************
|
height: 100%;
|
||||||
* header
|
|
||||||
******************************/
|
|
||||||
|
|
||||||
/* this is the one in the very top left of screen, next to logo and linked to
|
|
||||||
the home page */
|
|
||||||
#global-header-title {
|
|
||||||
margin-left: 0.3rem;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
header .level {
|
#scrollpane .inner-content {
|
||||||
/* TODO: not sure what this 60px was supposed to do? but it broke the */
|
padding: 0 0.5em 0.5em 0.5em;
|
||||||
/* styles for the feedback dialog, so disabled it is.
|
|
||||||
/* height: 60px; */
|
|
||||||
/* line-height: 60px; */
|
|
||||||
padding-left: 0.5em;
|
|
||||||
padding-right: 0.5em;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
header .level #header-logo {
|
|
||||||
display: inline-block;
|
|
||||||
}
|
|
||||||
|
|
||||||
header .level .global-title,
|
|
||||||
header .level-left .global-title {
|
|
||||||
font-size: 2em;
|
|
||||||
font-weight: bold;
|
|
||||||
}
|
|
||||||
|
|
||||||
/* indent nested menu items a bit */
|
|
||||||
header .navbar-item.nested {
|
|
||||||
padding-left: 2.5rem;
|
|
||||||
}
|
|
||||||
|
|
||||||
header span.header-text {
|
|
||||||
font-size: 2em;
|
|
||||||
font-weight: bold;
|
|
||||||
margin-right: 10px;
|
|
||||||
}
|
|
||||||
|
|
||||||
#content-title h1 {
|
|
||||||
margin-bottom: 0;
|
|
||||||
margin-right: 1rem;
|
|
||||||
max-width: 50%;
|
|
||||||
overflow: hidden;
|
|
||||||
padding: 0 0.3rem;
|
|
||||||
text-overflow: ellipsis;
|
|
||||||
white-space: nowrap;
|
|
||||||
}
|
|
||||||
|
|
||||||
/******************************
|
|
||||||
* content
|
|
||||||
******************************/
|
|
||||||
|
|
||||||
#page-body {
|
|
||||||
padding: 0.4em;
|
|
||||||
}
|
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* context menu
|
* context menu
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
#context-menu {
|
#context-menu {
|
||||||
margin-bottom: 1em;
|
float: right;
|
||||||
margin-left: 1em;
|
list-style-type: none;
|
||||||
|
margin: 0.5em;
|
||||||
text-align: right;
|
text-align: right;
|
||||||
white-space: nowrap;
|
white-space: nowrap;
|
||||||
}
|
}
|
||||||
|
|
||||||
/******************************
|
|
||||||
* "object helper" panel
|
|
||||||
******************************/
|
|
||||||
|
|
||||||
.object-helpers .panel {
|
|
||||||
margin: 1rem;
|
|
||||||
margin-bottom: 1.5rem;
|
|
||||||
}
|
|
||||||
|
|
||||||
.object-helpers .panel-heading {
|
|
||||||
white-space: nowrap;
|
|
||||||
}
|
|
||||||
|
|
||||||
.object-helpers a {
|
|
||||||
white-space: nowrap;
|
|
||||||
}
|
|
||||||
|
|
||||||
.object-helper {
|
|
||||||
border: 1px solid black;
|
|
||||||
margin: 1em;
|
|
||||||
padding: 1em;
|
|
||||||
width: 20em;
|
|
||||||
}
|
|
||||||
|
|
||||||
.object-helper-content {
|
|
||||||
margin-top: 1em;
|
|
||||||
}
|
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* markdown
|
* Panels
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
.rendered-markdown p,
|
.panel,
|
||||||
.rendered-markdown ul {
|
.panel-grid {
|
||||||
margin-bottom: 1rem;
|
border-left: 1px solid Black;
|
||||||
|
margin-bottom: 15px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.rendered-markdown .codehilite {
|
.panel {
|
||||||
margin-bottom: 2rem;
|
border-bottom: 1px solid Black;
|
||||||
|
border-right: 1px solid Black;
|
||||||
|
padding: 0px;
|
||||||
}
|
}
|
||||||
|
|
||||||
/******************************
|
.panel h2,
|
||||||
* fix datepicker within modals
|
.panel-grid h2 {
|
||||||
* TODO: someday this may not be necessary? cf.
|
border-bottom: 1px solid Black;
|
||||||
* https://github.com/buefy/buefy/issues/292#issuecomment-347365637
|
border-top: 1px solid Black;
|
||||||
******************************/
|
padding: 5px;
|
||||||
|
margin: 0px;
|
||||||
.modal .animation-content .modal-card {
|
|
||||||
overflow: visible !important;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
.modal-card-body {
|
.panel-grid h2 {
|
||||||
overflow: visible !important;
|
border-right: 1px solid Black;
|
||||||
}
|
}
|
||||||
|
|
||||||
/* TODO: a simpler option we might try sometime instead? */
|
.panel-body {
|
||||||
/* cf. https://github.com/buefy/buefy/issues/292#issuecomment-1073851313 */
|
overflow: auto;
|
||||||
|
padding: 5px;
|
||||||
|
}
|
||||||
|
|
||||||
/* .dropdown-content{ */
|
/****************************************
|
||||||
/* position: fixed; */
|
* footer
|
||||||
/* } */
|
****************************************/
|
||||||
|
|
||||||
|
#footer {
|
||||||
|
border-top: 1px solid lightgray;
|
||||||
|
bottom: 0;
|
||||||
|
font-size: 9pt;
|
||||||
|
height: 20px;
|
||||||
|
left: 0;
|
||||||
|
line-height: 20px;
|
||||||
|
margin: 0;
|
||||||
|
position: absolute;
|
||||||
|
width: 100%;
|
||||||
|
}
|
||||||
|
|
||||||
/******************************
|
/******************************
|
||||||
* feedback
|
* feedback
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
.feedback-dialog .red {
|
#feedback-dialog {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
#feedback-dialog p {
|
||||||
|
margin-top: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
#feedback-dialog .red {
|
||||||
color: red;
|
color: red;
|
||||||
font-weight: bold;
|
font-weight: bold;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
#feedback-dialog .field-wrapper {
|
||||||
|
margin-top: 1em;
|
||||||
|
padding: 0;
|
||||||
|
}
|
||||||
|
|
||||||
|
#feedback-dialog .field {
|
||||||
|
margin-bottom: 0;
|
||||||
|
margin-top: 0.5em;
|
||||||
|
}
|
||||||
|
|
||||||
|
#feedback-dialog .referrer .field {
|
||||||
|
clear: both;
|
||||||
|
float: none;
|
||||||
|
margin-top: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
#feedback-dialog textarea {
|
||||||
|
width: auto;
|
||||||
|
}
|
||||||
|
|
40
tailbone/static/css/login.css
Normal file
40
tailbone/static/css/login.css
Normal file
|
@ -0,0 +1,40 @@
|
||||||
|
|
||||||
|
/******************************
|
||||||
|
* login.css
|
||||||
|
******************************/
|
||||||
|
|
||||||
|
#logo {
|
||||||
|
margin: 40px auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.form {
|
||||||
|
margin: auto;
|
||||||
|
float: none;
|
||||||
|
text-align: center;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.field-wrapper {
|
||||||
|
margin: 10px auto;
|
||||||
|
width: 300px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.field-wrapper label {
|
||||||
|
text-align: right;
|
||||||
|
width: auto;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.field-wrapper div.field input[type="text"],
|
||||||
|
div.field-wrapper div.field input[type="password"] {
|
||||||
|
margin-left: 1em;
|
||||||
|
width: 150px;
|
||||||
|
}
|
||||||
|
|
||||||
|
div.buttons input {
|
||||||
|
margin: auto 5px;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* this is for "login as chuck" tip in demo mode */
|
||||||
|
.tips {
|
||||||
|
margin-top: 2em;
|
||||||
|
text-align: center;
|
||||||
|
}
|
57
tailbone/static/css/mobile.css
Normal file
57
tailbone/static/css/mobile.css
Normal file
|
@ -0,0 +1,57 @@
|
||||||
|
|
||||||
|
/****************************************
|
||||||
|
* Global styles for mobile templates
|
||||||
|
****************************************/
|
||||||
|
|
||||||
|
/* main user menu button when root */
|
||||||
|
[data-role="header"] a.root-user,
|
||||||
|
[data-role="header"] a.root-user:hover {
|
||||||
|
background-color: red;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* become/stop root menu links */
|
||||||
|
#usermenu .root-user a {
|
||||||
|
background-color: red;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* normal flash messages */
|
||||||
|
.flash {
|
||||||
|
color: green;
|
||||||
|
margin-bottom: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* error flash messages */
|
||||||
|
.error,
|
||||||
|
.error-messages {
|
||||||
|
color: red;
|
||||||
|
margin-bottom: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* receiving warning flash messages */
|
||||||
|
.receiving-warning {
|
||||||
|
color: red;
|
||||||
|
}
|
||||||
|
|
||||||
|
.replacement-header {
|
||||||
|
display: none;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-wrapper.with-error {
|
||||||
|
background-color: #ddcccc;
|
||||||
|
border: 2px solid #dd6666;
|
||||||
|
margin-bottom: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-wrapper label {
|
||||||
|
font-weight: bold;
|
||||||
|
margin-top: 1em;
|
||||||
|
}
|
||||||
|
|
||||||
|
.field-error .error-msg {
|
||||||
|
color: Red;
|
||||||
|
}
|
||||||
|
|
||||||
|
/* make sure space comes between simple filter and "grid" list */
|
||||||
|
.simple-filter {
|
||||||
|
margin-bottom: 1.5em;
|
||||||
|
}
|
|
@ -3,13 +3,12 @@
|
||||||
* Permission Lists
|
* Permission Lists
|
||||||
******************************/
|
******************************/
|
||||||
|
|
||||||
.permissions-group {
|
.field-wrapper.permissions .field .group {
|
||||||
margin-bottom: 10px;
|
margin-bottom: 10px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.permissions-group .group-label {
|
.field-wrapper.permissions .field .group p {
|
||||||
font-weight: bold;
|
font-weight: bold;
|
||||||
margin-bottom: 10px;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
.field-wrapper.permissions .field label {
|
.field-wrapper.permissions .field label {
|
||||||
|
@ -22,12 +21,12 @@
|
||||||
margin-right: 10px;
|
margin-right: 10px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.permissions-group .perm {
|
.field-wrapper.permissions .field .group p.perm {
|
||||||
font-weight: normal;
|
font-weight: normal;
|
||||||
margin-left: 15px;
|
margin-left: 15px;
|
||||||
}
|
}
|
||||||
|
|
||||||
.permissions-group p.perm span {
|
.field-wrapper.permissions .field .group p.perm span {
|
||||||
font-family: monospace;
|
font-family: monospace;
|
||||||
margin-right: 10px;
|
margin-right: 10px;
|
||||||
}
|
}
|
||||||
|
|
Binary file not shown.
Binary file not shown.
Binary file not shown.
Before Width: | Height: | Size: 10 KiB After Width: | Height: | Size: 4.7 KiB |
|
@ -1,36 +0,0 @@
|
||||||
|
|
||||||
// this code was politely stolen from
|
|
||||||
// https://vanillajstoolkit.com/helpers/debounce/
|
|
||||||
|
|
||||||
// its purpose is to help with Buefy autocomplete performance
|
|
||||||
// https://buefy.org/documentation/autocomplete/
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Debounce functions for better performance
|
|
||||||
* (c) 2021 Chris Ferdinandi, MIT License, https://gomakethings.com
|
|
||||||
* @param {Function} fn The function to debounce
|
|
||||||
*/
|
|
||||||
function debounce (fn) {
|
|
||||||
|
|
||||||
// Setup a timer
|
|
||||||
let timeout;
|
|
||||||
|
|
||||||
// Return a function to run debounced
|
|
||||||
return function () {
|
|
||||||
|
|
||||||
// Setup the arguments
|
|
||||||
let context = this;
|
|
||||||
let args = arguments;
|
|
||||||
|
|
||||||
// If there's a timer, cancel it
|
|
||||||
if (timeout) {
|
|
||||||
window.cancelAnimationFrame(timeout);
|
|
||||||
}
|
|
||||||
|
|
||||||
// Setup the new requestAnimationFrame()
|
|
||||||
timeout = window.requestAnimationFrame(function () {
|
|
||||||
fn.apply(context, args);
|
|
||||||
});
|
|
||||||
|
|
||||||
};
|
|
||||||
}
|
|
452
tailbone/static/js/jquery.ui.tailbone.js
vendored
Normal file
452
tailbone/static/js/jquery.ui.tailbone.js
vendored
Normal file
|
@ -0,0 +1,452 @@
|
||||||
|
|
||||||
|
/**********************************************************************
|
||||||
|
* jQuery UI plugins for Tailbone
|
||||||
|
**********************************************************************/
|
||||||
|
|
||||||
|
/**********************************************************************
|
||||||
|
* gridcore plugin
|
||||||
|
**********************************************************************/
|
||||||
|
|
||||||
|
(function($) {
|
||||||
|
|
||||||
|
$.widget('tailbone.gridcore', {
|
||||||
|
|
||||||
|
_create: function() {
|
||||||
|
|
||||||
|
var that = this;
|
||||||
|
|
||||||
|
// Add hover highlight effect to grid rows during mouse-over.
|
||||||
|
// this.element.on('mouseenter', 'tbody tr:not(.header)', function() {
|
||||||
|
this.element.on('mouseenter', 'tr:not(.header)', function() {
|
||||||
|
$(this).addClass('hovering');
|
||||||
|
});
|
||||||
|
// this.element.on('mouseleave', 'tbody tr:not(.header)', function() {
|
||||||
|
this.element.on('mouseleave', 'tr:not(.header)', function() {
|
||||||
|
$(this).removeClass('hovering');
|
||||||
|
});
|
||||||
|
|
||||||
|
// do some extra stuff for grids with checkboxes
|
||||||
|
|
||||||
|
// mark rows selected on page load, as needed
|
||||||
|
this.element.find('tr:not(.header) td.checkbox :checkbox:checked').each(function() {
|
||||||
|
$(this).parents('tr:first').addClass('selected');
|
||||||
|
});
|
||||||
|
|
||||||
|
// (un-)check all rows when clicking check-all box in header
|
||||||
|
if (this.element.find('tr.header td.checkbox :checkbox').length) {
|
||||||
|
this.element.on('click', 'tr.header td.checkbox :checkbox', function() {
|
||||||
|
var checked = $(this).prop('checked');
|
||||||
|
var rows = that.element.find('tr:not(.header)');
|
||||||
|
rows.find('td.checkbox :checkbox').prop('checked', checked);
|
||||||
|
if (checked) {
|
||||||
|
rows.addClass('selected');
|
||||||
|
} else {
|
||||||
|
rows.removeClass('selected');
|
||||||
|
}
|
||||||
|
that.element.trigger('gridchecked', that.count_selected());
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
// when row with checkbox is clicked, toggle selected status,
|
||||||
|
// unless clicking checkbox (since that already toggles it) or a
|
||||||
|
// link (since that does something completely different)
|
||||||
|
this.element.on('click', 'tr:not(.header)', function(event) {
|
||||||
|
var el = $(event.target);
|
||||||
|
if (!el.is('a') && !el.is(':checkbox')) {
|
||||||
|
$(this).find('td.checkbox :checkbox').click();
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
this.element.on('change', 'tr:not(.header) td.checkbox :checkbox', function() {
|
||||||
|
if (this.checked) {
|
||||||
|
$(this).parents('tr:first').addClass('selected');
|
||||||
|
} else {
|
||||||
|
$(this).parents('tr:first').removeClass('selected');
|
||||||
|
}
|
||||||
|
that.element.trigger('gridchecked', that.count_selected());
|
||||||
|
});
|
||||||
|
|
||||||
|
// Show 'more' actions when user hovers over 'more' link.
|
||||||
|
this.element.on('mouseenter', '.actions a.more', function() {
|
||||||
|
that.element.find('.actions div.more').hide();
|
||||||
|
$(this).siblings('div.more')
|
||||||
|
.show()
|
||||||
|
.position({my: 'left-5 top-4', at: 'left top', of: $(this)});
|
||||||
|
});
|
||||||
|
this.element.on('mouseleave', '.actions div.more', function() {
|
||||||
|
$(this).hide();
|
||||||
|
});
|
||||||
|
|
||||||
|
// Add speed bump for "Delete Row" action, if grid is so configured.
|
||||||
|
if (this.element.data('delete-speedbump')) {
|
||||||
|
this.element.on('click', 'tr:not(.header) .actions a.delete', function() {
|
||||||
|
return confirm("Are you sure you wish to delete this object?");
|
||||||
|
});
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
count_selected: function() {
|
||||||
|
return this.element.find('tr:not(.header) td.checkbox :checkbox:checked').length;
|
||||||
|
},
|
||||||
|
|
||||||
|
// TODO: deprecate / remove this?
|
||||||
|
count_checked: function() {
|
||||||
|
return this.count_selected();
|
||||||
|
},
|
||||||
|
|
||||||
|
selected_rows: function() {
|
||||||
|
return this.element.find('tr:not(.header) td.checkbox :checkbox:checked').parents('tr:first');
|
||||||
|
},
|
||||||
|
|
||||||
|
all_uuids: function() {
|
||||||
|
var uuids = [];
|
||||||
|
this.element.find('tr:not(.header)').each(function() {
|
||||||
|
uuids.push($(this).data('uuid'));
|
||||||
|
});
|
||||||
|
return uuids;
|
||||||
|
},
|
||||||
|
|
||||||
|
selected_uuids: function() {
|
||||||
|
var uuids = [];
|
||||||
|
this.element.find('tr:not(.header) td.checkbox :checkbox:checked').each(function() {
|
||||||
|
uuids.push($(this).parents('tr:first').data('uuid'));
|
||||||
|
});
|
||||||
|
return uuids;
|
||||||
|
}
|
||||||
|
|
||||||
|
});
|
||||||
|
|
||||||
|
})( jQuery );
|
||||||
|
|
||||||
|
|
||||||
|
/**********************************************************************
|
||||||
|
* gridwrapper plugin
|
||||||
|
**********************************************************************/
|
||||||
|
|
||||||
|
(function($) {
|
||||||
|
|
||||||
|
$.widget('tailbone.gridwrapper', {
|
||||||
|
|
||||||
|
_create: function() {
|
||||||
|
|
||||||
|
var that = this;
|
||||||
|
|
||||||
|
// Snag some element references.
|
||||||
|
this.filters = this.element.find('.newfilters');
|
||||||
|
this.filters_form = this.filters.find('form');
|
||||||
|
this.add_filter = this.filters.find('#add-filter');
|
||||||
|
this.apply_filters = this.filters.find('#apply-filters');
|
||||||
|
this.default_filters = this.filters.find('#default-filters');
|
||||||
|
this.clear_filters = this.filters.find('#clear-filters');
|
||||||
|
this.save_defaults = this.filters.find('#save-defaults');
|
||||||
|
this.grid = this.element.find('.grid');
|
||||||
|
|
||||||
|
// add standard grid behavior
|
||||||
|
this.grid.gridcore();
|
||||||
|
|
||||||
|
// Enhance filters etc.
|
||||||
|
this.filters.find('.filter').gridfilter();
|
||||||
|
this.apply_filters.button('option', 'icons', {primary: 'ui-icon-search'});
|
||||||
|
this.default_filters.button('option', 'icons', {primary: 'ui-icon-home'});
|
||||||
|
this.clear_filters.button('option', 'icons', {primary: 'ui-icon-trash'});
|
||||||
|
this.save_defaults.button('option', 'icons', {primary: 'ui-icon-disk'});
|
||||||
|
if (! this.filters.find('.active:checked').length) {
|
||||||
|
this.apply_filters.button('disable');
|
||||||
|
}
|
||||||
|
this.add_filter.selectmenu({
|
||||||
|
width: '15em',
|
||||||
|
|
||||||
|
// Initially disabled if contains no enabled filter options.
|
||||||
|
disabled: this.add_filter.find('option:enabled').length == 1,
|
||||||
|
|
||||||
|
// When add-filter choice is made, show/focus new filter value input,
|
||||||
|
// and maybe hide the add-filter selection or show the apply button.
|
||||||
|
change: function (event, ui) {
|
||||||
|
var filter = that.filters.find('#filter-' + ui.item.value);
|
||||||
|
var select = $(this);
|
||||||
|
var option = ui.item.element;
|
||||||
|
filter.gridfilter('active', true);
|
||||||
|
filter.gridfilter('focus');
|
||||||
|
select.val('');
|
||||||
|
option.attr('disabled', 'disabled');
|
||||||
|
select.selectmenu('refresh');
|
||||||
|
if (select.find('option:enabled').length == 1) { // prompt is always enabled
|
||||||
|
select.selectmenu('disable');
|
||||||
|
}
|
||||||
|
that.apply_filters.button('enable');
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
this.add_filter.on('selectmenuopen', function(event, ui) {
|
||||||
|
show_all_options($(this));
|
||||||
|
});
|
||||||
|
|
||||||
|
// Intercept filters form submittal, and submit via AJAX instead.
|
||||||
|
this.filters_form.on('submit', function() {
|
||||||
|
var settings = {filter: true, partial: true};
|
||||||
|
if (that.filters_form.find('input[name="save-current-filters-as-defaults"]').val() == 'true') {
|
||||||
|
settings['save-current-filters-as-defaults'] = true;
|
||||||
|
}
|
||||||
|
that.filters.find('.filter').each(function() {
|
||||||
|
|
||||||
|
// currently active filters will be included in form data
|
||||||
|
if ($(this).gridfilter('active')) {
|
||||||
|
settings[$(this).data('key')] = $(this).gridfilter('value');
|
||||||
|
settings[$(this).data('key') + '.verb'] = $(this).gridfilter('verb');
|
||||||
|
|
||||||
|
// others will be hidden from view
|
||||||
|
} else {
|
||||||
|
$(this).gridfilter('hide');
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
// if no filters are visible, disable submit button
|
||||||
|
if (! that.filters.find('.filter:visible').length) {
|
||||||
|
that.apply_filters.button('disable');
|
||||||
|
}
|
||||||
|
|
||||||
|
// okay, submit filters to server and refresh grid
|
||||||
|
that.refresh(settings);
|
||||||
|
return false;
|
||||||
|
});
|
||||||
|
|
||||||
|
// When user clicks Default Filters button, refresh page with
|
||||||
|
// instructions for the server to reset filters to default settings.
|
||||||
|
this.default_filters.click(function() {
|
||||||
|
that.filters_form.off('submit');
|
||||||
|
that.filters_form.find('input[name="reset-to-default-filters"]').val('true');
|
||||||
|
that.element.mask("Refreshing data...");
|
||||||
|
that.filters_form.get(0).submit();
|
||||||
|
});
|
||||||
|
|
||||||
|
// When user clicks Save Defaults button, refresh the grid as with
|
||||||
|
// Apply Filters, but add an instruction for the server to save
|
||||||
|
// current settings as defaults for the user.
|
||||||
|
this.save_defaults.click(function() {
|
||||||
|
that.filters_form.find('input[name="save-current-filters-as-defaults"]').val('true');
|
||||||
|
that.filters_form.submit();
|
||||||
|
that.filters_form.find('input[name="save-current-filters-as-defaults"]').val('false');
|
||||||
|
});
|
||||||
|
|
||||||
|
// When user clicks Clear Filters button, deactivate all filters
|
||||||
|
// and refresh the grid.
|
||||||
|
this.clear_filters.click(function() {
|
||||||
|
that.filters.find('.filter').each(function() {
|
||||||
|
if ($(this).gridfilter('active')) {
|
||||||
|
$(this).gridfilter('active', false);
|
||||||
|
}
|
||||||
|
});
|
||||||
|
that.filters_form.submit();
|
||||||
|
});
|
||||||
|
|
||||||
|
// Refresh data when user clicks a sortable column header.
|
||||||
|
this.element.on('click', 'tr.header a', function() {
|
||||||
|
var td = $(this).parent();
|
||||||
|
var data = {
|
||||||
|
sortkey: $(this).data('sortkey'),
|
||||||
|
sortdir: (td.hasClass('asc')) ? 'desc' : 'asc',
|
||||||
|
page: 1,
|
||||||
|
partial: true
|
||||||
|
};
|
||||||
|
that.refresh(data);
|
||||||
|
return false;
|
||||||
|
});
|
||||||
|
|
||||||
|
// Refresh data when user chooses a new page size setting.
|
||||||
|
this.element.on('change', '.pager #pagesize', function() {
|
||||||
|
var settings = {
|
||||||
|
partial: true,
|
||||||
|
pagesize: $(this).val()
|
||||||
|
};
|
||||||
|
that.refresh(settings);
|
||||||
|
});
|
||||||
|
|
||||||
|
// Refresh data when user clicks a pager link.
|
||||||
|
this.element.on('click', '.pager a', function() {
|
||||||
|
that.refresh(this.search.substring(1)); // remove leading '?'
|
||||||
|
return false;
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
// Refreshes the visible data within the grid, according to the given settings.
|
||||||
|
refresh: function(settings) {
|
||||||
|
var that = this;
|
||||||
|
this.element.mask("Refreshing data...");
|
||||||
|
$.get(this.grid.data('url'), settings, function(data) {
|
||||||
|
that.grid.replaceWith(data);
|
||||||
|
that.grid = that.element.find('.grid');
|
||||||
|
that.grid.gridcore();
|
||||||
|
that.element.unmask();
|
||||||
|
});
|
||||||
|
},
|
||||||
|
|
||||||
|
results_count: function(as_text) {
|
||||||
|
var count = null;
|
||||||
|
var match = /showing \d+ thru \d+ of (\S+)/.exec(this.element.find('.pager .showing').text());
|
||||||
|
if (match) {
|
||||||
|
count = match[1];
|
||||||
|
if (!as_text) {
|
||||||
|
count = parseInt(count, 10);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return count;
|
||||||
|
},
|
||||||
|
|
||||||
|
all_uuids: function() {
|
||||||
|
return this.grid.gridcore('all_uuids');
|
||||||
|
},
|
||||||
|
|
||||||
|
selected_uuids: function() {
|
||||||
|
return this.grid.gridcore('selected_uuids');
|
||||||
|
}
|
||||||
|
|
||||||
|
});
|
||||||
|
|
||||||
|
})( jQuery );
|
||||||
|
|
||||||
|
|
||||||
|
/**********************************************************************
|
||||||
|
* gridfilter plugin
|
||||||
|
**********************************************************************/
|
||||||
|
|
||||||
|
(function($) {
|
||||||
|
|
||||||
|
$.widget('tailbone.gridfilter', {
|
||||||
|
|
||||||
|
_create: function() {
|
||||||
|
|
||||||
|
var that = this;
|
||||||
|
|
||||||
|
// Track down some important elements.
|
||||||
|
this.checkbox = this.element.find('input[name$="-active"]');
|
||||||
|
this.label = this.element.find('label');
|
||||||
|
this.inputs = this.element.find('.inputs');
|
||||||
|
this.add_filter = this.element.parents('.grid-wrapper').find('#add-filter');
|
||||||
|
|
||||||
|
// Hide the checkbox and label, and add button for toggling active status.
|
||||||
|
this.checkbox.addClass('ui-helper-hidden-accessible');
|
||||||
|
this.label.hide();
|
||||||
|
this.activebutton = $('<button type="button" class="toggle" />')
|
||||||
|
.insertAfter(this.label)
|
||||||
|
.text(this.label.text())
|
||||||
|
.button({
|
||||||
|
icons: {primary: 'ui-icon-blank'}
|
||||||
|
});
|
||||||
|
|
||||||
|
// Enhance verb dropdown as selectmenu.
|
||||||
|
this.verb_select = this.inputs.find('.verb');
|
||||||
|
this.valueless_verbs = {};
|
||||||
|
$.each(this.verb_select.data('hide-value-for').split(' '), function(index, value) {
|
||||||
|
that.valueless_verbs[value] = true;
|
||||||
|
});
|
||||||
|
this.verb_select.selectmenu({
|
||||||
|
width: '15em',
|
||||||
|
change: function(event, ui) {
|
||||||
|
if (ui.item.value in that.valueless_verbs) {
|
||||||
|
that.inputs.find('.value').hide();
|
||||||
|
} else {
|
||||||
|
that.inputs.find('.value').show();
|
||||||
|
that.focus();
|
||||||
|
that.select();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
this.verb_select.on('selectmenuopen', function(event, ui) {
|
||||||
|
show_all_options($(this));
|
||||||
|
});
|
||||||
|
|
||||||
|
// Enhance any date values with datepicker widget.
|
||||||
|
this.inputs.find('.value input[data-datepicker="true"]').datepicker({
|
||||||
|
dateFormat: 'yy-mm-dd',
|
||||||
|
changeYear: true,
|
||||||
|
changeMonth: true
|
||||||
|
});
|
||||||
|
|
||||||
|
// Enhance any choice/dropdown values with selectmenu.
|
||||||
|
this.inputs.find('.value select').selectmenu({
|
||||||
|
// provide sane width for value dropdown
|
||||||
|
width: '15em'
|
||||||
|
});
|
||||||
|
|
||||||
|
this.inputs.find('.value select').on('selectmenuopen', function(event, ui) {
|
||||||
|
show_all_options($(this));
|
||||||
|
});
|
||||||
|
|
||||||
|
// Listen for button click, to keep checkbox in sync.
|
||||||
|
this._on(this.activebutton, {
|
||||||
|
click: function(e) {
|
||||||
|
var checked = !this.checkbox.is(':checked');
|
||||||
|
this.checkbox.prop('checked', checked);
|
||||||
|
this.refresh();
|
||||||
|
if (checked) {
|
||||||
|
this.focus();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
});
|
||||||
|
|
||||||
|
// Update the initial state of the button according to checkbox.
|
||||||
|
this.refresh();
|
||||||
|
},
|
||||||
|
|
||||||
|
refresh: function() {
|
||||||
|
if (this.checkbox.is(':checked')) {
|
||||||
|
this.activebutton.button('option', 'icons', {primary: 'ui-icon-check'});
|
||||||
|
if (this.verb() in this.valueless_verbs) {
|
||||||
|
this.inputs.find('.value').hide();
|
||||||
|
} else {
|
||||||
|
this.inputs.find('.value').show();
|
||||||
|
}
|
||||||
|
this.inputs.show();
|
||||||
|
} else {
|
||||||
|
this.activebutton.button('option', 'icons', {primary: 'ui-icon-blank'});
|
||||||
|
this.inputs.hide();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
active: function(value) {
|
||||||
|
if (value === undefined) {
|
||||||
|
return this.checkbox.is(':checked');
|
||||||
|
}
|
||||||
|
if (value) {
|
||||||
|
if (!this.checkbox.is(':checked')) {
|
||||||
|
this.checkbox.prop('checked', true);
|
||||||
|
this.refresh();
|
||||||
|
this.element.show();
|
||||||
|
}
|
||||||
|
} else if (this.checkbox.is(':checked')) {
|
||||||
|
this.checkbox.prop('checked', false);
|
||||||
|
this.refresh();
|
||||||
|
}
|
||||||
|
},
|
||||||
|
|
||||||
|
hide: function() {
|
||||||
|
this.active(false);
|
||||||
|
this.element.hide();
|
||||||
|
var option = this.add_filter.find('option[value="' + this.element.data('key') + '"]');
|
||||||
|
option.attr('disabled', false);
|
||||||
|
if (this.add_filter.selectmenu('option', 'disabled')) {
|
||||||
|
this.add_filter.selectmenu('enable');
|
||||||
|
}
|
||||||
|
this.add_filter.selectmenu('refresh');
|
||||||
|
},
|
||||||
|
|
||||||
|
focus: function() {
|
||||||
|
this.inputs.find('.value input').focus();
|
||||||
|
},
|
||||||
|
|
||||||
|
select: function() {
|
||||||
|
this.inputs.find('.value input').select();
|
||||||
|
},
|
||||||
|
|
||||||
|
value: function() {
|
||||||
|
return this.inputs.find('.value input, .value select').val();
|
||||||
|
},
|
||||||
|
|
||||||
|
verb: function() {
|
||||||
|
return this.inputs.find('.verb').val();
|
||||||
|
}
|
||||||
|
|
||||||
|
});
|
||||||
|
|
||||||
|
})( jQuery );
|
81
tailbone/static/js/jquery.ui.tailbone.mobile.js
Normal file
81
tailbone/static/js/jquery.ui.tailbone.mobile.js
Normal file
|
@ -0,0 +1,81 @@
|
||||||
|
|
||||||
|
/******************************************
|
||||||
|
* jQuery Mobile plugins for Tailbone
|
||||||
|
*****************************************/
|
||||||
|
|
||||||
|
/******************************************
|
||||||
|
* mobile autocomplete
|
||||||
|
*****************************************/
|
||||||
|
|
||||||
|
(function($) {
|
||||||
|
|
||||||
|
$.widget('tailbone.mobileautocomplete', {
|
||||||
|
|
||||||
|
_create: function() {
|
||||||
|
var that = this;
|
||||||
|
|
||||||
|
// snag some element references
|
||||||
|
this.search = this.element.find('.ui-input-search');
|
||||||
|
this.hidden_field = this.element.find('input[type="hidden"]');
|
||||||
|
this.text_field = this.element.find('input[type="text"]');
|
||||||
|
this.ul = this.element.find('ul');
|
||||||
|
this.button = this.element.find('button');
|
||||||
|
|
||||||
|
// establish our autocomplete URL
|
||||||
|
this.url = this.options.url || this.element.data('url');
|
||||||
|
|
||||||
|
// NOTE: much of this code was copied from the jquery mobile demo site
|
||||||
|
// https://demos.jquerymobile.com/1.4.5/listview-autocomplete-remote/
|
||||||
|
this.ul.on('filterablebeforefilter', function(e, data) {
|
||||||
|
|
||||||
|
var $input = $( data.input ),
|
||||||
|
value = $input.val(),
|
||||||
|
html = "";
|
||||||
|
that.ul.html( "" );
|
||||||
|
if ( value && value.length > 2 ) {
|
||||||
|
that.ul.html( "<li><div class='ui-loader'><span class='ui-icon ui-icon-loading'></span></div></li>" );
|
||||||
|
that.ul.listview( "refresh" );
|
||||||
|
$.ajax({
|
||||||
|
url: that.url,
|
||||||
|
data: {
|
||||||
|
term: $input.val()
|
||||||
|
}
|
||||||
|
})
|
||||||
|
.then( function ( response ) {
|
||||||
|
$.each( response, function ( i, val ) {
|
||||||
|
html += '<li data-uuid="' + val.value + '">' + val.label + "</li>";
|
||||||
|
});
|
||||||
|
that.ul.html( html );
|
||||||
|
that.ul.listview( "refresh" );
|
||||||
|
that.ul.trigger( "updatelayout");
|
||||||
|
});
|
||||||
|
}
|
||||||
|
|
||||||
|
});
|
||||||
|
|
||||||
|
// when user clicks autocomplete result, hide search etc.
|
||||||
|
this.ul.on('click', 'li', function() {
|
||||||
|
var $li = $(this);
|
||||||
|
var uuid = $li.data('uuid');
|
||||||
|
that.search.hide();
|
||||||
|
that.hidden_field.val(uuid);
|
||||||
|
that.button.text($li.text()).show();
|
||||||
|
that.ul.hide();
|
||||||
|
that.element.trigger('autocompleteitemselected', uuid);
|
||||||
|
});
|
||||||
|
|
||||||
|
// when user clicks "change" button, show search etc.
|
||||||
|
this.button.click(function() {
|
||||||
|
that.button.hide();
|
||||||
|
that.ul.empty().show();
|
||||||
|
that.hidden_field.val('');
|
||||||
|
that.search.show();
|
||||||
|
that.text_field.focus();
|
||||||
|
that.element.trigger('autocompleteitemcleared');
|
||||||
|
});
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
});
|
||||||
|
|
||||||
|
})( jQuery );
|
10
tailbone/static/js/lib/jquery.loadmask.min.js
vendored
Normal file
10
tailbone/static/js/lib/jquery.loadmask.min.js
vendored
Normal file
|
@ -0,0 +1,10 @@
|
||||||
|
/**
|
||||||
|
* Copyright (c) 2009 Sergiy Kovalchuk (serg472@gmail.com)
|
||||||
|
*
|
||||||
|
* Dual licensed under the MIT (http://www.opensource.org/licenses/mit-license.php)
|
||||||
|
* and GPL (http://www.opensource.org/licenses/gpl-license.php) licenses.
|
||||||
|
*
|
||||||
|
* Following code is based on Element.mask() implementation from ExtJS framework (http://extjs.com/)
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
(function(a){a.fn.mask=function(c,b){a(this).each(function(){if(b!==undefined&&b>0){var d=a(this);d.data("_mask_timeout",setTimeout(function(){a.maskElement(d,c)},b))}else{a.maskElement(a(this),c)}})};a.fn.unmask=function(){a(this).each(function(){a.unmaskElement(a(this))})};a.fn.isMasked=function(){return this.hasClass("masked")};a.maskElement=function(d,c){if(d.data("_mask_timeout")!==undefined){clearTimeout(d.data("_mask_timeout"));d.removeData("_mask_timeout")}if(d.isMasked()){a.unmaskElement(d)}if(d.css("position")=="static"){d.addClass("masked-relative")}d.addClass("masked");var e=a('<div class="loadmask"></div>');if(navigator.userAgent.toLowerCase().indexOf("msie")>-1){e.height(d.height()+parseInt(d.css("padding-top"))+parseInt(d.css("padding-bottom")));e.width(d.width()+parseInt(d.css("padding-left"))+parseInt(d.css("padding-right")))}if(navigator.userAgent.toLowerCase().indexOf("msie 6")>-1){d.find("select").addClass("masked-hidden")}d.append(e);if(c!==undefined){var b=a('<div class="loadmask-msg" style="display:none;"></div>');b.append("<div>"+c+"</div>");d.append(b);b.css("top",Math.round(d.height()/2-(b.height()-parseInt(b.css("padding-top"))-parseInt(b.css("padding-bottom")))/2)+"px");b.css("left",Math.round(d.width()/2-(b.width()-parseInt(b.css("padding-left"))-parseInt(b.css("padding-right")))/2)+"px");b.show()}};a.unmaskElement=function(b){if(b.data("_mask_timeout")!==undefined){clearTimeout(b.data("_mask_timeout"));b.removeData("_mask_timeout")}b.find(".loadmask-msg,.loadmask").remove();b.removeClass("masked");b.removeClass("masked-relative");b.find("select").removeClass("masked-hidden")}})(jQuery);
|
Some files were not shown because too many files have changed in this diff Show more
Loading…
Add table
Add a link
Reference in a new issue