diff --git a/.gitignore b/.gitignore index 906dc226..b3006f90 100644 --- a/.gitignore +++ b/.gitignore @@ -1,5 +1,8 @@ +*~ +*.pyc .coverage .tox/ +dist/ docs/_build/ htmlcov/ Tailbone.egg-info/ diff --git a/CHANGELOG.md b/CHANGELOG.md new file mode 100644 index 00000000..c6106236 --- /dev/null +++ b/CHANGELOG.md @@ -0,0 +1,689 @@ + +# Changelog +All notable changes to Tailbone will be documented in this file. + +The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html). + +## v0.22.8 (2025-05-20) + +### Fix + +- add startup hack for tempmon DB model + +## v0.22.7 (2025-02-19) + +### Fix + +- stop using old config for logo image url on login page +- fix warning msg for deprecated Grid param + +## v0.22.6 (2025-02-01) + +### Fix + +- register vue3 form component for products -> make batch + +## v0.22.5 (2024-12-16) + +### Fix + +- whoops this is latest rattail +- require newer rattail lib +- require newer wuttaweb +- let caller request safe HTML literal for rendered grid table + +## v0.22.4 (2024-11-22) + +### Fix + +- avoid error in product search for duplicated key +- use vmodel for confirm password widget input + +## v0.22.3 (2024-11-19) + +### Fix + +- avoid error for trainwreck query when not a customer + +## v0.22.2 (2024-11-18) + +### Fix + +- use local/custom enum for continuum operations +- add basic master view for Product Costs +- show continuum operation type when viewing version history +- always define `app` attr for ViewSupplement +- avoid deprecated import + +## v0.22.1 (2024-11-02) + +### Fix + +- fix submit button for running problem report +- avoid deprecated grid method + +## v0.22.0 (2024-10-22) + +### Feat + +- add support for new ordering batch from parsed file + +### Fix + +- avoid deprecated method to suggest username + +## v0.21.11 (2024-10-03) + +### Fix + +- custom method for adding grid action +- become/stop root should redirect to previous url + +## v0.21.10 (2024-09-15) + +### Fix + +- update project repo links, kallithea -> forgejo +- use better icon for submit button on login page +- wrap notes text for batch view +- expose datasync consumer batch size via configure page + +## v0.21.9 (2024-08-28) + +### Fix + +- render custom attrs in form component tag + +## v0.21.8 (2024-08-28) + +### Fix + +- ignore session kwarg for `MasterView.make_row_grid()` + +## v0.21.7 (2024-08-28) + +### Fix + +- avoid error when form value cannot be obtained + +## v0.21.6 (2024-08-28) + +### Fix + +- avoid error when grid value cannot be obtained + +## v0.21.5 (2024-08-28) + +### Fix + +- set empty string for "-new-" file configure option + +## v0.21.4 (2024-08-26) + +### Fix + +- handle differing email profile keys for appinfo/configure + +## v0.21.3 (2024-08-26) + +### Fix + +- show non-standard config values for app info configure email + +## v0.21.2 (2024-08-26) + +### Fix + +- refactor waterpark base template to use wutta feedback component +- fix input/output file upload feature for configure pages, per oruga +- tweak how grid data translates to Vue template context +- merge filters into main grid template +- add basic wutta view for users +- some fixes for wutta people view +- various fixes for waterpark theme +- avoid deprecated `component` form kwarg + +## v0.21.1 (2024-08-22) + +### Fix + +- misc. bugfixes per recent changes + +## v0.21.0 (2024-08-22) + +### Feat + +- move "most" filtering logic for grid class to wuttaweb +- inherit from wuttaweb templates for home, login pages +- inherit from wuttaweb for AppInfoView, appinfo/configure template +- add "has output file templates" config option for master view + +### Fix + +- change grid reset-view param name to match wuttaweb +- move "searchable columns" grid feature to wuttaweb +- use wuttaweb to get/render csrf token +- inherit from wuttaweb for appinfo/index template +- prefer wuttaweb config for "home redirect to login" feature +- fix master/index template rendering for waterpark theme +- fix spacing for navbar logo/title in waterpark theme + +## v0.20.1 (2024-08-20) + +### Fix + +- fix default filter verbs logic for workorder status + +## v0.20.0 (2024-08-20) + +### Feat + +- add new 'waterpark' theme, based on wuttaweb w/ vue2 + buefy +- refactor templates to simplify base/page/form structure + +### Fix + +- avoid deprecated reference to app db engine + +## v0.19.3 (2024-08-19) + +### Fix + +- add pager stats to all grid vue data (fixes view history) + +## v0.19.2 (2024-08-19) + +### Fix + +- sort on frontend for appinfo package listing grid +- prefer attr over key lookup when getting model values +- replace all occurrences of `component_studly` => `vue_component` + +## v0.19.1 (2024-08-19) + +### Fix + +- fix broken user auth for web API app + +## v0.19.0 (2024-08-18) + +### Feat + +- move multi-column grid sorting logic to wuttaweb +- move single-column grid sorting logic to wuttaweb + +### Fix + +- fix misc. errors in grid template per wuttaweb +- fix broken permission directives in web api startup + +## v0.18.0 (2024-08-16) + +### Feat + +- move "basic" grid pagination logic to wuttaweb +- inherit from wutta base class for Grid +- inherit most logic from wuttaweb, for GridAction + +### Fix + +- avoid route error in user view, when using wutta people view +- fix some more wutta compat for base template + +## v0.17.0 (2024-08-15) + +### Feat + +- use wuttaweb for `get_liburl()` logic + +## v0.16.1 (2024-08-15) + +### Fix + +- improve wutta People view a bit +- update references to `get_class_hierarchy()` +- tweak template for `people/view_profile` per wutta compat + +## v0.16.0 (2024-08-15) + +### Feat + +- add first wutta-based master, for PersonView +- refactor forms/grids/views/templates per wuttaweb compat + +## v0.15.6 (2024-08-13) + +### Fix + +- avoid `before_render` subscriber hook for web API +- simplify verbiage for batch execution panel + +## v0.15.5 (2024-08-09) + +### Fix + +- assign convenience attrs for all views (config, app, enum, model) + +## v0.15.4 (2024-08-09) + +### Fix + +- avoid bug when checking current theme + +## v0.15.3 (2024-08-08) + +### Fix + +- fix timepicker `parseTime()` when value is null + +## v0.15.2 (2024-08-06) + +### Fix + +- use auth handler, avoid legacy calls for role/perm checks + +## v0.15.1 (2024-08-05) + +### Fix + +- move magic `b` template context var to wuttaweb + +## v0.15.0 (2024-08-05) + +### Feat + +- move more subscriber logic to wuttaweb + +### Fix + +- use wuttaweb logic for `util.get_form_data()` + +## v0.14.5 (2024-08-03) + +### Fix + +- use auth handler instead of deprecated auth functions +- avoid duplicate `partial` param when grid reloads data + +## v0.14.4 (2024-07-18) + +### Fix + +- fix more settings persistence bug(s) for datasync/configure +- fix modals for luigi tasks page, per oruga + +## v0.14.3 (2024-07-17) + +### Fix + +- fix auto-collapse title for viewing trainwreck txn +- allow auto-collapse of header when viewing trainwreck txn + +## v0.14.2 (2024-07-15) + +### Fix + +- add null menu handler, for use with API apps + +## v0.14.1 (2024-07-14) + +### Fix + +- update usage of auth handler, per rattail changes +- fix model reference in menu handler +- fix bug when making "integration" menus + +## v0.14.0 (2024-07-14) + +### Feat + +- move core menu logic to wuttaweb + +## v0.13.2 (2024-07-13) + +### Fix + +- fix logic bug for datasync/config settings save + +## v0.13.1 (2024-07-13) + +### Fix + +- fix settings persistence bug(s) for datasync/configure page + +## v0.13.0 (2024-07-12) + +### Feat + +- begin integrating WuttaWeb as upstream dependency + +### Fix + +- cast enum as list to satisfy deform widget + +## v0.12.1 (2024-07-11) + +### Fix + +- refactor `config.get_model()` => `app.model` + +## v0.12.0 (2024-07-09) + +### Feat + +- drop python 3.6 support, use pyproject.toml (again) + +## v0.11.10 (2024-07-05) + +### Fix + +- make the Members tab optional, for profile view + +## v0.11.9 (2024-07-05) + +### Fix + +- do not show flash message when changing app theme + +- improve collapse panels for butterball theme + +- expand input for butterball theme + +- add xref button to customer profile, for trainwreck txn view + +- add optional Transactions tab for profile view + +## v0.11.8 (2024-07-04) + +### Fix + +- fix grid action icons for datasync/configure, per oruga + +- allow view supplements to add extra links for profile employee tab + +- leverage import handler method to determine command/subcommand + +- add tool to make user account from profile view + +## v0.11.7 (2024-07-04) + +### Fix + +- add stacklevel to deprecation warnings + +- require zope.sqlalchemy >= 1.5 + +- include edit profile email/phone dialogs only if user has perms + +- allow view supplements to add to profile member context + +- cast enum as list to satisfy deform widget + +- expand POD image URL setting input + +## v0.11.6 (2024-07-01) + +### Fix + +- set explicit referrer when changing dbkey + +- remove references, dependency for `six` package + +## v0.11.5 (2024-06-30) + +### Fix + +- allow comma in numeric filter input + +- add custom url prefix if needed, for fanstatic + +- use vue 3.4.31 and oruga 0.8.12 by default + +## v0.11.4 (2024-06-30) + +### Fix + +- start/stop being root should submit POST instead of GET + +- require vendor when making new ordering batch via api + +- don't escape each address for email attempts grid + +## v0.11.3 (2024-06-28) + +### Fix + +- add link to "resolved by" user for pending products + +- handle error when merging 2 records fails + +## v0.11.2 (2024-06-18) + +### Fix + +- hide certain custorder settings if not applicable + +- use different logic for buefy/oruga for product lookup keydown + +- product records should be touchable + +- show flash error message if resolve pending product fails + +## v0.11.1 (2024-06-14) + +### Fix + +- revert back to setup.py + setup.cfg + +## v0.11.0 (2024-06-10) + +### Feat + +- switch from setup.cfg to pyproject.toml + hatchling + +## v0.10.16 (2024-06-10) + +### Feat + +- standardize how app, package versions are determined + +### Fix + +- avoid deprecated config methods for app/node title + +## v0.10.15 (2024-06-07) + +### Fix + +- do *not* Use `pkg_resources` to determine package versions + +## v0.10.14 (2024-06-06) + +### Fix + +- use `pkg_resources` to determine package versions + +## v0.10.13 (2024-06-06) + +### Feat + +- remove old/unused scaffold for use with `pcreate` + +- add 'fanstatic' support for sake of libcache assets + +## v0.10.12 (2024-06-04) + +### Feat + +- require pyramid 2.x; remove 1.x-style auth policies + +- remove version cap for deform + +- set explicit referrer when changing app theme + +- add `` component shim + +- include extra styles from `base_meta` template for butterball + +- include butterball theme by default for new apps + +### Fix + +- fix product lookup component, per butterball + +## v0.10.11 (2024-06-03) + +### Feat + +- fix vue3 refresh bugs for various views + +- fix grid bug for tempmon appliance view, per oruga + +- fix ordering worksheet generator, per butterball + +- fix inventory worksheet generator, per butterball + +## v0.10.10 (2024-06-03) + +### Feat + +- more butterball fixes for "view profile" template + +### Fix + +- fix focus for `` shim component + +## v0.10.9 (2024-06-03) + +### Feat + +- let master view control context menu items for page + +- fix the "new custorder" page for butterball + +### Fix + +- fix panel style for PO vs. Invoice breakdown in receiving batch + +## v0.10.8 (2024-06-02) + +### Feat + +- add styling for checked grid rows, per oruga/butterball + +- fix product view template for oruga/butterball + +- allow per-user custom styles for butterball + +- use oruga 0.8.9 by default + +## v0.10.7 (2024-06-01) + +### Feat + +- add setting to allow decimal quantities for receiving + +- log error if registry has no rattail config + +- add column filters for import/export main grid + +- escape all unsafe html for grid data + +- add speedbumps for delete, set preferred email/phone in profile view + +- fix file upload widget for oruga + +### Fix + +- fix overflow when instance header title is too long (butterball) + +## v0.10.6 (2024-05-29) + +### Feat + +- add way to flag organic products within lookup dialog + +- expose db picker for butterball theme + +- expose quickie lookup for butterball theme + +- fix basic problems with people profile view, per butterball + +## v0.10.5 (2024-05-29) + +### Feat + +- add `` component for oruga + +## v0.10.4 (2024-05-12) + +### Fix + +- fix styles for grid actions, per butterball + +## v0.10.3 (2024-05-10) + +### Fix + +- fix bug with grid date filters + +## v0.10.2 (2024-05-08) + +### Feat + +- remove version restriction for pyramid_beaker dependency + +- rename some attrs etc. for buefy components used with oruga + +- fix "tools" helper for receiving batch view, per oruga + +- more data type fixes for ```` + +- fix "view receiving row" page, per oruga + +- tweak styles for grid action links, per butterball + +### Fix + +- fix employees grid when viewing department (per oruga) + +- fix login "enter" key behavior, per oruga + +- fix button text for autocomplete + +## v0.10.1 (2024-04-28) + +### Feat + +- sort list of available themes + +- update various icon names for oruga compatibility + +- show "View This" button when cloning a record + +- stop including 'falafel' as available theme + +### Fix + +- fix vertical alignment in main menu bar, for butterball + +- fix upgrade execution logic/UI per oruga + +## v0.10.0 (2024-04-28) + +This version bump is to reflect adding support for Vue 3 + Oruga via +the 'butterball' theme. There is likely more work to be done for that +yet, but it mostly works at this point. + +### Feat + +- misc. template and view logic tweaks (applicable to all themes) for + better patterns, consistency etc. + +- add initial support for Vue 3 + Oruga, via "butterball" theme + + +## Older Releases + +Please see `docs/OLDCHANGES.rst` for older release notes. diff --git a/MANIFEST.in b/MANIFEST.in index 0114904a..a3d57f93 100644 --- a/MANIFEST.in +++ b/MANIFEST.in @@ -11,6 +11,8 @@ recursive-include tailbone/static *.jpg recursive-include tailbone/static *.gif recursive-include tailbone/static *.ico +recursive-include tailbone/static/files * + recursive-include tailbone/templates *.mako recursive-include tailbone/templates *.pt recursive-include tailbone/reports *.mako diff --git a/README.rst b/README.md similarity index 56% rename from README.rst rename to README.md index 0cffc62d..74c007f6 100644 --- a/README.rst +++ b/README.md @@ -1,10 +1,8 @@ -Tailbone -======== +# Tailbone Tailbone is an extensible web application based on Rattail. It provides a "back-office network environment" (BONE) for use in managing retail data. -Please see Rattail's `home page`_ for more information. - -.. _home page: http://rattailproject.org/ +Please see Rattail's [home page](http://rattailproject.org/) for more +information. diff --git a/CHANGES.rst b/docs/OLDCHANGES.rst similarity index 75% rename from CHANGES.rst rename to docs/OLDCHANGES.rst index defb6035..0a802f40 100644 --- a/CHANGES.rst +++ b/docs/OLDCHANGES.rst @@ -2,6 +2,1983 @@ CHANGELOG ========= +NB. this file contains "old" release notes only. for newer releases +see the `CHANGELOG.md` file in the source root folder. + + +0.9.96 (2024-04-25) +------------------- + +* Remove unused code for ``webhelpers2_grid``. + +* Rename setting for custom user css (remove "buefy"). + +* Fix permission checks for root user with pyramid 2.x. + +* Cleanup grid/filters logic a bit. + +* Use normal (not checkbox) button for grid filters. + +* Tweak icon for Download Results button. + +* Use v-model to track selection etc. for download results fields. + +* Allow deleting rows from executed batches. + + +0.9.95 (2024-04-19) +------------------- + +* Fix ASGI websockets when serving on sub-path under site root. + +* Fix raw query to avoid SQLAlchemy 2.x warnings. + +* Remove config "style" from appinfo page. + + +0.9.94 (2024-04-16) +------------------- + +* Fix master template bug when no form in context. + + +0.9.93 (2024-04-16) +------------------- + +* Improve form support for view supplements. + +* Prevent multi-click for grid filters "Save Defaults" button. + +* Fix typo when getting app instance. + + +0.9.92 (2024-04-16) +------------------- + +* Escape underscore char for "contains" query filter. + +* Rename custom ``user_css`` context. + +* Add support for Pyramid 2.x; new security policy. + + +0.9.91 (2024-04-15) +------------------- + +* Avoid uncaught error when updating order batch row quantities. + +* Try to return JSON error when receiving API call fails. + +* Avoid error for tax field when creating new department. + +* Show toast msg instead of silent error, when grid fetch fails. + +* Remove most references to "buefy" name in class methods, template + filenames etc. + + +0.9.90 (2024-04-01) +------------------- + +* Add basic CRUD for Person "preferred first name". + + +0.9.89 (2024-03-27) +------------------- + +* Fix bulk-delete rows for import/export batch. + + +0.9.88 (2024-03-26) +------------------- + +* Update some SQLAlchemy logic per upcoming 2.0 changes. + + +0.9.87 (2023-12-26) +------------------- + +* Auto-disable submit button for login form. + +* Hide single invoice file field for multi-invoice receiving batch. + +* Use common logic to render invoice total for receiving. + +* Expose default custorder discount for Departments. + + +0.9.86 (2023-12-12) +------------------- + +* Use ``ltrim(rtrim())`` instead of just ``trim()`` in grid filters. + + +0.9.85 (2023-12-01) +------------------- + +* Use clientele handler to populate customer dropdown widget. + + +0.9.84 (2023-11-30) +------------------- + +* Provide a way to show enum display text for some version diff fields. + + +0.9.83 (2023-11-30) +------------------- + +* Avoid error when editing a department. + + +0.9.82 (2023-11-19) +------------------- + +* Fix DB picker, theme picker per Buefy conventions. + + +0.9.81 (2023-11-15) +------------------- + +* Log warning instead of error for batch population error. + +* Remove reference to ``pytz`` library. + +* Avoid outright error if user scans barcode for inventory count. + + +0.9.80 (2023-11-05) +------------------- + +* Expose status code for equity payments. + + +0.9.79 (2023-11-01) +------------------- + +* Add button to confirm all costs for receiving. + + +0.9.78 (2023-11-01) +------------------- + +* Use shared logic to get batch handler. + +* Fix config key for default themes list. + + +0.9.77 (2023-11-01) +------------------- + +* Encode values for "between" query filter. + +* Avoid error when rendering version diff. + + +0.9.76 (2023-11-01) +------------------- + +* Fix missing import. + + +0.9.75 (2023-11-01) +------------------- + +* Add deprecation warnings for ambgiguous config keys. + + +0.9.74 (2023-10-30) +------------------- + +* Log warning / avoid error if email profile can't be normalized. + + +0.9.73 (2023-10-29) +------------------- + +* Add way to "ignore" a pending product. + +* Tweak param docs for ``Form.set_validator()``. + +* Remove unused "simple menus" module approach. + + +0.9.72 (2023-10-26) +------------------- + +* Use product lookup component for "resolve pending product" tool. + + +0.9.71 (2023-10-25) +------------------- + +* Fix bug when editing vendor. + +* Show user warning if "add item to custorder" fails. + +* Allow pending product fields to be required, for new custorder. + +* Add price confirm prompt when adding unknown item to custorder. + +* Use ```` for theme picker. + +* Add ``column_only`` kwarg for ``Grid.set_label()`` method. + +* Do not show profile buttons for inactive customer shoppers. + +* Add separate perm for making new custorder for unknown product. + +* Expand the "product lookup" component to include autocomplete. + + +0.9.70 (2023-10-24) +------------------- + +* Fix config file priority for display, and batch subprocess commands. + + +0.9.69 (2023-10-24) +------------------- + +* Allow override of version diff for master views. + +* No need to configure logging. + + +0.9.68 (2023-10-23) +------------------- + +* Expose more permissions for POS. + +* Fix order xlsx download if missing order date. + +* Replace dropdowns with autocomplete, for "find principals by perm". + +* Use ``Grid.make_sorter()`` instead of legacy code. + +* Avoid "None" when rendering product UOM field. + +* Fix default grid filter when "local" date times are involved. + +* Expose new fields for POS batch/row. + +* Remove sorter for "Credits?" column in purchasing batch row grid. + +* Add validation to prevent duplicate files for multi-invoice receiving. + +* Include invoice number for receiving batch row API. + +* Show food stamp tender info for POS batch. + +* Stop using sa-filters for basic grid sorting. + + +0.9.67 (2023-10-12) +------------------- + +* Fix grid sorting when column key/name differ. + +* Expose department tax, FS flag. + +* Add permission for testing error handling at POS. + +* Add some awareness of suspend/resume for POS batch. + +* Fix version child classes for Customers view. + + +0.9.66 (2023-10-11) +------------------- + +* Make grid JS ``loadAsyncData()`` method truly async. + +* Add support for multi-column grid sorting. + +* Add smarts to show display text for some version diff fields. + +* Allow null for FalafelDateTime form fields. + +* Show full version history within the "view" page. + +* Use autocomplete instead of dropdown for grid "add filter". + + +0.9.65 (2023-10-07) +------------------- + +* Avoid deprecated logic for fetching vendor contact email/phone. + +* Add "mark complete" button for inventory batch row entry page. + +* Expose tender ref in POS batch rows; new tender flags. + +* Improve views for taxes, esp. in POS batches. + + +0.9.64 (2023-10-06) +------------------- + +* Fix bug for param helptext in New Report page. + + +0.9.63 (2023-10-06) +------------------- + +* Fix CRUD pages for tempmon clients, probes. + +* Fix bug in POS batch view. + +* Expose permissions for POS, if so configured. + + +0.9.62 (2023-10-04) +------------------- + +* Avoid deprecated ``pretty_hours()`` function. + +* Improve master view ``oneoff_import()`` method. + + +0.9.61 (2023-10-04) +------------------- + +* Use enum to display ``POS_ROW_TYPE``. + +* Expose cash-back flags for tenders. + +* Re-work FalafelDateTime logic a bit. + + +0.9.60 (2023-10-01) +------------------- + +* Do not allow executing custorder if no customer is set. + +* Add clone support for POS batches. + +* Expose views for tenders, more columns for POS batch/rows. + +* Tidy up logic for vendor filtering in products grid. + +* Add support for void rows in POS batch. + + +0.9.59 (2023-09-25) +------------------- + +* Add custom form type/widget for time fields. + + +0.9.58 (2023-09-25) +------------------- + +* Expose POS batch views as "typical". + + +0.9.57 (2023-09-24) +------------------- + +* Show yesterday by default for Trainwreck if so configured. + +* Add ``remove_sorter()`` method for grids. + +* Show "true" (calculated) equity total in members grid. + +* Add basic views for POS batches. + +* Show customer for POS batches. + +* Use header button instead of link for "touch" instance. + + +0.9.56 (2023-09-19) +------------------- + +* Add link to vendor name for receiving batches grid. + +* Prevent catalog/invoice cost edits if receiving batch is complete. + +* Use small text input for receiving cost editor fields. + +* Show catalog/invoice costs as 2-decimal currency in receiving. + + +0.9.55 (2023-09-18) +------------------- + +* Show user warning if receive quick lookup fails. + +* Fix bug for new receiving from scratch via API. + + +0.9.54 (2023-09-17) +------------------- + +* Add "falafel" custom date/time field type and widget. + +* Avoid error when history has blanks for ordering worksheet. + +* Include PO number for receiving batch details via API. + +* Tweaks to improve handling of "missing" items for receiving. + + +0.9.53 (2023-09-16) +------------------- + +* Make member key field readonly when viewing equity payment. + + +0.9.52 (2023-09-15) +------------------- + +* Add basic feature for "grid totals". + + +0.9.51 (2023-09-15) +------------------- + +* Tweak default field list for batch views. + +* Add ``get_rattail_app()`` method for view supplements. + + +0.9.50 (2023-09-12) +------------------- + +* Avoid legacy logic for ``Customer.people`` schema. + +* Show events instead of notes, in field subgrid for custorder item. + + +0.9.49 (2023-09-11) +------------------- + +* Add custom hook for grid "apply filters". + +* Use common POST logic for submitting new customer order. + +* Optionally configure SQLAlchemy Session with ``future=True``. + +* Show related customer orders for Pending Product view. + +* Set stacklevel for all deprecation warnings. + +* Add support for toggling custorder item "flagged". + +* Add support for "mark received" when viewing custorder item. + +* Misc. improvements for custorder views. + + +0.9.48 (2023-09-08) +------------------- + +* Add grid link for equity payment description. + +* Fix msg body display, download link for email bounces. + +* Fix member key display for equity payment form. + + +0.9.47 (2023-09-07) +------------------- + +* Fallback to None when getting values for merge preview. + + +0.9.46 (2023-09-07) +------------------- + +* Improve display for member equity payments. + + +0.9.45 (2023-09-02) +------------------- + +* Add grid filter type for BigInteger columns. + +* Add products API route to fetch label profiles for use w/ printing. + +* Tweaks for cost editing within a receiving batch. + + +0.9.44 (2023-08-31) +------------------- + +* Avoid deprecated ``User.email_address`` property. + +* Preserve URL hash when redirecting in grid "reset to defaults". + + +0.9.43 (2023-08-30) +------------------- + +* Let "new product" batch override type-2 UPC lookup behavior. + + +0.9.42 (2023-08-29) +------------------- + +* When bulk-deleting, skip objects which are not "deletable". + +* Declare "from PO" receiving workflow if applicable, in API. + +* Auto-select text when editing costs for receiving. + +* Include shopper history from parent customer account perspective. + +* Link to product record, for New Product batch row. + +* Fix profile history to show when a CustomerShopperHistory is deleted. + +* Fairly massive overhaul of the Profile view; standardize tabs etc.. + +* Add support for "missing" credit in mobile receiving. + + +0.9.41 (2023-08-08) +------------------- + +* Add common logic to validate employee reference field. + +* Fix HTML rendering for UOM choice options. + +* Fix custom cell click handlers in main buefy grid tables. + + +0.9.40 (2023-08-03) +------------------- + +* Make system key searchable for problem report grid. + + +0.9.39 (2023-07-15) +------------------- + +* Show invoice number for each row in receiving. + +* Tweak display options for tempmon probe readings graph. + + +0.9.38 (2023-07-07) +------------------- + +* Optimize "auto-receive" batch process. + + +0.9.37 (2023-07-03) +------------------- + +* Avoid deprecated product key field getter. + +* Allow "arbitrary" PO attachment to purchase batch. + + +0.9.36 (2023-06-20) +------------------- + +* Include user "active" flag in profile view context. + + +0.9.35 (2023-06-20) +------------------- + +* Add views etc. for member equity payments. + +* Improve merge support for records with no uuid. + +* Turn on quickie person search for CustomerShopper views. + + +0.9.34 (2023-06-17) +------------------- + +* Add basic Shopper tab for profile view. + +* Cleanup some wording in profile view template. + +* Tweak ``SimpleRequestMixin`` to not rely on ``response.data.ok``. + +* Add support for Notes tab in profile view. + +* Add basic support for Person quickie lookup. + +* Hide unwanted revisions for CustomerPerson etc. + +* Fix some things for viewing a member. + + +0.9.33 (2023-06-16) +------------------- + +* Update usage of app handler per upstream changes. + + +0.9.32 (2023-06-16) +------------------- + +* Fix grid filter bug when switching from 'equal' to 'between' verbs. + +* Add users context data for profile view. + +* Join the Person model for Customers grid differently based on config. + + +0.9.31 (2023-06-15) +------------------- + +* Prefer account holder, shoppers over legacy ``Customers.people``. + + +0.9.30 (2023-06-12) +------------------- + +* Add basic support for exposing ``Customer.shoppers``. + +* Move "view history" and related buttons, for person profile view. + +* Consider vendor catalog batch views "typical". + +* Let external customer link buttons be more dynamic, for profile view. + +* Add options for grid results to link straight to Profile view. + +* Change label for Member.person to "Account Holder". + + +0.9.29 (2023-06-06) +------------------- + +* Add "typical" view config, for e.g. Theo and the like. + +* Add customer number filter for People grid. + +* Tweak logic for ``MasterView.get_action_route_kwargs()``. + +* Add "touch" support for Members. + +* Add support for "configured customer/member key". + +* Use *actual* current URL for user feedback msg. + +* Remove old/unused feedback templates. + +* Add basic support for membership types. + +* Add support for version history in person profile view. + + +0.9.28 (2023-06-02) +------------------- + +* Expose mail handler and template paths in email config page. + + +0.9.27 (2023-06-01) +------------------- + +* Share some code for validating vendor field. + +* Save datasync config with new keys, per RattailConfiguration. + + +0.9.26 (2023-05-25) +------------------- + +* Prevent bug in upgrade diff for empty new version. + +* Expose basic way to send test email. + +* Avoid error when filter params not valid. + +* Tweak byjove project generator form. + +* Define essential views for API. + + +0.9.25 (2023-05-18) +------------------- + +* Add initial swagger.json endpoint for API. + +* Add workaround for "share grid link" on insecure sites. + + +0.9.24 (2023-05-16) +------------------- + +* Replace ``setup.py`` contents with ``setup.cfg``. + +* Prevent error in old product search logic. + + +0.9.23 (2023-05-15) +------------------- + +* Get rid of ``newstyle`` flag for ``Form.validate()`` method. + +* Add basic support for managing, and accepting API tokens. + + +0.9.22 (2023-05-13) +------------------- + +* Tweak button wording in "find role by perm" form. + +* Warn user if DB not up to date, in new table wizard. + + +0.9.21 (2023-05-10) +------------------- + +* Move row delete check logic for receiving to batch handler. + + +0.9.20 (2023-05-09) +------------------- + +* Add form config for generating 'shopfoo' projects. + +* Misc. tweaks for "run import job" form. + + +0.9.19 (2023-05-05) +------------------- + +* Massive overhaul of "generate project" feature. + +* Include project views by default, in "essential" views. + + +0.9.18 (2023-05-03) +------------------- + +* Avoid error if tempmon probe has invalid status. + +* Expose, honor the ``prevent_password_change`` flag for Users. + + +0.9.17 (2023-04-17) +------------------- + +* Allow bulk-delete for products grid. + +* Improve global menu search behavior for multiple terms. + + +0.9.16 (2023-03-27) +------------------- + +* Avoid accidental auto-submit of new msg form, for subject field. + +* Add ``has_perm()`` etc. to request during the NewRequest event. + +* Fix table sorting for FK reference column in new table wizard. + +* Overhaul the "find by perm" feature a bit. + + +0.9.15 (2023-03-15) +------------------- + +* Remove version workaround for sphinx. + +* Let providers do DB connection setup for web API. + + +0.9.14 (2023-03-09) +------------------- + +* Fix JSON rendering for Cornice API views. + + +0.9.13 (2023-03-08) +------------------- + +* Remove version cap for cornice, now that we require python3. + + +0.9.12 (2023-03-02) +------------------- + +* Add "equal to any of" verb for string-type grid filters. + +* Allow download results for Trainwreck. + + +0.9.11 (2023-02-24) +------------------- + +* Allow sort/filter by vendor for sample files grid. + + +0.9.10 (2023-02-22) +------------------- + +* Add views for sample vendor files. + + +0.9.9 (2023-02-21) +------------------ + +* Validate vendor for catalog batch upload. + + +0.9.8 (2023-02-20) +------------------ + +* Make ``config`` param more explicit, for GridFilter constructor. + + +0.9.7 (2023-02-14) +------------------ + +* Add dedicated view config methods for "view" and "edit help". + + +0.9.6 (2023-02-12) +------------------ + +* Refactor ``Query.get()`` => ``Session.get()`` per SQLAlchemy 1.4. + + +0.9.5 (2023-02-11) +------------------ + +* Use sa-filters instead of sqlalchemy-filters for API queries. + + +0.9.4 (2023-02-11) +------------------ + +* Remove legacy grid for alt codes in product view. + + +0.9.3 (2023-02-10) +------------------ + +* Add dependency for pyramid_retry. + +* Use latest zope.sqlalchemy package. + +* Fix auto-advance on ENTER for login form. + +* Use label handler to avoid deprecated logic. + +* Remove legacy vendor sources grid for product view. + +* Expose setting for POD image URL. + +* Fix multi-file upload widget bug. + + +0.9.2 (2023-02-03) +------------------ + +* Fix auto-focus username for login form. + + +0.9.1 (2023-02-03) +------------------ + +* Stop including deform JS static files. + + +0.9.0 (2023-02-03) +------------------ + +* Officially drop support for python2. + +* Remove all deprecated jquery and ``use_buefy`` logic. + +* Add new Buefy-specific upgrade template. + +* Replace 'default' theme to match 'falafel'. + +* Allow editing the Department field for a Subdepartment. + +* Refactor the Ordering Worksheet generator, per Buefy. + + +0.8.292 (2023-02-02) +-------------------- + +* Always assume ``use_buefy=True`` within main page template. + + +0.8.291 (2023-02-02) +-------------------- + +* Fix checkbox behavior for Inventory Worksheet. + +* Form constructor assumes ``use_buefy=True`` by default. + + +0.8.290 (2023-02-02) +-------------------- + +* Remove support for Buefy 0.8. + +* Add progress bar page for Buefy theme. + + +0.8.289 (2023-01-30) +-------------------- + +* Fix icon for multi-file upload widget. + +* Tweak customer panel header style for new custorder. + +* Add basic API support for printing product labels. + +* Tweak the Ordering Worksheet generator, per Buefy. + +* Refactor the Inventory Worksheet generator, per Buefy. + + +0.8.288 (2023-01-28) +-------------------- + +* Tweak import handler form, some fields not required. + +* Tweak styles for Quantity panel when viewing Receiving row. + + +0.8.287 (2023-01-26) +-------------------- + +* Fix click event for right-aligned buttons on profile view. + + +0.8.286 (2023-01-18) +-------------------- + +* Add some more menu items to default set. + +* Add default view config for Trainwreck. + +* Rename frontend request handler logic to ``SimpleRequestMixin``. + + +0.8.285 (2023-01-18) +-------------------- + +* Misc. tweaks for App Details / Configure Menus. + +* Add specific data type options for new table entry form. + +* Add more views, menus to default set. + +* Add way to override particular 'essential' views. + + +0.8.284 (2023-01-15) +-------------------- + +* Let the API "rawbytes" response be just that, w/ no file. + +* Fix bug when adding new profile via datasync configure. + +* Add default logic to get merge data for object. + +* Add new handlers, TailboneHandler and MenuHandler. + +* Add full set of default menus. + +* Wrap up steps for new table wizard. + +* Add basic "new model view" wizard. + + +0.8.283 (2023-01-14) +-------------------- + +* Tweak how backfill task is launched. + + +0.8.282 (2023-01-13) +-------------------- + +* Show basic column info as row grid when viewing Table. + +* Semi-finish logic for writing new table model class to file. + +* Fix "toggle batch complete" for Chrome browser. + +* Revert logic that assumes all themes use buefy. + +* Refactor tempmon dashboard view, for buefy themes. + +* Prevent listing for top-level Messages view. + + +0.8.281 (2023-01-12) +-------------------- + +* Add new views for App Info, and Configure App. + + +0.8.280 (2023-01-11) +-------------------- + +* Allow all external dependency URLs to be set in config. + + +0.8.279 (2023-01-11) +-------------------- + +* Add basic support for receiving from multiple invoice files. + +* Add support for per-item default discount, for new custorder. + +* Fix panel header icon behavior for new custorder. + +* Refactor inventory batch "add row" page, per new theme. + + +0.8.278 (2023-01-08) +-------------------- + +* Improve "download rows as XLSX" for importer batch. + + +0.8.277 (2023-01-07) +-------------------- + +* Expose, start to honor "units only" setting for products. + + +0.8.276 (2023-01-05) +-------------------- + +* Keep aspect ratio for product images in new custorder. + +* Fix template bug for generating report. + +* Show help link when generating or viewing report, if applicable. + +* Use product handler to normalize data for products API. + + +0.8.275 (2023-01-04) +-------------------- + +* Allow xref buttons to have "internal" links. + + +0.8.274 (2023-01-02) +-------------------- + +* Show only "core" app settings by default. + +* Allow buefy version to be 'latest'. + +* Add beginnings of "New Table" feature. + +* Make invalid email more obvious, in profile view. + +* Expose some settings for Trainwreck DB rotation. + + +0.8.273 (2022-12-28) +-------------------- + +* Add support for Buefy 0.9.x. + +* Warn user when luigi is not installed, for relevant view. + +* Fix HUD display when toggling employee status in profile view. + +* Fix checkbox values when re-running a report. + +* Make static files optional, for new tailbone-integration project. + +* Preserve current tab for page reload in profile view. + +* Add cleanup logic for old Beaker session data. + +* Add basic support for editing help info for page, fields. + +* Override document title when upgrading. + +* Filter by person instead of user, for Generated Reports "Created by". + +* Add "direct link" support for master grids. + +* Add support for websockets over HTTP. + +* Fix product image view for python3. + +* Add "global searchbox" for quicker access to main views. + +* Use minified version of vue.js by default, in falafel theme. + + +0.8.272 (2022-12-21) +-------------------- + +* Add support for "is row checkable" in grids. + +* Add ``make_status_renderer()`` to MasterView. + +* Expose the ``terms`` field for Vendor CRUD. + + +0.8.271 (2022-12-15) +-------------------- + +* Add ``configure_execute_form()`` hook for batch views. + + +0.8.270 (2022-12-10) +-------------------- + +* Fix error if no view supplements defined. + + +0.8.269 (2022-12-10) +-------------------- + +* Show simple error string, when subprocess batch actions fail. + +* Fix ordering worksheet API for date objects. + +* Add the ViewSupplement concept. + +* Cleanup employees view per new supplements. + +* Add common logic for xref buttons, links when viewing object. + +* Add common logic to determine panel fields for product view. + +* Add xref buttons for Customer, Member tabs in profile view. + +* Suppress error if menu entry has bad route name. + + +0.8.268 (2022-12-07) +-------------------- + +* Add support for Beaker >= 1.12.0. + + +0.8.267 (2022-12-06) +-------------------- + +* Fix bug when viewing certain receiving batches. + + +0.8.266 (2022-12-06) +-------------------- + +* Add simple template hook for "before object helpers". + +* Include email address for current API user info. + +* Add support for editing catalog cost in receiving batch, per new theme. + +* Add receiving workflow as param when making receiving batch. + +* Show invoice cost in receiving batch, if "from scratch". + +* Add support for editing invoice cost in receiving batch, per new theme. + +* Add helptext for "Admin-ish" field when editing Role. + + +0.8.265 (2022-12-01) +-------------------- + +* Add way to quickly re-run "any" report. + +* Avoid web config when launching overnight task. + + +0.8.264 (2022-11-28) +-------------------- + +* Add prompt dialog when launching overnight task. + +* Fix page title for datasync status. + +* Use newer config strategy for all views. + +* Auto-format phone number when saving for contact records. + + +0.8.263 (2022-11-21) +-------------------- + +* Update 'testing' watermark for dev background. + +* Let the Luigi handler take care of removing some DB settings. + + +0.8.262 (2022-11-20) +-------------------- + +* Add luigi module/class awareness for overnight tasks. + + +0.8.261 (2022-11-20) +-------------------- + +* Allow disabling, or per-day scheduling, of problem reports. + +* Fix how keys are stored for luigi overnight/backfill tasks. + + +0.8.260 (2022-11-18) +-------------------- + +* Turn on download results feature for Employees. + + +0.8.259 (2022-11-17) +-------------------- + +* Add "between" verb for numeric grid filters. + + +0.8.258 (2022-11-15) +-------------------- + +* Let the auth handler manage user merge. + + +0.8.257 (2022-11-03) +-------------------- + +* Add template method for rendering row grid component. + +* Use people handler to update address. + +* Fix start_date param for pricing batch upload. + +* Use shared logic for rendering percentage values. + +* Log a warning to troubleshoot luigi restart failure. + +* Show UPC for receiving line item if no product reference. + + +0.8.256 (2022-09-09) +-------------------- + +* Add basic per-item discount support for custorders. + +* Make past item lookup optional for custorders. + +* Do not convert date if already a date (for grid filters). + +* Avoid use of ``self.handler`` within batch API views. + + +0.8.255 (2022-09-06) +-------------------- + +* Include ``WorkOrder.estimated_total`` for API. + +* Add default normalize logic for API views. + +* Disable "Delete Results" button if no results, for row grid. + +* Move logic for "bulk-delete row objects" into MasterView. + +* Convert value for more date filters; only add condition if valid. + + +0.8.254 (2022-08-30) +-------------------- + +* Improve parsing of purchase order quantities. + +* Expose more attrs for new product batch rows. + + +0.8.253 (2022-08-30) +-------------------- + +* Convert value for date filter; only add condition if valid. + +* Add 'warning' flash messages to old jquery base template. + +* Add uom fields, configurable template for newproduct batch. + + +0.8.252 (2022-08-25) +-------------------- + +* Avoid error when no datasync profiles configured. + +* Add max lengths when editing person name via profile view. + + +0.8.251 (2022-08-24) +-------------------- + +* Fix index title for datasync configure page. + +* Add basic support for backfill Luigi tasks. + + +0.8.250 (2022-08-21) +-------------------- + +* Add ``render_person_profile()`` method to MasterView. + +* Add way to declare failure for an upgrade. + +* Add websockets progress, "multi-system" support for upgrades. + +* Add global context from handler, for email previews. + +* Allow configuring datasync watcher kwargs. + +* Expose, honor "admin-ish" flag for roles. + + +0.8.249 (2022-08-18) +-------------------- + +* Add brief delay before declaring websocket broken. + +* Add basic views for Luigi / overnight tasks. + +* Expose setting for auto-correct when receiving from invoice. + + +0.8.248 (2022-08-17) +-------------------- + +* Redirect to custom index URL when user cancels new custorder entry. + +* Add ``get_next_url_after_submit_new_order()`` for customer orders. + +* Add first experiment with websockets, for datasync status page. + +* Allow user feedback to request email reply back. + + +0.8.247 (2022-08-14) +-------------------- + +* Avoid double-quotes in field error messages JS code. + +* Add the FormPosterMixin to ProfileInfo component. + +* Fix default help URLs for ordering, receiving. + +* Move handheld batch view module to appropriate location. + +* Refactor usage of ``get_vendor()`` lookup. + +* Consolidate master API view logic. + + +0.8.246 (2022-08-12) +-------------------- + +* Couple of API tweaks for work orders. + +* Standardize merge logic when a handler is defined for it. + + +0.8.245 (2022-08-10) +-------------------- + +* Add convenience wrapper to make customer field widget, etc.. + +* Some API tweaks to support a byjove app. + +* Tweak flash msg, logging when batch population fails. + +* Log traceback output when batch action subprocess fails. + +* Add initial views for work orders. + +* Fix sequence of events re: grid component creation. + +* Allow download results for Customers grid. + + +0.8.244 (2022-08-08) +-------------------- + +* Add separate product grid filters for Category Code, Category Name. + + +0.8.243 (2022-08-08) +-------------------- + +* Add button to raise bogus error, for testing email alerts. + +* Make sure "configure" pages use AppHandler to save/delete settings. + +* Expose setting for sendmail failure alerts. + + +0.8.242 (2022-08-07) +-------------------- + +* Always show "all" email settings if user has config perm. + + +0.8.241 (2022-08-06) +-------------------- + +* Add support for toggling visibility of email profile settings. + + +0.8.240 (2022-08-05) +-------------------- + +* Clean up URL routes for row CRUD. + + +0.8.239 (2022-08-04) +-------------------- + +* Invalidate config cache when raw setting is deleted. + + +0.8.238 (2022-08-03) +-------------------- + +* Improve "touch" logic for employees. + +* Stop using the old ``rattail.db.api.settings`` module. + +* Force cache invalidation when Raw Setting is edited. + + +0.8.237 (2022-07-27) +-------------------- + +* Add some more views to potentially include via poser. + +* Misc. improvements for desktop receiving views. + + +0.8.236 (2022-07-25) +-------------------- + +* Add setting to expose/hide "active in POS" customer flag. + +* Allow optional row grid title for master view. + +* Add basic/minimal merge support for customers. + +* Assume default vendor for new receiving batch. + +* Add basic edit support for Purchases. + +* Add ``iter(Form)`` logic, to loop through fields. + +* Add "auto-receive all items" support for receiving batch API. + + +0.8.235 (2022-07-22) +-------------------- + +* Split out rendering of ``this-page`` component in falafel theme. + +* Allow download of results for common product-related tables. + +* Make caching products optional, when creating vendor catalog batch. + +* Expose the ``complete`` flag for pricing batch. + +* Add ``template_kwargs_clone()`` stub for master view. + +* Misc deform template improvements. + + +0.8.234 (2022-07-18) +-------------------- + +* Fix form validation for app settings page w/ buefy theme. + +* Honor default pagesize for all grids, per setting. + +* Add basic "download results" for Subdepartments grid. + +* Add new-style config defaults for BrandView. + + +0.8.233 (2022-06-24) +-------------------- + +* Add minimal buefy support for 'percentinput' field widget. + +* Add autocomplete support for subdepartments. + + +0.8.232 (2022-06-14) +-------------------- + +* Let default grid page size correspond to first option. + +* Add start date support for "future" pricing batch. + + +0.8.231 (2022-05-15) +-------------------- + +* Expose config for identifying supported vendors. + +* Allow restricting to supported vendors only, for Receiving. + + +0.8.230 (2022-05-10) +-------------------- + +* Sort roles list when viewing a user. + +* Add grid workarounds when data is list instead of query. + + +0.8.229 (2022-05-03) +-------------------- + +* Tweak how family data is displayed. + + +0.8.228 (2022-04-13) +-------------------- + +* Fix quotes for field helptext. + +* Flush early when populating batch, to ensure error is shown. + + +0.8.227 (2022-04-04) +-------------------- + +* Add touch for report codes. + +* Raise 404 if report not found. + +* Add template kwargs stub for ``view_row()``. + +* Log error when failing to submit new custorder batch. + +* Honor case vs. unit restrictions for new custorder. + +* Tweak where description field is shown for receiving batch. + +* Fix "touch" url for non-standard record types. + + +0.8.226 (2022-03-29) +-------------------- + +* Let errors raise when showing poser reports. + + +0.8.225 (2022-03-29) +-------------------- + +* Force session flush within try/catch, for batch refresh. + + +0.8.224 (2022-03-25) +-------------------- + +* Improve vendor validation for new receiving batch. + +* Use common logic for fetching batch handler. + + +0.8.223 (2022-03-21) +-------------------- + +* Show link to txn as field when viewing trainwreck item. + + +0.8.222 (2022-03-17) +-------------------- + +* Expose custorder xref markers for trainwreck. + + +0.8.221 (2022-03-16) +-------------------- + +* Always show batch params by default when viewing. + +* Show helptext when applicable for "new batch from product query". + +* Make problem report titles searchable in grid. + + +0.8.220 (2022-03-15) +-------------------- + +* Log error instead of warning, when batch population fails. + +* Add default help link for Receiving feature. + + +0.8.219 (2022-03-10) +-------------------- + +* Cleanup grid filters for vendor catalog batches. + +* Cleanup view config syntax for vendor catalog batch. + +* Add workaround when inserting new fields to form field list. + +* Add ``Form.insert()`` method, to insert field based on index. + +* Default behavior for report chooser should *not* be form/dropdown. + + +0.8.218 (2022-03-08) +-------------------- + +* Log warning/traceback when failing to include a configured view. + +* Fix gotcha when defining new provider views. + +* Bump the default Buefy version to 0.8.13. + + +0.8.217 (2022-03-07) +-------------------- + +* Add the "provider" concept, let them configure db sessions. + +* Let providers add extra views, options for includes config. + +* Let tailbone providers include static views. + +* Link to email settings profile when viewing email attempt. + + +0.8.216 (2022-03-05) +-------------------- + +* Show list of generated reports when viewing Poser Report. + +* Show link back to Poser Report when viewing Generated Report. + +* Always include ``app_title`` in global template rendering context. + +* Update some more view config syntax. + +* Make common web view a bit more common. + +* Improve the Poser Setup page; allow poser dir refresh. + +* Add initial/basic support for configuring "included views". + +* Add ``tailbone.views.essentials`` to include common / "core" views. + +* Add flash message when upgrade execution completes (pass or fail). + + +0.8.215 (2022-03-02) +-------------------- + +* Show toast msg instead of alert after sending feedback. + +* Add basic support for Poser reports, list/create. + + +0.8.214 (2022-03-01) +-------------------- + +* Params should be readonly when editing batch. + +* Tweak styles for links in object helper panel. + + +0.8.213 (2022-03-01) +-------------------- + +* Add simple searchable column support for non-AJAX grids. + +* Fix stdout/stderr fields for upgrade view. + +* Pass query along for download results, so subclass can modify. + +* Avoid making discounts data if missing field, for trainwreck item view. + + +0.8.212 (2022-02-26) +-------------------- + +* Add page/way to configure main menus. + + +0.8.211 (2022-02-25) +-------------------- + +* Add view template stub for trainwreck transaction. + +* Add auto-filter hyperlinks for batch row status breakdown. + +* Auto-filter hyperlinks for PO vs. invoice breakdown in Receiving. + +* Add grid hyperlinks for trainwreck transaction line items. + +* Use dict instead of custom object to represent menus. + +* Expose "discount type" for Trainwreck line items. + + +0.8.210 (2022-02-20) +-------------------- + +* Only show DB picker for permissioned users. + +* Expose some new trainwreck fields; per-item discounts. + +* Show SRP as currency for vendor catalog batch. + + +0.8.209 (2022-02-16) +-------------------- + +* Fix progress bar when running problem report. + + +0.8.208 (2022-02-15) +-------------------- + +* Allow override of navbar-end element in falafel theme header. + +* Add initial support for editing user preferences. + +* Add FormPosterMixin to WholePage class. + + +0.8.207 (2022-02-13) +-------------------- + +* Try out new config defaults function for some views (user, customer). + +* Add highlight for non-active users, customers in grid. + +* Prevent cache for index pages by default, unless configured not to. + +* Cleanup labels for Vendor/Code "preferred" vs. "any" in products grid. + +* Add config for showing ordered vs. shipped amounts when receiving. + +* Tweak how "duration" fields are rendered for grids, forms. + +* New upgrades should be enabled by default. + + +0.8.206 (2022-02-08) +-------------------- + +* Add "full lookup" product search modal for new custorder page. + + +0.8.205 (2022-02-05) +-------------------- + +* Tweak how product key field is handled for product views. + +* Add some autocomplete workarounds for new vendor catalog batch. + + +0.8.204 (2022-02-04) +-------------------- + +* Add ``CustomerGroupAssignment`` to customer version history. + + +0.8.203 (2022-02-01) +-------------------- + +* Expose batch params for vendor catalogs. + + +0.8.202 (2022-01-31) +-------------------- + +* Make "generate report" the same as "create new generated report". + + +0.8.201 (2022-01-31) +-------------------- + +* Show helptext for params when generating new report. + +* Tweak handling of empty params when generating report. + + +0.8.200 (2022-01-31) +-------------------- + +* Improve profile link helper for buefy themes. + +* Add project generator support for rattail-integration, tailbone-integration. + + +0.8.199 (2022-01-26) +-------------------- + +* Tweak the "auto-receive all" tool for Chrome browser. + + +0.8.198 (2022-01-25) +-------------------- + +* Only expose "product" departments within product view dropdowns. + + +0.8.197 (2022-01-19) +-------------------- + +* Use buefy input for quickie search. + + +0.8.196 (2022-01-15) +-------------------- + +* Use the new label handler. + + +0.8.195 (2022-01-13) +-------------------- + +* Strip whitespace for new customer fields, in new custorder page. + + +0.8.194 (2022-01-12) +-------------------- + +* Include all static files in manifest. + +* Update usage of ``app.get_email_handler()`` to avoid warnings. + + +0.8.193 (2022-01-10) +-------------------- + +* Add buefy support for quick-printing product labels; also speed bump. + +* Add way to set form-wide schema validator. + +* Add progress support when deleting a batch. + +* Expose the Sale, TPR, Current price fields for label batch. + + +0.8.192 (2022-01-08) +-------------------- + +* Add configurable template file for vendor catalog batch. + +* Some aesthetic improvements for vendor catalog batch. + +* Several disparate changes needed for vendor catalog improvements. + +* Expose, honor "allow future" setting for vendor catalog batch. + +* Add config for supported vendor catalog parsers. + +* Update some method calls to avoid deprecation warnings. + + +0.8.191 (2022-01-03) +-------------------- + +* Fix permission check for input file template links. + +* Remove usage of ``app.get_designated_import_handler()``. + +* Add basic configure page for Trainwreck. + +* Use ``AuthHandler.get_permissions()``. + + +0.8.190 (2021-12-29) +-------------------- + +* Show create button on "most" pages for a master view. + +* Expose products setting for type 2 UPC lookup. + +* Add basic "resolve" support for person, product from new custorder. + + +0.8.189 (2021-12-23) +-------------------- + +* Add basic "pending product" support for new custorder batch. + +* Improve email bounce view per buefy theme. + + +0.8.188 (2021-12-20) +-------------------- + +* Flag discontinued items for main Products grid. + + +0.8.187 (2021-12-20) +-------------------- + +* Add common configuration logic for "input file templates". + +* Add some standard CRUD buttons for buefy themes. + + +0.8.186 (2021-12-17) +-------------------- + +* Render "pretty" UPC by default, for batch row form fields. + +* Let config decide which versions of vue.js and buefy to use. + + +0.8.185 (2021-12-15) +-------------------- + +* Allow for null price when showing price history. + +* Overhaul desktop views for receiving, for efficiency. + +* Add some basic "config" views, to obviate some App Settings. + +* Add "jump to" chooser in App Settings, for various "configure" pages. + +* Fix params field when deleting a report. + +* Add some smarts when making batch execution form schema. + + +0.8.184 (2021-12-09) +-------------------- + +* Refactor "receive row" and "declare credit" tools per buefy theme. + +* Allow "auto-receive all items" batch feature in production. + +* Make "view row" prettier for receiving batch, for buefy themes. + +* Add buttons to edit, confirm cost for receiving batch row view. + + +0.8.183 (2021-12-08) +-------------------- + +* Add basic views to expose Problem Reports, and run them. + +* Only include ``--runas`` arg if we have a value, for import jobs. + +* Assume default receiving workflow if there is only one. + +* Fix bug when report has no params dict. + + 0.8.182 (2021-12-07) -------------------- @@ -3015,7 +4992,7 @@ and related technologies. 0.6.47 (2017-11-08) ------------------- -* Fix manifest to include *.pt deform templates +* Fix manifest to include ``*.pt`` deform templates 0.6.46 (2017-11-08) @@ -3348,13 +5325,13 @@ and related technologies. 0.6.13 (2017-07-26) ------------------- +------------------- * Allow master view to decide whether each grid checkbox is checked 0.6.12 (2017-07-26) ------------------- +------------------- * Add basic support for product inventory and status @@ -3362,7 +5339,7 @@ and related technologies. 0.6.11 (2017-07-18) ------------------- +------------------- * Tweak some basic styles for forms/grids @@ -3370,7 +5347,7 @@ and related technologies. 0.6.10 (2017-07-18) ------------------- +------------------- * Fix grid bug if "current page" becomes invalid diff --git a/docs/api/db.rst b/docs/api/db.rst new file mode 100644 index 00000000..ace21b68 --- /dev/null +++ b/docs/api/db.rst @@ -0,0 +1,6 @@ + +``tailbone.db`` +=============== + +.. automodule:: tailbone.db + :members: diff --git a/docs/api/diffs.rst b/docs/api/diffs.rst new file mode 100644 index 00000000..fb1bba71 --- /dev/null +++ b/docs/api/diffs.rst @@ -0,0 +1,6 @@ + +``tailbone.diffs`` +================== + +.. automodule:: tailbone.diffs + :members: diff --git a/docs/api/forms.widgets.rst b/docs/api/forms.widgets.rst new file mode 100644 index 00000000..33316903 --- /dev/null +++ b/docs/api/forms.widgets.rst @@ -0,0 +1,6 @@ + +``tailbone.forms.widgets`` +========================== + +.. automodule:: tailbone.forms.widgets + :members: diff --git a/docs/api/grids.core.rst b/docs/api/grids.core.rst new file mode 100644 index 00000000..60155cb2 --- /dev/null +++ b/docs/api/grids.core.rst @@ -0,0 +1,6 @@ + +``tailbone.grids.core`` +======================= + +.. automodule:: tailbone.grids.core + :members: diff --git a/docs/api/subscribers.rst b/docs/api/subscribers.rst index 8b25c994..d28a1b15 100644 --- a/docs/api/subscribers.rst +++ b/docs/api/subscribers.rst @@ -3,5 +3,4 @@ ======================== .. automodule:: tailbone.subscribers - -.. autofunction:: new_request + :members: diff --git a/docs/api/util.rst b/docs/api/util.rst new file mode 100644 index 00000000..35e66ed3 --- /dev/null +++ b/docs/api/util.rst @@ -0,0 +1,6 @@ + +``tailbone.util`` +================= + +.. automodule:: tailbone.util + :members: diff --git a/docs/api/views/master.rst b/docs/api/views/master.rst index bf505b6c..e7de7170 100644 --- a/docs/api/views/master.rst +++ b/docs/api/views/master.rst @@ -81,6 +81,12 @@ override when defining your subclass. override this for certain views, if so that should be done within :meth:`get_help_url()`. + .. attribute:: MasterView.version_diff_factory + + Optional factory to use for version diff objects. By default + this is *not set* but a subclass is free to set it. See also + :meth:`get_version_diff_factory()`. + Methods to Override ------------------- @@ -88,6 +94,8 @@ Methods to Override The following is a list of methods which you can override when defining your subclass. + .. automethod:: MasterView.editable_instance + .. .. automethod:: MasterView.get_settings .. automethod:: MasterView.get_csv_fields @@ -95,3 +103,24 @@ subclass. .. automethod:: MasterView.get_csv_row .. automethod:: MasterView.get_help_url + + .. automethod:: MasterView.get_model_key + + .. automethod:: MasterView.get_version_diff_enums + + .. automethod:: MasterView.get_version_diff_factory + + .. automethod:: MasterView.make_version_diff + + .. automethod:: MasterView.title_for_version + + +Support Methods +--------------- + +The following is a list of methods you should (probably) not need to +override, but may find useful: + + .. automethod:: MasterView.default_edit_url + + .. automethod:: MasterView.get_action_route_kwargs diff --git a/docs/api/views/members.rst b/docs/api/views/members.rst new file mode 100644 index 00000000..6a9e9168 --- /dev/null +++ b/docs/api/views/members.rst @@ -0,0 +1,6 @@ + +``tailbone.views.members`` +========================== + +.. automodule:: tailbone.views.members + :members: diff --git a/docs/changelog.rst b/docs/changelog.rst new file mode 100644 index 00000000..bbf94f4b --- /dev/null +++ b/docs/changelog.rst @@ -0,0 +1,8 @@ + +Changelog Archive +================= + +.. toctree:: + :maxdepth: 1 + + OLDCHANGES diff --git a/docs/conf.py b/docs/conf.py index 505396ed..ade4c92a 100644 --- a/docs/conf.py +++ b/docs/conf.py @@ -1,38 +1,21 @@ -# -*- coding: utf-8; -*- +# Configuration file for the Sphinx documentation builder. # -# Tailbone documentation build configuration file, created by -# sphinx-quickstart on Sat Feb 15 23:15:27 2014. -# -# This file is exec()d with the current directory set to its -# containing dir. -# -# Note that not all possible configuration values are present in this -# autogenerated file. -# -# All configuration values have a default; values that are commented out -# serve to show the default. +# For the full list of built-in configuration values, see the documentation: +# https://www.sphinx-doc.org/en/master/usage/configuration.html -import sys -import os +# -- Project information ----------------------------------------------------- +# https://www.sphinx-doc.org/en/master/usage/configuration.html#project-information -import sphinx_rtd_theme +from importlib.metadata import version as get_version -exec(open(os.path.join(os.pardir, 'tailbone', '_version.py')).read()) +project = 'Tailbone' +copyright = '2010 - 2024, Lance Edgar' +author = 'Lance Edgar' +release = get_version('Tailbone') +# -- General configuration --------------------------------------------------- +# https://www.sphinx-doc.org/en/master/usage/configuration.html#general-configuration -# If extensions (or modules to document with autodoc) are in another directory, -# add these directories to sys.path here. If the directory is relative to the -# documentation root, use os.path.abspath to make it absolute, like shown here. -#sys.path.insert(0, os.path.abspath('.')) - -# -- General configuration ------------------------------------------------ - -# If your documentation needs a minimal Sphinx version, state it here. -#needs_sphinx = '1.0' - -# Add any Sphinx extension module names here, as strings. They can be -# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom -# ones. extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.todo', @@ -40,241 +23,30 @@ extensions = [ 'sphinx.ext.viewcode', ] +templates_path = ['_templates'] +exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store'] + intersphinx_mapping = { - 'rattail': ('https://rattailproject.org/docs/rattail/', None), + 'rattail': ('https://docs.wuttaproject.org/rattail/', None), 'webhelpers2': ('https://webhelpers2.readthedocs.io/en/latest/', None), + 'wuttaweb': ('https://docs.wuttaproject.org/wuttaweb/', None), + 'wuttjamaican': ('https://docs.wuttaproject.org/wuttjamaican/', None), } -# Add any paths that contain templates here, relative to this directory. -templates_path = ['_templates'] - -# The suffix of source filenames. -source_suffix = '.rst' - -# The encoding of source files. -#source_encoding = 'utf-8-sig' - -# The master toctree document. -master_doc = 'index' - -# General information about the project. -project = u'Tailbone' -copyright = u'2010 - 2020, Lance Edgar' - -# The version info for the project you're documenting, acts as replacement for -# |version| and |release|, also used in various other places throughout the -# built documents. -# -# The short X.Y version. -# version = '0.3' -version = '.'.join(__version__.split('.')[:2]) -# The full version, including alpha/beta/rc tags. -release = __version__ - -# The language for content autogenerated by Sphinx. Refer to documentation -# for a list of supported languages. -#language = None - -# There are two options for replacing |today|: either, you set today to some -# non-false value, then it is used: -#today = '' -# Else, today_fmt is used as the format for a strftime call. -#today_fmt = '%B %d, %Y' - -# List of patterns, relative to source directory, that match files and -# directories to ignore when looking for source files. -exclude_patterns = ['_build'] - -# The reST default role (used for this markup: `text`) to use for all -# documents. -#default_role = None - -# If true, '()' will be appended to :func: etc. cross-reference text. -#add_function_parentheses = True - -# If true, the current module name will be prepended to all description -# unit titles (such as .. function::). -#add_module_names = True - -# If true, sectionauthor and moduleauthor directives will be shown in the -# output. They are ignored by default. -#show_authors = False - -# The name of the Pygments (syntax highlighting) style to use. -pygments_style = 'sphinx' - -# A list of ignored prefixes for module index sorting. -#modindex_common_prefix = [] - -# If true, keep warnings as "system message" paragraphs in the built documents. -#keep_warnings = False - -# Allow todo entries to show up. +# allow todo entries to show up todo_include_todos = True -# -- Options for HTML output ---------------------------------------------- +# -- Options for HTML output ------------------------------------------------- +# https://www.sphinx-doc.org/en/master/usage/configuration.html#options-for-html-output -# The theme to use for HTML and HTML Help pages. See the documentation for -# a list of builtin themes. -# html_theme = 'classic' -html_theme = 'sphinx_rtd_theme' - -# Theme options are theme-specific and customize the look and feel of a theme -# further. For a list of options available for each theme, see the -# documentation. -#html_theme_options = {} - -# Add any paths that contain custom themes here, relative to this directory. -#html_theme_path = [] -html_theme_path = [sphinx_rtd_theme.get_html_theme_path()] - -# The name for this set of Sphinx documents. If None, it defaults to -# " v documentation". -#html_title = None - -# A shorter title for the navigation bar. Default is the same as html_title. -#html_short_title = None +html_theme = 'furo' +html_static_path = ['_static'] # The name of an image file (relative to this directory) to place at the top # of the sidebar. #html_logo = None -html_logo = 'images/rattail_avatar.png' - -# The name of an image file (within the static path) to use as favicon of the -# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 -# pixels large. -#html_favicon = None - -# Add any paths that contain custom static files (such as style sheets) here, -# relative to this directory. They are copied after the builtin static files, -# so a file named "default.css" will overwrite the builtin "default.css". -html_static_path = ['_static'] - -# Add any extra paths that contain custom files (such as robots.txt or -# .htaccess) here, relative to this directory. These files are copied -# directly to the root of the documentation. -#html_extra_path = [] - -# If not '', a 'Last updated on:' timestamp is inserted at every page bottom, -# using the given strftime format. -#html_last_updated_fmt = '%b %d, %Y' - -# If true, SmartyPants will be used to convert quotes and dashes to -# typographically correct entities. -#html_use_smartypants = True - -# Custom sidebar templates, maps document names to template names. -#html_sidebars = {} - -# Additional templates that should be rendered to pages, maps page names to -# template names. -#html_additional_pages = {} - -# If false, no module index is generated. -#html_domain_indices = True - -# If false, no index is generated. -#html_use_index = True - -# If true, the index is split into individual pages for each letter. -#html_split_index = False - -# If true, links to the reST sources are added to the pages. -#html_show_sourcelink = True - -# If true, "Created using Sphinx" is shown in the HTML footer. Default is True. -#html_show_sphinx = True - -# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True. -#html_show_copyright = True - -# If true, an OpenSearch description file will be output, and all pages will -# contain a tag referring to it. The value of this option must be the -# base URL from which the finished HTML is served. -#html_use_opensearch = '' - -# This is the file name suffix for HTML files (e.g. ".xhtml"). -#html_file_suffix = None +#html_logo = 'images/rattail_avatar.png' # Output file base name for HTML help builder. -htmlhelp_basename = 'Tailbonedoc' - - -# -- Options for LaTeX output --------------------------------------------- - -latex_elements = { -# The paper size ('letterpaper' or 'a4paper'). -#'papersize': 'letterpaper', - -# The font size ('10pt', '11pt' or '12pt'). -#'pointsize': '10pt', - -# Additional stuff for the LaTeX preamble. -#'preamble': '', -} - -# Grouping the document tree into LaTeX files. List of tuples -# (source start file, target name, title, -# author, documentclass [howto, manual, or own class]). -latex_documents = [ - ('index', 'Tailbone.tex', u'Tailbone Documentation', - u'Lance Edgar', 'manual'), -] - -# The name of an image file (relative to this directory) to place at the top of -# the title page. -#latex_logo = None - -# For "manual" documents, if this is true, then toplevel headings are parts, -# not chapters. -#latex_use_parts = False - -# If true, show page references after internal links. -#latex_show_pagerefs = False - -# If true, show URL addresses after external links. -#latex_show_urls = False - -# Documents to append as an appendix to all manuals. -#latex_appendices = [] - -# If false, no module index is generated. -#latex_domain_indices = True - - -# -- Options for manual page output --------------------------------------- - -# One entry per manual page. List of tuples -# (source start file, name, description, authors, manual section). -man_pages = [ - ('index', 'tailbone', u'Tailbone Documentation', - [u'Lance Edgar'], 1) -] - -# If true, show URL addresses after external links. -#man_show_urls = False - - -# -- Options for Texinfo output ------------------------------------------- - -# Grouping the document tree into Texinfo files. List of tuples -# (source start file, target name, title, author, -# dir menu entry, description, category) -texinfo_documents = [ - ('index', 'Tailbone', u'Tailbone Documentation', - u'Lance Edgar', 'Tailbone', 'One line description of project.', - 'Miscellaneous'), -] - -# Documents to append as an appendix to all manuals. -#texinfo_appendices = [] - -# If false, no module index is generated. -#texinfo_domain_indices = True - -# How to display URL addresses: 'footnote', 'no', or 'inline'. -#texinfo_show_urls = 'footnote' - -# If true, do not generate a @detailmenu in the "Top" node's menu. -#texinfo_no_detailmenu = False +#htmlhelp_basename = 'Tailbonedoc' diff --git a/docs/index.rst b/docs/index.rst index ffa516e9..d964086f 100644 --- a/docs/index.rst +++ b/docs/index.rst @@ -44,18 +44,32 @@ Package API: api/api/batch/core api/api/batch/ordering + api/db + api/diffs api/forms + api/forms.widgets api/grids + api/grids.core api/progress api/subscribers + api/util api/views/batch api/views/batch.vendorcatalog api/views/core api/views/master + api/views/members api/views/purchasing.batch api/views/purchasing.ordering +Changelog: + +.. toctree:: + :maxdepth: 1 + + changelog + + Documentation To-Do =================== diff --git a/pyproject.toml b/pyproject.toml new file mode 100644 index 00000000..4a4d5e66 --- /dev/null +++ b/pyproject.toml @@ -0,0 +1,103 @@ + +[build-system] +requires = ["hatchling"] +build-backend = "hatchling.build" + + +[project] +name = "Tailbone" +version = "0.22.8" +description = "Backoffice Web Application for Rattail" +readme = "README.md" +authors = [{name = "Lance Edgar", email = "lance@edbob.org"}] +license = {text = "GNU GPL v3+"} +classifiers = [ + "Development Status :: 4 - Beta", + "Environment :: Web Environment", + "Framework :: Pyramid", + "Intended Audience :: Developers", + "License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)", + "Natural Language :: English", + "Operating System :: OS Independent", + "Programming Language :: Python", + "Programming Language :: Python :: 3", + "Programming Language :: Python :: 3.8", + "Programming Language :: Python :: 3.9", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Topic :: Internet :: WWW/HTTP", + "Topic :: Office/Business", + "Topic :: Software Development :: Libraries :: Python Modules", +] +requires-python = ">= 3.8" +dependencies = [ + "asgiref", + "colander", + "ColanderAlchemy", + "cornice", + "cornice-swagger", + "deform", + "humanize", + "Mako", + "markdown", + "openpyxl", + "paginate", + "paginate_sqlalchemy", + "passlib", + "Pillow", + "pyramid>=2", + "pyramid_beaker", + "pyramid_deform", + "pyramid_exclog", + "pyramid_fanstatic", + "pyramid_mako", + "pyramid_retry", + "pyramid_tm", + "rattail[db,bouncer]>=0.20.1", + "sa-filters", + "simplejson", + "transaction", + "waitress", + "WebHelpers2", + "WuttaWeb>=0.21.0", + "zope.sqlalchemy>=1.5", +] + + +[project.optional-dependencies] +docs = ["Sphinx", "furo"] +tests = ["coverage", "mock", "pytest", "pytest-cov"] + + +[project.entry-points."paste.app_factory"] +main = "tailbone.app:main" +webapi = "tailbone.webapi:main" + + +[project.entry-points."rattail.cleaners"] +beaker = "tailbone.cleanup:BeakerCleaner" + + +[project.entry-points."rattail.config.extensions"] +tailbone = "tailbone.config:ConfigExtension" + + +[project.urls] +Homepage = "https://rattailproject.org" +Repository = "https://forgejo.wuttaproject.org/rattail/tailbone" +Issues = "https://forgejo.wuttaproject.org/rattail/tailbone/issues" +Changelog = "https://forgejo.wuttaproject.org/rattail/tailbone/src/branch/master/CHANGELOG.md" + + +[tool.commitizen] +version_provider = "pep621" +tag_format = "v$version" +update_changelog_on_bump = true + + +[tool.nosetests] +nocapture = 1 +cover-package = "tailbone" +cover-erase = 1 +cover-html = 1 +cover-html-dir = "htmlcov" diff --git a/setup.cfg b/setup.cfg deleted file mode 100644 index 7712ec72..00000000 --- a/setup.cfg +++ /dev/null @@ -1,6 +0,0 @@ -[nosetests] -nocapture = 1 -cover-package = tailbone -cover-erase = 1 -cover-html = 1 -cover-html-dir = htmlcov diff --git a/setup.py b/setup.py deleted file mode 100644 index e24e3f98..00000000 --- a/setup.py +++ /dev/null @@ -1,185 +0,0 @@ -# -*- coding: utf-8; -*- -################################################################################ -# -# Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar -# -# This file is part of Rattail. -# -# Rattail is free software: you can redistribute it and/or modify it under the -# terms of the GNU General Public License as published by the Free Software -# Foundation, either version 3 of the License, or (at your option) any later -# version. -# -# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY -# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS -# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more -# details. -# -# You should have received a copy of the GNU General Public License along with -# Rattail. If not, see . -# -################################################################################ -""" -Setup script for Tailbone -""" - -from __future__ import unicode_literals, absolute_import - -import os.path -from setuptools import setup, find_packages - - -here = os.path.abspath(os.path.dirname(__file__)) -exec(open(os.path.join(here, 'tailbone', '_version.py')).read()) -README = open(os.path.join(here, 'README.rst')).read() - - -requires = [ - # - # Version numbers within comments below have specific meanings. - # Basically the 'low' value is a "soft low," and 'high' a "soft high." - # In other words: - # - # If either a 'low' or 'high' value exists, the primary point to be - # made about the value is that it represents the most current (stable) - # version available for the package (assuming typical public access - # methods) whenever this project was started and/or documented. - # Therefore: - # - # If a 'low' version is present, you should know that attempts to use - # versions of the package significantly older than the 'low' version - # may not yield happy results. (A "hard" high limit may or may not be - # indicated by a true version requirement.) - # - # Similarly, if a 'high' version is present, and especially if this - # project has laid dormant for a while, you may need to refactor a bit - # when attempting to support a more recent version of the package. (A - # "hard" low limit should be indicated by a true version requirement - # when a 'high' version is present.) - # - # In any case, developers and other users are encouraged to play - # outside the lines with regard to these soft limits. If bugs are - # encountered then they should be filed as such. - # - # package # low high - - # TODO: previously was capping this to pre-1.0 although i'm not sure why. - # however the 1.2 release has some breaking changes which require refactor. - # cf. https://pypi.org/project/zope.sqlalchemy/#id3 - 'zope.sqlalchemy<1.2', # 0.7 1.1 - - # TODO: apparently they jumped from 0.1 to 0.9 and that broke us... - # (0.1 was released on 2014-09-14 and then 0.9 came out on 2018-09-27) - # (i've cached 0.1 at pypi.rattailproject.org just in case it disappears) - # (still, probably a better idea is to refactor so we can use 0.9) - 'webhelpers2_grid==0.1', # 0.1 - - # TODO: remove version cap once we can drop support for python 2.x - 'cornice<5.0', # 3.4.2 4.0.1 - - # TODO: remove once their bug is fixed? idk what this is about yet... - 'deform<2.0.15', # 2.0.14 - - # TODO: cornice<5 requires pyramid<2 (see above) - 'pyramid<2', # 1.3b2 1.10.8 - - 'colander', # 1.7.0 - 'ColanderAlchemy', # 0.3.3 - 'humanize', # 0.5.1 - 'Mako', # 0.6.2 - 'markdown', # 3.3.3 - 'openpyxl', # 2.4.7 - 'paginate', # 0.5.6 - 'paginate_sqlalchemy', # 0.2.0 - 'passlib', # 1.7.1 - 'Pillow', # 5.3.0 - 'pyramid_beaker>=0.6', # 0.6.1 - 'pyramid_deform', # 0.2 - 'pyramid_exclog', # 0.6 - 'pyramid_mako', # 1.0.2 - 'pyramid_tm', # 0.3 - 'rattail[db,bouncer]', # 0.5.0 - 'six', # 1.10.0 - 'sqlalchemy-filters', # 0.8.0 - 'transaction', # 1.2.0 - 'waitress', # 0.8.1 - 'WebHelpers2', # 2.0 - 'WTForms', # 2.1 -] - - -extras = { - - 'docs': [ - # - # package # low high - - 'Sphinx', # 1.2 - 'sphinx-rtd-theme', # 0.2.4 - ], - - 'tests': [ - # - # package # low high - - 'coverage', # 3.6 - 'fixture', # 1.5 - 'mock', # 1.0.1 - 'nose', # 1.3.0 - ], -} - - -setup( - name = "Tailbone", - version = __version__, - author = "Lance Edgar", - author_email = "lance@edbob.org", - url = "http://rattailproject.org/", - license = "GNU GPL v3", - description = "Backoffice Web Application for Rattail", - long_description = README, - - classifiers = [ - 'Development Status :: 4 - Beta', - 'Environment :: Web Environment', - 'Framework :: Pyramid', - 'Intended Audience :: Developers', - 'License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)', - 'Natural Language :: English', - 'Operating System :: OS Independent', - 'Programming Language :: Python', - 'Programming Language :: Python :: 2.7', - 'Programming Language :: Python :: 3', - 'Programming Language :: Python :: 3.5', - 'Topic :: Internet :: WWW/HTTP', - 'Topic :: Office/Business', - 'Topic :: Software Development :: Libraries :: Python Modules', - ], - - install_requires = requires, - extras_require = extras, - tests_require = ['Tailbone[tests]'], - test_suite = 'nose.collector', - - packages = find_packages(exclude=['tests.*', 'tests']), - include_package_data = True, - zip_safe = False, - - entry_points = { - - 'paste.app_factory': [ - 'main = tailbone.app:main', - 'webapi = tailbone.webapi:main', - ], - - 'rattail.config.extensions': [ - 'tailbone = tailbone.config:ConfigExtension', - ], - - 'pyramid.scaffold': [ - 'rattail = tailbone.scaffolds:RattailTemplate', - ], - }, -) diff --git a/tailbone/_version.py b/tailbone/_version.py index c5a1b4cb..7095f6c8 100644 --- a/tailbone/_version.py +++ b/tailbone/_version.py @@ -1,3 +1,9 @@ # -*- coding: utf-8; -*- -__version__ = '0.8.182' +try: + from importlib.metadata import version +except ImportError: + from importlib_metadata import version + + +__version__ = version('Tailbone') diff --git a/tailbone/api/__init__.py b/tailbone/api/__init__.py index 0b669b6c..1fae059f 100644 --- a/tailbone/api/__init__.py +++ b/tailbone/api/__init__.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2022 Lance Edgar # # This file is part of Rattail. # @@ -28,6 +28,7 @@ from __future__ import unicode_literals, absolute_import from .core import APIView, api from .master import APIMasterView, SortColumn +# TODO: remove this from .master2 import APIMasterView2 diff --git a/tailbone/api/auth.py b/tailbone/api/auth.py index 80f8fac0..a710e30d 100644 --- a/tailbone/api/auth.py +++ b/tailbone/api/auth.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,10 +24,6 @@ Tailbone Web API - Auth Views """ -from __future__ import unicode_literals, absolute_import - -from rattail.db.auth import set_user_password - from cornice import Service from tailbone.api import APIView, api @@ -44,11 +40,10 @@ class AuthenticationView(APIView): This will establish a server-side web session for the user if none exists. Note that this also resets the user's session timer. """ - data = {'ok': True} + data = {'ok': True, 'permissions': []} if self.request.user: data['user'] = self.get_user_info(self.request.user) - - data['permissions'] = list(self.request.tailbone_cached_permissions) + data['permissions'] = list(self.request.user_permissions) # background color may be set per-request, by some apps if hasattr(self.request, 'background_color') and self.request.background_color: @@ -57,6 +52,16 @@ class AuthenticationView(APIView): data['background_color'] = self.rattail_config.get( 'tailbone', 'background_color') + # TODO: this seems the best place to return some global app + # settings, but maybe not desirable in all cases..in which + # case should caller need to ask for these explicitly? or + # make a different call altogether to get them..? + app = self.get_rattail_app() + customer_handler = app.get_clientele_handler() + data['settings'] = { + 'customer_field_dropdown': customer_handler.choice_uses_dropdown(), + } + return data @api @@ -89,7 +94,7 @@ class AuthenticationView(APIView): return { 'ok': True, 'user': self.get_user_info(user), - 'permissions': list(auth.cache_permissions(Session(), user)), + 'permissions': list(auth.get_permissions(Session(), user)), } def authenticate_user(self, username, password): @@ -158,6 +163,9 @@ class AuthenticationView(APIView): if not self.request.user: raise self.forbidden() + if self.request.user.prevent_password_change and not self.request.is_root: + raise self.forbidden() + data = self.request.json_body # first make sure "current" password is accurate @@ -165,7 +173,8 @@ class AuthenticationView(APIView): return {'error': "The current/old password you provided is incorrect"} # okay then, set new password - set_user_password(self.request.user, data['new_password']) + auth = self.app.get_auth_handler() + auth.set_user_password(self.request.user, data['new_password']) return { 'ok': True, 'user': self.get_user_info(self.request.user), @@ -209,5 +218,12 @@ class AuthenticationView(APIView): config.add_cornice_service(change_password) -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + AuthenticationView = kwargs.get('AuthenticationView', base['AuthenticationView']) AuthenticationView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/batch/core.py b/tailbone/api/batch/core.py index a2f44596..f7bc9333 100644 --- a/tailbone/api/batch/core.py +++ b/tailbone/api/batch/core.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,18 +24,12 @@ Tailbone Web API - Batch Views """ -from __future__ import unicode_literals, absolute_import - import logging +import warnings -import six +from cornice import Service -from rattail.time import localtime -from rattail.util import load_object - -from cornice import resource, Service - -from tailbone.api import APIMasterView2 as APIMasterView +from tailbone.api import APIMasterView log = logging.getLogger(__name__) @@ -70,10 +64,9 @@ class APIBatchMixin(object): table name, although technically it is whatever value returns from the ``batch_key`` attribute of the main batch model class. """ + app = self.get_rattail_app() key = self.get_batch_class().batch_key - spec = self.rattail_config.get('rattail.batch', '{}.handler'.format(key), - default=self.default_handler_spec) - return load_object(spec)(self.rattail_config) + return app.get_batch_handler(key, default=self.default_handler_spec) class APIBatchView(APIBatchMixin, APIMasterView): @@ -86,38 +79,45 @@ class APIBatchView(APIBatchMixin, APIMasterView): def __init__(self, request, **kwargs): super(APIBatchView, self).__init__(request, **kwargs) - self.handler = self.get_handler() + self.batch_handler = self.get_handler() + + @property + def handler(self): + warnings.warn("the `handler` property is deprecated; " + "please use `batch_handler` instead", + DeprecationWarning, stacklevel=2) + return self.batch_handler def normalize(self, batch): - - created = localtime(self.rattail_config, batch.created, from_utc=True) + app = self.get_rattail_app() + created = app.localtime(batch.created, from_utc=True) executed = None if batch.executed: - executed = localtime(self.rattail_config, batch.executed, from_utc=True) + executed = app.localtime(batch.executed, from_utc=True) return { 'uuid': batch.uuid, - '_str': six.text_type(batch), + '_str': str(batch), 'id': batch.id, 'id_str': batch.id_str, 'description': batch.description, 'notes': batch.notes, 'params': batch.params or {}, 'rowcount': batch.rowcount, - 'created': six.text_type(created), + 'created': str(created), 'created_display': self.pretty_datetime(created), 'created_by_uuid': batch.created_by.uuid, - 'created_by_display': six.text_type(batch.created_by), + 'created_by_display': str(batch.created_by), 'complete': batch.complete, 'status_code': batch.status_code, 'status_display': batch.STATUS.get(batch.status_code, - six.text_type(batch.status_code)), - 'executed': six.text_type(executed) if executed else None, + str(batch.status_code)), + 'executed': str(executed) if executed else None, 'executed_display': self.pretty_datetime(executed) if executed else None, 'executed_by_uuid': batch.executed_by_uuid, - 'executed_by_display': six.text_type(batch.executed_by or ''), - 'mutable': self.handler.is_mutable(batch), + 'executed_by_display': str(batch.executed_by or ''), + 'mutable': self.batch_handler.is_mutable(batch), } def create_object(self, data): @@ -130,9 +130,9 @@ class APIBatchView(APIBatchMixin, APIMasterView): user = self.request.user kwargs = dict(data) kwargs['user'] = user - batch = self.handler.make_batch(self.Session(), **kwargs) - if self.handler.should_populate(batch): - self.handler.do_populate(batch, user) + batch = self.batch_handler.make_batch(self.Session(), **kwargs) + if self.batch_handler.should_populate(batch): + self.batch_handler.do_populate(batch, user) return batch def update_object(self, batch, data): @@ -200,7 +200,7 @@ class APIBatchView(APIBatchMixin, APIMasterView): kwargs = dict(self.request.json_body) kwargs.pop('user', None) kwargs.pop('progress', None) - result = self.handler.do_execute(batch, self.request.user, **kwargs) + result = self.batch_handler.do_execute(batch, self.request.user, **kwargs) return {'ok': bool(result), 'batch': self.normalize(batch)} @classmethod @@ -254,14 +254,21 @@ class APIBatchRowView(APIBatchMixin, APIMasterView): def __init__(self, request, **kwargs): super(APIBatchRowView, self).__init__(request, **kwargs) - self.handler = self.get_handler() + self.batch_handler = self.get_handler() + + @property + def handler(self): + warnings.warn("the `handler` property is deprecated; " + "please use `batch_handler` instead", + DeprecationWarning, stacklevel=2) + return self.batch_handler def normalize(self, row): batch = row.batch return { 'uuid': row.uuid, - '_str': six.text_type(row), - '_parent_str': six.text_type(batch), + '_str': str(row), + '_parent_str': str(batch), '_parent_uuid': batch.uuid, 'batch_uuid': batch.uuid, 'batch_id': batch.id, @@ -269,10 +276,10 @@ class APIBatchRowView(APIBatchMixin, APIMasterView): 'batch_description': batch.description, 'batch_complete': batch.complete, 'batch_executed': bool(batch.executed), - 'batch_mutable': self.handler.is_mutable(batch), + 'batch_mutable': self.batch_handler.is_mutable(batch), 'sequence': row.sequence, 'status_code': row.status_code, - 'status_display': row.STATUS.get(row.status_code, six.text_type(row.status_code)), + 'status_display': row.STATUS.get(row.status_code, str(row.status_code)), } def update_object(self, row, data): @@ -282,14 +289,14 @@ class APIBatchRowView(APIBatchMixin, APIMasterView): Invokes the batch handler's ``refresh_row()`` method after updating the row's field data per usual. """ - if not self.handler.is_mutable(row.batch): + if not self.batch_handler.is_mutable(row.batch): return {'error': "Batch is not mutable"} # update row per usual row = super(APIBatchRowView, self).update_object(row, data) # okay now we apply handler refresh logic - self.handler.refresh_row(row) + self.batch_handler.refresh_row(row) return row def delete_object(self, row): @@ -298,7 +305,7 @@ class APIBatchRowView(APIBatchMixin, APIMasterView): Delegates deletion of the row to the batch handler. """ - self.handler.do_remove_row(row) + self.batch_handler.do_remove_row(row) def quick_entry(self): """ @@ -307,23 +314,26 @@ class APIBatchRowView(APIBatchMixin, APIMasterView): data = self.request.json_body uuid = data['batch_uuid'] - batch = self.Session.query(self.get_batch_class()).get(uuid) + batch = self.Session.get(self.get_batch_class(), uuid) if not batch: raise self.notfound() entry = data['quick_entry'] try: - row = self.handler.quick_entry(self.Session(), batch, entry) + row = self.batch_handler.quick_entry(self.Session(), batch, entry) except Exception as error: log.warning("quick entry failed for '%s' batch %s: %s", - self.handler.batch_key, batch.id_str, entry, + self.batch_handler.batch_key, batch.id_str, entry, exc_info=True) - msg = six.text_type(error) + msg = str(error) if not msg and isinstance(error, NotImplementedError): msg = "Feature is not implemented" return {'error': msg} + if not row: + return {'error': "Could not identify product"} + self.Session.flush() result = self._get(obj=row) result['ok'] = True @@ -339,13 +349,12 @@ class APIBatchRowView(APIBatchMixin, APIMasterView): route_prefix = cls.get_route_prefix() permission_prefix = cls.get_permission_prefix() collection_url_prefix = cls.get_collection_url_prefix() - object_url_prefix = cls.get_object_url_prefix() if cls.supports_quick_entry: # quick entry - config.add_route('{}.quick_entry'.format(route_prefix), '{}/quick-entry'.format(collection_url_prefix), - request_method=('OPTIONS', 'POST')) - config.add_view(cls, attr='quick_entry', route_name='{}.quick_entry'.format(route_prefix), - permission='{}.edit'.format(permission_prefix), - renderer='json') + quick_entry = Service(name='{}.quick_entry'.format(route_prefix), + path='{}/quick-entry'.format(collection_url_prefix)) + quick_entry.add_view('POST', 'quick_entry', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(quick_entry) diff --git a/tailbone/api/batch/inventory.py b/tailbone/api/batch/inventory.py index a798c58e..22b67e54 100644 --- a/tailbone/api/batch/inventory.py +++ b/tailbone/api/batch/inventory.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,15 +24,12 @@ Tailbone Web API - Inventory Batches """ -from __future__ import unicode_literals, absolute_import - import decimal -import six +import sqlalchemy as sa from rattail import pod -from rattail.db import model -from rattail.util import pretty_quantity +from rattail.db.model import InventoryBatch, InventoryBatchRow from cornice import Service @@ -41,7 +38,7 @@ from tailbone.api.batch import APIBatchView, APIBatchRowView class InventoryBatchViews(APIBatchView): - model_class = model.InventoryBatch + model_class = InventoryBatch default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler' route_prefix = 'inventory' permission_prefix = 'batch.inventory' @@ -50,12 +47,12 @@ class InventoryBatchViews(APIBatchView): supports_toggle_complete = True def normalize(self, batch): - data = super(InventoryBatchViews, self).normalize(batch) + data = super().normalize(batch) data['mode'] = batch.mode data['mode_display'] = self.enum.INVENTORY_MODE.get(batch.mode) if data['mode_display'] is None and batch.mode is not None: - data['mode_display'] = six.text_type(batch.mode) + data['mode_display'] = str(batch.mode) data['reason_code'] = batch.reason_code @@ -67,9 +64,9 @@ class InventoryBatchViews(APIBatchView): """ permission_prefix = self.get_permission_prefix() if self.request.is_root: - modes = self.handler.get_count_modes() + modes = self.batch_handler.get_count_modes() else: - modes = self.handler.get_allowed_count_modes( + modes = self.batch_handler.get_allowed_count_modes( self.Session(), self.request.user, permission_prefix=permission_prefix) return modes @@ -79,7 +76,7 @@ class InventoryBatchViews(APIBatchView): Retrieve info about the available "reasons" for inventory adjustment batches. """ - raw_reasons = self.handler.get_adjustment_reasons(self.Session()) + raw_reasons = self.batch_handler.get_adjustment_reasons(self.Session()) reasons = [] for reason in raw_reasons: reasons.append({ @@ -119,7 +116,7 @@ class InventoryBatchViews(APIBatchView): class InventoryBatchRowViews(APIBatchRowView): - model_class = model.InventoryBatchRow + model_class = InventoryBatchRow default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler' route_prefix = 'inventory.rows' permission_prefix = 'batch.inventory' @@ -130,26 +127,27 @@ class InventoryBatchRowViews(APIBatchRowView): def normalize(self, row): batch = row.batch - data = super(InventoryBatchRowViews, self).normalize(row) + data = super().normalize(row) + app = self.get_rattail_app() data['item_id'] = row.item_id - data['upc'] = six.text_type(row.upc) + data['upc'] = str(row.upc) data['upc_pretty'] = row.upc.pretty() if row.upc else None data['brand_name'] = row.brand_name data['description'] = row.description data['size'] = row.size data['full_description'] = row.product.full_description if row.product else row.description data['image_url'] = pod.get_image_url(self.rattail_config, row.upc) if row.upc else None - data['case_quantity'] = pretty_quantity(row.case_quantity or 1) + data['case_quantity'] = app.render_quantity(row.case_quantity or 1) data['cases'] = row.cases data['units'] = row.units data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA' data['quantity_display'] = "{} {}".format( - pretty_quantity(row.cases or row.units), + app.render_quantity(row.cases or row.units), 'CS' if row.cases else data['unit_uom']) - data['allow_cases'] = self.handler.allow_cases(batch) + data['allow_cases'] = self.batch_handler.allow_cases(batch) return data @@ -174,10 +172,29 @@ class InventoryBatchRowViews(APIBatchRowView): data['units'] = decimal.Decimal(data['units']) # update row per usual - row = super(InventoryBatchRowViews, self).update_object(row, data) + try: + row = super().update_object(row, data) + except sa.exc.DataError as error: + # detect when user scans barcode for cases/units field + if hasattr(error, 'orig'): + orig = type(error.orig) + if hasattr(orig, '__name__'): + # nb. this particular error is from psycopg2 + if orig.__name__ == 'NumericValueOutOfRange': + return {'error': "Numeric value out of range"} + raise return row -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + InventoryBatchViews = kwargs.get('InventoryBatchViews', base['InventoryBatchViews']) InventoryBatchViews.defaults(config) + + InventoryBatchRowViews = kwargs.get('InventoryBatchRowViews', base['InventoryBatchRowViews']) InventoryBatchRowViews.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/batch/labels.py b/tailbone/api/batch/labels.py index 11a3d20d..4f154b21 100644 --- a/tailbone/api/batch/labels.py +++ b/tailbone/api/batch/labels.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,10 +24,6 @@ Tailbone Web API - Label Batches """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model from tailbone.api.batch import APIBatchView, APIBatchRowView @@ -56,10 +52,10 @@ class LabelBatchRowViews(APIBatchRowView): def normalize(self, row): batch = row.batch - data = super(LabelBatchRowViews, self).normalize(row) + data = super().normalize(row) data['item_id'] = row.item_id - data['upc'] = six.text_type(row.upc) + data['upc'] = str(row.upc) data['upc_pretty'] = row.upc.pretty() if row.upc else None data['brand_name'] = row.brand_name data['description'] = row.description @@ -68,6 +64,15 @@ class LabelBatchRowViews(APIBatchRowView): return data -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + LabelBatchViews = kwargs.get('LabelBatchViews', base['LabelBatchViews']) LabelBatchViews.defaults(config) + + LabelBatchRowViews = kwargs.get('LabelBatchRowViews', base['LabelBatchRowViews']) LabelBatchRowViews.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/batch/ordering.py b/tailbone/api/batch/ordering.py index 21de8da0..204be8ad 100644 --- a/tailbone/api/batch/ordering.py +++ b/tailbone/api/batch/ordering.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -27,22 +27,24 @@ These views expose the basic CRUD interface to "ordering" batches, for the web API. """ -from __future__ import unicode_literals, absolute_import +import datetime +import logging -import six +import sqlalchemy as sa -from rattail.core import Object -from rattail.db import model -from rattail.util import pretty_quantity +from rattail.db.model import PurchaseBatch, PurchaseBatchRow from cornice import Service from tailbone.api.batch import APIBatchView, APIBatchRowView +log = logging.getLogger(__name__) + + class OrderingBatchViews(APIBatchView): - model_class = model.PurchaseBatch + model_class = PurchaseBatch default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' route_prefix = 'orderingbatchviews' permission_prefix = 'ordering' @@ -58,18 +60,19 @@ class OrderingBatchViews(APIBatchView): Adds a condition to the query, to ensure only purchase batches with "ordering" mode are returned. """ - query = super(OrderingBatchViews, self).base_query() + model = self.model + query = super().base_query() query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_ORDERING) return query def normalize(self, batch): - data = super(OrderingBatchViews, self).normalize(batch) + data = super().normalize(batch) data['vendor_uuid'] = batch.vendor.uuid - data['vendor_display'] = six.text_type(batch.vendor) + data['vendor_display'] = str(batch.vendor) data['department_uuid'] = batch.department_uuid - data['department_display'] = six.text_type(batch.department) if batch.department else None + data['department_display'] = str(batch.department) if batch.department else None data['po_total_calculated_display'] = "${:0.2f}".format(batch.po_total_calculated or 0) data['ship_method'] = batch.ship_method @@ -83,8 +86,10 @@ class OrderingBatchViews(APIBatchView): Sets the mode to "ordering" for the new batch. """ data = dict(data) + if not data.get('vendor_uuid'): + raise ValueError("You must specify the vendor") data['mode'] = self.enum.PURCHASE_BATCH_MODE_ORDERING - batch = super(OrderingBatchViews, self).create_object(data) + batch = super().create_object(data) return batch def worksheet(self): @@ -95,6 +100,8 @@ class OrderingBatchViews(APIBatchView): if batch.executed: raise self.forbidden() + app = self.get_rattail_app() + # TODO: much of the logic below was copied from the traditional master # view for ordering batches. should maybe let them share it somehow? @@ -105,10 +112,10 @@ class OrderingBatchViews(APIBatchView): # organize vendor catalog costs by dept / subdept departments = {} - costs = self.handler.get_order_form_costs(self.Session(), batch.vendor) - costs = self.handler.sort_order_form_costs(costs) + costs = self.batch_handler.get_order_form_costs(self.Session(), batch.vendor) + costs = self.batch_handler.sort_order_form_costs(costs) costs = list(costs) # we must have a stable list for the rest of this - self.handler.decorate_order_form_costs(batch, costs) + self.batch_handler.decorate_order_form_costs(batch, costs) for cost in costs: department = cost.product.department @@ -149,7 +156,7 @@ class OrderingBatchViews(APIBatchView): product = cost.product subdept_costs.append({ 'uuid': cost.uuid, - 'upc': six.text_type(product.upc), + 'upc': str(product.upc), 'upc_pretty': product.upc.pretty() if product.upc else None, 'brand_name': product.brand.name if product.brand else None, 'description': product.description, @@ -170,16 +177,28 @@ class OrderingBatchViews(APIBatchView): # sort the (sub)department groupings sorted_departments = [] - for dept in sorted(six.itervalues(departments), key=lambda d: d['name']): - dept['subdepartments'] = sorted(six.itervalues(dept['subdepartments']), + for dept in sorted(departments.values(), key=lambda d: d['name']): + dept['subdepartments'] = sorted(dept['subdepartments'].values(), key=lambda s: s['name']) sorted_departments.append(dept) # fetch recent purchase history, sort/pad for template convenience - history = self.handler.get_order_form_history(batch, costs, 6) + history = self.batch_handler.get_order_form_history(batch, costs, 6) for i in range(6 - len(history)): history.append(None) history = list(reversed(history)) + # must convert some date objects to string, for JSON sake + for h in history: + if not h: + continue + purchase = h.get('purchase') + if purchase: + dt = purchase.get('date_ordered') + if dt and isinstance(dt, datetime.date): + purchase['date_ordered'] = app.render_date(dt) + dt = purchase.get('date_received') + if dt and isinstance(dt, datetime.date): + purchase['date_received'] = app.render_date(dt) return { 'batch': self.normalize(batch), @@ -210,7 +229,7 @@ class OrderingBatchViews(APIBatchView): class OrderingBatchRowViews(APIBatchRowView): - model_class = model.PurchaseBatchRow + model_class = PurchaseBatchRow default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' route_prefix = 'ordering.rows' permission_prefix = 'ordering' @@ -220,11 +239,12 @@ class OrderingBatchRowViews(APIBatchRowView): editable = True def normalize(self, row): + data = super().normalize(row) + app = self.get_rattail_app() batch = row.batch - data = super(OrderingBatchRowViews, self).normalize(row) data['item_id'] = row.item_id - data['upc'] = six.text_type(row.upc) + data['upc'] = str(row.upc) data['upc_pretty'] = row.upc.pretty() if row.upc else None data['brand_name'] = row.brand_name data['description'] = row.description @@ -241,15 +261,15 @@ class OrderingBatchRowViews(APIBatchRowView): data['case_quantity'] = row.case_quantity data['cases_ordered'] = row.cases_ordered data['units_ordered'] = row.units_ordered - data['cases_ordered_display'] = pretty_quantity(row.cases_ordered or 0, empty_zero=False) - data['units_ordered_display'] = pretty_quantity(row.units_ordered or 0, empty_zero=False) + data['cases_ordered_display'] = app.render_quantity(row.cases_ordered or 0, empty_zero=False) + data['units_ordered_display'] = app.render_quantity(row.units_ordered or 0, empty_zero=False) data['po_unit_cost'] = row.po_unit_cost data['po_unit_cost_display'] = "${:0.2f}".format(row.po_unit_cost) if row.po_unit_cost is not None else None data['po_total_calculated'] = row.po_total_calculated data['po_total_calculated_display'] = "${:0.2f}".format(row.po_total_calculated) if row.po_total_calculated is not None else None data['status_code'] = row.status_code - data['status_display'] = row.STATUS.get(row.status_code, six.text_type(row.status_code)) + data['status_display'] = row.STATUS.get(row.status_code, str(row.status_code)) return data @@ -267,13 +287,32 @@ class OrderingBatchRowViews(APIBatchRowView): Note that the "normal" logic for this method is not invoked at all. """ - if not self.handler.is_mutable(row.batch): + if not self.batch_handler.is_mutable(row.batch): return {'error': "Batch is not mutable"} - self.handler.update_row_quantity(row, **data) + try: + self.batch_handler.update_row_quantity(row, **data) + self.Session.flush() + except Exception as error: + log.warning("update_row_quantity failed", exc_info=True) + if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'): + error = str(error.orig) + else: + error = str(error) + return {'error': error} + return row -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + OrderingBatchViews = kwargs.get('OrderingBatchViews', base['OrderingBatchViews']) OrderingBatchViews.defaults(config) + + OrderingBatchRowViews = kwargs.get('OrderingBatchRowViews', base['OrderingBatchRowViews']) OrderingBatchRowViews.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/batch/receiving.py b/tailbone/api/batch/receiving.py index 37bb00b5..b23bff55 100644 --- a/tailbone/api/batch/receiving.py +++ b/tailbone/api/batch/receiving.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,17 +24,14 @@ Tailbone Web API - Receiving Batches """ -from __future__ import unicode_literals, absolute_import - import logging -import six import humanize +import sqlalchemy as sa -from rattail.db import model -from rattail.time import make_utc -from rattail.util import pretty_quantity +from rattail.db.model import PurchaseBatch, PurchaseBatchRow +from cornice import Service from deform import widget as dfwidget from tailbone import forms @@ -47,7 +44,7 @@ log = logging.getLogger(__name__) class ReceivingBatchViews(APIBatchView): - model_class = model.PurchaseBatch + model_class = PurchaseBatch default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' route_prefix = 'receivingbatchviews' permission_prefix = 'receiving' @@ -57,30 +54,49 @@ class ReceivingBatchViews(APIBatchView): supports_execute = True def base_query(self): - query = super(ReceivingBatchViews, self).base_query() + model = self.app.model + query = super().base_query() query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_RECEIVING) return query def normalize(self, batch): - data = super(ReceivingBatchViews, self).normalize(batch) + data = super().normalize(batch) data['vendor_uuid'] = batch.vendor.uuid - data['vendor_display'] = six.text_type(batch.vendor) + data['vendor_display'] = str(batch.vendor) data['department_uuid'] = batch.department_uuid - data['department_display'] = six.text_type(batch.department) if batch.department else None + data['department_display'] = str(batch.department) if batch.department else None + data['po_number'] = batch.po_number data['po_total'] = batch.po_total data['invoice_total'] = batch.invoice_total data['invoice_total_calculated'] = batch.invoice_total_calculated + data['can_auto_receive'] = self.batch_handler.can_auto_receive(batch) + return data def create_object(self, data): data = dict(data) + + # all about receiving mode here data['mode'] = self.enum.PURCHASE_BATCH_MODE_RECEIVING - batch = super(ReceivingBatchViews, self).create_object(data) - return batch + + # assume "receive from PO" if given a PO key + if data.get('purchase_key'): + data['workflow'] = 'from_po' + + return super().create_object(data) + + def auto_receive(self): + """ + View which handles auto-marking as received, all items within + a pending batch. + """ + batch = self.get_object() + self.batch_handler.auto_receive_all_items(batch) + return self._get(obj=batch) def mark_receiving_complete(self): """ @@ -104,12 +120,13 @@ class ReceivingBatchViews(APIBatchView): return self._get(obj=batch) def eligible_purchases(self): + model = self.app.model uuid = self.request.params.get('vendor_uuid') - vendor = self.Session.query(model.Vendor).get(uuid) if uuid else None + vendor = self.Session.get(model.Vendor, uuid) if uuid else None if not vendor: return {'error': "Vendor not found"} - purchases = self.handler.get_eligible_purchases( + purchases = self.batch_handler.get_eligible_purchases( vendor, self.enum.PURCHASE_BATCH_MODE_RECEIVING) purchases = [self.normalize_eligible_purchase(p) @@ -118,14 +135,10 @@ class ReceivingBatchViews(APIBatchView): return {'purchases': purchases} def normalize_eligible_purchase(self, purchase): - return { - 'key': purchase.uuid, - 'department_uuid': purchase.department_uuid, - 'display': self.render_eligible_purchase(purchase), - } + return self.batch_handler.normalize_eligible_purchase(purchase) def render_eligible_purchase(self, purchase): - return self.handler.render_eligible_purchase(purchase) + return self.batch_handler.render_eligible_purchase(purchase) @classmethod def defaults(cls, config): @@ -140,23 +153,31 @@ class ReceivingBatchViews(APIBatchView): collection_url_prefix = cls.get_collection_url_prefix() object_url_prefix = cls.get_object_url_prefix() - # mark receiving complete - config.add_route('{}.mark_receiving_complete'.format(route_prefix), '{}/{{uuid}}/mark-receiving-complete'.format(object_url_prefix)) - config.add_view(cls, attr='mark_receiving_complete', route_name='{}.mark_receiving_complete'.format(route_prefix), - permission='{}.edit'.format(permission_prefix), - renderer='json') + # auto_receive + auto_receive = Service(name='{}.auto_receive'.format(route_prefix), + path='{}/{{uuid}}/auto-receive'.format(object_url_prefix)) + auto_receive.add_view('GET', 'auto_receive', klass=cls, + permission='{}.auto_receive'.format(permission_prefix)) + config.add_cornice_service(auto_receive) + + # mark_receiving_complete + mark_receiving_complete = Service(name='{}.mark_receiving_complete'.format(route_prefix), + path='{}/{{uuid}}/mark-receiving-complete'.format(object_url_prefix)) + mark_receiving_complete.add_view('POST', 'mark_receiving_complete', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(mark_receiving_complete) # eligible purchases - config.add_route('{}.eligible_purchases'.format(route_prefix), '{}/eligible-purchases'.format(collection_url_prefix), - request_method='GET') - config.add_view(cls, attr='eligible_purchases', route_name='{}.eligible_purchases'.format(route_prefix), - permission='{}.create'.format(permission_prefix), - renderer='json') + eligible_purchases = Service(name='{}.eligible_purchases'.format(route_prefix), + path='{}/eligible-purchases'.format(collection_url_prefix)) + eligible_purchases.add_view('GET', 'eligible_purchases', klass=cls, + permission='{}.create'.format(permission_prefix)) + config.add_cornice_service(eligible_purchases) class ReceivingBatchRowViews(APIBatchRowView): - model_class = model.PurchaseBatchRow + model_class = PurchaseBatchRow default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' route_prefix = 'receiving.rows' permission_prefix = 'receiving' @@ -165,7 +186,8 @@ class ReceivingBatchRowViews(APIBatchRowView): supports_quick_entry = True def make_filter_spec(self): - filters = super(ReceivingBatchRowViews, self).make_filter_spec() + model = self.app.model + filters = super().make_filter_spec() if filters: # must translate certain convenience filters @@ -261,21 +283,30 @@ class ReceivingBatchRowViews(APIBatchRowView): ]}, ]) + # is_missing + elif filtr['field'] == 'is_missing' and filtr['op'] == 'eq' and filtr['value'] is True: + filters.extend([ + {'or': [ + {'field': 'cases_missing', 'op': '!=', 'value': 0}, + {'field': 'units_missing', 'op': '!=', 'value': 0}, + ]}, + ]) + else: # just some filter, use as-is filters.append(filtr) return filters def normalize(self, row): - data = super(ReceivingBatchRowViews, self).normalize(row) + data = super().normalize(row) + model = self.app.model batch = row.batch - app = self.get_rattail_app() - prodder = app.get_products_handler() + prodder = self.app.get_products_handler() data['product_uuid'] = row.product_uuid data['item_id'] = row.item_id - data['upc'] = six.text_type(row.upc) + data['upc'] = str(row.upc) data['upc_pretty'] = row.upc.pretty() if row.upc else None data['brand_name'] = row.brand_name data['description'] = row.description @@ -307,14 +338,22 @@ class ReceivingBatchRowViews(APIBatchRowView): data['cases_expired'] = row.cases_expired data['units_expired'] = row.units_expired + data['cases_missing'] = row.cases_missing + data['units_missing'] = row.units_missing + + cases, units = self.batch_handler.get_unconfirmed_counts(row) + data['cases_unconfirmed'] = cases + data['units_unconfirmed'] = units + data['po_unit_cost'] = row.po_unit_cost data['po_total'] = row.po_total + data['invoice_number'] = row.invoice_number data['invoice_unit_cost'] = row.invoice_unit_cost data['invoice_total'] = row.invoice_total data['invoice_total_calculated'] = row.invoice_total_calculated - data['allow_cases'] = self.handler.allow_cases() + data['allow_cases'] = self.batch_handler.allow_cases() data['quick_receive'] = self.rattail_config.getbool( 'rattail.batch', 'purchase.mobile_quick_receive', @@ -332,13 +371,13 @@ class ReceivingBatchRowViews(APIBatchRowView): raise NotImplementedError("TODO: add CS support for quick_receive_all") else: data['quick_receive_uom'] = data['unit_uom'] - accounted_for = self.handler.get_units_accounted_for(row) - remainder = self.handler.get_units_ordered(row) - accounted_for + accounted_for = self.batch_handler.get_units_accounted_for(row) + remainder = self.batch_handler.get_units_ordered(row) - accounted_for if accounted_for: # some product accounted for; button should receive "remainder" only if remainder: - remainder = pretty_quantity(remainder) + remainder = self.app.render_quantity(remainder) data['quick_receive_quantity'] = remainder data['quick_receive_text'] = "Receive Remainder ({} {})".format( remainder, data['unit_uom']) @@ -349,7 +388,7 @@ class ReceivingBatchRowViews(APIBatchRowView): else: # nothing yet accounted for, button should receive "all" if not remainder: log.warning("quick receive remainder is empty for row %s", row.uuid) - remainder = pretty_quantity(remainder) + remainder = self.app.render_quantity(remainder) data['quick_receive_quantity'] = remainder data['quick_receive_text'] = "Receive ALL ({} {})".format( remainder, data['unit_uom']) @@ -375,9 +414,9 @@ class ReceivingBatchRowViews(APIBatchRowView): default=False) if alert_received: data['received_alert'] = None - if self.handler.get_units_confirmed(row): + if self.batch_handler.get_units_confirmed(row): msg = "You have already received some of this product; last update was {}.".format( - humanize.naturaltime(make_utc() - row.modified)) + humanize.naturaltime(self.app.make_utc() - row.modified)) data['received_alert'] = msg return data @@ -386,27 +425,37 @@ class ReceivingBatchRowViews(APIBatchRowView): """ View which handles "receiving" against a particular batch row. """ + model = self.app.model + # first do basic input validation schema = ReceiveRow().bind(session=self.Session()) form = forms.Form(schema=schema, request=self.request) # TODO: this seems hacky, but avoids "complex" date value parsing form.set_widget('expiration_date', dfwidget.TextInputWidget()) - if not form.validate(newstyle=True): - log.debug("form did not validate: %s", - form.make_deform_form().error) + if not form.validate(): + log.warning("form did not validate: %s", + form.make_deform_form().error) return {'error': "Form did not validate"} # fetch / validate row object - row = self.Session.query(model.PurchaseBatchRow).get(form.validated['row']) + row = self.Session.get(model.PurchaseBatchRow, form.validated['row']) if row is not self.get_object(): return {'error': "Specified row does not match the route!"} # handler takes care of the row receiving logic for us kwargs = dict(form.validated) del kwargs['row'] - self.handler.receive_row(row, **kwargs) + try: + self.batch_handler.receive_row(row, **kwargs) + self.Session.flush() + except Exception as error: + log.warning("receive() failed", exc_info=True) + if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'): + error = str(error.orig) + else: + error = str(error) + return {'error': error} - self.Session.flush() return self._get(obj=row) @classmethod @@ -422,13 +471,22 @@ class ReceivingBatchRowViews(APIBatchRowView): object_url_prefix = cls.get_object_url_prefix() # receive (row) - config.add_route('{}.receive'.format(route_prefix), '{}/{{uuid}}/receive'.format(object_url_prefix), - request_method=('OPTIONS', 'POST')) - config.add_view(cls, attr='receive', route_name='{}.receive'.format(route_prefix), - permission='{}.edit_row'.format(permission_prefix), - renderer='json') + receive = Service(name='{}.receive'.format(route_prefix), + path='{}/{{uuid}}/receive'.format(object_url_prefix)) + receive.add_view('POST', 'receive', klass=cls, + permission='{}.edit_row'.format(permission_prefix)) + config.add_cornice_service(receive) + + +def defaults(config, **kwargs): + base = globals() + + ReceivingBatchViews = kwargs.get('ReceivingBatchViews', base['ReceivingBatchViews']) + ReceivingBatchViews.defaults(config) + + ReceivingBatchRowViews = kwargs.get('ReceivingBatchRowViews', base['ReceivingBatchRowViews']) + ReceivingBatchRowViews.defaults(config) def includeme(config): - ReceivingBatchViews.defaults(config) - ReceivingBatchRowViews.defaults(config) + defaults(config) diff --git a/tailbone/api/common.py b/tailbone/api/common.py index 81458c01..6cacfb06 100644 --- a/tailbone/api/common.py +++ b/tailbone/api/common.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,16 +24,14 @@ Tailbone Web API - "Common" Views """ -from __future__ import unicode_literals, absolute_import +from collections import OrderedDict -import rattail -from rattail.db import model -from rattail.mail import send_email -from rattail.util import OrderedDict +from rattail.util import get_pkg_version from cornice import Service +from cornice.service import get_services +from cornice_swagger import CorniceSwagger -import tailbone from tailbone import forms from tailbone.forms.common import Feedback from tailbone.api import APIView, api @@ -65,11 +63,12 @@ class CommonView(APIView): } def get_project_title(self): - return self.rattail_config.app_title(default="Tailbone") + app = self.get_rattail_app() + return app.get_title() def get_project_version(self): - import tailbone - return tailbone.__version__ + app = self.get_rattail_app() + return app.get_version() def get_packages(self): """ @@ -77,8 +76,8 @@ class CommonView(APIView): 'about' page. """ return OrderedDict([ - ('rattail', rattail.__version__), - ('Tailbone', tailbone.__version__), + ('rattail', get_pkg_version('rattail')), + ('Tailbone', get_pkg_version('Tailbone')), ]) @api @@ -86,18 +85,20 @@ class CommonView(APIView): """ View to handle user feedback form submits. """ + app = self.get_rattail_app() + model = self.model # TODO: this logic was copied from tailbone.views.common and is largely # identical; perhaps should merge somehow? schema = Feedback().bind(session=Session()) form = forms.Form(schema=schema, request=self.request) - if form.validate(newstyle=True): + if form.validate(): data = dict(form.validated) # figure out who the sending user is, if any if self.request.user: data['user'] = self.request.user elif data['user']: - data['user'] = Session.query(model.User).get(data['user']) + data['user'] = Session.get(model.User, data['user']) # TODO: should provide URL to view user if data['user']: @@ -105,17 +106,27 @@ class CommonView(APIView): data['client_ip'] = self.request.client_addr email_key = data['email_key'] or self.feedback_email_key - send_email(self.rattail_config, email_key, data=data) + app.send_email(email_key, data=data) return {'ok': True} return {'error': "Form did not validate!"} + def swagger(self): + doc = CorniceSwagger(get_services()) + app = self.get_rattail_app() + spec = doc.generate(f"{app.get_node_title()} API docs", + app.get_version(), + base_path='/api') # TODO + return spec + @classmethod def defaults(cls, config): cls._common_defaults(config) @classmethod def _common_defaults(cls, config): + rattail_config = config.registry.settings.get('rattail_config') + app = rattail_config.get_app() # about about = Service(name='about', path='/about') @@ -128,6 +139,21 @@ class CommonView(APIView): permission='common.feedback') config.add_cornice_service(feedback) + # swagger + swagger = Service(name='swagger', + path='/swagger.json', + description=f"OpenAPI documentation for {app.get_title()}") + swagger.add_view('GET', 'swagger', klass=cls, + permission='common.api_swagger') + config.add_cornice_service(swagger) + + +def defaults(config, **kwargs): + base = globals() + + CommonView = kwargs.get('CommonView', base['CommonView']) + CommonView.defaults(config) + def includeme(config): - CommonView.defaults(config) + defaults(config) diff --git a/tailbone/api/core.py b/tailbone/api/core.py index 65aa9699..0d8eec32 100644 --- a/tailbone/api/core.py +++ b/tailbone/api/core.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,10 +24,6 @@ Tailbone Web API - Core Views """ -from __future__ import unicode_literals, absolute_import - -from rattail.util import load_object - from tailbone.views import View @@ -102,24 +98,28 @@ class APIView(View): info.pop('short_name', None) return info """ + app = self.get_rattail_app() + auth = app.get_auth_handler() + # basic / default info - is_admin = user.is_admin() - employee = user.employee + is_admin = auth.user_is_admin(user) + employee = app.get_employee(user) info = { 'uuid': user.uuid, 'username': user.username, 'display_name': user.display_name, - 'short_name': user.get_short_name(), + 'short_name': auth.get_short_display_name(user), 'is_admin': is_admin, 'is_root': is_admin and self.request.session.get('is_root', False), 'employee_uuid': employee.uuid if employee else None, + 'email_address': app.get_contact_email_address(user), } # maybe get/use "extra" info extra = self.rattail_config.get('tailbone.api', 'extra_user_info', usedb=False) if extra: - extra = load_object(extra) + extra = app.load_object(extra) info = extra(self.request, user, **info) return info diff --git a/tailbone/api/customers.py b/tailbone/api/customers.py index fdd2c18e..85d28c24 100644 --- a/tailbone/api/customers.py +++ b/tailbone/api/customers.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,13 +24,9 @@ Tailbone Web API - Customer Views """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model -from tailbone.api import APIMasterView2 as APIMasterView +from tailbone.api import APIMasterView class CustomerView(APIMasterView): @@ -40,16 +36,25 @@ class CustomerView(APIMasterView): model_class = model.Customer collection_url_prefix = '/customers' object_url_prefix = '/customer' + supports_autocomplete = True + autocomplete_fieldname = 'name' def normalize(self, customer): return { 'uuid': customer.uuid, - '_str': six.text_type(customer), + '_str': str(customer), 'id': customer.id, 'number': customer.number, 'name': customer.name, } -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + CustomerView = kwargs.get('CustomerView', base['CustomerView']) CustomerView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/essentials.py b/tailbone/api/essentials.py new file mode 100644 index 00000000..7b151578 --- /dev/null +++ b/tailbone/api/essentials.py @@ -0,0 +1,36 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2023 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Essential views for convenient includes +""" + + +def defaults(config, **kwargs): + mod = lambda spec: kwargs.get(spec, spec) + + config.include(mod('tailbone.api.auth')) + config.include(mod('tailbone.api.common')) + + +def includeme(config): + defaults(config) diff --git a/tailbone/scaffolds.py b/tailbone/api/labels.py similarity index 57% rename from tailbone/scaffolds.py rename to tailbone/api/labels.py index 10bf9640..8bc11f8f 100644 --- a/tailbone/scaffolds.py +++ b/tailbone/api/labels.py @@ -1,8 +1,8 @@ -# -*- coding: utf-8 -*- +# -*- coding: utf-8; -*- ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -21,25 +21,31 @@ # ################################################################################ """ -Pyramid scaffold templates +Tailbone Web API - Label Views """ from __future__ import unicode_literals, absolute_import -from rattail.files import resource_path -from rattail.util import prettify +from rattail.db.model import LabelProfile -from pyramid.scaffolds import PyramidTemplate +from tailbone.api import APIMasterView -class RattailTemplate(PyramidTemplate): - _template_dir = resource_path('rattail:data/project') - summary = "Starter project based on Rattail / Tailbone" +class LabelProfileView(APIMasterView): + """ + API views for Label Profile data + """ + model_class = LabelProfile + collection_url_prefix = '/label-profiles' + object_url_prefix = '/label-profile' - def pre(self, command, output_dir, vars): - """ - Adds some more variables to the template context. - """ - vars['project_title'] = prettify(vars['project']) - vars['package_title'] = vars['package'].capitalize() - return super(RattailTemplate, self).pre(command, output_dir, vars) + +def defaults(config, **kwargs): + base = globals() + + LabelProfileView = kwargs.get('LabelProfileView', base['LabelProfileView']) + LabelProfileView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/master.py b/tailbone/api/master.py index 27030f5b..551d6428 100644 --- a/tailbone/api/master.py +++ b/tailbone/api/master.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,28 +24,29 @@ Tailbone Web API - Master View """ -from __future__ import unicode_literals, absolute_import - import json -import six -from rattail.config import parse_bool +from rattail.db.util import get_fieldnames -from tailbone.api import APIView, api +from cornice import resource, Service + +from tailbone.api import APIView from tailbone.db import Session - - -class SortColumn(object): - - def __init__(self, field_name, model_name=None): - self.field_name = field_name - self.model_name = model_name +from tailbone.util import SortColumn class APIMasterView(APIView): """ Base class for data model REST API views. """ + listable = True + creatable = True + viewable = True + editable = True + deletable = True + supports_autocomplete = False + supports_download = False + supports_rawbytes = False @property def Session(self): @@ -120,6 +121,34 @@ class APIMasterView(APIView): return cls.collection_key return '{}s'.format(cls.get_object_key()) + @classmethod + def establish_method(cls, method_name): + """ + Establish the given HTTP method for this Cornice Resource. + + Cornice will auto-register any class methods for a resource, if they + are named according to what it expects (i.e. 'get', 'collection_get' + etc.). Tailbone API tries to make things automagical for the sake of + e.g. Poser logic, but in this case if we predefine all of these methods + and then some subclass view wants to *not* allow one, it's not clear + how to "undefine" it per se. Or at least, the more straightforward + thing (I think) is to not define such a method in the first place, if + it was not wanted. + + Enter ``establish_method()``, which is what finally "defines" each + resource method according to what the subclass has declared via its + various attributes (:attr:`creatable`, :attr:`deletable` etc.). + + Note that you will not likely have any need to use this + ``establish_method()`` yourself! But we describe its purpose here, for + clarity. + """ + def method(self): + internal_method = getattr(self, '_{}'.format(method_name)) + return internal_method() + + setattr(cls, method_name, method) + def make_filter_spec(self): if not self.request.GET.has_key('filters'): return [] @@ -155,7 +184,7 @@ class APIMasterView(APIView): if sortcol: spec = { 'field': sortcol.field_name, - 'direction': 'asc' if parse_bool(self.request.params['ascending']) else 'desc', + 'direction': 'asc' if self.config.parse_bool(self.request.params['ascending']) else 'desc', } if sortcol.model_name: spec['model'] = sortcol.model_name @@ -177,17 +206,14 @@ class APIMasterView(APIView): """ return self.sortcol(order_by) - def sortcol(self, *args): + def sortcol(self, field_name, model_name=None): """ Return a simple ``SortColumn`` object which denotes the field and optionally, the model, to be used when sorting. """ - if len(args) == 1: - return SortColumn(args[0]) - elif len(args) == 2: - return SortColumn(args[1], args[0]) - else: - raise ValueError("must pass 1 arg (field_name) or 2 args (model_name, field_name)") + if not model_name: + model_name = self.model_class.__name__ + return SortColumn(field_name, model_name) def join_for_sort_spec(self, query, sort_spec): """ @@ -234,8 +260,23 @@ class APIMasterView(APIView): query = self.Session.query(cls) return query + def get_fieldnames(self): + if not hasattr(self, '_fieldnames'): + self._fieldnames = get_fieldnames( + self.rattail_config, self.model_class, + columns=True, proxies=True, relations=False) + return self._fieldnames + + def normalize(self, obj): + data = {'_str': str(obj)} + + for field in self.get_fieldnames(): + data[field] = getattr(obj, field) + + return data + def _collection_get(self): - from sqlalchemy_filters import apply_filters, apply_sort, apply_pagination + from sa_filters import apply_filters, apply_sort, apply_pagination query = self.base_query() context = {} @@ -291,7 +332,7 @@ class APIMasterView(APIView): if not uuid: uuid = self.request.matchdict['uuid'] - obj = self.Session.query(self.get_model_class()).get(uuid) + obj = self.Session.get(self.get_model_class(), uuid) if obj: return obj @@ -313,9 +354,13 @@ class APIMasterView(APIView): data = self.request.json_body # add instance to session, and return data for it - obj = self.create_object(data) - self.Session.flush() - return self._get(obj) + try: + obj = self.create_object(data) + except Exception as error: + return self.json_response({'error': str(error)}) + else: + self.Session.flush() + return self._get(obj) def create_object(self, data): """ @@ -342,7 +387,7 @@ class APIMasterView(APIView): """ if not uuid: uuid = self.request.matchdict['uuid'] - obj = self.Session.query(self.get_model_class()).get(uuid) + obj = self.Session.get(self.get_model_class(), uuid) if not obj: raise self.notfound() @@ -374,6 +419,70 @@ class APIMasterView(APIView): # that's all we can do here, subclass must override if more needed return obj + ############################## + # delete + ############################## + + def _delete(self): + """ + View to handle DELETE action for an existing record/object. + """ + obj = self.get_object() + self.delete_object(obj) + + def delete_object(self, obj): + """ + Delete the object, or mark it as deleted, or whatever you need to do. + """ + # flush immediately to force any pending integrity errors etc. + self.Session.delete(obj) + self.Session.flush() + + ############################## + # download + ############################## + + def download(self): + """ + GET view allowing for download of a single file, which is attached to a + given record. + """ + obj = self.get_object() + + filename = self.request.GET.get('filename', None) + if not filename: + raise self.notfound() + path = self.download_path(obj, filename) + + response = self.file_response(path) + return response + + def download_path(self, obj, filename): + """ + Should return absolute path on disk, for the given object and filename. + Result will be used to return a file response to client. + """ + raise NotImplementedError + + def rawbytes(self): + """ + GET view allowing for direct access to the raw bytes of a file, which + is attached to a given record. Basically the same as 'download' except + this does not come as an attachment. + """ + obj = self.get_object() + + # TODO: is this really needed? + # filename = self.request.GET.get('filename', None) + # if filename: + # path = self.download_path(obj, filename) + # return self.file_response(path, attachment=False) + + return self.rawbytes_response(obj) + + def rawbytes_response(self, obj): + raise NotImplementedError + ############################## # autocomplete ############################## @@ -429,3 +538,81 @@ class APIMasterView(APIView): autocomplete query. """ return term + + @classmethod + def defaults(cls, config): + cls._defaults(config) + + @classmethod + def _defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + object_url_prefix = cls.get_object_url_prefix() + + # first, the primary resource API + + # list/search + if cls.listable: + cls.establish_method('collection_get') + resource.add_view(cls.collection_get, permission='{}.list'.format(permission_prefix)) + + # create + if cls.creatable: + cls.establish_method('collection_post') + if hasattr(cls, 'permission_to_create'): + permission = cls.permission_to_create + else: + permission = '{}.create'.format(permission_prefix) + resource.add_view(cls.collection_post, permission=permission) + + # view + if cls.viewable: + cls.establish_method('get') + resource.add_view(cls.get, permission='{}.view'.format(permission_prefix)) + + # edit + if cls.editable: + cls.establish_method('post') + resource.add_view(cls.post, permission='{}.edit'.format(permission_prefix)) + + # delete + if cls.deletable: + cls.establish_method('delete') + resource.add_view(cls.delete, permission='{}.delete'.format(permission_prefix)) + + # register primary resource API via cornice + object_resource = resource.add_resource( + cls, + collection_path=collection_url_prefix, + # TODO: probably should allow for other (composite?) key fields + path='{}/{{uuid}}'.format(object_url_prefix)) + config.add_cornice_resource(object_resource) + + # now for some more "custom" things, which are still somewhat generic + + # autocomplete + if cls.supports_autocomplete: + autocomplete = Service(name='{}.autocomplete'.format(route_prefix), + path='{}/autocomplete'.format(collection_url_prefix)) + autocomplete.add_view('GET', 'autocomplete', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(autocomplete) + + # download + if cls.supports_download: + download = Service(name='{}.download'.format(route_prefix), + # TODO: probably should allow for other (composite?) key fields + path='{}/{{uuid}}/download'.format(object_url_prefix)) + download.add_view('GET', 'download', klass=cls, + permission='{}.download'.format(permission_prefix)) + config.add_cornice_service(download) + + # rawbytes + if cls.supports_rawbytes: + rawbytes = Service(name='{}.rawbytes'.format(route_prefix), + # TODO: probably should allow for other (composite?) key fields + path='{}/{{uuid}}/rawbytes'.format(object_url_prefix)) + rawbytes.add_view('GET', 'rawbytes', klass=cls, + permission='{}.download'.format(permission_prefix)) + config.add_cornice_service(rawbytes) diff --git a/tailbone/api/master2.py b/tailbone/api/master2.py index 7f62489e..4a5abb3e 100644 --- a/tailbone/api/master2.py +++ b/tailbone/api/master2.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2022 Lance Edgar # # This file is part of Rattail. # @@ -26,8 +26,7 @@ Tailbone Web API - Master View (v2) from __future__ import unicode_literals, absolute_import -from pyramid.response import FileResponse -from cornice import resource, Service +import warnings from tailbone.api import APIMasterView @@ -36,174 +35,9 @@ class APIMasterView2(APIMasterView): """ Base class for data model REST API views. """ - listable = True - creatable = True - viewable = True - editable = True - deletable = True - supports_autocomplete = False - supports_download = False - supports_rawbytes = False - @classmethod - def establish_method(cls, method_name): - """ - Establish the given HTTP method for this Cornice Resource. - - Cornice will auto-register any class methods for a resource, if they - are named according to what it expects (i.e. 'get', 'collection_get' - etc.). Tailbone API tries to make things automagical for the sake of - e.g. Poser logic, but in this case if we predefine all of these methods - and then some subclass view wants to *not* allow one, it's not clear - how to "undefine" it per se. Or at least, the more straightforward - thing (I think) is to not define such a method in the first place, if - it was not wanted. - - Enter ``establish_method()``, which is what finally "defines" each - resource method according to what the subclass has declared via its - various attributes (:attr:`creatable`, :attr:`deletable` etc.). - - Note that you will not likely have any need to use this - ``establish_method()`` yourself! But we describe its purpose here, for - clarity. - """ - def method(self): - internal_method = getattr(self, '_{}'.format(method_name)) - return internal_method() - - setattr(cls, method_name, method) - - def _delete(self): - """ - View to handle DELETE action for an existing record/object. - """ - obj = self.get_object() - self.delete_object(obj) - - def delete_object(self, obj): - """ - Delete the object, or mark it as deleted, or whatever you need to do. - """ - # flush immediately to force any pending integrity errors etc. - self.Session.delete(obj) - self.Session.flush() - - ############################## - # download - ############################## - - def download(self): - """ - GET view allowing for download of a single file, which is attached to a - given record. - """ - obj = self.get_object() - - filename = self.request.GET.get('filename', None) - if not filename: - raise self.notfound() - path = self.download_path(obj, filename) - - response = self.file_response(path) - return response - - def download_path(self, obj, filename): - """ - Should return absolute path on disk, for the given object and filename. - Result will be used to return a file response to client. - """ - raise NotImplementedError - - def rawbytes(self): - """ - GET view allowing for direct access to the raw bytes of a file, which - is attached to a given record. Basically the same as 'download' except - this does not come as an attachment. - """ - obj = self.get_object() - - filename = self.request.GET.get('filename', None) - if not filename: - raise self.notfound() - path = self.download_path(obj, filename) - - response = self.file_response(path, attachment=False) - return response - - @classmethod - def defaults(cls, config): - cls._defaults(config) - - @classmethod - def _defaults(cls, config): - route_prefix = cls.get_route_prefix() - permission_prefix = cls.get_permission_prefix() - collection_url_prefix = cls.get_collection_url_prefix() - object_url_prefix = cls.get_object_url_prefix() - - # first, the primary resource API - - # list/search - if cls.listable: - cls.establish_method('collection_get') - resource.add_view(cls.collection_get, permission='{}.list'.format(permission_prefix)) - - # create - if cls.creatable: - cls.establish_method('collection_post') - if hasattr(cls, 'permission_to_create'): - permission = cls.permission_to_create - else: - permission = '{}.create'.format(permission_prefix) - resource.add_view(cls.collection_post, permission=permission) - - # view - if cls.viewable: - cls.establish_method('get') - resource.add_view(cls.get, permission='{}.view'.format(permission_prefix)) - - # edit - if cls.editable: - cls.establish_method('post') - resource.add_view(cls.post, permission='{}.edit'.format(permission_prefix)) - - # delete - if cls.deletable: - cls.establish_method('delete') - resource.add_view(cls.delete, permission='{}.delete'.format(permission_prefix)) - - # register primary resource API via cornice - object_resource = resource.add_resource( - cls, - collection_path=collection_url_prefix, - # TODO: probably should allow for other (composite?) key fields - path='{}/{{uuid}}'.format(object_url_prefix)) - config.add_cornice_resource(object_resource) - - # now for some more "custom" things, which are still somewhat generic - - # autocomplete - if cls.supports_autocomplete: - autocomplete = Service(name='{}.autocomplete'.format(route_prefix), - path='{}/autocomplete'.format(collection_url_prefix)) - autocomplete.add_view('GET', 'autocomplete', klass=cls, - permission='{}.list'.format(permission_prefix)) - config.add_cornice_service(autocomplete) - - # download - if cls.supports_download: - download = Service(name='{}.download'.format(route_prefix), - # TODO: probably should allow for other (composite?) key fields - path='{}/{{uuid}}/download'.format(object_url_prefix)) - download.add_view('GET', 'download', klass=cls, - permission='{}.download'.format(permission_prefix)) - config.add_cornice_service(download) - - # rawbytes - if cls.supports_rawbytes: - rawbytes = Service(name='{}.rawbytes'.format(route_prefix), - # TODO: probably should allow for other (composite?) key fields - path='{}/{{uuid}}/rawbytes'.format(object_url_prefix)) - rawbytes.add_view('GET', 'rawbytes', klass=cls, - permission='{}.download'.format(permission_prefix)) - config.add_cornice_service(rawbytes) + def __init__(self, request, context=None): + warnings.warn("APIMasterView2 class is deprecated; please use " + "APIMasterView instead", + DeprecationWarning, stacklevel=2) + super(APIMasterView2, self).__init__(request, context=context) diff --git a/tailbone/api/people.py b/tailbone/api/people.py index bb8dd883..f7c08dfa 100644 --- a/tailbone/api/people.py +++ b/tailbone/api/people.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,13 +24,9 @@ Tailbone Web API - Person Views """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model -from tailbone.api import APIMasterView2 as APIMasterView +from tailbone.api import APIMasterView class PersonView(APIMasterView): @@ -45,12 +41,19 @@ class PersonView(APIMasterView): def normalize(self, person): return { 'uuid': person.uuid, - '_str': six.text_type(person), + '_str': str(person), 'first_name': person.first_name, 'last_name': person.last_name, 'display_name': person.display_name, } -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + PersonView = kwargs.get('PersonView', base['PersonView']) PersonView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/products.py b/tailbone/api/products.py index d7aeabcd..3f29ff54 100644 --- a/tailbone/api/products.py +++ b/tailbone/api/products.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,15 +24,19 @@ Tailbone Web API - Product Views """ -from __future__ import unicode_literals, absolute_import +import logging -import six import sqlalchemy as sa from sqlalchemy import orm +from cornice import Service + from rattail.db import model -from tailbone.api import APIMasterView2 as APIMasterView +from tailbone.api import APIMasterView + + +log = logging.getLogger(__name__) class ProductView(APIMasterView): @@ -44,20 +48,49 @@ class ProductView(APIMasterView): object_url_prefix = '/product' supports_autocomplete = True + def __init__(self, request, context=None): + super(ProductView, self).__init__(request, context=context) + app = self.get_rattail_app() + self.products_handler = app.get_products_handler() + def normalize(self, product): + + # get what we can from handler + data = self.products_handler.normalize_product(product, fields=[ + 'brand_name', + 'full_description', + 'department_name', + 'unit_price_display', + 'sale_price', + 'sale_price_display', + 'sale_ends', + 'sale_ends_display', + 'tpr_price', + 'tpr_price_display', + 'tpr_ends', + 'tpr_ends_display', + 'current_price', + 'current_price_display', + 'current_ends', + 'current_ends_display', + 'vendor_name', + 'costs', + 'image_url', + ]) + + # but must supplement cost = product.cost - return { - 'uuid': product.uuid, - '_str': six.text_type(product), - 'upc': six.text_type(product.upc), + data.update({ + 'upc': str(product.upc), 'scancode': product.scancode, 'item_id': product.item_id, 'item_type': product.item_type, - 'description': product.description, 'status_code': product.status_code, 'default_unit_cost': cost.unit_cost if cost else None, 'default_unit_cost_display': "${:0.2f}".format(cost.unit_cost) if cost and cost.unit_cost is not None else None, - } + }) + + return data def make_autocomplete_query(self, term): query = self.Session.query(model.Product)\ @@ -77,6 +110,111 @@ class ProductView(APIMasterView): def autocomplete_display(self, product): return product.full_description + def quick_lookup(self): + """ + View for handling "quick lookup" user input, for index page. + """ + data = self.request.GET + entry = data['entry'] + + product = self.products_handler.locate_product_for_entry(self.Session(), + entry) + if not product: + return {'error': "Product not found"} + + return {'ok': True, + 'product': self.normalize(product)} + + def label_profiles(self): + """ + Returns the set of label profiles available for use with + printing label for product. + """ + app = self.get_rattail_app() + label_handler = app.get_label_handler() + model = self.model + + profiles = [] + for profile in label_handler.get_label_profiles(self.Session()): + profiles.append({ + 'uuid': profile.uuid, + 'description': profile.description, + }) + + return {'label_profiles': profiles} + + def print_labels(self): + app = self.get_rattail_app() + label_handler = app.get_label_handler() + model = self.model + data = self.request.json_body + + uuid = data.get('label_profile_uuid') + profile = self.Session.get(model.LabelProfile, uuid) if uuid else None + if not profile: + return {'error': "Label profile not found"} + + uuid = data.get('product_uuid') + product = self.Session.get(model.Product, uuid) if uuid else None + if not product: + return {'error': "Product not found"} + + try: + quantity = int(data.get('quantity')) + except: + return {'error': "Quantity must be integer"} + + printer = label_handler.get_printer(profile) + if not printer: + return {'error': "Couldn't get printer from label profile"} + + try: + printer.print_labels([({'product': product}, quantity)]) + except Exception as error: + log.warning("error occurred while printing labels", exc_info=True) + return {'error': str(error)} + + return {'ok': True} + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._product_defaults(config) + + @classmethod + def _product_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + + # quick lookup + quick_lookup = Service(name='{}.quick_lookup'.format(route_prefix), + path='{}/quick-lookup'.format(collection_url_prefix)) + quick_lookup.add_view('GET', 'quick_lookup', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(quick_lookup) + + # label profiles + label_profiles = Service(name=f'{route_prefix}.label_profiles', + path=f'{collection_url_prefix}/label-profiles') + label_profiles.add_view('GET', 'label_profiles', klass=cls, + permission=f'{permission_prefix}.print_labels') + config.add_cornice_service(label_profiles) + + # print labels + print_labels = Service(name='{}.print_labels'.format(route_prefix), + path='{}/print-labels'.format(collection_url_prefix)) + print_labels.add_view('POST', 'print_labels', klass=cls, + permission='{}.print_labels'.format(permission_prefix)) + config.add_cornice_service(print_labels) + + +def defaults(config, **kwargs): + base = globals() + + ProductView = kwargs.get('ProductView', base['ProductView']) + ProductView.defaults(config) + def includeme(config): - ProductView.defaults(config) + defaults(config) diff --git a/tailbone/api/upgrades.py b/tailbone/api/upgrades.py index 85e4a91e..467c8a0d 100644 --- a/tailbone/api/upgrades.py +++ b/tailbone/api/upgrades.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,13 +24,9 @@ Tailbone Web API - Upgrade Views """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model -from tailbone.api import APIMasterView2 as APIMasterView +from tailbone.api import APIMasterView class UpgradeView(APIMasterView): @@ -53,9 +49,16 @@ class UpgradeView(APIMasterView): data['status_code'] = None else: data['status_code'] = self.enum.UPGRADE_STATUS.get(upgrade.status_code, - six.text_type(upgrade.status_code)) + str(upgrade.status_code)) return data -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + UpgradeView = kwargs.get('UpgradeView', base['UpgradeView']) UpgradeView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/users.py b/tailbone/api/users.py index 8474fd97..a6bcad57 100644 --- a/tailbone/api/users.py +++ b/tailbone/api/users.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,13 +24,9 @@ Tailbone Web API - User Views """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model -from tailbone.api import APIMasterView2 as APIMasterView +from tailbone.api import APIMasterView class UserView(APIMasterView): @@ -59,6 +55,17 @@ class UserView(APIMasterView): query = query.outerjoin(model.Person) return query + def update_object(self, user, data): + # TODO: should ensure prevent_password_change is respected + return super(UserView, self).update_object(user, data) + + +def defaults(config, **kwargs): + base = globals() + + UserView = kwargs.get('UserView', base['UserView']) + UserView.defaults(config) + def includeme(config): - UserView.defaults(config) + defaults(config) diff --git a/tailbone/api/vendors.py b/tailbone/api/vendors.py index ce885e07..64311b1b 100644 --- a/tailbone/api/vendors.py +++ b/tailbone/api/vendors.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,13 +24,9 @@ Tailbone Web API - Vendor Views """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model -from tailbone.api import APIMasterView2 as APIMasterView +from tailbone.api import APIMasterView class VendorView(APIMasterView): @@ -44,11 +40,18 @@ class VendorView(APIMasterView): def normalize(self, vendor): return { 'uuid': vendor.uuid, - '_str': six.text_type(vendor), + '_str': str(vendor), 'id': vendor.id, 'name': vendor.name, } -def includeme(config): +def defaults(config, **kwargs): + base = globals() + + VendorView = kwargs.get('VendorView', base['VendorView']) VendorView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/workorders.py b/tailbone/api/workorders.py new file mode 100644 index 00000000..19def6c4 --- /dev/null +++ b/tailbone/api/workorders.py @@ -0,0 +1,234 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Work Order Views +""" + +import datetime + +from rattail.db.model import WorkOrder + +from cornice import Service + +from tailbone.api import APIMasterView + + +class WorkOrderView(APIMasterView): + + model_class = WorkOrder + collection_url_prefix = '/workorders' + object_url_prefix = '/workorder' + + def __init__(self, *args, **kwargs): + super().__init__(*args, **kwargs) + app = self.get_rattail_app() + self.workorder_handler = app.get_workorder_handler() + + def normalize(self, workorder): + data = super().normalize(workorder) + data.update({ + 'customer_name': workorder.customer.name, + 'status_label': self.enum.WORKORDER_STATUS[workorder.status_code], + 'date_submitted': str(workorder.date_submitted or ''), + 'date_received': str(workorder.date_received or ''), + 'date_released': str(workorder.date_released or ''), + 'date_delivered': str(workorder.date_delivered or ''), + }) + return data + + def create_object(self, data): + + # invoke the handler instead of normal API CRUD logic + workorder = self.workorder_handler.make_workorder(self.Session(), **data) + return workorder + + def update_object(self, workorder, data): + date_fields = [ + 'date_submitted', + 'date_received', + 'date_released', + 'date_delivered', + ] + + # coerce date field values to proper datetime.date objects + for field in date_fields: + if field in data: + if data[field] == '': + data[field] = None + elif not isinstance(data[field], datetime.date): + date = datetime.datetime.strptime(data[field], '%Y-%m-%d').date() + data[field] = date + + # coerce status code value to proper integer + if 'status_code' in data: + data['status_code'] = int(data['status_code']) + + return super().update_object(workorder, data) + + def status_codes(self): + """ + Retrieve all info about possible work order status codes. + """ + return self.workorder_handler.status_codes() + + def receive(self): + """ + Sets work order status to "received". + """ + workorder = self.get_object() + self.workorder_handler.receive(workorder) + self.Session.flush() + return self.normalize(workorder) + + def await_estimate(self): + """ + Sets work order status to "awaiting estimate confirmation". + """ + workorder = self.get_object() + self.workorder_handler.await_estimate(workorder) + self.Session.flush() + return self.normalize(workorder) + + def await_parts(self): + """ + Sets work order status to "awaiting parts". + """ + workorder = self.get_object() + self.workorder_handler.await_parts(workorder) + self.Session.flush() + return self.normalize(workorder) + + def work_on_it(self): + """ + Sets work order status to "working on it". + """ + workorder = self.get_object() + self.workorder_handler.work_on_it(workorder) + self.Session.flush() + return self.normalize(workorder) + + def release(self): + """ + Sets work order status to "released". + """ + workorder = self.get_object() + self.workorder_handler.release(workorder) + self.Session.flush() + return self.normalize(workorder) + + def deliver(self): + """ + Sets work order status to "delivered". + """ + workorder = self.get_object() + self.workorder_handler.deliver(workorder) + self.Session.flush() + return self.normalize(workorder) + + def cancel(self): + """ + Sets work order status to "canceled". + """ + workorder = self.get_object() + self.workorder_handler.cancel(workorder) + self.Session.flush() + return self.normalize(workorder) + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._workorder_defaults(config) + + @classmethod + def _workorder_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + object_url_prefix = cls.get_object_url_prefix() + + # status codes + status_codes = Service(name='{}.status_codes'.format(route_prefix), + path='{}/status-codes'.format(collection_url_prefix)) + status_codes.add_view('GET', 'status_codes', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(status_codes) + + # receive + receive = Service(name='{}.receive'.format(route_prefix), + path='{}/{{uuid}}/receive'.format(object_url_prefix)) + receive.add_view('POST', 'receive', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(receive) + + # await estimate confirmation + await_estimate = Service(name='{}.await_estimate'.format(route_prefix), + path='{}/{{uuid}}/await-estimate'.format(object_url_prefix)) + await_estimate.add_view('POST', 'await_estimate', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(await_estimate) + + # await parts + await_parts = Service(name='{}.await_parts'.format(route_prefix), + path='{}/{{uuid}}/await-parts'.format(object_url_prefix)) + await_parts.add_view('POST', 'await_parts', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(await_parts) + + # work on it + work_on_it = Service(name='{}.work_on_it'.format(route_prefix), + path='{}/{{uuid}}/work-on-it'.format(object_url_prefix)) + work_on_it.add_view('POST', 'work_on_it', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(work_on_it) + + # release + release = Service(name='{}.release'.format(route_prefix), + path='{}/{{uuid}}/release'.format(object_url_prefix)) + release.add_view('POST', 'release', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(release) + + # deliver + deliver = Service(name='{}.deliver'.format(route_prefix), + path='{}/{{uuid}}/deliver'.format(object_url_prefix)) + deliver.add_view('POST', 'deliver', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(deliver) + + # cancel + cancel = Service(name='{}.cancel'.format(route_prefix), + path='{}/{{uuid}}/cancel'.format(object_url_prefix)) + cancel.add_view('POST', 'cancel', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(cancel) + + +def defaults(config, **kwargs): + base = globals() + + WorkOrderView = kwargs.get('WorkOrderView', base['WorkOrderView']) + WorkOrderView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/app.py b/tailbone/app.py index bbb6d295..d2d0c5ef 100644 --- a/tailbone/app.py +++ b/tailbone/app.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,27 +24,23 @@ Application Entry Point """ -from __future__ import unicode_literals, absolute_import - import os -import warnings -import six -import sqlalchemy as sa from sqlalchemy.orm import sessionmaker, scoped_session -from rattail.config import make_config, parse_list +from wuttjamaican.util import parse_list + +from rattail.config import make_config from rattail.exceptions import ConfigurationError -from rattail.db.types import GPCType from pyramid.config import Configurator -from pyramid.authentication import SessionAuthenticationPolicy from zope.sqlalchemy import register import tailbone.db -from tailbone.auth import TailboneAuthorizationPolicy +from tailbone.auth import TailboneSecurityPolicy from tailbone.config import csrf_token_name, csrf_header_name from tailbone.util import get_effective_theme, get_theme_template_path +from tailbone.providers import get_all_providers def make_rattail_config(settings): @@ -62,16 +58,33 @@ def make_rattail_config(settings): "to the path of your config file. Lame, but necessary.") rattail_config = make_config(path) settings['rattail_config'] = rattail_config - rattail_config.configure_logging() + + # nb. this is for compaibility with wuttaweb + settings['wutta_config'] = rattail_config + + # must import all sqlalchemy models before things get rolling, + # otherwise can have errors about continuum TransactionMeta class + # not yet mapped, when relevant pages are first requested... + # cf. https://docs.pylonsproject.org/projects/pyramid_cookbook/en/latest/database/sqlalchemy.html#importing-all-sqlalchemy-models + # hat tip to https://stackoverflow.com/a/59241485 + if getattr(rattail_config, 'tempmon_engine', None): + from rattail_tempmon.db import model as tempmon_model, Session as TempmonSession + tempmon_session = TempmonSession() + tempmon_session.query(tempmon_model.Appliance).first() + tempmon_session.close() # configure database sessions - if hasattr(rattail_config, 'rattail_engine'): - tailbone.db.Session.configure(bind=rattail_config.rattail_engine) + if hasattr(rattail_config, 'appdb_engine'): + tailbone.db.Session.configure(bind=rattail_config.appdb_engine) if hasattr(rattail_config, 'trainwreck_engine'): tailbone.db.TrainwreckSession.configure(bind=rattail_config.trainwreck_engine) if hasattr(rattail_config, 'tempmon_engine'): tailbone.db.TempmonSession.configure(bind=rattail_config.tempmon_engine) + # maybe set "future" behavior for SQLAlchemy + if rattail_config.getbool('rattail.db', 'sqlalchemy_future_mode', usedb=False): + tailbone.db.Session.configure(future=True) + # create session wrappers for each "extra" Trainwreck engine for key, engine in rattail_config.trainwreck_engines.items(): if key != 'default': @@ -115,24 +128,31 @@ def make_pyramid_config(settings, configure_csrf=True): """ Make a Pyramid config object from the given settings. """ + rattail_config = settings['rattail_config'] + config = settings.pop('pyramid_config', None) if config: config.set_root_factory(Root) else: + # declare this web app of the "classic" variety + settings.setdefault('tailbone.classic', 'true') + # we want the new themes feature! establish_theme(settings) + settings.setdefault('fanstatic.versioning', 'true') settings.setdefault('pyramid_deform.template_search_path', 'tailbone:templates/deform') config = Configurator(settings=settings, root_factory=Root) + # add rattail config directly to registry, for access throughout the app + config.registry['rattail_config'] = rattail_config + # configure user authorization / authentication - config.set_authorization_policy(TailboneAuthorizationPolicy()) - config.set_authentication_policy(SessionAuthenticationPolicy()) + config.set_security_policy(TailboneSecurityPolicy()) # maybe require CSRF token protection if configure_csrf: - rattail_config = settings['rattail_config'] config.set_default_csrf_options(require_csrf=True, token=csrf_token_name(rattail_config), header=csrf_header_name(rattail_config)) @@ -140,9 +160,20 @@ def make_pyramid_config(settings, configure_csrf=True): # Bring in some Pyramid goodies. config.include('tailbone.beaker') config.include('pyramid_deform') + config.include('pyramid_fanstatic') config.include('pyramid_mako') config.include('pyramid_tm') + # TODO: this may be a good idea some day, if wanting to leverage + # deform resources for component JS? cf. also base.mako template + # # override default script mapping for deform + # from deform import Field + # from deform.widget import ResourceRegistry, default_resources + # registry = ResourceRegistry(use_defaults=False) + # for key in default_resources: + # registry.set_js_resources(key, None, {'js': []}) + # Field.set_default_resource_registry(registry) + # bring in the pyramid_retry logic, if available # TODO: pretty soon we can require this package, hopefully.. try: @@ -152,13 +183,127 @@ def make_pyramid_config(settings, configure_csrf=True): else: config.include('pyramid_retry') - # Add some permissions magic. - config.add_directive('add_tailbone_permission_group', 'tailbone.auth.add_permission_group') - config.add_directive('add_tailbone_permission', 'tailbone.auth.add_permission') + # fetch all tailbone providers + providers = get_all_providers(rattail_config) + for provider in providers.values(): + + # configure DB sessions associated with transaction manager + provider.configure_db_sessions(rattail_config, config) + + # add any static includes + includes = provider.get_static_includes() + if includes: + for spec in includes: + config.include(spec) + + # add some permissions magic + config.add_directive('add_wutta_permission_group', + 'wuttaweb.auth.add_permission_group') + config.add_directive('add_wutta_permission', + 'wuttaweb.auth.add_permission') + # TODO: deprecate / remove these + config.add_directive('add_tailbone_permission_group', + 'wuttaweb.auth.add_permission_group') + config.add_directive('add_tailbone_permission', + 'wuttaweb.auth.add_permission') + + # and some similar magic for certain master views + config.add_directive('add_tailbone_index_page', 'tailbone.app.add_index_page') + config.add_directive('add_tailbone_config_page', 'tailbone.app.add_config_page') + config.add_directive('add_tailbone_model_view', 'tailbone.app.add_model_view') + config.add_directive('add_tailbone_view_supplement', 'tailbone.app.add_view_supplement') + + config.add_directive('add_tailbone_websocket', 'tailbone.app.add_websocket') return config +def add_websocket(config, name, view, attr=None): + """ + Register a websocket entry point for the app. + """ + def action(): + rattail_config = config.registry.settings['rattail_config'] + rattail_app = rattail_config.get_app() + + if isinstance(view, str): + view_callable = rattail_app.load_object(view) + else: + view_callable = view + view_callable = view_callable(config) + if attr: + view_callable = getattr(view_callable, attr) + + # register route + path = '/ws/{}'.format(name) + route_name = 'ws.{}'.format(name) + config.add_route(route_name, path, static=True) + + # register view callable + websockets = config.registry.setdefault('tailbone_websockets', {}) + websockets[path] = view_callable + + config.action('tailbone-add-websocket-{}'.format(name), action, + # nb. since this action adds routes, it must happen + # sooner in the order than it normally would, hence + # we declare that + order=-20) + + +def add_index_page(config, route_name, label, permission): + """ + Register a config page for the app. + """ + def action(): + pages = config.get_settings().get('tailbone_index_pages', []) + pages.append({'label': label, 'route': route_name, + 'permission': permission}) + config.add_settings({'tailbone_index_pages': pages}) + config.action(None, action) + + +def add_config_page(config, route_name, label, permission): + """ + Register a config page for the app. + """ + def action(): + pages = config.get_settings().get('tailbone_config_pages', []) + pages.append({'label': label, 'route': route_name, + 'permission': permission}) + config.add_settings({'tailbone_config_pages': pages}) + config.action(None, action) + + +def add_model_view(config, model_name, label, route_prefix, permission_prefix): + """ + Register a model view for the app. + """ + def action(): + all_views = config.get_settings().get('tailbone_model_views', {}) + + model_views = all_views.setdefault(model_name, []) + model_views.append({ + 'label': label, + 'route_prefix': route_prefix, + 'permission_prefix': permission_prefix, + }) + + config.add_settings({'tailbone_model_views': all_views}) + + config.action(None, action) + + +def add_view_supplement(config, route_prefix, cls): + """ + Register a master view supplement for the app. + """ + def action(): + supplements = config.get_settings().get('tailbone_view_supplements', {}) + supplements.setdefault(route_prefix, []).append(cls) + config.add_settings({'tailbone_view_supplements': supplements}) + config.action(None, action) + + def establish_theme(settings): rattail_config = settings['rattail_config'] @@ -166,7 +311,7 @@ def establish_theme(settings): settings['tailbone.theme'] = theme directories = settings['mako.directories'] - if isinstance(directories, six.string_types): + if isinstance(directories, str): directories = parse_list(directories) path = get_theme_template_path(rattail_config) @@ -187,7 +332,8 @@ def main(global_config, **settings): """ This function returns a Pyramid WSGI application. """ - settings.setdefault('mako.directories', ['tailbone:templates']) + settings.setdefault('mako.directories', ['tailbone:templates', + 'wuttaweb:templates']) rattail_config = make_rattail_config(settings) pyramid_config = make_pyramid_config(settings) pyramid_config.include('tailbone') diff --git a/tailbone/asgi.py b/tailbone/asgi.py new file mode 100644 index 00000000..1afbe12a --- /dev/null +++ b/tailbone/asgi.py @@ -0,0 +1,110 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +ASGI App Utilities +""" + +import os +import configparser +import logging + +from rattail.util import load_object + +from asgiref.wsgi import WsgiToAsgi + + +log = logging.getLogger(__name__) + + +class TailboneWsgiToAsgi(WsgiToAsgi): + """ + Custom WSGI -> ASGI wrapper, to add routing for websockets. + """ + + async def __call__(self, scope, *args, **kwargs): + protocol = scope['type'] + path = scope['path'] + + # strip off the root path, if non-empty. needed for serving + # under /poser or anything other than true site root + root_path = scope['root_path'] + if root_path and path.startswith(root_path): + path = path[len(root_path):] + + if protocol == 'websocket': + websockets = self.wsgi_application.registry.get( + 'tailbone_websockets', {}) + if path in websockets: + await websockets[path](scope, *args, **kwargs) + + try: + await super().__call__(scope, *args, **kwargs) + except ValueError as e: + # The developer may wish to improve handling of this exception. + # See https://github.com/Pylons/pyramid_cookbook/issues/225 and + # https://asgi.readthedocs.io/en/latest/specs/www.html#websocket + pass + except Exception as e: + raise e + + +def make_asgi_app(main_app=None): + """ + This function returns an ASGI application. + """ + path = os.environ.get('TAILBONE_ASGI_CONFIG') + if not path: + raise RuntimeError("You must define TAILBONE_ASGI_CONFIG env variable.") + + # make a config parser good enough to load pyramid settings + configdir = os.path.dirname(path) + parser = configparser.ConfigParser(defaults={'__file__': path, + 'here': configdir}) + + # read the config file + parser.read(path) + + # parse the settings needed for pyramid app + settings = dict(parser.items('app:main')) + + if isinstance(main_app, str): + make_wsgi_app = load_object(main_app) + elif callable(main_app): + make_wsgi_app = main_app + else: + if main_app: + log.warning("specified main app of unknown type: %s", main_app) + make_wsgi_app = load_object('tailbone.app:main') + + # construct a pyramid app "per usual" + app = make_wsgi_app({}, **settings) + + # then wrap it with ASGI + return TailboneWsgiToAsgi(app) + + +def asgi_main(): + """ + This function returns an ASGI application. + """ + return make_asgi_app() diff --git a/tailbone/auth.py b/tailbone/auth.py index 88fbab0b..95bf90ba 100644 --- a/tailbone/auth.py +++ b/tailbone/auth.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,32 +24,31 @@ Authentication & Authorization """ -from __future__ import unicode_literals, absolute_import - import logging +import re -from rattail import enum -from rattail.util import prettify, NOTSET +from wuttjamaican.util import UNSPECIFIED -from zope.interface import implementer -from pyramid.interfaces import IAuthorizationPolicy -from pyramid.security import remember, forget, Everyone, Authenticated +from pyramid.security import remember, forget +from wuttaweb.auth import WuttaSecurityPolicy from tailbone.db import Session log = logging.getLogger(__name__) -def login_user(request, user, timeout=NOTSET): +def login_user(request, user, timeout=UNSPECIFIED): """ Perform the steps necessary to login the given user. Note that this returns a ``headers`` dict which you should pass to the redirect. """ - user.record_event(enum.USER_EVENT_LOGIN) + config = request.rattail_config + app = config.get_app() + user.record_event(app.enum.USER_EVENT_LOGIN) headers = remember(request, user.uuid) - if timeout is NOTSET: - timeout = session_timeout_for_user(user) + if timeout is UNSPECIFIED: + timeout = session_timeout_for_user(config, user) log.debug("setting session timeout for '{}' to {}".format(user.username, timeout)) set_session_timeout(request, timeout) return headers @@ -60,24 +59,28 @@ def logout_user(request): Perform the logout action for the given request. Note that this returns a ``headers`` dict which you should pass to the redirect. """ + app = request.rattail_config.get_app() user = request.user if user: - user.record_event(enum.USER_EVENT_LOGOUT) + user.record_event(app.enum.USER_EVENT_LOGOUT) request.session.delete() request.session.invalidate() headers = forget(request) return headers -def session_timeout_for_user(user): +def session_timeout_for_user(config, user): """ Returns the "max" session timeout for the user, according to roles """ - from rattail.db.auth import authenticated_role + app = config.get_app() + auth = app.get_auth_handler() - roles = user.roles + [authenticated_role(Session())] + authenticated = auth.get_role_authenticated(Session()) + roles = user.roles + [authenticated] timeouts = [role.session_timeout for role in roles if role.session_timeout is not None] + if timeouts and 0 not in timeouts: return max(timeouts) @@ -89,58 +92,42 @@ def set_session_timeout(request, timeout): request.session['_timeout'] = timeout or None -@implementer(IAuthorizationPolicy) -class TailboneAuthorizationPolicy(object): +class TailboneSecurityPolicy(WuttaSecurityPolicy): - def permits(self, context, principals, permission): - config = context.request.rattail_config - model = config.get_model() + def __init__(self, db_session=None, api_mode=False, **kwargs): + kwargs['db_session'] = db_session or Session() + super().__init__(**kwargs) + self.api_mode = api_mode + + def load_identity(self, request): + config = request.registry.settings.get('rattail_config') app = config.get_app() - auth = app.get_auth_handler() + user = None - for userid in principals: - if userid not in (Everyone, Authenticated): - if context.request.user and context.request.user.uuid == userid: - return context.request.has_perm(permission) - else: - # this is pretty rare, but can happen in dev after - # re-creating the database, which means new user uuids. - # TODO: the odds of this query returning a user in that - # case, are probably nil, and we should just skip this bit? - user = Session.query(model.User).get(userid) - if user: - if auth.has_permission(Session(), user, permission): - return True - if Everyone in principals: - return auth.has_permission(Session(), None, permission) - return False + if self.api_mode: - def principals_allowed_by_permission(self, context, permission): - raise NotImplementedError + # determine/load user from header token if present + credentials = request.headers.get('Authorization') + if credentials: + match = re.match(r'^Bearer (\S+)$', credentials) + if match: + token = match.group(1) + auth = app.get_auth_handler() + user = auth.authenticate_user_token(self.db_session, token) + if not user: -def add_permission_group(config, key, label=None, overwrite=True): - """ - Add a permission group to the app configuration. - """ - def action(): - perms = config.get_settings().get('tailbone_permissions', {}) - if key not in perms or overwrite: - group = perms.setdefault(key, {'key': key}) - group['label'] = label or prettify(key) - config.add_settings({'tailbone_permissions': perms}) - config.action(None, action) + # fetch user uuid from current session + uuid = self.session_helper.authenticated_userid(request) + if not uuid: + return + # fetch user object from db + model = app.model + user = self.db_session.get(model.User, uuid) + if not user: + return -def add_permission(config, groupkey, key, label=None): - """ - Add a permission to the app configuration. - """ - def action(): - perms = config.get_settings().get('tailbone_permissions', {}) - group = perms.setdefault(groupkey, {'key': groupkey}) - group.setdefault('label', prettify(groupkey)) - perm = group.setdefault('perms', {}).setdefault(key, {'key': key}) - perm['label'] = label or prettify(key) - config.add_settings({'tailbone_permissions': perms}) - config.action(None, action) + # this user is responsible for data changes in current request + self.db_session.set_continuum_user(user) + return user diff --git a/tailbone/beaker.py b/tailbone/beaker.py index 1f7f20c5..25a450df 100644 --- a/tailbone/beaker.py +++ b/tailbone/beaker.py @@ -1,8 +1,8 @@ -# -*- coding: utf-8 -*- +# -*- coding: utf-8; -*- ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -27,10 +27,12 @@ Note that most of the code for this module was copied from the beaker and pyramid_beaker projects. """ -from __future__ import unicode_literals, absolute_import - import time +from pkg_resources import parse_version +from rattail.util import get_pkg_version + +import beaker from beaker.session import Session from beaker.util import coerce_session_params from pyramid.settings import asbool @@ -45,6 +47,10 @@ class TailboneSession(Session): def load(self): "Loads the data from this session from persistent storage" + + # are we using older version of beaker? + old_beaker = parse_version(get_pkg_version('beaker')) < parse_version('1.12') + self.namespace = self.namespace_class(self.id, data_dir=self.data_dir, digest_filenames=False, @@ -60,8 +66,12 @@ class TailboneSession(Session): try: session_data = self.namespace['session'] - if (session_data is not None and self.encrypt_key): - session_data = self._decrypt_data(session_data) + if old_beaker: + if (session_data is not None and self.encrypt_key): + session_data = self._decrypt_data(session_data) + else: # beaker >= 1.12 + if session_data is not None: + session_data = self._decrypt_data(session_data) # Memcached always returns a key, its None when its not # present @@ -90,6 +100,7 @@ class TailboneSession(Session): # for this module entirely... timeout = session_data.get('_timeout', self.timeout) if timeout is not None and \ + '_accessed_time' in session_data and \ now - session_data['_accessed_time'] > timeout: timed_out = True else: @@ -103,9 +114,6 @@ class TailboneSession(Session): # Update the current _accessed_time session_data['_accessed_time'] = now - # Set the path if applicable - if '_path' in session_data: - self._path = session_data['_path'] self.update(session_data) self.accessed_dict = session_data.copy() finally: diff --git a/tailbone/cleanup.py b/tailbone/cleanup.py new file mode 100644 index 00000000..0ed5d026 --- /dev/null +++ b/tailbone/cleanup.py @@ -0,0 +1,80 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2022 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Cleanup logic +""" + +from __future__ import unicode_literals, absolute_import + +import os +import logging +import time + +from rattail.cleanup import Cleaner + + +log = logging.getLogger(__name__) + + +class BeakerCleaner(Cleaner): + """ + Cleanup logic for old Beaker session files. + """ + + def get_session_dir(self): + session_dir = self.config.get('rattail.cleanup', 'beaker.session_dir') + if session_dir and os.path.isdir(session_dir): + return session_dir + + session_dir = os.path.join(self.config.appdir(), 'sessions') + if os.path.isdir(session_dir): + return session_dir + + def cleanup(self, session, dry_run=False, progress=None, **kwargs): + session_dir = self.get_session_dir() + if not session_dir: + return + + data_dir = os.path.join(session_dir, 'data') + lock_dir = os.path.join(session_dir, 'lock') + + # looking for files older than X days + days = self.config.getint('rattail.cleanup', + 'beaker.session_cutoff_days', + default=30) + cutoff = time.time() - 3600 * 24 * days + + for topdir in (data_dir, lock_dir): + if not os.path.isdir(topdir): + continue + + for dirpath, dirnames, filenames in os.walk(topdir): + for fname in filenames: + path = os.path.join(dirpath, fname) + ts = os.path.getmtime(path) + if ts <= cutoff: + if dry_run: + log.debug("would delete file: %s", path) + else: + os.remove(path) + log.debug("deleted file: %s", path) diff --git a/tailbone/config.py b/tailbone/config.py index 90799016..8392ba0a 100644 --- a/tailbone/config.py +++ b/tailbone/config.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,15 +24,16 @@ Rattail config extension for Tailbone """ -from __future__ import unicode_literals, absolute_import +import warnings + +from wuttjamaican.conf import WuttaConfigExtension -from rattail.config import ConfigExtension as BaseExtension from rattail.db.config import configure_session from tailbone.db import Session -class ConfigExtension(BaseExtension): +class ConfigExtension(WuttaConfigExtension): """ Rattail config extension for Tailbone. Does the following: @@ -49,9 +50,12 @@ class ConfigExtension(BaseExtension): configure_session(config, Session) # provide default theme selection - config.setdefault('tailbone', 'themes', 'default, falafel') + config.setdefault('tailbone', 'themes.keys', 'default, butterball') config.setdefault('tailbone', 'themes.expose_picker', 'true') + # override oruga detection + config.setdefault('wuttaweb.oruga_detector.spec', 'tailbone.util:should_use_oruga') + def csrf_token_name(config): return config.get('tailbone', 'csrf_token_name', default='_csrf') @@ -67,3 +71,8 @@ def global_help_url(config): def protected_usernames(config): return config.getlist('tailbone', 'protected_usernames') + + +def should_expose_websockets(config): + return config.getbool('tailbone', 'expose_websockets', + usedb=False, default=False) diff --git a/tailbone/db.py b/tailbone/db.py index ae919e49..8b37f399 100644 --- a/tailbone/db.py +++ b/tailbone/db.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -21,16 +21,13 @@ # ################################################################################ """ -Database Stuff +Database sessions etc. """ -from __future__ import unicode_literals, absolute_import - import sqlalchemy as sa from zope.sqlalchemy import datamanager import sqlalchemy_continuum as continuum from sqlalchemy.orm import sessionmaker, scoped_session -from pkg_resources import get_distribution, parse_version from rattail.db import SessionBase from rattail.db.continuum import versioning_manager @@ -45,23 +42,28 @@ TrainwreckSession = scoped_session(sessionmaker()) # empty dict for now, this must populated on app startup (if needed) ExtraTrainwreckSessions = {} -# some of the logic below may need to vary somewhat, based on which version of -# zope.sqlalchemy we have installed -zope_sqlalchemy_version = get_distribution('zope.sqlalchemy').version -zope_sqlalchemy_version_parsed = parse_version(zope_sqlalchemy_version) - class TailboneSessionDataManager(datamanager.SessionDataManager): - """Integrate a top level sqlalchemy session transaction into a zope transaction + """ + Integrate a top level sqlalchemy session transaction into a zope + transaction One phase variant. .. note:: - This class appears to be necessary in order for the Continuum - integration to work alongside the Zope transaction integration. + + This class appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It subclasses + ``zope.sqlalchemy.datamanager.SessionDataManager`` but injects + some SQLAlchemy-Continuum logic within :meth:`tpc_vote()`, and + is sort of monkey-patched into the mix. """ def tpc_vote(self, trans): + """ """ # for a one phase data manager commit last in tpc_vote if self.tx is not None: # there may have been no work to do @@ -73,82 +75,117 @@ class TailboneSessionDataManager(datamanager.SessionDataManager): self._finish('committed') -def join_transaction(session, initial_state=datamanager.STATUS_ACTIVE, transaction_manager=datamanager.zope_transaction.manager, keep_session=False): - """Join a session to a transaction using the appropriate datamanager. +def join_transaction( + session, + initial_state=datamanager.STATUS_ACTIVE, + transaction_manager=datamanager.zope_transaction.manager, + keep_session=False, +): + """ + Join a session to a transaction using the appropriate datamanager. - It is safe to call this multiple times, if the session is already joined - then it just returns. + It is safe to call this multiple times, if the session is already + joined then it just returns. - `initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or STATUS_READONLY + `initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or + STATUS_READONLY - If using the default initial status of STATUS_ACTIVE, you must ensure that - mark_changed(session) is called when data is written to the database. + If using the default initial status of STATUS_ACTIVE, you must + ensure that mark_changed(session) is called when data is written + to the database. - The ZopeTransactionExtesion SessionExtension can be used to ensure that this is - called automatically after session write operations. + The ZopeTransactionExtesion SessionExtension can be used to ensure + that this is called automatically after session write operations. .. note:: - This function is copied from upstream, and tweaked so that our custom - :class:`TailboneSessionDataManager` will be used. + + This function appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It overrides ``zope.sqlalchemy.datamanager.join_transaction()`` + to ensure the custom :class:`TailboneSessionDataManager` is + used, and is sort of monkey-patched into the mix. """ # the upstream internals of this function has changed a little over time. # unfortunately for us, that means we must include each variant here. - if zope_sqlalchemy_version_parsed >= parse_version('1.1'): # 1.1+ - if datamanager._SESSION_STATE.get(session, None) is None: - if session.twophase: - DataManager = datamanager.TwoPhaseSessionDataManager - else: - DataManager = TailboneSessionDataManager - DataManager(session, initial_state, transaction_manager, keep_session=keep_session) - - else: # pre-1.1 - if datamanager._SESSION_STATE.get(id(session), None) is None: - if session.twophase: - DataManager = datamanager.TwoPhaseSessionDataManager - else: - DataManager = TailboneSessionDataManager - DataManager(session, initial_state, transaction_manager, keep_session=keep_session) + if datamanager._SESSION_STATE.get(session, None) is None: + if session.twophase: + DataManager = datamanager.TwoPhaseSessionDataManager + else: + DataManager = TailboneSessionDataManager + DataManager(session, initial_state, transaction_manager, keep_session=keep_session) -class ZopeTransactionExtension(datamanager.ZopeTransactionExtension): - """Record that a flush has occurred on a session's connection. This allows - the DataManager to rollback rather than commit on read only transactions. +class ZopeTransactionEvents(datamanager.ZopeTransactionEvents): + """ + Record that a flush has occurred on a session's connection. This + allows the DataManager to rollback rather than commit on read only + transactions. .. note:: - This class is copied from upstream, and tweaked so that our custom - :func:`join_transaction()` will be used. + + This class appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It subclasses + ``zope.sqlalchemy.datamanager.ZopeTransactionEvents`` but + overrides various methods to ensure the custom + :func:`join_transaction()` is called, and is sort of + monkey-patched into the mix. """ def after_begin(self, session, transaction, connection): - join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session) + """ """ + join_transaction(session, self.initial_state, + self.transaction_manager, self.keep_session) def after_attach(self, session, instance): - join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session) + """ """ + join_transaction(session, self.initial_state, + self.transaction_manager, self.keep_session) + + def join_transaction(self, session): + """ """ + join_transaction(session, self.initial_state, + self.transaction_manager, self.keep_session) -def register(session, initial_state=datamanager.STATUS_ACTIVE, - transaction_manager=datamanager.zope_transaction.manager, keep_session=False): - """Register ZopeTransaction listener events on the - given Session or Session factory/class. +def register( + session, + initial_state=datamanager.STATUS_ACTIVE, + transaction_manager=datamanager.zope_transaction.manager, + keep_session=False, +): + """ + Register ZopeTransaction listener events on the given Session or + Session factory/class. - This function requires at least SQLAlchemy 0.7 and makes use - of the newer sqlalchemy.event package in order to register event listeners - on the given Session. + This function requires at least SQLAlchemy 0.7 and makes use of + the newer sqlalchemy.event package in order to register event + listeners on the given Session. The session argument here may be a Session class or subclass, a - sessionmaker or scoped_session instance, or a specific Session instance. - Event listening will be specific to the scope of the type of argument - passed, including specificity to its subclass as well as its identity. + sessionmaker or scoped_session instance, or a specific Session + instance. Event listening will be specific to the scope of the + type of argument passed, including specificity to its subclass as + well as its identity. .. note:: - This function is copied from upstream, and tweaked so that our custom - :class:`ZopeTransactionExtension` will be used. + + This function appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It overrides ``zope.sqlalchemy.datamanager.regsiter()`` to + ensure the custom :class:`ZopeTransactionEvents` is used. """ from sqlalchemy import event - ext = ZopeTransactionExtension( - initial_state=initial_state, + ext = ZopeTransactionEvents( + initial_state=initial_state, transaction_manager=transaction_manager, keep_session=keep_session, ) @@ -160,6 +197,9 @@ def register(session, initial_state=datamanager.STATUS_ACTIVE, event.listen(session, "after_bulk_delete", ext.after_bulk_delete) event.listen(session, "before_commit", ext.before_commit) + if datamanager.SA_GE_14: + event.listen(session, "do_orm_execute", ext.do_orm_execute) + register(Session) register(TempmonSession) diff --git a/tailbone/diffs.py b/tailbone/diffs.py index d4031b1f..2e582b15 100644 --- a/tailbone/diffs.py +++ b/tailbone/diffs.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2019 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,7 +24,8 @@ Tools for displaying data diffs """ -from __future__ import unicode_literals, absolute_import +import sqlalchemy as sa +import sqlalchemy_continuum as continuum from pyramid.renderers import render from webhelpers2.html import HTML @@ -33,16 +34,41 @@ from webhelpers2.html import HTML class Diff(object): """ Core diff class. In sore need of documentation. + + You must provide the old and new data sets, and the set of + relevant fields as well, if they cannot be easily introspected. + + :param old_data: Dict of "old" data values. + + :param new_data: Dict of "old" data values. + + :param fields: Sequence of relevant field names. Note that + both data dicts are expected to have keys which match these + field names. If you do not specify the fields then they + will (hopefully) be introspected from the old or new data + sets; however this will not work if they are both empty. + + :param monospace: If true, this flag will cause the value + columns to be rendered in monospace font. This is assumed + to be helpful when comparing "raw" data values which are + shown as e.g. ``repr(val)``. + + :param enums: Optional dict of enums for use when displaying field + values. If specified, keys should be field names and values + should be enum dicts. """ - def __init__(self, old_data, new_data, columns=None, fields=None, render_field=None, render_value=None, monospace=False, - extra_row_attrs=None): + def __init__(self, old_data, new_data, columns=None, fields=None, enums=None, + render_field=None, render_value=None, nature='dirty', + monospace=False, extra_row_attrs=None): self.old_data = old_data self.new_data = new_data self.columns = columns or ["field name", "old value", "new value"] self.fields = fields or self.make_fields() + self.enums = enums or {} self._render_field = render_field or self.render_field_default self.render_value = render_value or self.render_value_default + self.nature = nature self.monospace = monospace self.extra_row_attrs = extra_row_attrs @@ -69,7 +95,7 @@ class Diff(object): for the given field. May be an empty string, or a snippet of HTML attribute syntax, e.g.: - .. code-highlight:: none + .. code-block:: none class="diff" foo="bar" @@ -105,3 +131,161 @@ class Diff(object): def render_new_value(self, field): value = self.new_value(field) return self.render_value(field, value) + + +class VersionDiff(Diff): + """ + Special diff class, for use with version history views. Note that + while based on :class:`Diff`, this class uses a different + signature for the constructor. + + :param version: Reference to a Continuum version record (object). + + :param \*args: Typical usage will not require positional args + beyond the ``version`` param, in which case ``old_data`` and + ``new_data`` params will be auto-determined based on the + ``version``. But if you specify positional args then nothing + automatic is done, they are passed as-is to the parent + :class:`Diff` constructor. + + :param \*\*kwargs: Remaining kwargs are passed as-is to the + :class:`Diff` constructor. + """ + + def __init__(self, version, *args, **kwargs): + self.version = version + self.mapper = sa.inspect(continuum.parent_class(type(self.version))) + self.version_mapper = sa.inspect(type(self.version)) + self.title = kwargs.pop('title', None) + + if 'nature' not in kwargs: + if version.previous and version.operation_type == continuum.Operation.DELETE: + kwargs['nature'] = 'deleted' + elif version.previous: + kwargs['nature'] = 'dirty' + else: + kwargs['nature'] = 'new' + + if 'fields' not in kwargs: + kwargs['fields'] = self.get_default_fields() + + if not args: + old_data = {} + new_data = {} + for field in kwargs['fields']: + if version.previous: + old_data[field] = getattr(version.previous, field) + new_data[field] = getattr(version, field) + args = (old_data, new_data) + + super().__init__(*args, **kwargs) + + def get_default_fields(self): + fields = sorted(self.version_mapper.columns.keys()) + + unwanted = [ + 'transaction_id', + 'end_transaction_id', + 'operation_type', + ] + + return [field for field in fields + if field not in unwanted] + + def render_version_value(self, field, value, version): + """ + Render the cell value text for the given version/field info. + + Note that this method is used to render both sides of the diff + (before and after values). + + :param field: Name of the field, as string. + + :param value: Raw value for the field, as obtained from ``version``. + + :param version: Reference to the Continuum version object. + + :returns: Rendered text as string, or ``None``. + """ + text = HTML.tag('span', c=[repr(value)], + style='font-family: monospace;') + + # assume the enum display is all we need, if enum exists for the field + if field in self.enums: + + # but skip the enum display if None + display = self.enums[field].get(value) + if display is None and value is None: + return text + + # otherwise show enum display to the right of raw value + display = self.enums[field].get(value, str(value)) + return HTML.tag('span', c=[ + text, + HTML.tag('span', c=[display], + style='margin-left: 2rem; font-style: italic; font-weight: bold;'), + ]) + + # next we look for a relationship and may render the foreign object + for prop in self.mapper.relationships: + if prop.uselist: + continue + + for col in prop.local_columns: + if col.name != field: + continue + + if not hasattr(version, prop.key): + continue + + if col in self.mapper.primary_key: + continue + + ref = getattr(version, prop.key) + if ref: + ref = getattr(ref, 'version_parent', None) + if ref: + return HTML.tag('span', c=[ + text, + HTML.tag('span', c=[str(ref)], + style='margin-left: 2rem; font-style: italic; font-weight: bold;'), + ]) + + return text + + def render_old_value(self, field): + if self.nature == 'new': + return '' + value = self.old_value(field) + return self.render_version_value(field, value, self.version.previous) + + def render_new_value(self, field): + if self.nature == 'deleted': + return '' + value = self.new_value(field) + return self.render_version_value(field, value, self.version) + + def as_struct(self): + values = {} + for field in self.fields: + values[field] = {'before': self.render_old_value(field), + 'after': self.render_new_value(field)} + + operation = None + if self.version.operation_type == continuum.Operation.INSERT: + operation = 'INSERT' + elif self.version.operation_type == continuum.Operation.UPDATE: + operation = 'UPDATE' + elif self.version.operation_type == continuum.Operation.DELETE: + operation = 'DELETE' + else: + operation = self.version.operation_type + + return { + 'key': id(self.version), + 'model_title': self.title, + 'operation': operation, + 'diff_class': self.nature, + 'fields': self.fields, + 'values': values, + } diff --git a/tailbone/exceptions.py b/tailbone/exceptions.py index beea1366..3468562a 100644 --- a/tailbone/exceptions.py +++ b/tailbone/exceptions.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2020 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,10 +24,6 @@ Tailbone Exceptions """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.exceptions import RattailError @@ -37,7 +33,6 @@ class TailboneError(RattailError): """ -@six.python_2_unicode_compatible class TailboneJSONFieldError(TailboneError): """ Error raised when JSON serialization of a form field results in an error. diff --git a/tailbone/forms/__init__.py b/tailbone/forms/__init__.py index a368f2d1..34b34a6c 100644 --- a/tailbone/forms/__init__.py +++ b/tailbone/forms/__init__.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,8 +24,7 @@ Forms Library """ -from __future__ import unicode_literals, absolute_import - -from . import types +# nb. import widgets before types, b/c types may refer to widgets from . import widgets +from . import types from .core import Form, SimpleFileImport diff --git a/tailbone/forms/common.py b/tailbone/forms/common.py index 26934479..6183d17f 100644 --- a/tailbone/forms/common.py +++ b/tailbone/forms/common.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,8 +24,6 @@ Common Forms """ -from __future__ import unicode_literals, absolute_import - from rattail.db import model import colander @@ -35,7 +33,7 @@ import colander def validate_user(node, kw): session = kw['session'] def validate(node, value): - user = session.query(model.User).get(value) + user = session.get(model.User, value) if not user: raise colander.Invalid(node, "User not found") return user.uuid @@ -58,4 +56,7 @@ class Feedback(colander.Schema): user_name = colander.SchemaNode(colander.String(), missing=colander.null) + please_reply_to = colander.SchemaNode(colander.String(), + missing=colander.null) + message = colander.SchemaNode(colander.String()) diff --git a/tailbone/forms/core.py b/tailbone/forms/core.py index 6b463f55..4024557b 100644 --- a/tailbone/forms/core.py +++ b/tailbone/forms/core.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2021 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,20 +24,19 @@ Forms Core """ -from __future__ import unicode_literals, absolute_import - +import hashlib import json -import datetime import logging +import warnings +from collections import OrderedDict -import six import sqlalchemy as sa from sqlalchemy import orm from sqlalchemy.ext.associationproxy import AssociationProxy, ASSOCIATION_PROXY +from wuttjamaican.util import UNSPECIFIED -from rattail.time import localtime -from rattail.util import prettify, pretty_boolean, pretty_hours, pretty_quantity -from rattail.core import UNSPECIFIED +from rattail.util import pretty_boolean +from rattail.db.util import get_fieldnames import colander import deform @@ -48,9 +47,14 @@ from pyramid_deform import SessionFileUploadTempStore from pyramid.renderers import render from webhelpers2.html import tags, HTML -from tailbone.util import raw_datetime -from . import types -from .widgets import ReadonlyWidget, PlainDateWidget, JQueryDateWidget, JQueryTimeWidget +from wuttaweb.util import FieldList, get_form_data, make_json_safe + +from tailbone.db import Session +from tailbone.util import raw_datetime, render_markdown +from tailbone.forms import types +from tailbone.forms.widgets import (ReadonlyWidget, PlainDateWidget, + JQueryDateWidget, JQueryTimeWidget, + FileUploadWidget, MultiFileUploadWidget) from tailbone.exceptions import TailboneJSONFieldError @@ -112,22 +116,14 @@ class CustomSchemaNode(SQLAlchemySchemaNode): for the given association proxy field name. Typically this will refer to the "extension" model class. """ - proxy = self.association_proxy(field) - if proxy: - proxy_target = self.inspector.get_property(proxy.target_collection) - if isinstance(proxy_target, orm.RelationshipProperty) and not proxy_target.uselist: - return proxy_target + return get_association_proxy_target(self.inspector, field) def association_proxy_column(self, field): """ Returns the property on the proxy target class, for the column which is reflected by the proxy. """ - proxy_target = self.association_proxy_target(field) - if proxy_target: - prop = proxy_target.mapper.get_property(field) - if isinstance(prop, orm.ColumnProperty) and isinstance(prop.columns[0], sa.Column): - return prop + return get_association_proxy_column(self.inspector, field) def supported_association_proxy(self, field): """ @@ -230,7 +226,7 @@ class CustomSchemaNode(SQLAlchemySchemaNode): if excludes: overrides['excludes'] = excludes - return super(CustomSchemaNode, self).get_schema_from_relationship(prop, overrides) + return super().get_schema_from_relationship(prop, overrides) def dictify(self, obj): """ Return a dictified version of `obj` using schema information. @@ -239,7 +235,7 @@ class CustomSchemaNode(SQLAlchemySchemaNode): This method was copied from upstream and modified to add automatic handling of "association proxy" fields. """ - dict_ = super(CustomSchemaNode, self).dictify(obj) + dict_ = super().dictify(obj) for node in self: name = node.name @@ -332,7 +328,7 @@ class Form(object): """ Base class for all forms. """ - save_label = "Save" + save_label = "Submit" update_label = "Save" show_cancel = True auto_disable = True @@ -341,16 +337,22 @@ class Form(object): def __init__(self, fields=None, schema=None, request=None, readonly=False, readonly_fields=[], model_instance=None, model_class=None, appstruct=UNSPECIFIED, nodes={}, enums={}, labels={}, - assume_local_times=False, renderers=None, + assume_local_times=False, renderers=None, renderer_kwargs={}, hidden={}, widgets={}, defaults={}, validators={}, required={}, helptext={}, focus_spec=None, - action_url=None, cancel_url=None, use_buefy=None, component='tailbone-form'): - + action_url=None, cancel_url=None, + vue_tagname=None, + vuejs_component_kwargs=None, vuejs_field_converters={}, json_data={}, included_templates={}, + # TODO: ugh this is getting out hand! + can_edit_help=False, edit_help_url=None, route_prefix=None, + **kwargs + ): self.fields = None if fields is not None: self.set_fields(fields) self.schema = schema if self.fields is None and self.schema: self.set_fields([f.name for f in self.schema]) + self.grouping = None self.request = request self.readonly = readonly self.readonly_fields = set(readonly_fields or []) @@ -369,22 +371,89 @@ class Form(object): self.renderers = self.make_renderers() else: self.renderers = renderers or {} + self.renderer_kwargs = renderer_kwargs or {} self.hidden = hidden or {} self.widgets = widgets or {} self.defaults = defaults or {} self.validators = validators or {} self.required = required or {} self.helptext = helptext or {} + self.dynamic_helptext = {} self.focus_spec = focus_spec self.action_url = action_url self.cancel_url = cancel_url - self.use_buefy = use_buefy - self.component = component + + # vue_tagname + self.vue_tagname = vue_tagname + if not self.vue_tagname and kwargs.get('component'): + warnings.warn("component kwarg is deprecated for Form(); " + "please use vue_tagname param instead", + DeprecationWarning, stacklevel=2) + self.vue_tagname = kwargs['component'] + if not self.vue_tagname: + self.vue_tagname = 'tailbone-form' + + self.vuejs_component_kwargs = vuejs_component_kwargs or {} + self.vuejs_field_converters = vuejs_field_converters or {} + self.json_data = json_data or {} + self.included_templates = included_templates or {} + self.can_edit_help = can_edit_help + self.edit_help_url = edit_help_url + self.route_prefix = route_prefix + + self.button_icon_submit = kwargs.get('button_icon_submit', 'save') + + def __iter__(self): + return iter(self.fields) + + @property + def vue_component(self): + """ + String name for the Vue component, e.g. ``'TailboneGrid'``. + + This is a generated value based on :attr:`vue_tagname`. + """ + words = self.vue_tagname.split('-') + return ''.join([word.capitalize() for word in words]) + + @property + def component(self): + """ + DEPRECATED - use :attr:`vue_tagname` instead. + """ + warnings.warn("Form.component is deprecated; " + "please use vue_tagname instead", + DeprecationWarning, stacklevel=2) + return self.vue_tagname @property def component_studly(self): - words = self.component.split('-') - return ''.join([word.capitalize() for word in words]) + """ + DEPRECATED - use :attr:`vue_component` instead. + """ + warnings.warn("Form.component_studly is deprecated; " + "please use vue_component instead", + DeprecationWarning, stacklevel=2) + return self.vue_component + + def get_button_label_submit(self): + """ """ + if hasattr(self, '_button_label_submit'): + return self._button_label_submit + + label = getattr(self, 'submit_label', None) + if label: + return label + + return self.save_label + + def set_button_label_submit(self, value): + """ """ + self._button_label_submit = value + + # wutta compat + button_label_submit = property(get_button_label_submit, + set_button_label_submit) def __contains__(self, item): return item in self.fields @@ -399,19 +468,11 @@ class Form(object): if not self.model_class: raise ValueError("Must define model_class to use make_fields()") - mapper = orm.class_mapper(self.model_class) + return get_fieldnames(self.request.rattail_config, self.model_class, + columns=True, proxies=True, relations=True) - # first add primary column fields - fields = FieldList([prop.key for prop in mapper.iterate_properties - if not prop.key.startswith('_') - and prop.key != 'versions']) - - # then add association proxy fields - for key, desc in sa.inspect(self.model_class).all_orm_descriptors.items(): - if desc.extension_type == ASSOCIATION_PROXY: - fields.append(key) - - return fields + def set_grouping(self, items): + self.grouping = OrderedDict(items) def make_renderers(self): """ @@ -454,6 +515,9 @@ class Form(object): def append(self, field): self.fields.append(field) + def insert(self, index, field): + self.fields.insert(index, field) + def insert_before(self, field, newfield): self.fields.insert_before(field, newfield) @@ -540,7 +604,10 @@ class Form(object): # apply any validators for key, validator in self.validators.items(): - if key in schema: + if key is None: + # this one is form-wide + schema.validator = validator + elif key in schema: schema[key].validator = validator # apply required flags @@ -563,7 +630,9 @@ class Form(object): self.schema[key].title = label def get_label(self, key): - return self.labels.get(key, prettify(key)) + config = self.request.rattail_config + app = config.get_app() + return self.labels.get(key, app.make_title(key)) def set_readonly(self, key, readonly=True): if readonly: @@ -580,9 +649,23 @@ class Form(object): node = colander.SchemaNode(nodeinfo, **kwargs) self.nodes[key] = node + # must explicitly replace node, if we already have a schema + if self.schema: + self.schema[key] = node + def set_type(self, key, type_, **kwargs): + if type_ == 'datetime': self.set_renderer(key, self.render_datetime) + + elif type_ == 'datetime_falafel': + self.set_renderer(key, self.render_datetime) + self.set_node(key, types.FalafelDateTime(request=self.request)) + if kwargs.get('helptext'): + app = self.request.rattail_config.get_app() + timezone = app.get_timezone() + self.set_helptext(key, f"NOTE: all times are local to {timezone}") + elif type_ == 'datetime_local': self.set_renderer(key, self.render_datetime_local) elif type_ == 'date_plain': @@ -591,9 +674,14 @@ class Form(object): # TODO: is this safe / a good idea? # self.set_node(key, colander.Date()) self.set_widget(key, JQueryDateWidget()) + elif type_ == 'time_jquery': self.set_node(key, types.JQueryTime()) self.set_widget(key, JQueryTimeWidget()) + + elif type_ == 'time_falafel': + self.set_node(key, types.FalafelTime(request=self.request)) + elif type_ == 'duration': self.set_renderer(key, self.render_duration) elif type_ == 'boolean': @@ -620,17 +708,40 @@ class Form(object): self.set_widget(key, dfwidget.TextAreaWidget(cols=80, rows=8)) elif type_ == 'file': tmpstore = SessionFileUploadTempStore(self.request) - kw = {'widget': dfwidget.FileUploadWidget(tmpstore), + kw = {'widget': FileUploadWidget(tmpstore, request=self.request), 'title': self.get_label(key)} if 'required' in kwargs and not kwargs['required']: kw['missing'] = colander.null self.set_node(key, colander.SchemaNode(deform.FileData(), **kw)) - # must explicitly replace node, if we already have a schema - if self.schema: - self.schema[key] = self.nodes[key] + elif type_ == 'multi_file': + tmpstore = SessionFileUploadTempStore(self.request) + file_node = colander.SchemaNode(deform.FileData(), + name='upload') + + kw = {'name': key, + 'title': self.get_label(key), + 'widget': MultiFileUploadWidget(tmpstore)} + # if 'required' in kwargs and not kwargs['required']: + # kw['missing'] = colander.null + if kwargs.get('validate_unique'): + kw['validator'] = self.validate_multiple_files_unique + files_node = colander.SequenceSchema(file_node, **kw) + self.set_node(key, files_node) else: raise ValueError("unknown type for '{}' field: {}".format(key, type_)) + def validate_multiple_files_unique(self, node, value): + + # get SHA256 hash for each file; error if duplicates encountered + hashes = {} + for fileinfo in value: + fp = fileinfo['fp'] + fp.seek(0) + filehash = hashlib.sha256(fp.read()).hexdigest() + if filehash in hashes: + node.raise_invalid(f"Duplicate file detected: {fileinfo['filename']}") + hashes[filehash] = fileinfo + def set_enum(self, key, enum, empty=None): if enum: self.enums[key] = enum @@ -658,6 +769,22 @@ class Form(object): else: self.renderers[key] = renderer + def add_renderer_kwargs(self, key, kwargs): + self.renderer_kwargs.setdefault(key, {}).update(kwargs) + + def get_renderer_kwargs(self, key): + return self.renderer_kwargs.get(key, {}) + + def set_renderer_kwargs(self, key, kwargs): + self.renderer_kwargs[key] = kwargs + + def set_input_handler(self, key, value): + """ + Convenience method to assign "input handler" callback code for + the given field. + """ + self.add_renderer_kwargs(key, {'input_handler': value}) + def set_hidden(self, key, hidden=True): self.hidden[key] = hidden @@ -669,8 +796,26 @@ class Form(object): self.schema[key].widget = widget def set_validator(self, key, validator): + """ + Set the validator for the schema node represented by the given + key. + + :param key: Normally this the name of one of the fields + contained in the form. It can also be ``None`` in which + case the validator pertains to the form at large instead of + one of the fields. + + :param validator: Callable which accepts ``(node, value)`` + args. + """ self.validators[key] = validator + # we normally apply the validator when creating the schema, so + # if this form already has a schema, then go ahead and apply + # the validator to it + if self.schema and key in self.schema: + self.schema[key].validator = validator + def set_required(self, key, required=True): """ Set whether or not value is required for a given field. @@ -683,11 +828,16 @@ class Form(object): """ self.defaults[key] = value - def set_helptext(self, key, value): + def set_helptext(self, key, value, dynamic=False): """ Set the help text for a given field. """ - self.helptext[key] = value + # nb. must avoid newlines, they cause some weird "blank page" error?! + self.helptext[key] = value.replace('\n', ' ') + if value and dynamic: + self.dynamic_helptext[key] = True + else: + self.dynamic_helptext.pop(key, None) def has_helptext(self, key): """ @@ -700,17 +850,22 @@ class Form(object): """ Render the help text for the given field. """ - return self.helptext[key] + text = self.helptext[key] + text = text.replace('"', '"') + return HTML.literal(text) - def render(self, template=None, **kwargs): - if not template: - if self.readonly and not self.use_buefy: - template = '/forms/form_readonly.mako' - else: - template = '/forms/form.mako' - context = kwargs - context['form'] = self - return render(template, context) + def set_vuejs_field_converter(self, field, converter): + self.vuejs_field_converters[field] = converter + + def render(self, **kwargs): + warnings.warn("Form.render() is deprecated (for now?); " + "please use Form.render_deform() instead", + DeprecationWarning, stacklevel=2) + return self.render_deform(**kwargs) + + def get_deform(self): + """ """ + return self.make_deform_form() def make_deform_form(self): if not hasattr(self, 'deform_form'): @@ -750,31 +905,35 @@ class Form(object): return self.deform_form + def render_vue_template(self, template='/forms/deform.mako', **context): + """ """ + output = self.render_deform(template=template, **context) + return HTML.literal(output) + def render_deform(self, dform=None, template=None, **kwargs): if not template: - if self.use_buefy: - template = '/forms/deform_buefy.mako' - else: - template = '/forms/deform.mako' + template = '/forms/deform.mako' if dform is None: dform = self.make_deform_form() # TODO: would perhaps be nice to leverage deform's default rendering # someday..? i.e. using Chameleon *.pt templates - # return form.render() + # return dform.render() context = kwargs context['form'] = self context['dform'] = dform + context.setdefault('can_edit_help', self.can_edit_help) + if context['can_edit_help']: + context.setdefault('edit_help_url', self.edit_help_url) + context['field_labels'] = self.get_field_labels() + context['field_markdowns'] = self.get_field_markdowns() context.setdefault('form_kwargs', {}) # TODO: deprecate / remove the latter option here if self.auto_disable_save or self.auto_disable: - if self.use_buefy: - context['form_kwargs'].setdefault('ref', self.component_studly) - context['form_kwargs']['@submit'] = 'submit{}'.format(self.component_studly) - else: - context['form_kwargs']['class_'] = 'autodisable' + context['form_kwargs'].setdefault('ref', self.vue_component) + context['form_kwargs']['@submit'] = 'submit{}'.format(self.vue_component) if self.focus_spec: context['form_kwargs']['data-focus'] = self.focus_spec context['request'] = self.request @@ -782,31 +941,89 @@ class Form(object): context['render_field_readonly'] = self.render_field_readonly return render(template, context) + def get_field_labels(self): + return dict([(field, self.get_label(field)) + for field in self]) + + def get_field_markdowns(self, session=None): + app = self.request.rattail_config.get_app() + model = app.model + session = session or Session() + + if not hasattr(self, 'field_markdowns'): + infos = session.query(model.TailboneFieldInfo)\ + .filter(model.TailboneFieldInfo.route_prefix == self.route_prefix)\ + .all() + self.field_markdowns = dict([(info.field_name, info.markdown_text) + for info in infos]) + + return self.field_markdowns + + def get_vue_field_value(self, key): + """ """ + if key not in self.fields: + return + + dform = self.get_deform() + if key not in dform: + return + + field = dform[key] + return make_json_safe(field.cstruct) + def get_vuejs_model_value(self, field): """ This method must return "raw" JS which will be assigned as the initial model value for the given field. This JS will be written as part of the overall response, to be interpreted on the client side. """ - if isinstance(field.schema.typ, deform.FileData): - # TODO: we used to always/only return 'null' here but hopefully - # this also works, to show existing filename when present - if field.cstruct and field.cstruct['filename']: - return json.dumps({'name': field.cstruct['filename']}) - return 'null' + if field.name in self.vuejs_field_converters: + convert = self.vuejs_field_converters[field.name] + value = convert(field.cstruct) + return json.dumps(value) if isinstance(field.schema.typ, colander.Set): if field.cstruct is colander.null: return '[]' - if field.cstruct is colander.null: - return 'null' - try: - return json.dumps(field.cstruct) + return self.jsonify_value(field.cstruct) except Exception as error: raise TailboneJSONFieldError(field.name, error) + def jsonify_value(self, value): + """ + Take a Python value and convert to JSON + """ + if value is colander.null: + return 'null' + + if isinstance(value, dfwidget.filedict): + # TODO: we used to always/only return 'null' here but hopefully + # this also works, to show existing filename when present + if value and value['filename']: + return json.dumps({'name': value['filename']}) + return 'null' + + elif isinstance(value, list) and all([isinstance(f, dfwidget.filedict) + for f in value]): + return json.dumps([{'name': f['filename']} + for f in value]) + + app = self.request.rattail_config.get_app() + value = app.json_friendly(value) + return json.dumps(value) + + def get_error_messages(self, field): + if field.error: + return field.error.messages() + + error = self.make_deform_form().error + if error: + if isinstance(error, colander.Invalid): + if error.node.name == field.name: + return error.messages() + def messages_json(self, messages): dump = json.dumps(messages) dump = dump.replace("'", ''') @@ -817,6 +1034,208 @@ class Form(object): return False return True + def set_vuejs_component_kwargs(self, **kwargs): + self.vuejs_component_kwargs.update(kwargs) + + def render_vue_tag(self, **kwargs): + """ """ + return self.render_vuejs_component(**kwargs) + + def render_vuejs_component(self, **kwargs): + """ + Render the Vue.js component HTML for the form. + + Most typically this is something like: + + .. code-block:: html + + + + """ + kw = dict(self.vuejs_component_kwargs) + kw.update(kwargs) + if self.can_edit_help: + kw.setdefault(':configure-fields-help', 'configureFieldsHelp') + return HTML.tag(self.vue_tagname, **kw) + + def set_json_data(self, key, value): + """ + Establish a data value for use in client-side JS. This value + will be JSON-encoded and made available to the + `` component within the client page. + """ + self.json_data[key] = value + + def include_template(self, template, context): + """ + Declare a JS template as required by the current form. This + template will then be included in the final page, so all + widgets behave correctly. + """ + self.included_templates[template] = context + + def render_included_templates(self): + templates = [] + for template, context in self.included_templates.items(): + context = dict(context) + context['form'] = self + templates.append(HTML.literal(render(template, context))) + return HTML.literal('\n').join(templates) + + def render_vue_field(self, fieldname, **kwargs): + """ """ + return self.render_field_complete(fieldname, **kwargs) + + def render_field_complete(self, fieldname, bfield_attrs={}, + session=None): + """ + Render the given field completely, i.e. with ```` + wrapper. Note that this is meant to render *editable* fields, + i.e. showing a widget, unless the field input is hidden. In + other words it's not for "readonly" fields. + """ + dform = self.make_deform_form() + field = dform[fieldname] if fieldname in dform else None + + include = bool(field) + if self.readonly or (not field and fieldname in self.readonly_fields): + include = True + if not include: + return + + if self.field_visible(fieldname): + label = self.get_label(fieldname) + markdowns = self.get_field_markdowns(session=session) + + # these attrs will be for the (*not* the widget) + attrs = { + ':horizontal': 'true', + } + + # add some magic for file input fields + if field and isinstance(field.schema.typ, deform.FileData): + attrs['class_'] = 'file' + + # next we will build array of messages to display..some + # fields always show a "helptext" msg, and some may have + # validation errors.. + field_type = None + messages = [] + + # show errors if present + error_messages = self.get_error_messages(field) if field else None + if error_messages: + field_type = 'is-danger' + messages.extend(error_messages) + + # show helptext if present + # TODO: older logic did this only if field was *not* + # readonly, perhaps should add that back.. + if self.has_helptext(fieldname): + messages.append(self.render_helptext(fieldname)) + + # ..okay now we can declare the field messages and type + if field_type: + attrs['type'] = field_type + if messages: + if len(messages) == 1: + msg = messages[0] + if msg.startswith('`') and msg.endswith('`'): + attrs[':message'] = msg + else: + attrs['message'] = msg + else: + # nb. must pass an array as JSON string + attrs[':message'] = '[{}]'.format(', '.join([ + "'{}'".format(msg.replace("'", r"\'")) + for msg in messages])) + + # merge anything caller provided + attrs.update(bfield_attrs) + + # render the field widget or whatever + if self.readonly or fieldname in self.readonly_fields: + html = self.render_field_value(fieldname) or HTML.tag('span') + if type(html) is str: + html = HTML.tag('span', c=[html]) + elif field: + html = field.serialize(**self.get_renderer_kwargs(fieldname)) + html = HTML.literal(html) + + # may need a complex label + label_contents = [label] + + # add 'help' icon/tooltip if defined + if markdowns.get(fieldname): + icon = HTML.tag('b-icon', size='is-small', pack='fas', + icon='question-circle') + tooltip = render_markdown(markdowns[fieldname]) + + # nb. must apply hack to get