diff --git a/.gitignore b/.gitignore index 906dc226..b3006f90 100644 --- a/.gitignore +++ b/.gitignore @@ -1,5 +1,8 @@ +*~ +*.pyc .coverage .tox/ +dist/ docs/_build/ htmlcov/ Tailbone.egg-info/ diff --git a/CHANGELOG.md b/CHANGELOG.md new file mode 100644 index 00000000..c974b3a6 --- /dev/null +++ b/CHANGELOG.md @@ -0,0 +1,683 @@ + +# Changelog +All notable changes to Tailbone will be documented in this file. + +The format is based on [Keep a Changelog](http://keepachangelog.com/en/1.0.0/) +and this project adheres to [Semantic Versioning](http://semver.org/spec/v2.0.0.html). + +## v0.22.7 (2025-02-19) + +### Fix + +- stop using old config for logo image url on login page +- fix warning msg for deprecated Grid param + +## v0.22.6 (2025-02-01) + +### Fix + +- register vue3 form component for products -> make batch + +## v0.22.5 (2024-12-16) + +### Fix + +- whoops this is latest rattail +- require newer rattail lib +- require newer wuttaweb +- let caller request safe HTML literal for rendered grid table + +## v0.22.4 (2024-11-22) + +### Fix + +- avoid error in product search for duplicated key +- use vmodel for confirm password widget input + +## v0.22.3 (2024-11-19) + +### Fix + +- avoid error for trainwreck query when not a customer + +## v0.22.2 (2024-11-18) + +### Fix + +- use local/custom enum for continuum operations +- add basic master view for Product Costs +- show continuum operation type when viewing version history +- always define `app` attr for ViewSupplement +- avoid deprecated import + +## v0.22.1 (2024-11-02) + +### Fix + +- fix submit button for running problem report +- avoid deprecated grid method + +## v0.22.0 (2024-10-22) + +### Feat + +- add support for new ordering batch from parsed file + +### Fix + +- avoid deprecated method to suggest username + +## v0.21.11 (2024-10-03) + +### Fix + +- custom method for adding grid action +- become/stop root should redirect to previous url + +## v0.21.10 (2024-09-15) + +### Fix + +- update project repo links, kallithea -> forgejo +- use better icon for submit button on login page +- wrap notes text for batch view +- expose datasync consumer batch size via configure page + +## v0.21.9 (2024-08-28) + +### Fix + +- render custom attrs in form component tag + +## v0.21.8 (2024-08-28) + +### Fix + +- ignore session kwarg for `MasterView.make_row_grid()` + +## v0.21.7 (2024-08-28) + +### Fix + +- avoid error when form value cannot be obtained + +## v0.21.6 (2024-08-28) + +### Fix + +- avoid error when grid value cannot be obtained + +## v0.21.5 (2024-08-28) + +### Fix + +- set empty string for "-new-" file configure option + +## v0.21.4 (2024-08-26) + +### Fix + +- handle differing email profile keys for appinfo/configure + +## v0.21.3 (2024-08-26) + +### Fix + +- show non-standard config values for app info configure email + +## v0.21.2 (2024-08-26) + +### Fix + +- refactor waterpark base template to use wutta feedback component +- fix input/output file upload feature for configure pages, per oruga +- tweak how grid data translates to Vue template context +- merge filters into main grid template +- add basic wutta view for users +- some fixes for wutta people view +- various fixes for waterpark theme +- avoid deprecated `component` form kwarg + +## v0.21.1 (2024-08-22) + +### Fix + +- misc. bugfixes per recent changes + +## v0.21.0 (2024-08-22) + +### Feat + +- move "most" filtering logic for grid class to wuttaweb +- inherit from wuttaweb templates for home, login pages +- inherit from wuttaweb for AppInfoView, appinfo/configure template +- add "has output file templates" config option for master view + +### Fix + +- change grid reset-view param name to match wuttaweb +- move "searchable columns" grid feature to wuttaweb +- use wuttaweb to get/render csrf token +- inherit from wuttaweb for appinfo/index template +- prefer wuttaweb config for "home redirect to login" feature +- fix master/index template rendering for waterpark theme +- fix spacing for navbar logo/title in waterpark theme + +## v0.20.1 (2024-08-20) + +### Fix + +- fix default filter verbs logic for workorder status + +## v0.20.0 (2024-08-20) + +### Feat + +- add new 'waterpark' theme, based on wuttaweb w/ vue2 + buefy +- refactor templates to simplify base/page/form structure + +### Fix + +- avoid deprecated reference to app db engine + +## v0.19.3 (2024-08-19) + +### Fix + +- add pager stats to all grid vue data (fixes view history) + +## v0.19.2 (2024-08-19) + +### Fix + +- sort on frontend for appinfo package listing grid +- prefer attr over key lookup when getting model values +- replace all occurrences of `component_studly` => `vue_component` + +## v0.19.1 (2024-08-19) + +### Fix + +- fix broken user auth for web API app + +## v0.19.0 (2024-08-18) + +### Feat + +- move multi-column grid sorting logic to wuttaweb +- move single-column grid sorting logic to wuttaweb + +### Fix + +- fix misc. errors in grid template per wuttaweb +- fix broken permission directives in web api startup + +## v0.18.0 (2024-08-16) + +### Feat + +- move "basic" grid pagination logic to wuttaweb +- inherit from wutta base class for Grid +- inherit most logic from wuttaweb, for GridAction + +### Fix + +- avoid route error in user view, when using wutta people view +- fix some more wutta compat for base template + +## v0.17.0 (2024-08-15) + +### Feat + +- use wuttaweb for `get_liburl()` logic + +## v0.16.1 (2024-08-15) + +### Fix + +- improve wutta People view a bit +- update references to `get_class_hierarchy()` +- tweak template for `people/view_profile` per wutta compat + +## v0.16.0 (2024-08-15) + +### Feat + +- add first wutta-based master, for PersonView +- refactor forms/grids/views/templates per wuttaweb compat + +## v0.15.6 (2024-08-13) + +### Fix + +- avoid `before_render` subscriber hook for web API +- simplify verbiage for batch execution panel + +## v0.15.5 (2024-08-09) + +### Fix + +- assign convenience attrs for all views (config, app, enum, model) + +## v0.15.4 (2024-08-09) + +### Fix + +- avoid bug when checking current theme + +## v0.15.3 (2024-08-08) + +### Fix + +- fix timepicker `parseTime()` when value is null + +## v0.15.2 (2024-08-06) + +### Fix + +- use auth handler, avoid legacy calls for role/perm checks + +## v0.15.1 (2024-08-05) + +### Fix + +- move magic `b` template context var to wuttaweb + +## v0.15.0 (2024-08-05) + +### Feat + +- move more subscriber logic to wuttaweb + +### Fix + +- use wuttaweb logic for `util.get_form_data()` + +## v0.14.5 (2024-08-03) + +### Fix + +- use auth handler instead of deprecated auth functions +- avoid duplicate `partial` param when grid reloads data + +## v0.14.4 (2024-07-18) + +### Fix + +- fix more settings persistence bug(s) for datasync/configure +- fix modals for luigi tasks page, per oruga + +## v0.14.3 (2024-07-17) + +### Fix + +- fix auto-collapse title for viewing trainwreck txn +- allow auto-collapse of header when viewing trainwreck txn + +## v0.14.2 (2024-07-15) + +### Fix + +- add null menu handler, for use with API apps + +## v0.14.1 (2024-07-14) + +### Fix + +- update usage of auth handler, per rattail changes +- fix model reference in menu handler +- fix bug when making "integration" menus + +## v0.14.0 (2024-07-14) + +### Feat + +- move core menu logic to wuttaweb + +## v0.13.2 (2024-07-13) + +### Fix + +- fix logic bug for datasync/config settings save + +## v0.13.1 (2024-07-13) + +### Fix + +- fix settings persistence bug(s) for datasync/configure page + +## v0.13.0 (2024-07-12) + +### Feat + +- begin integrating WuttaWeb as upstream dependency + +### Fix + +- cast enum as list to satisfy deform widget + +## v0.12.1 (2024-07-11) + +### Fix + +- refactor `config.get_model()` => `app.model` + +## v0.12.0 (2024-07-09) + +### Feat + +- drop python 3.6 support, use pyproject.toml (again) + +## v0.11.10 (2024-07-05) + +### Fix + +- make the Members tab optional, for profile view + +## v0.11.9 (2024-07-05) + +### Fix + +- do not show flash message when changing app theme + +- improve collapse panels for butterball theme + +- expand input for butterball theme + +- add xref button to customer profile, for trainwreck txn view + +- add optional Transactions tab for profile view + +## v0.11.8 (2024-07-04) + +### Fix + +- fix grid action icons for datasync/configure, per oruga + +- allow view supplements to add extra links for profile employee tab + +- leverage import handler method to determine command/subcommand + +- add tool to make user account from profile view + +## v0.11.7 (2024-07-04) + +### Fix + +- add stacklevel to deprecation warnings + +- require zope.sqlalchemy >= 1.5 + +- include edit profile email/phone dialogs only if user has perms + +- allow view supplements to add to profile member context + +- cast enum as list to satisfy deform widget + +- expand POD image URL setting input + +## v0.11.6 (2024-07-01) + +### Fix + +- set explicit referrer when changing dbkey + +- remove references, dependency for `six` package + +## v0.11.5 (2024-06-30) + +### Fix + +- allow comma in numeric filter input + +- add custom url prefix if needed, for fanstatic + +- use vue 3.4.31 and oruga 0.8.12 by default + +## v0.11.4 (2024-06-30) + +### Fix + +- start/stop being root should submit POST instead of GET + +- require vendor when making new ordering batch via api + +- don't escape each address for email attempts grid + +## v0.11.3 (2024-06-28) + +### Fix + +- add link to "resolved by" user for pending products + +- handle error when merging 2 records fails + +## v0.11.2 (2024-06-18) + +### Fix + +- hide certain custorder settings if not applicable + +- use different logic for buefy/oruga for product lookup keydown + +- product records should be touchable + +- show flash error message if resolve pending product fails + +## v0.11.1 (2024-06-14) + +### Fix + +- revert back to setup.py + setup.cfg + +## v0.11.0 (2024-06-10) + +### Feat + +- switch from setup.cfg to pyproject.toml + hatchling + +## v0.10.16 (2024-06-10) + +### Feat + +- standardize how app, package versions are determined + +### Fix + +- avoid deprecated config methods for app/node title + +## v0.10.15 (2024-06-07) + +### Fix + +- do *not* Use `pkg_resources` to determine package versions + +## v0.10.14 (2024-06-06) + +### Fix + +- use `pkg_resources` to determine package versions + +## v0.10.13 (2024-06-06) + +### Feat + +- remove old/unused scaffold for use with `pcreate` + +- add 'fanstatic' support for sake of libcache assets + +## v0.10.12 (2024-06-04) + +### Feat + +- require pyramid 2.x; remove 1.x-style auth policies + +- remove version cap for deform + +- set explicit referrer when changing app theme + +- add `` component shim + +- include extra styles from `base_meta` template for butterball + +- include butterball theme by default for new apps + +### Fix + +- fix product lookup component, per butterball + +## v0.10.11 (2024-06-03) + +### Feat + +- fix vue3 refresh bugs for various views + +- fix grid bug for tempmon appliance view, per oruga + +- fix ordering worksheet generator, per butterball + +- fix inventory worksheet generator, per butterball + +## v0.10.10 (2024-06-03) + +### Feat + +- more butterball fixes for "view profile" template + +### Fix + +- fix focus for `` shim component + +## v0.10.9 (2024-06-03) + +### Feat + +- let master view control context menu items for page + +- fix the "new custorder" page for butterball + +### Fix + +- fix panel style for PO vs. Invoice breakdown in receiving batch + +## v0.10.8 (2024-06-02) + +### Feat + +- add styling for checked grid rows, per oruga/butterball + +- fix product view template for oruga/butterball + +- allow per-user custom styles for butterball + +- use oruga 0.8.9 by default + +## v0.10.7 (2024-06-01) + +### Feat + +- add setting to allow decimal quantities for receiving + +- log error if registry has no rattail config + +- add column filters for import/export main grid + +- escape all unsafe html for grid data + +- add speedbumps for delete, set preferred email/phone in profile view + +- fix file upload widget for oruga + +### Fix + +- fix overflow when instance header title is too long (butterball) + +## v0.10.6 (2024-05-29) + +### Feat + +- add way to flag organic products within lookup dialog + +- expose db picker for butterball theme + +- expose quickie lookup for butterball theme + +- fix basic problems with people profile view, per butterball + +## v0.10.5 (2024-05-29) + +### Feat + +- add `` component for oruga + +## v0.10.4 (2024-05-12) + +### Fix + +- fix styles for grid actions, per butterball + +## v0.10.3 (2024-05-10) + +### Fix + +- fix bug with grid date filters + +## v0.10.2 (2024-05-08) + +### Feat + +- remove version restriction for pyramid_beaker dependency + +- rename some attrs etc. for buefy components used with oruga + +- fix "tools" helper for receiving batch view, per oruga + +- more data type fixes for ```` + +- fix "view receiving row" page, per oruga + +- tweak styles for grid action links, per butterball + +### Fix + +- fix employees grid when viewing department (per oruga) + +- fix login "enter" key behavior, per oruga + +- fix button text for autocomplete + +## v0.10.1 (2024-04-28) + +### Feat + +- sort list of available themes + +- update various icon names for oruga compatibility + +- show "View This" button when cloning a record + +- stop including 'falafel' as available theme + +### Fix + +- fix vertical alignment in main menu bar, for butterball + +- fix upgrade execution logic/UI per oruga + +## v0.10.0 (2024-04-28) + +This version bump is to reflect adding support for Vue 3 + Oruga via +the 'butterball' theme. There is likely more work to be done for that +yet, but it mostly works at this point. + +### Feat + +- misc. template and view logic tweaks (applicable to all themes) for + better patterns, consistency etc. + +- add initial support for Vue 3 + Oruga, via "butterball" theme + + +## Older Releases + +Please see `docs/OLDCHANGES.rst` for older release notes. diff --git a/MANIFEST.in b/MANIFEST.in index 0114904a..a3d57f93 100644 --- a/MANIFEST.in +++ b/MANIFEST.in @@ -11,6 +11,8 @@ recursive-include tailbone/static *.jpg recursive-include tailbone/static *.gif recursive-include tailbone/static *.ico +recursive-include tailbone/static/files * + recursive-include tailbone/templates *.mako recursive-include tailbone/templates *.pt recursive-include tailbone/reports *.mako diff --git a/README.rst b/README.md similarity index 56% rename from README.rst rename to README.md index 0cffc62d..74c007f6 100644 --- a/README.rst +++ b/README.md @@ -1,10 +1,8 @@ -Tailbone -======== +# Tailbone Tailbone is an extensible web application based on Rattail. It provides a "back-office network environment" (BONE) for use in managing retail data. -Please see Rattail's `home page`_ for more information. - -.. _home page: http://rattailproject.org/ +Please see Rattail's [home page](http://rattailproject.org/) for more +information. diff --git a/CHANGES.rst b/docs/OLDCHANGES.rst similarity index 50% rename from CHANGES.rst rename to docs/OLDCHANGES.rst index a8e4a3de..0a802f40 100644 --- a/CHANGES.rst +++ b/docs/OLDCHANGES.rst @@ -2,6 +2,3725 @@ CHANGELOG ========= +NB. this file contains "old" release notes only. for newer releases +see the `CHANGELOG.md` file in the source root folder. + + +0.9.96 (2024-04-25) +------------------- + +* Remove unused code for ``webhelpers2_grid``. + +* Rename setting for custom user css (remove "buefy"). + +* Fix permission checks for root user with pyramid 2.x. + +* Cleanup grid/filters logic a bit. + +* Use normal (not checkbox) button for grid filters. + +* Tweak icon for Download Results button. + +* Use v-model to track selection etc. for download results fields. + +* Allow deleting rows from executed batches. + + +0.9.95 (2024-04-19) +------------------- + +* Fix ASGI websockets when serving on sub-path under site root. + +* Fix raw query to avoid SQLAlchemy 2.x warnings. + +* Remove config "style" from appinfo page. + + +0.9.94 (2024-04-16) +------------------- + +* Fix master template bug when no form in context. + + +0.9.93 (2024-04-16) +------------------- + +* Improve form support for view supplements. + +* Prevent multi-click for grid filters "Save Defaults" button. + +* Fix typo when getting app instance. + + +0.9.92 (2024-04-16) +------------------- + +* Escape underscore char for "contains" query filter. + +* Rename custom ``user_css`` context. + +* Add support for Pyramid 2.x; new security policy. + + +0.9.91 (2024-04-15) +------------------- + +* Avoid uncaught error when updating order batch row quantities. + +* Try to return JSON error when receiving API call fails. + +* Avoid error for tax field when creating new department. + +* Show toast msg instead of silent error, when grid fetch fails. + +* Remove most references to "buefy" name in class methods, template + filenames etc. + + +0.9.90 (2024-04-01) +------------------- + +* Add basic CRUD for Person "preferred first name". + + +0.9.89 (2024-03-27) +------------------- + +* Fix bulk-delete rows for import/export batch. + + +0.9.88 (2024-03-26) +------------------- + +* Update some SQLAlchemy logic per upcoming 2.0 changes. + + +0.9.87 (2023-12-26) +------------------- + +* Auto-disable submit button for login form. + +* Hide single invoice file field for multi-invoice receiving batch. + +* Use common logic to render invoice total for receiving. + +* Expose default custorder discount for Departments. + + +0.9.86 (2023-12-12) +------------------- + +* Use ``ltrim(rtrim())`` instead of just ``trim()`` in grid filters. + + +0.9.85 (2023-12-01) +------------------- + +* Use clientele handler to populate customer dropdown widget. + + +0.9.84 (2023-11-30) +------------------- + +* Provide a way to show enum display text for some version diff fields. + + +0.9.83 (2023-11-30) +------------------- + +* Avoid error when editing a department. + + +0.9.82 (2023-11-19) +------------------- + +* Fix DB picker, theme picker per Buefy conventions. + + +0.9.81 (2023-11-15) +------------------- + +* Log warning instead of error for batch population error. + +* Remove reference to ``pytz`` library. + +* Avoid outright error if user scans barcode for inventory count. + + +0.9.80 (2023-11-05) +------------------- + +* Expose status code for equity payments. + + +0.9.79 (2023-11-01) +------------------- + +* Add button to confirm all costs for receiving. + + +0.9.78 (2023-11-01) +------------------- + +* Use shared logic to get batch handler. + +* Fix config key for default themes list. + + +0.9.77 (2023-11-01) +------------------- + +* Encode values for "between" query filter. + +* Avoid error when rendering version diff. + + +0.9.76 (2023-11-01) +------------------- + +* Fix missing import. + + +0.9.75 (2023-11-01) +------------------- + +* Add deprecation warnings for ambgiguous config keys. + + +0.9.74 (2023-10-30) +------------------- + +* Log warning / avoid error if email profile can't be normalized. + + +0.9.73 (2023-10-29) +------------------- + +* Add way to "ignore" a pending product. + +* Tweak param docs for ``Form.set_validator()``. + +* Remove unused "simple menus" module approach. + + +0.9.72 (2023-10-26) +------------------- + +* Use product lookup component for "resolve pending product" tool. + + +0.9.71 (2023-10-25) +------------------- + +* Fix bug when editing vendor. + +* Show user warning if "add item to custorder" fails. + +* Allow pending product fields to be required, for new custorder. + +* Add price confirm prompt when adding unknown item to custorder. + +* Use ```` for theme picker. + +* Add ``column_only`` kwarg for ``Grid.set_label()`` method. + +* Do not show profile buttons for inactive customer shoppers. + +* Add separate perm for making new custorder for unknown product. + +* Expand the "product lookup" component to include autocomplete. + + +0.9.70 (2023-10-24) +------------------- + +* Fix config file priority for display, and batch subprocess commands. + + +0.9.69 (2023-10-24) +------------------- + +* Allow override of version diff for master views. + +* No need to configure logging. + + +0.9.68 (2023-10-23) +------------------- + +* Expose more permissions for POS. + +* Fix order xlsx download if missing order date. + +* Replace dropdowns with autocomplete, for "find principals by perm". + +* Use ``Grid.make_sorter()`` instead of legacy code. + +* Avoid "None" when rendering product UOM field. + +* Fix default grid filter when "local" date times are involved. + +* Expose new fields for POS batch/row. + +* Remove sorter for "Credits?" column in purchasing batch row grid. + +* Add validation to prevent duplicate files for multi-invoice receiving. + +* Include invoice number for receiving batch row API. + +* Show food stamp tender info for POS batch. + +* Stop using sa-filters for basic grid sorting. + + +0.9.67 (2023-10-12) +------------------- + +* Fix grid sorting when column key/name differ. + +* Expose department tax, FS flag. + +* Add permission for testing error handling at POS. + +* Add some awareness of suspend/resume for POS batch. + +* Fix version child classes for Customers view. + + +0.9.66 (2023-10-11) +------------------- + +* Make grid JS ``loadAsyncData()`` method truly async. + +* Add support for multi-column grid sorting. + +* Add smarts to show display text for some version diff fields. + +* Allow null for FalafelDateTime form fields. + +* Show full version history within the "view" page. + +* Use autocomplete instead of dropdown for grid "add filter". + + +0.9.65 (2023-10-07) +------------------- + +* Avoid deprecated logic for fetching vendor contact email/phone. + +* Add "mark complete" button for inventory batch row entry page. + +* Expose tender ref in POS batch rows; new tender flags. + +* Improve views for taxes, esp. in POS batches. + + +0.9.64 (2023-10-06) +------------------- + +* Fix bug for param helptext in New Report page. + + +0.9.63 (2023-10-06) +------------------- + +* Fix CRUD pages for tempmon clients, probes. + +* Fix bug in POS batch view. + +* Expose permissions for POS, if so configured. + + +0.9.62 (2023-10-04) +------------------- + +* Avoid deprecated ``pretty_hours()`` function. + +* Improve master view ``oneoff_import()`` method. + + +0.9.61 (2023-10-04) +------------------- + +* Use enum to display ``POS_ROW_TYPE``. + +* Expose cash-back flags for tenders. + +* Re-work FalafelDateTime logic a bit. + + +0.9.60 (2023-10-01) +------------------- + +* Do not allow executing custorder if no customer is set. + +* Add clone support for POS batches. + +* Expose views for tenders, more columns for POS batch/rows. + +* Tidy up logic for vendor filtering in products grid. + +* Add support for void rows in POS batch. + + +0.9.59 (2023-09-25) +------------------- + +* Add custom form type/widget for time fields. + + +0.9.58 (2023-09-25) +------------------- + +* Expose POS batch views as "typical". + + +0.9.57 (2023-09-24) +------------------- + +* Show yesterday by default for Trainwreck if so configured. + +* Add ``remove_sorter()`` method for grids. + +* Show "true" (calculated) equity total in members grid. + +* Add basic views for POS batches. + +* Show customer for POS batches. + +* Use header button instead of link for "touch" instance. + + +0.9.56 (2023-09-19) +------------------- + +* Add link to vendor name for receiving batches grid. + +* Prevent catalog/invoice cost edits if receiving batch is complete. + +* Use small text input for receiving cost editor fields. + +* Show catalog/invoice costs as 2-decimal currency in receiving. + + +0.9.55 (2023-09-18) +------------------- + +* Show user warning if receive quick lookup fails. + +* Fix bug for new receiving from scratch via API. + + +0.9.54 (2023-09-17) +------------------- + +* Add "falafel" custom date/time field type and widget. + +* Avoid error when history has blanks for ordering worksheet. + +* Include PO number for receiving batch details via API. + +* Tweaks to improve handling of "missing" items for receiving. + + +0.9.53 (2023-09-16) +------------------- + +* Make member key field readonly when viewing equity payment. + + +0.9.52 (2023-09-15) +------------------- + +* Add basic feature for "grid totals". + + +0.9.51 (2023-09-15) +------------------- + +* Tweak default field list for batch views. + +* Add ``get_rattail_app()`` method for view supplements. + + +0.9.50 (2023-09-12) +------------------- + +* Avoid legacy logic for ``Customer.people`` schema. + +* Show events instead of notes, in field subgrid for custorder item. + + +0.9.49 (2023-09-11) +------------------- + +* Add custom hook for grid "apply filters". + +* Use common POST logic for submitting new customer order. + +* Optionally configure SQLAlchemy Session with ``future=True``. + +* Show related customer orders for Pending Product view. + +* Set stacklevel for all deprecation warnings. + +* Add support for toggling custorder item "flagged". + +* Add support for "mark received" when viewing custorder item. + +* Misc. improvements for custorder views. + + +0.9.48 (2023-09-08) +------------------- + +* Add grid link for equity payment description. + +* Fix msg body display, download link for email bounces. + +* Fix member key display for equity payment form. + + +0.9.47 (2023-09-07) +------------------- + +* Fallback to None when getting values for merge preview. + + +0.9.46 (2023-09-07) +------------------- + +* Improve display for member equity payments. + + +0.9.45 (2023-09-02) +------------------- + +* Add grid filter type for BigInteger columns. + +* Add products API route to fetch label profiles for use w/ printing. + +* Tweaks for cost editing within a receiving batch. + + +0.9.44 (2023-08-31) +------------------- + +* Avoid deprecated ``User.email_address`` property. + +* Preserve URL hash when redirecting in grid "reset to defaults". + + +0.9.43 (2023-08-30) +------------------- + +* Let "new product" batch override type-2 UPC lookup behavior. + + +0.9.42 (2023-08-29) +------------------- + +* When bulk-deleting, skip objects which are not "deletable". + +* Declare "from PO" receiving workflow if applicable, in API. + +* Auto-select text when editing costs for receiving. + +* Include shopper history from parent customer account perspective. + +* Link to product record, for New Product batch row. + +* Fix profile history to show when a CustomerShopperHistory is deleted. + +* Fairly massive overhaul of the Profile view; standardize tabs etc.. + +* Add support for "missing" credit in mobile receiving. + + +0.9.41 (2023-08-08) +------------------- + +* Add common logic to validate employee reference field. + +* Fix HTML rendering for UOM choice options. + +* Fix custom cell click handlers in main buefy grid tables. + + +0.9.40 (2023-08-03) +------------------- + +* Make system key searchable for problem report grid. + + +0.9.39 (2023-07-15) +------------------- + +* Show invoice number for each row in receiving. + +* Tweak display options for tempmon probe readings graph. + + +0.9.38 (2023-07-07) +------------------- + +* Optimize "auto-receive" batch process. + + +0.9.37 (2023-07-03) +------------------- + +* Avoid deprecated product key field getter. + +* Allow "arbitrary" PO attachment to purchase batch. + + +0.9.36 (2023-06-20) +------------------- + +* Include user "active" flag in profile view context. + + +0.9.35 (2023-06-20) +------------------- + +* Add views etc. for member equity payments. + +* Improve merge support for records with no uuid. + +* Turn on quickie person search for CustomerShopper views. + + +0.9.34 (2023-06-17) +------------------- + +* Add basic Shopper tab for profile view. + +* Cleanup some wording in profile view template. + +* Tweak ``SimpleRequestMixin`` to not rely on ``response.data.ok``. + +* Add support for Notes tab in profile view. + +* Add basic support for Person quickie lookup. + +* Hide unwanted revisions for CustomerPerson etc. + +* Fix some things for viewing a member. + + +0.9.33 (2023-06-16) +------------------- + +* Update usage of app handler per upstream changes. + + +0.9.32 (2023-06-16) +------------------- + +* Fix grid filter bug when switching from 'equal' to 'between' verbs. + +* Add users context data for profile view. + +* Join the Person model for Customers grid differently based on config. + + +0.9.31 (2023-06-15) +------------------- + +* Prefer account holder, shoppers over legacy ``Customers.people``. + + +0.9.30 (2023-06-12) +------------------- + +* Add basic support for exposing ``Customer.shoppers``. + +* Move "view history" and related buttons, for person profile view. + +* Consider vendor catalog batch views "typical". + +* Let external customer link buttons be more dynamic, for profile view. + +* Add options for grid results to link straight to Profile view. + +* Change label for Member.person to "Account Holder". + + +0.9.29 (2023-06-06) +------------------- + +* Add "typical" view config, for e.g. Theo and the like. + +* Add customer number filter for People grid. + +* Tweak logic for ``MasterView.get_action_route_kwargs()``. + +* Add "touch" support for Members. + +* Add support for "configured customer/member key". + +* Use *actual* current URL for user feedback msg. + +* Remove old/unused feedback templates. + +* Add basic support for membership types. + +* Add support for version history in person profile view. + + +0.9.28 (2023-06-02) +------------------- + +* Expose mail handler and template paths in email config page. + + +0.9.27 (2023-06-01) +------------------- + +* Share some code for validating vendor field. + +* Save datasync config with new keys, per RattailConfiguration. + + +0.9.26 (2023-05-25) +------------------- + +* Prevent bug in upgrade diff for empty new version. + +* Expose basic way to send test email. + +* Avoid error when filter params not valid. + +* Tweak byjove project generator form. + +* Define essential views for API. + + +0.9.25 (2023-05-18) +------------------- + +* Add initial swagger.json endpoint for API. + +* Add workaround for "share grid link" on insecure sites. + + +0.9.24 (2023-05-16) +------------------- + +* Replace ``setup.py`` contents with ``setup.cfg``. + +* Prevent error in old product search logic. + + +0.9.23 (2023-05-15) +------------------- + +* Get rid of ``newstyle`` flag for ``Form.validate()`` method. + +* Add basic support for managing, and accepting API tokens. + + +0.9.22 (2023-05-13) +------------------- + +* Tweak button wording in "find role by perm" form. + +* Warn user if DB not up to date, in new table wizard. + + +0.9.21 (2023-05-10) +------------------- + +* Move row delete check logic for receiving to batch handler. + + +0.9.20 (2023-05-09) +------------------- + +* Add form config for generating 'shopfoo' projects. + +* Misc. tweaks for "run import job" form. + + +0.9.19 (2023-05-05) +------------------- + +* Massive overhaul of "generate project" feature. + +* Include project views by default, in "essential" views. + + +0.9.18 (2023-05-03) +------------------- + +* Avoid error if tempmon probe has invalid status. + +* Expose, honor the ``prevent_password_change`` flag for Users. + + +0.9.17 (2023-04-17) +------------------- + +* Allow bulk-delete for products grid. + +* Improve global menu search behavior for multiple terms. + + +0.9.16 (2023-03-27) +------------------- + +* Avoid accidental auto-submit of new msg form, for subject field. + +* Add ``has_perm()`` etc. to request during the NewRequest event. + +* Fix table sorting for FK reference column in new table wizard. + +* Overhaul the "find by perm" feature a bit. + + +0.9.15 (2023-03-15) +------------------- + +* Remove version workaround for sphinx. + +* Let providers do DB connection setup for web API. + + +0.9.14 (2023-03-09) +------------------- + +* Fix JSON rendering for Cornice API views. + + +0.9.13 (2023-03-08) +------------------- + +* Remove version cap for cornice, now that we require python3. + + +0.9.12 (2023-03-02) +------------------- + +* Add "equal to any of" verb for string-type grid filters. + +* Allow download results for Trainwreck. + + +0.9.11 (2023-02-24) +------------------- + +* Allow sort/filter by vendor for sample files grid. + + +0.9.10 (2023-02-22) +------------------- + +* Add views for sample vendor files. + + +0.9.9 (2023-02-21) +------------------ + +* Validate vendor for catalog batch upload. + + +0.9.8 (2023-02-20) +------------------ + +* Make ``config`` param more explicit, for GridFilter constructor. + + +0.9.7 (2023-02-14) +------------------ + +* Add dedicated view config methods for "view" and "edit help". + + +0.9.6 (2023-02-12) +------------------ + +* Refactor ``Query.get()`` => ``Session.get()`` per SQLAlchemy 1.4. + + +0.9.5 (2023-02-11) +------------------ + +* Use sa-filters instead of sqlalchemy-filters for API queries. + + +0.9.4 (2023-02-11) +------------------ + +* Remove legacy grid for alt codes in product view. + + +0.9.3 (2023-02-10) +------------------ + +* Add dependency for pyramid_retry. + +* Use latest zope.sqlalchemy package. + +* Fix auto-advance on ENTER for login form. + +* Use label handler to avoid deprecated logic. + +* Remove legacy vendor sources grid for product view. + +* Expose setting for POD image URL. + +* Fix multi-file upload widget bug. + + +0.9.2 (2023-02-03) +------------------ + +* Fix auto-focus username for login form. + + +0.9.1 (2023-02-03) +------------------ + +* Stop including deform JS static files. + + +0.9.0 (2023-02-03) +------------------ + +* Officially drop support for python2. + +* Remove all deprecated jquery and ``use_buefy`` logic. + +* Add new Buefy-specific upgrade template. + +* Replace 'default' theme to match 'falafel'. + +* Allow editing the Department field for a Subdepartment. + +* Refactor the Ordering Worksheet generator, per Buefy. + + +0.8.292 (2023-02-02) +-------------------- + +* Always assume ``use_buefy=True`` within main page template. + + +0.8.291 (2023-02-02) +-------------------- + +* Fix checkbox behavior for Inventory Worksheet. + +* Form constructor assumes ``use_buefy=True`` by default. + + +0.8.290 (2023-02-02) +-------------------- + +* Remove support for Buefy 0.8. + +* Add progress bar page for Buefy theme. + + +0.8.289 (2023-01-30) +-------------------- + +* Fix icon for multi-file upload widget. + +* Tweak customer panel header style for new custorder. + +* Add basic API support for printing product labels. + +* Tweak the Ordering Worksheet generator, per Buefy. + +* Refactor the Inventory Worksheet generator, per Buefy. + + +0.8.288 (2023-01-28) +-------------------- + +* Tweak import handler form, some fields not required. + +* Tweak styles for Quantity panel when viewing Receiving row. + + +0.8.287 (2023-01-26) +-------------------- + +* Fix click event for right-aligned buttons on profile view. + + +0.8.286 (2023-01-18) +-------------------- + +* Add some more menu items to default set. + +* Add default view config for Trainwreck. + +* Rename frontend request handler logic to ``SimpleRequestMixin``. + + +0.8.285 (2023-01-18) +-------------------- + +* Misc. tweaks for App Details / Configure Menus. + +* Add specific data type options for new table entry form. + +* Add more views, menus to default set. + +* Add way to override particular 'essential' views. + + +0.8.284 (2023-01-15) +-------------------- + +* Let the API "rawbytes" response be just that, w/ no file. + +* Fix bug when adding new profile via datasync configure. + +* Add default logic to get merge data for object. + +* Add new handlers, TailboneHandler and MenuHandler. + +* Add full set of default menus. + +* Wrap up steps for new table wizard. + +* Add basic "new model view" wizard. + + +0.8.283 (2023-01-14) +-------------------- + +* Tweak how backfill task is launched. + + +0.8.282 (2023-01-13) +-------------------- + +* Show basic column info as row grid when viewing Table. + +* Semi-finish logic for writing new table model class to file. + +* Fix "toggle batch complete" for Chrome browser. + +* Revert logic that assumes all themes use buefy. + +* Refactor tempmon dashboard view, for buefy themes. + +* Prevent listing for top-level Messages view. + + +0.8.281 (2023-01-12) +-------------------- + +* Add new views for App Info, and Configure App. + + +0.8.280 (2023-01-11) +-------------------- + +* Allow all external dependency URLs to be set in config. + + +0.8.279 (2023-01-11) +-------------------- + +* Add basic support for receiving from multiple invoice files. + +* Add support for per-item default discount, for new custorder. + +* Fix panel header icon behavior for new custorder. + +* Refactor inventory batch "add row" page, per new theme. + + +0.8.278 (2023-01-08) +-------------------- + +* Improve "download rows as XLSX" for importer batch. + + +0.8.277 (2023-01-07) +-------------------- + +* Expose, start to honor "units only" setting for products. + + +0.8.276 (2023-01-05) +-------------------- + +* Keep aspect ratio for product images in new custorder. + +* Fix template bug for generating report. + +* Show help link when generating or viewing report, if applicable. + +* Use product handler to normalize data for products API. + + +0.8.275 (2023-01-04) +-------------------- + +* Allow xref buttons to have "internal" links. + + +0.8.274 (2023-01-02) +-------------------- + +* Show only "core" app settings by default. + +* Allow buefy version to be 'latest'. + +* Add beginnings of "New Table" feature. + +* Make invalid email more obvious, in profile view. + +* Expose some settings for Trainwreck DB rotation. + + +0.8.273 (2022-12-28) +-------------------- + +* Add support for Buefy 0.9.x. + +* Warn user when luigi is not installed, for relevant view. + +* Fix HUD display when toggling employee status in profile view. + +* Fix checkbox values when re-running a report. + +* Make static files optional, for new tailbone-integration project. + +* Preserve current tab for page reload in profile view. + +* Add cleanup logic for old Beaker session data. + +* Add basic support for editing help info for page, fields. + +* Override document title when upgrading. + +* Filter by person instead of user, for Generated Reports "Created by". + +* Add "direct link" support for master grids. + +* Add support for websockets over HTTP. + +* Fix product image view for python3. + +* Add "global searchbox" for quicker access to main views. + +* Use minified version of vue.js by default, in falafel theme. + + +0.8.272 (2022-12-21) +-------------------- + +* Add support for "is row checkable" in grids. + +* Add ``make_status_renderer()`` to MasterView. + +* Expose the ``terms`` field for Vendor CRUD. + + +0.8.271 (2022-12-15) +-------------------- + +* Add ``configure_execute_form()`` hook for batch views. + + +0.8.270 (2022-12-10) +-------------------- + +* Fix error if no view supplements defined. + + +0.8.269 (2022-12-10) +-------------------- + +* Show simple error string, when subprocess batch actions fail. + +* Fix ordering worksheet API for date objects. + +* Add the ViewSupplement concept. + +* Cleanup employees view per new supplements. + +* Add common logic for xref buttons, links when viewing object. + +* Add common logic to determine panel fields for product view. + +* Add xref buttons for Customer, Member tabs in profile view. + +* Suppress error if menu entry has bad route name. + + +0.8.268 (2022-12-07) +-------------------- + +* Add support for Beaker >= 1.12.0. + + +0.8.267 (2022-12-06) +-------------------- + +* Fix bug when viewing certain receiving batches. + + +0.8.266 (2022-12-06) +-------------------- + +* Add simple template hook for "before object helpers". + +* Include email address for current API user info. + +* Add support for editing catalog cost in receiving batch, per new theme. + +* Add receiving workflow as param when making receiving batch. + +* Show invoice cost in receiving batch, if "from scratch". + +* Add support for editing invoice cost in receiving batch, per new theme. + +* Add helptext for "Admin-ish" field when editing Role. + + +0.8.265 (2022-12-01) +-------------------- + +* Add way to quickly re-run "any" report. + +* Avoid web config when launching overnight task. + + +0.8.264 (2022-11-28) +-------------------- + +* Add prompt dialog when launching overnight task. + +* Fix page title for datasync status. + +* Use newer config strategy for all views. + +* Auto-format phone number when saving for contact records. + + +0.8.263 (2022-11-21) +-------------------- + +* Update 'testing' watermark for dev background. + +* Let the Luigi handler take care of removing some DB settings. + + +0.8.262 (2022-11-20) +-------------------- + +* Add luigi module/class awareness for overnight tasks. + + +0.8.261 (2022-11-20) +-------------------- + +* Allow disabling, or per-day scheduling, of problem reports. + +* Fix how keys are stored for luigi overnight/backfill tasks. + + +0.8.260 (2022-11-18) +-------------------- + +* Turn on download results feature for Employees. + + +0.8.259 (2022-11-17) +-------------------- + +* Add "between" verb for numeric grid filters. + + +0.8.258 (2022-11-15) +-------------------- + +* Let the auth handler manage user merge. + + +0.8.257 (2022-11-03) +-------------------- + +* Add template method for rendering row grid component. + +* Use people handler to update address. + +* Fix start_date param for pricing batch upload. + +* Use shared logic for rendering percentage values. + +* Log a warning to troubleshoot luigi restart failure. + +* Show UPC for receiving line item if no product reference. + + +0.8.256 (2022-09-09) +-------------------- + +* Add basic per-item discount support for custorders. + +* Make past item lookup optional for custorders. + +* Do not convert date if already a date (for grid filters). + +* Avoid use of ``self.handler`` within batch API views. + + +0.8.255 (2022-09-06) +-------------------- + +* Include ``WorkOrder.estimated_total`` for API. + +* Add default normalize logic for API views. + +* Disable "Delete Results" button if no results, for row grid. + +* Move logic for "bulk-delete row objects" into MasterView. + +* Convert value for more date filters; only add condition if valid. + + +0.8.254 (2022-08-30) +-------------------- + +* Improve parsing of purchase order quantities. + +* Expose more attrs for new product batch rows. + + +0.8.253 (2022-08-30) +-------------------- + +* Convert value for date filter; only add condition if valid. + +* Add 'warning' flash messages to old jquery base template. + +* Add uom fields, configurable template for newproduct batch. + + +0.8.252 (2022-08-25) +-------------------- + +* Avoid error when no datasync profiles configured. + +* Add max lengths when editing person name via profile view. + + +0.8.251 (2022-08-24) +-------------------- + +* Fix index title for datasync configure page. + +* Add basic support for backfill Luigi tasks. + + +0.8.250 (2022-08-21) +-------------------- + +* Add ``render_person_profile()`` method to MasterView. + +* Add way to declare failure for an upgrade. + +* Add websockets progress, "multi-system" support for upgrades. + +* Add global context from handler, for email previews. + +* Allow configuring datasync watcher kwargs. + +* Expose, honor "admin-ish" flag for roles. + + +0.8.249 (2022-08-18) +-------------------- + +* Add brief delay before declaring websocket broken. + +* Add basic views for Luigi / overnight tasks. + +* Expose setting for auto-correct when receiving from invoice. + + +0.8.248 (2022-08-17) +-------------------- + +* Redirect to custom index URL when user cancels new custorder entry. + +* Add ``get_next_url_after_submit_new_order()`` for customer orders. + +* Add first experiment with websockets, for datasync status page. + +* Allow user feedback to request email reply back. + + +0.8.247 (2022-08-14) +-------------------- + +* Avoid double-quotes in field error messages JS code. + +* Add the FormPosterMixin to ProfileInfo component. + +* Fix default help URLs for ordering, receiving. + +* Move handheld batch view module to appropriate location. + +* Refactor usage of ``get_vendor()`` lookup. + +* Consolidate master API view logic. + + +0.8.246 (2022-08-12) +-------------------- + +* Couple of API tweaks for work orders. + +* Standardize merge logic when a handler is defined for it. + + +0.8.245 (2022-08-10) +-------------------- + +* Add convenience wrapper to make customer field widget, etc.. + +* Some API tweaks to support a byjove app. + +* Tweak flash msg, logging when batch population fails. + +* Log traceback output when batch action subprocess fails. + +* Add initial views for work orders. + +* Fix sequence of events re: grid component creation. + +* Allow download results for Customers grid. + + +0.8.244 (2022-08-08) +-------------------- + +* Add separate product grid filters for Category Code, Category Name. + + +0.8.243 (2022-08-08) +-------------------- + +* Add button to raise bogus error, for testing email alerts. + +* Make sure "configure" pages use AppHandler to save/delete settings. + +* Expose setting for sendmail failure alerts. + + +0.8.242 (2022-08-07) +-------------------- + +* Always show "all" email settings if user has config perm. + + +0.8.241 (2022-08-06) +-------------------- + +* Add support for toggling visibility of email profile settings. + + +0.8.240 (2022-08-05) +-------------------- + +* Clean up URL routes for row CRUD. + + +0.8.239 (2022-08-04) +-------------------- + +* Invalidate config cache when raw setting is deleted. + + +0.8.238 (2022-08-03) +-------------------- + +* Improve "touch" logic for employees. + +* Stop using the old ``rattail.db.api.settings`` module. + +* Force cache invalidation when Raw Setting is edited. + + +0.8.237 (2022-07-27) +-------------------- + +* Add some more views to potentially include via poser. + +* Misc. improvements for desktop receiving views. + + +0.8.236 (2022-07-25) +-------------------- + +* Add setting to expose/hide "active in POS" customer flag. + +* Allow optional row grid title for master view. + +* Add basic/minimal merge support for customers. + +* Assume default vendor for new receiving batch. + +* Add basic edit support for Purchases. + +* Add ``iter(Form)`` logic, to loop through fields. + +* Add "auto-receive all items" support for receiving batch API. + + +0.8.235 (2022-07-22) +-------------------- + +* Split out rendering of ``this-page`` component in falafel theme. + +* Allow download of results for common product-related tables. + +* Make caching products optional, when creating vendor catalog batch. + +* Expose the ``complete`` flag for pricing batch. + +* Add ``template_kwargs_clone()`` stub for master view. + +* Misc deform template improvements. + + +0.8.234 (2022-07-18) +-------------------- + +* Fix form validation for app settings page w/ buefy theme. + +* Honor default pagesize for all grids, per setting. + +* Add basic "download results" for Subdepartments grid. + +* Add new-style config defaults for BrandView. + + +0.8.233 (2022-06-24) +-------------------- + +* Add minimal buefy support for 'percentinput' field widget. + +* Add autocomplete support for subdepartments. + + +0.8.232 (2022-06-14) +-------------------- + +* Let default grid page size correspond to first option. + +* Add start date support for "future" pricing batch. + + +0.8.231 (2022-05-15) +-------------------- + +* Expose config for identifying supported vendors. + +* Allow restricting to supported vendors only, for Receiving. + + +0.8.230 (2022-05-10) +-------------------- + +* Sort roles list when viewing a user. + +* Add grid workarounds when data is list instead of query. + + +0.8.229 (2022-05-03) +-------------------- + +* Tweak how family data is displayed. + + +0.8.228 (2022-04-13) +-------------------- + +* Fix quotes for field helptext. + +* Flush early when populating batch, to ensure error is shown. + + +0.8.227 (2022-04-04) +-------------------- + +* Add touch for report codes. + +* Raise 404 if report not found. + +* Add template kwargs stub for ``view_row()``. + +* Log error when failing to submit new custorder batch. + +* Honor case vs. unit restrictions for new custorder. + +* Tweak where description field is shown for receiving batch. + +* Fix "touch" url for non-standard record types. + + +0.8.226 (2022-03-29) +-------------------- + +* Let errors raise when showing poser reports. + + +0.8.225 (2022-03-29) +-------------------- + +* Force session flush within try/catch, for batch refresh. + + +0.8.224 (2022-03-25) +-------------------- + +* Improve vendor validation for new receiving batch. + +* Use common logic for fetching batch handler. + + +0.8.223 (2022-03-21) +-------------------- + +* Show link to txn as field when viewing trainwreck item. + + +0.8.222 (2022-03-17) +-------------------- + +* Expose custorder xref markers for trainwreck. + + +0.8.221 (2022-03-16) +-------------------- + +* Always show batch params by default when viewing. + +* Show helptext when applicable for "new batch from product query". + +* Make problem report titles searchable in grid. + + +0.8.220 (2022-03-15) +-------------------- + +* Log error instead of warning, when batch population fails. + +* Add default help link for Receiving feature. + + +0.8.219 (2022-03-10) +-------------------- + +* Cleanup grid filters for vendor catalog batches. + +* Cleanup view config syntax for vendor catalog batch. + +* Add workaround when inserting new fields to form field list. + +* Add ``Form.insert()`` method, to insert field based on index. + +* Default behavior for report chooser should *not* be form/dropdown. + + +0.8.218 (2022-03-08) +-------------------- + +* Log warning/traceback when failing to include a configured view. + +* Fix gotcha when defining new provider views. + +* Bump the default Buefy version to 0.8.13. + + +0.8.217 (2022-03-07) +-------------------- + +* Add the "provider" concept, let them configure db sessions. + +* Let providers add extra views, options for includes config. + +* Let tailbone providers include static views. + +* Link to email settings profile when viewing email attempt. + + +0.8.216 (2022-03-05) +-------------------- + +* Show list of generated reports when viewing Poser Report. + +* Show link back to Poser Report when viewing Generated Report. + +* Always include ``app_title`` in global template rendering context. + +* Update some more view config syntax. + +* Make common web view a bit more common. + +* Improve the Poser Setup page; allow poser dir refresh. + +* Add initial/basic support for configuring "included views". + +* Add ``tailbone.views.essentials`` to include common / "core" views. + +* Add flash message when upgrade execution completes (pass or fail). + + +0.8.215 (2022-03-02) +-------------------- + +* Show toast msg instead of alert after sending feedback. + +* Add basic support for Poser reports, list/create. + + +0.8.214 (2022-03-01) +-------------------- + +* Params should be readonly when editing batch. + +* Tweak styles for links in object helper panel. + + +0.8.213 (2022-03-01) +-------------------- + +* Add simple searchable column support for non-AJAX grids. + +* Fix stdout/stderr fields for upgrade view. + +* Pass query along for download results, so subclass can modify. + +* Avoid making discounts data if missing field, for trainwreck item view. + + +0.8.212 (2022-02-26) +-------------------- + +* Add page/way to configure main menus. + + +0.8.211 (2022-02-25) +-------------------- + +* Add view template stub for trainwreck transaction. + +* Add auto-filter hyperlinks for batch row status breakdown. + +* Auto-filter hyperlinks for PO vs. invoice breakdown in Receiving. + +* Add grid hyperlinks for trainwreck transaction line items. + +* Use dict instead of custom object to represent menus. + +* Expose "discount type" for Trainwreck line items. + + +0.8.210 (2022-02-20) +-------------------- + +* Only show DB picker for permissioned users. + +* Expose some new trainwreck fields; per-item discounts. + +* Show SRP as currency for vendor catalog batch. + + +0.8.209 (2022-02-16) +-------------------- + +* Fix progress bar when running problem report. + + +0.8.208 (2022-02-15) +-------------------- + +* Allow override of navbar-end element in falafel theme header. + +* Add initial support for editing user preferences. + +* Add FormPosterMixin to WholePage class. + + +0.8.207 (2022-02-13) +-------------------- + +* Try out new config defaults function for some views (user, customer). + +* Add highlight for non-active users, customers in grid. + +* Prevent cache for index pages by default, unless configured not to. + +* Cleanup labels for Vendor/Code "preferred" vs. "any" in products grid. + +* Add config for showing ordered vs. shipped amounts when receiving. + +* Tweak how "duration" fields are rendered for grids, forms. + +* New upgrades should be enabled by default. + + +0.8.206 (2022-02-08) +-------------------- + +* Add "full lookup" product search modal for new custorder page. + + +0.8.205 (2022-02-05) +-------------------- + +* Tweak how product key field is handled for product views. + +* Add some autocomplete workarounds for new vendor catalog batch. + + +0.8.204 (2022-02-04) +-------------------- + +* Add ``CustomerGroupAssignment`` to customer version history. + + +0.8.203 (2022-02-01) +-------------------- + +* Expose batch params for vendor catalogs. + + +0.8.202 (2022-01-31) +-------------------- + +* Make "generate report" the same as "create new generated report". + + +0.8.201 (2022-01-31) +-------------------- + +* Show helptext for params when generating new report. + +* Tweak handling of empty params when generating report. + + +0.8.200 (2022-01-31) +-------------------- + +* Improve profile link helper for buefy themes. + +* Add project generator support for rattail-integration, tailbone-integration. + + +0.8.199 (2022-01-26) +-------------------- + +* Tweak the "auto-receive all" tool for Chrome browser. + + +0.8.198 (2022-01-25) +-------------------- + +* Only expose "product" departments within product view dropdowns. + + +0.8.197 (2022-01-19) +-------------------- + +* Use buefy input for quickie search. + + +0.8.196 (2022-01-15) +-------------------- + +* Use the new label handler. + + +0.8.195 (2022-01-13) +-------------------- + +* Strip whitespace for new customer fields, in new custorder page. + + +0.8.194 (2022-01-12) +-------------------- + +* Include all static files in manifest. + +* Update usage of ``app.get_email_handler()`` to avoid warnings. + + +0.8.193 (2022-01-10) +-------------------- + +* Add buefy support for quick-printing product labels; also speed bump. + +* Add way to set form-wide schema validator. + +* Add progress support when deleting a batch. + +* Expose the Sale, TPR, Current price fields for label batch. + + +0.8.192 (2022-01-08) +-------------------- + +* Add configurable template file for vendor catalog batch. + +* Some aesthetic improvements for vendor catalog batch. + +* Several disparate changes needed for vendor catalog improvements. + +* Expose, honor "allow future" setting for vendor catalog batch. + +* Add config for supported vendor catalog parsers. + +* Update some method calls to avoid deprecation warnings. + + +0.8.191 (2022-01-03) +-------------------- + +* Fix permission check for input file template links. + +* Remove usage of ``app.get_designated_import_handler()``. + +* Add basic configure page for Trainwreck. + +* Use ``AuthHandler.get_permissions()``. + + +0.8.190 (2021-12-29) +-------------------- + +* Show create button on "most" pages for a master view. + +* Expose products setting for type 2 UPC lookup. + +* Add basic "resolve" support for person, product from new custorder. + + +0.8.189 (2021-12-23) +-------------------- + +* Add basic "pending product" support for new custorder batch. + +* Improve email bounce view per buefy theme. + + +0.8.188 (2021-12-20) +-------------------- + +* Flag discontinued items for main Products grid. + + +0.8.187 (2021-12-20) +-------------------- + +* Add common configuration logic for "input file templates". + +* Add some standard CRUD buttons for buefy themes. + + +0.8.186 (2021-12-17) +-------------------- + +* Render "pretty" UPC by default, for batch row form fields. + +* Let config decide which versions of vue.js and buefy to use. + + +0.8.185 (2021-12-15) +-------------------- + +* Allow for null price when showing price history. + +* Overhaul desktop views for receiving, for efficiency. + +* Add some basic "config" views, to obviate some App Settings. + +* Add "jump to" chooser in App Settings, for various "configure" pages. + +* Fix params field when deleting a report. + +* Add some smarts when making batch execution form schema. + + +0.8.184 (2021-12-09) +-------------------- + +* Refactor "receive row" and "declare credit" tools per buefy theme. + +* Allow "auto-receive all items" batch feature in production. + +* Make "view row" prettier for receiving batch, for buefy themes. + +* Add buttons to edit, confirm cost for receiving batch row view. + + +0.8.183 (2021-12-08) +-------------------- + +* Add basic views to expose Problem Reports, and run them. + +* Only include ``--runas`` arg if we have a value, for import jobs. + +* Assume default receiving workflow if there is only one. + +* Fix bug when report has no params dict. + + +0.8.182 (2021-12-07) +-------------------- + +* Fix form ref bug, for batch execution. + + +0.8.181 (2021-12-07) +-------------------- + +* Bugfix. + + +0.8.180 (2021-12-07) +-------------------- + +* Add basic import/export handler views, tool to run jobs. + +* Overhaul import handler config etc.: + * add ``MasterView.configurable`` concept, ``/configure.mako`` template + * add new master view for DataSync Threads (needs content) + * tweak view config for DataSync Changes accordingly + * update the Configure DataSync page per ``configurable`` concept + * add new Configure Import/Export page, per ``configurable`` + * add basic views for Raw Permissions + +* Honor "safe for web app" flags for import/export handlers. + +* When viewing report output, show params as proper buefy table. + + +0.8.179 (2021-12-03) +-------------------- + +* Expose the Sale Price and TPR Price for product views. + + +0.8.178 (2021-11-29) +-------------------- + +* Add page for configuring datasync. + + +0.8.177 (2021-11-28) +-------------------- + +* Show current/sale pricing for products in new custorder page. + +* Add simple search filters for past items dialog in new custorder. + + +0.8.176 (2021-11-25) +-------------------- + +* Add basic support for receiving from PO with invoice. + +* Don't use multi-select for new report in buefy themes. + + +0.8.175 (2021-11-17) +-------------------- + +* Fix bug when product has empty suggested price. + +* Show ordered quantity when viewing costing batch row. + + +0.8.174 (2021-11-14) +-------------------- + +* Expose the "sync users" flag for Roles. + + +0.8.173 (2021-11-11) +-------------------- + +* Improve error handling when executing a custorder batch. + +* Fix "download results" support for Products. + + +0.8.172 (2021-11-11) +-------------------- + +* Add permission for viewing "all" employees. + + +0.8.171 (2021-11-11) +-------------------- + +* Add "true margin" to products XLSX export. + +* Add initial ``VersionMasterView`` base class. + +* Add views for ``PendingProduct`` model; also ``DepartmentWidget``. + + +0.8.170 (2021-11-09) +-------------------- + +* Fix dynamic content title for "view profile" page. + + +0.8.169 (2021-11-08) +-------------------- + +* Use products handler to get image URL. + +* Show some more product attributes in custorder item selection popup. + +* Auto-select Quantity tab when editing item for new custorder. + +* Let user "add past product" when making new custorder. + +* Let handler restrict available invoice parser options. + +* Cleanup grid columns for receiving batches. + +* Fall back to empty string for product regular price. + + +0.8.168 (2021-11-05) +-------------------- + +* Make separate method for writing results XLSX file. + +* Add ``render_brand()`` method for MasterView. + +* Add link to download generic template for vendor catalog batch. + + +0.8.167 (2021-11-04) +-------------------- + +* Try to prevent caching for any /index (grid) page. + +* Fix product view page when user cannot view version history. + +* Move some custorder logic to handler; allow force-swap of product selection. + +* Honor the "product price may be questionable" flag for new custorder. + +* Show unit price in line items grid for new custorder. + +* Avoid exposing batch params when creating a batch. + + +0.8.166 (2021-11-03) +-------------------- + +* Fix the Department filter for Products grid, for jquery themes. + + +0.8.165 (2021-11-02) +-------------------- + +* Optionally set the ``sticky-header`` attribute for main buefy grids. + +* Show case qty by default for costing batch rows. + +* Highlight the "did not receive" rows for purchase batch. + +* Improve validation for Person field of User form. + +* Omit "edit" link unless user has perm, for Customer "people" subgrid. + +* Highlight "cannot calculate price" rows for new product batch. + + +0.8.164 (2021-10-20) +-------------------- + +* Give custorder batch handler a couple ways to affect adding new items. + +* Refactor to leverage all existing methods of auth handler. + +* Overhaul the autocomplete component, for sake of new custorder. + +* Improve "refresh contact", show new fields in green for custorder. + +* Invoke handler when adding new item to custorder batch. + +* Add basic "price needs confirmation" support for custorder. + +* Clean up the product selection UI for new custorder. + + +0.8.163 (2021-10-14) +-------------------- + +* Misc. tweaks for users, roles. + + +0.8.162 (2021-10-14) +-------------------- + +* Cleanup form display a bit, for App Settings. + +* Invoke the auth handler to cache user permissions etc. + + +0.8.161 (2021-10-13) +-------------------- + +* Add ``debounce()`` wrapper for buefy autocomplete. + +* Leverage the auth handler for main user login. + + +0.8.160 (2021-10-11) +-------------------- + +* Stop rounding case/unit cost fields to 2 places for purchase batch. + +* Fix some phone/email bugs for new custorder page. + +* Fix bug when making context for mailing address. + +* Improve display, handling for "add contact info to customer record". + + +0.8.159 (2021-10-10) +-------------------- + +* Simplify template context customization for view_profile_buefy. + + +0.8.158 (2021-10-07) +-------------------- + +* Add support for "new customer" when creating new custorder. + +* Improve contact name handling for new custorder. + + +0.8.157 (2021-10-06) +-------------------- + +* Some tweaks for invoice costing batch views. + +* Add "restrict contact info" features for new custorder batch. + +* Add "contact update request" workflow for new custorder batch. + + +0.8.156 (2021-10-05) +-------------------- + +* Show "contact notes" when creating new custorder. + +* Improve phone editing for new custorder. + +* Add button to refresh contact info for new custorder. + +* Overhaul the "Personal" tab of profile view. + +* Refactor the Employee tab of profile view, per better patterns. + + +0.8.155 (2021-10-01) +-------------------- + +* Refactor autocomplete view logic to leverage new "autocompleters". + + +0.8.154 (2021-09-30) +-------------------- + +* Initial (basic) views for invoice costing batches. + + +0.8.153 (2021-09-28) +-------------------- + +* Improve phone/email handling when making new custorder. + +* Avoid "detach person" logic if not supported by view class. + + +0.8.152 (2021-09-27) +-------------------- + +* Allow changing status, adding notes for customer order items. + + +0.8.151 (2021-09-27) +-------------------- + +* Overhaul new custorder so contact may be either Person or Customer. + +* Add a dropdown of choices to the Department filter for Products grid. + + +0.8.150 (2021-09-26) +-------------------- + +* Refactor several "field grids" per Buefy theme. + +* Display the Store field for Customer Orders. + + +0.8.149 (2021-09-25) +-------------------- + +* Improve default autocomplete query logic, w/ multiple ILIKE. + +* Add placeholder to customer lookup for new order. + +* Invoke handler for customer autocomplete when making new custorder. + +* Improve "employees" list when viewing a department, for buefy themes. + +* Add products row grid for misc. org table views. + + +0.8.148 (2021-09-22) +-------------------- + +* Add way to update Employee ID from profile view. + + +0.8.147 (2021-09-22) +-------------------- + +* Add way to override grid action label rendering. + + +0.8.146 (2021-09-21) +-------------------- + +* Misc. improvements for customer order views. + + +0.8.145 (2021-09-19) +-------------------- + +* Allow setting the "exclusive" sequence of grid filters. + + +0.8.144 (2021-09-16) +-------------------- + +* Invoke handler when request is made to merge 2 people. + + +0.8.143 (2021-09-12) +-------------------- + +* Add way to customize product autocomplete for new custorder. + + +0.8.142 (2021-09-09) +-------------------- + +* Set quantity type when viewing vendor lead times, order intervals. + + +0.8.141 (2021-09-09) +-------------------- + +* Add /people API endpoint; allow for "native sort". + +* Allow override of "create" permission in API. + +* Add the ``Grid.remove()`` method, deprecate ``hide_column()`` etc. + +* Improve error handling for purchase batch. + + +0.8.140 (2021-09-01) +-------------------- + +* Make it easier to override rendering grid component in master/index. + +* Always show all grid actions...for now. + +* Allow grid columns to be *invisible* (but still present in grid). + +* Improve UI, customization hooks for new custorder batch. + +* Add hover text for vendor ID column of pricing batch row grid. + +* Fix size of roles multi-select when editing user. + +* Allow "touch" action for employees. + + +0.8.139 (2021-08-26) +-------------------- + +* Tweak how email preview is sent, and attempt "to" is displayed. + +* Move "merge 2 people" logic into People Handler. + +* Expose "merge request tracking" feature for People data. + +* Allow customization of row 'view' action url. + +* Require explicit opt-in for "clicking grid row checks box" feature. + +* Add ``before_render_index()`` customization hook for MasterView. + + +0.8.138 (2021-08-04) +-------------------- + +* Let feedback forms define their own email key. + + +0.8.137 (2021-07-15) +-------------------- + +* Set UPC renderer for delproduct batch row. + +* Expose ``pack_size`` for delproduct batch. + + +0.8.136 (2021-06-18) +-------------------- + +* Include "is/not null" filters for GPC fields. + + +0.8.135 (2021-06-15) +-------------------- + +* Add 'v' prefix for release package diff links. + + +0.8.134 (2021-06-15) +-------------------- + +* Allow config to set favicon and header image. + + +0.8.133 (2021-06-11) +-------------------- + +* Allow customization of rendering version diff values. + +* Allow direct creation of new label batches. + +* Allow generating project which integrates w/ LOC SMS. + + +0.8.132 (2021-05-03) +-------------------- + +* Highlight "has inventory" rows for delete item batch. + +* Add csrftoken to TailboneForm js. + +* Freeze pyramid version at 1.x. + + +0.8.131 (2021-04-12) +-------------------- + +* Show current price date range as hover text, for products grid. + +* Make it easier to extend "common" API views. + +* Accept any decimal numbers for API inventory batch counts. + + +0.8.130 (2021-03-30) +-------------------- + +* Catch and show error, if one happens when making batch from product query. + +* Expose the new ``Store.archived`` flag. + + +0.8.129 (2021-03-11) +-------------------- + +* Add support for ``inactivity_months`` field for delete product batch. + +* Expose new fields for Trainwreck. + +* Fix enum display for customer order status. + + +0.8.128 (2021-03-05) +-------------------- + +* Allow per-user stylesheet for Buefy themes. + +* Expose ``date_created`` for delete product batches. + + +0.8.127 (2021-03-02) +-------------------- + +* Use end time as default filter, sort for Trainwreck. + +* Avoid encoding values as string, for integer grid filters. + +* Fix message recipients for Reply / Reply-All, with Buefy themes. + +* Handle row click as if checkbox was clicked, for checkable grid. + +* Highlight delete product batch rows with "pending customer orders" status. + +* Add hover text for subdepartment name, in pricing batch row grid. + + +0.8.126 (2021-02-18) +-------------------- + +* Allow customization of main Buefy CSS styles, for falafel theme. + +* Add special "contains any of" verb for string-based grid filters. + +* Add special "equal to any of" verb for UPC-related grid filters. + +* Tweaks per "delete products" batch. + +* Misc. tweaks for vendor catalog batch. + +* Add support for "default" trainwreck model. + + +0.8.125 (2021-02-10) +-------------------- + +* Fix some permission bugs when showing batch tools etc. + +* Render batch execution description as markdown. + +* Cleanup default display for vendor catalog batches. + +* Make errors more obvious, when running batch commands as subprocess. + +* Add styles for field labels in profile view. + + +0.8.124 (2021-02-04) +-------------------- + +* Fix bug when editing a Person. + + +0.8.123 (2021-02-04) +-------------------- + +* Fix config defaults for PurchaseView. + +* Add stub methods for ``MasterView.template_kwargs_view()`` etc. + +* Update references to vendor catalog batches etc. + +* Fix display of handheld batch links, when viewing label batch. + +* Prevent updates to batch rows, if batch is immutable. + + +0.8.122 (2021-02-01) +-------------------- + +* Normalize naming of all traditional master views. + +* Undo recent ``base.css`` changes for ``

`` tags. + +* Misc. improvements for ordering batches, purchases. + +* Purge things for legacy (jquery) mobile, and unused template themes. + +* Make handler responsible for possible receiving modes. + +* Split "new receiving batch" process into 2 steps: choose, create. + +* Add initial "scanning" feature for Ordering Batches. + +* Add support for "nested" menu items. + +* Add icon for Help button. + + +0.8.121 (2021-01-28) +-------------------- + +* Tweak how vendor link is rendered for readonly field. + +* Use "People Handler" to update names, when editing person or user. + + +0.8.120 (2021-01-27) +-------------------- + +* Initial support for adding items to, executing customer order batch. + +* Add changelog link for Theo, in upgrade package diff. + +* Hide "collect from wild" button for UOMs unless user has permission. + + +0.8.119 (2021-01-25) +-------------------- + +* Don't create new person for new user, if one was selected. + +* Allow newer zope.sqlalchemy package. + +* Add variant transaction logic per zope.sqlalchemy 1.1 changes. + +* Add CSS styles for 'codehilite' a la Pygments. + +* Add feature to generate new features... + +* Add views for "delete product" batch. + +* Set ``self.model`` when constructing new View. + +* Add some generic render methods to MasterView. + +* Add custom ``base.css`` for falafel theme. + +* Add master view for Units of Measure mapping table. + +* Add woocommerce package links for sake of upgrade diff view. + +* Add basic web API app, for simple use cases. + + +0.8.118 (2021-01-10) +-------------------- + +* Show node title in header for Login, About pages. + +* Allow changing protected user password when acting as root. + +* Allow specifying the size of a file, for ``readable_size()`` method. + +* Try to show existing filename, for upload widget. + +* Add basic support for "download" and "rawbytes" API views. + + +0.8.117 (2020-12-16) +-------------------- + +* Add common "form poster" logic, to make CSRF token/header names configurable. + +* Refactor the feedback form to use common form poster logic. + + +0.8.116 (2020-12-15) +-------------------- + +* Add basic views for IFPS PLU Codes. + +* Add very basic support for merging 2 People. + +* Tweak spacing for header logo + title, in falafel theme. + + +0.8.115 (2020-12-04) +-------------------- + +* Add the "Employee Status" filter to People grid. + +* Add "is empty" and related verbs, for "string" type grid filters. + +* Assume composite PK when fetching instance for master view. + + +0.8.114 (2020-12-01) +-------------------- + +* Misc. tweaks to vendor catalog views. + +* Tweak how an "enum" grid filter is initialized. + +* Add "generic" Employee tab feature, for profile view. + + +0.8.113 (2020-10-13) +-------------------- + +* Tweak how global DB session is created. + + +0.8.112 (2020-09-29) +-------------------- + +* Add support for "list" type of app settings (w/ textarea). + +* Add feature to "download rows for results" in master index view. + +* Fix "refresh results" for batches, in Buefy theme. + + +0.8.111 (2020-09-25) +-------------------- + +* Allow alternate engine to act as 'default' when multiple are available. + +* Fix grid bug when paginator is not involved. + + +0.8.110 (2020-09-24) +-------------------- + +* Add ``user_is_protected()`` method to core View class. + +* Change how we protect certain person, employee records. + +* Add global help URL to login template. + +* Fix bug when fetching partial versions data grid. + + +0.8.109 (2020-09-22) +-------------------- + +* Add 'warning' class for 'delete' action in b-table grid. + +* Add "worksheet file" pattern for editing batches. + +* Avoid unhelpful error when perm check happens for "re-created" DB user. + +* Prompt user if they try to send email preview w/ no address. + +* Don't expose "timezone" for input when generating 'fabric' project. + +* Add some more field hints when generating 'fabric' project. + +* Show node title in header, for home page. + +* Remove unwanted columns for default Products grid. + + +0.8.108 (2020-09-16) +-------------------- + +* Allow custom props for TailboneForm component. + +* Remove some custom field labels for Vendor. + +* Add support for generating new 'fabric' project. + + +0.8.107 (2020-09-14) +-------------------- + +* Stop including 'complete' filter by default for purchasing batches. + +* Overhaul project changelog links for upgrade pkg diff table. + +* Add support/views for generating new custom projects, via handler. + + +0.8.106 (2020-09-02) +-------------------- + +* Add progress for generating "results as CSV/XLSX" file to download. + +* Use utf8 encoding when downloading results as CSV. + +* Add new/flexible "download results" feature. + +* Fix spacing between components in "grid tools" section. + +* Add support for batch execution options in Buefy themes. + +* Improve auto-handling of "local" timestamps. + +* Expose ``Product.average_weight`` field. + + +0.8.105 (2020-08-21) +-------------------- + +* Tweaks for export views, to make more generic. + +* Add config for "global" help URL. + +* Remove ``

`` tag around "no results" for minimal b-table. + +* Allow for unknown/missing "changed by" user for product price history. + +* Add buefy theme support for ordering worksheet. + +* Don't require department by default, for new purchasing batch. + + +0.8.104 (2020-08-17) +-------------------- + +* Make "download row results" a bit more generic. + +* Add pagination to price, cost history grids for product view. + + +0.8.103 (2020-08-13) +-------------------- + +* Tweak config methods for customer master view. + + +0.8.102 (2020-08-10) +-------------------- + +* Improve rendering of ``true_margin`` column for pricing batch row grid. + + +0.8.101 (2020-08-09) +-------------------- + +* Fix missing scrollbar when version diff table is too wide for screen. + +* Add basic web views for "new customer order" batches. + +* Tweak the buefy autocomplete component a bit. + +* Add basic/unfinished "new customer order" page/feature. + +* Add ``protected_usernames()`` config function. + +* Add ``model`` to global template context, plus ``h.maxlen()``. + +* Coalesce on ``User.active`` when merging. + +* Expose user reference(s) for employees. + + +0.8.100 (2020-07-30) +-------------------- + +* Add more customization hooks for making grid actions in master view. + + +0.8.99 (2020-07-29) +------------------- + +* Add ``self.cloning`` convenience indicator for master view. + +* Use handler ``do_delete()`` method when deleting a batch. + + +0.8.98 (2020-07-26) +------------------- + +* Tweak field label for ``Product.item_id``. + +* Make field list explicit for Department views. + +* Make field list explicit for Store views. + +* Don't allow "execute results" for any batches by default. + +* Fix pagination sync issue with buefy grid tables. + +* Fix permissions wiget bug when creating new role. + +* Tweak "coalesce" logic for merging field data. + + +0.8.97 (2020-06-24) +------------------- + +* Add dropdown, autohide magic when editing Role permissions. + +* Add ability to download roles / permissions matrix as Excel file. + +* Improve support for composite key in master view. + +* Use byte string filters for row grid too. + +* Convert mako directories to list, if it's a string. + + +0.8.96 (2020-06-17) +------------------- + +* Don't allow edit/delete of rows, if master view says so. + + +0.8.95 (2020-05-27) +------------------- + +* Cap version for 'cornice' dependency. + +* Let each grid component have a custom name, if needed. + + +0.8.94 (2020-05-20) +------------------- + +* Expose "shelved" field for pricing batches. + +* Sort available reports by name, if handler doesn't specify. + + +0.8.93 (2020-05-15) +------------------- + +* Parse pip requirements file ourselves, instead of using their internals. + +* Don't auto-include "Guest" role when finding roles w/ permission X. + + +0.8.92 (2020-04-07) +------------------- + +* Allow the home page to include quickie search. + + +0.8.91 (2020-04-06) +------------------- + +* Add "danger" style for "delete" grid row action. + +* Misc. API improvements for sake of mobile receiving. + +* Use proper cornice service registration, for API batch execute etc. + +* Add common permission for sending user feedback. + +* Fix the "change password" form per Buefy theme. + +* Expose the ``Role.notes`` field for view/edit. + +* Add "local only" column to Users grid. + +* Fix row status filter for Import/Export batches. + +* Add "generic" ``render_id_str()`` method to MasterView. + +* Stop raising an error if view doesn't define row grid columns. + +* Add helper function, ``get_csrf_token()``. + +* Add support for "choice" widget, for report params. + +* Allow bulk-delete, merge for Brands table. + +* Move inventory batch view to its proper location. + +* Allow bulk-delete for Inventory Batches. + +* Move "most" inventory batch logic out of view, to underlying handler. + +* Add initial API views for inventory batches. + +* Add basic dashboard page for TempMon. + +* Let config totally disable the old/legacy jQuery mobile app. + +* Defer fetching price, cost history when viewing product details. + + +0.8.90 (2020-03-18) +------------------- + +* Add basic "ordering worksheet" API. + +* Tweak GPC grid filter, to better handle spaces in user input. + +* Only show tables for "public" schema. + +* Remove old/unwanted Vue.js index experiment, for Users table. + +* Misc. changes to User, Role permissions and management thereof. + +* Don't let user delete roles to which they belong, without permission. + +* Prevent deletion of department which still has products. + +* Add sort/filter for Department Name, in Subdepartments grid. + +* Allow "touch" for Department, Subdepartment. + +* Expose ``Customer.number`` field. + +* Add support for "bulk-delete" of Person table. + +* Allow customization for Customers tab of Profile view. + +* Expose default email address, phone number when editing a Person. + +* Add/improve various display of Member data. + + +0.8.89 (2020-03-11) +------------------- + +* Refactor "view profile" page per latest Buefy theme conventions. + +* Move logic for Order Form worksheet into purchase batch handler. + +* Make sure all contact info is "touched" when touching person record. + + +0.8.88 (2020-03-05) +------------------- + +* Fix batch row status breakdown for Buefy themes. + +* Add support for refreshing multiple batches (results) at once. + +* Remove "api." prefix for default route names, in API master views. + +* Allow "touch" for vendor records. + + +0.8.87 (2020-03-02) +------------------- + +* Add new "master" API view class; refactor products and batches to use it. + +* Refactor all API views thus far, to use new v2 master. + +* Use Cornice when registering all "service" API views. + + +0.8.86 (2020-03-01) +------------------- + +* Add toggle complete, more normalized row fields for odering batch API. + +* Return employee_uuid along with user info, from API. + +* Add support for executing ordering batches via API. + +* Fix how we fetch employee history, for profile view. + +* Cleanup main version history views for Buefy theme. + +* Fix product price, cost history dialogs, for Buefy theme. + +* Fix some basic product editing features. + + +0.8.85 (2020-02-26) +------------------- + +* Overhaul the /ordering batch API somewhat; update docs. + +* Tweak ``save_edit_row_form()`` of purchase batch view, to leverage handler. + +* Tweak ``worksheet_update()`` of ordering batch view, to leverage handler. + +* Fix "edit row" logic for ordering batch. + +* Raise 404 not found instead of error, when user is not employee. + +* Send batch params as part of normalized API. + + +0.8.84 (2020-02-21) +------------------- + +* Add API view for changing current user password. + +* Return new user permissions when logging in via API. + + +0.8.83 (2020-02-12) +------------------- + +* Use new ``Email.obtain_sample_data()`` method when generating preview. + +* Add some custom display logic for "current price" in pricing batch. + +* Fix email preview for TXT templates on python3. + +* Allow override of "email key" for user feedback, sent via API. + +* Add way to prevent user login via API, per custom logic. + +* Add common ``get_user_info()`` method for all API views. + +* Return package names as list, from "about" page from API. + + +0.8.82 (2020-02-03) +------------------- + +* Fix vendor ID/name for Excel download of pricing batch rows. + +* Add red highlight for SRP breach, for generic product batch. + +* Make sure falafel theme is somewhat available by default. + + +0.8.81 (2020-01-28) +------------------- + +* Include regular price changes, for current price history dialog. + +* Allow populate of new pricing batch from products w/ "SRP breach". + +* Tweak how we import pip internal things, for upgrade view. + +* Sort report options by name, when choosing which to generate. + +* Add warning for "price breaches SRP" rows in pricing batch. + + +0.8.80 (2020-01-20) +------------------- + +* Hide the SRP history link for new buefy themes. + +* Add regular price history dialog for product view. + +* Add support for Row Status Breakdown, for Import/Export batches. + +* Cleanup "diff" table for importer batch row view, per Buefy theme. + +* Highlight SRP in red, if reg price is greater. + +* Expose batch ID, sequence for datasync change queue. + +* Add "current price history" dialog for product view. + +* Add "cost history" dialog for product view. + + +0.8.79 (2020-01-06) +------------------- + +* Move "delete results" logic for master grid. + + +0.8.78 (2020-01-02) +------------------- + +* Add ``Grid.set_filters_sequence()`` convenience method. + +* Add dialog for viewing product SRP history. + + +0.8.77 (2019-12-04) +------------------- + +* Use currency formatting for costs in vendor catalog batch. + + +0.8.76 (2019-12-02) +------------------- + +* Allow update of row unit cost directly from receiving batch view. + +* Show vendor item code in receiving batch row grid. + +* Expose catalog cost, allow updating, for receiving batch rows. + +* Add API view for marking "receiving complete" for receiving batch. + +* Allow override of user authentication logic for API. + +* Add API views for admin user to become / stop being "root". + + +0.8.75 (2019-11-19) +------------------- + +* Filter by receiving mode, for receiving batch API. + + +0.8.74 (2019-11-15) +------------------- + +* Add support for label batch "quick entry" API. + +* Add support for "toggle complete" for batch API. + +* Add some API views for receiving, and vendor autocomplete. + +* Move "quick entry" logic for purchase batch, into rattail handler. + +* Provide background color when first checking API session. + + +0.8.73 (2019-11-08) +------------------- + +* Assume "local only" flag should be ON by default, for new objects. + +* Bump default Buefy version to 0.8.2. + +* Always store CSRF token for each page in Vue.js theme. + +* Refactor "make batch from products query" per Vue.js theme. + +* Add Vue.js support for "enable / disable selected" grid feature. + +* Add Vue.js support for "delete selected" grid feature. + +* Improve checkbox click handling support for grids. + +* Improve/fix some views for Messages per Vue.js theme. + +* Add some padding above/below form fields (for Vue.js). + +* Use "warning" status for pricing batch rows, where product not found. + +* Refactor "send new message" form, esp. recipients field, per Vue.js. + +* Allow rendering of "raw" datetime as ISO date. + +* Add very basic API views for label batches. + +* Fallback to referrer if form has no cancel button URL. + +* Fix merge feature for master index grid. + + +0.8.72 (2019-10-25) +------------------- + +* Allow bulk delete of New Product batch rows. + +* Don't bug out if can't update roles for user. + + +0.8.71 (2019-10-23) +------------------- + +* Improve default behavior for clone operation. + +* Add config flag to "force unit item" for inventory batch. + +* Fix JS bug for graph view of tempmon probe readings. + + +0.8.70 (2019-10-17) +------------------- + +* Don't bug out if stores, departments fields aren't present for Employee. + + +0.8.69 (2019-10-15) +------------------- + +* Fix buefy grid pager bug. + +* Fix permissions for add/edit/delete notes from people profile view. + + +0.8.68 (2019-10-14) +------------------- + +* Use ``self.has_perm()`` within MasterView. + +* Only show action URL if present, for Buefy grid rows. + +* Show active flag for users mini-grid on Role view page. + + +0.8.67 (2019-10-12) +------------------- + +* Fix URL for user, for feedback email. + +* Add "is false or null" verb for boolean grid filters. + +* Move label batch views to ``tailbone.views.batch.labels``. + +* Allow bulk-delete for some common batches. + +* Move vendor catalog batch views to ``tailbone.views.batch.vendorcatalog``. + +* Expose the "is preferred vendor" flag for vendor catalog batches. + +* Move vendor invoice batch views to ``tailbone.views.batch.vendorinvoice``. + +* Expose unit cost diff for vendor invoice batch rows. + +* Honor configured db key sequence; let config hide some db keys from UI. + + +0.8.66 (2019-10-08) +------------------- + +* Fix label bug for grid filter with value choices dropdown. + + +0.8.65 (2019-10-07) +------------------- + +* Add support for "local only" Person, User, plus related security. + + +0.8.64 (2019-10-04) +------------------- + +* Add ``forbidden()`` convenience method to core View class. + + +0.8.63 (2019-10-02) +------------------- + +* Fix "progress" behavior for upgrade page. + + +0.8.62 (2019-09-25) +------------------- + +* Add core ``View.make_progress()`` method. + + +0.8.61 (2019-09-24) +------------------- + +* Use ``simple_error()`` from rattail, for showing some error messages. + +* Honor kwargs used for ``MasterView.get_index_url()``. + +* Fix progress page so it effectively fetches progress data synchronously. + +* Show "image not found" placeholder image for products which have none. + + +0.8.60 (2019-09-09) +------------------- + +* Show product image from database, if it exists. + +* Let config turn off display of "POD" image from products. + + +0.8.59 (2019-09-09) +------------------- + +* Let a grid have custom ajax data url. + +* Set default max height, width for app logo. + +* Hopefully fix "single store" behavior when make a new ordering batch. + +* Add basic support for create and update actions in API views. + +* Tweak how we detect JSON request body instead of POST params. + +* Add basic support for "between" verb, for date range grid filter. + +* Add basic API view for user feedback. + +* Add basic API view for "about" page. + +* Include ``short_name`` in field list returned by /session API. + +* Return current user permissions when session is checked via API. + +* Tweak return value for /customers API. + +* Cleanup styles for login form. + +* Add /products API endpoint, enable basic filter support for API views. + +* Add basic API endpoints for /ordering-batch. + +* Don't show Delete Row button for executed batch, on jquery mobile site. + +* Include tax1 thru tax3 flags in form fields for product view page. + +* Prevent text wrap for pricing panel fields on product view page. + +* Fix rendering of "handheld batches" field for inventory batch view. + +* Fix various templates for generating reports, per Buefy. + +* Fix 'about' page template for Buefy themes. + + +0.8.58 (2019-08-21) +------------------- + +* Provide today's date as context for profile view. + +* Tweak login page logo style for jQuery (non-Buefy) themes. + + +0.8.57 (2019-08-05) +------------------- + +* Remove unused "login tips" for demo. + +* Fix form handling for user feedback. + +* Fix "last sold" field rendering for product view. + + +0.8.56 (2019-08-04) +------------------- + +* Fix home and login pages for Buefy theme. + + +0.8.55 (2019-08-04) +------------------- + +* Allow "touch" for Person records. + +* Refactor Buefy templates to use WholePage and ThisPage components. + +* Highlight former Employee records as red/warning. + + +0.8.54 (2019-07-31) +------------------- + +* Freeze Buefy version at pre-0.8.0. + + +0.8.53 (2019-07-30) +------------------- + +* Add proper support for composite primary key, in MasterView. + + +0.8.52 (2019-07-25) +------------------- + +* Add 'disabled' prop for Buefy datepicker. + +* Add perm for editing employee history from profile view. + +* Add "multi-engine" support for Trainwreck transaction views. + +* Cleanup 'phone' filter/sort logic for Employees grid. + + +0.8.51 (2019-07-13) +------------------- + +* Add basic "DB picker" support, for views which allow multiple engines. + +* Include employee history data in context for "view profile". + +* Add custom permissions for People "profile" view. + +* Use latest version of Buefy by default, for falafel theme. + +* Send URL for viewing employee, along to profile page template. + + +0.8.50 (2019-07-09) +------------------- + +* Add way to hide "view profile" helper for customer view. + +* Add ``render_customer()`` method for MasterView. + +* When creating an export, set creator to current user. + +* Add basic "downloadable" support for ExportMasterView. + +* Remove unwanted "export has file" logic for ExportMasterView. + +* Refactor feedback dialog for Buefy themes. + +* Add support for general "view click handler" for ```` element. + + +0.8.49 (2019-07-01) +------------------- + +* Fix product view template per Buefy refactoring. + + +0.8.48 (2019-07-01) +------------------- + +* Clear checked rows when refreshing async grid data. + + +0.8.47 (2019-07-01) +------------------- + +* Allow "touch" for customer records. + +* Add ``NumericInputWidget`` for use with Buefy themes. + +* Expose a way to embed "raw" data values within Buefy grid data. + +* Add 'duration_hours' type for grid column display. + +* Make sure grid action links preserve white-space. + + +0.8.46 (2019-06-25) +------------------- + +* Only expose "Make User" button when viewing a person. + +* Fix PO total calculation bug for mobile ordering. + +* Fix "edit row" icon for batch row grids, for Buefy themes. + +* Refactor all Buefy form submit buttons, per Chrome behavior. + + +0.8.45 (2019-06-18) +------------------- + +* Fix inheritance issue with "view row" master template. + + +0.8.44 (2019-06-18) +------------------- + +* Add generic ``/page.mako`` template. + +* Add Buefy support for "execute results" from core batch grid view. + +* Pull the grid tools to the right, for Buefy. + +* Fix click behavior for all/diffs package links in upgrade view. + +* Refactor form/page component structure for Buefy/Vue.js. + + +0.8.43 (2019-06-16) +------------------- + +* Refactor tempmon probe view template, per Buefy. + +* Refactor tempmon probe graph view per Buefy. + +* Use once-button for tempmon client restart. + +* Fix package diff table for upgrade view template, per Buefy. + +* Assign client IP address to session, for sake of data versioning. + +* Use locale formatting for some numbers in the Buefy grid. + +* Buefy support for "mark batch as (in)complete". + + +0.8.42 (2019-06-14) +------------------- + +* Fix some response headers per python 3. + +* Make person, created by fields readonly when editing Person Note. + + +0.8.41 (2019-06-13) +------------------- + +* Add ``json_response()`` convenience method for all views. + +* Add ```` element template for simple grids with "static" data. + +* Improve props handling for ```` component. + +* Fall back to parsing request body as JSON for form data. + +* Basic support for maintaining PersonNote data from profile view. + +* Fix permissions styles for view/edit of User, Role. + +* Turn on bulk-delete feature for Raw Settings view. + +* Add a generic "user" field renderer to master view. + +* Fix "current value" for ```` element in e.g. edit form views. + +* Use ```` in more places, where appropriate. + +* Update calculated PO totals for purchasing batch, when editing row. + +* Add support for Buefy autocomplete. + +* More Buefy tweaks, for file upload, and "edit batch" generally. + +* Tweak structure of "view product" page to support Buefy, context menu. + +* Add support for "simple confirm" of object deletion. + +* Add some vendor fields for product Excel download. + + +0.8.40 (2019-06-03) +------------------- + +* Add ``verbose`` flag for ``util.raw_datetime()`` rendering. + +* Add basic master view for PersonNote data model. + +* Make email preview buttons use primary color. + +* Add basic Buefy support for batch refresh, execute buttons. + +* Add basic/generic Buefy support to the Form class. + +* Add custom ``tailbone-datepicker`` component for Buefy. + +* Let view template define how to render "row grid tools". + +* Move logic used to determine if current request should use Buefy. + +* Allow inherited theme to set location of Vue.js, Buefy etc. + +* Add "full justify" for grid filter pseudo-column elements. + +* Expose per-page size picker for Buefy grids. + +* Add basic Buefy support for default SelectWidget template. + +* Add Buefy support for enum grid filters. + +* Add ```` component for Buefy templates. + +* Add basic Buefy support for "Make User" button when viewing Person. + +* Make Buefy grids use proper Vue.js component structure. + +* Assume forms support Buefy if theme does; fix basic CRUD views. + +* Fix Buefy "row grids" when viewing parent; add basic file upload support. + +* Refactor "edit printer settings" view for Label Profile. + +* Add Buefy panels support for "view product" page. + +* Allow bulk row delete for generic products batch. + +* also "lots more changes" for sake of Buefy support... + + +0.8.39 (2019-05-09) +------------------- + +* Expose params and type key for report output. + +* Clean up falafel theme, move some parts to root template path. + +* Allow choosing report from simple list, when generating new. + +* Force unicode string behavior for left/right arrow thingies. + +* Must still define "jquery theme" for falafel theme, for now. + +* Add support for "quickie" search in falafel theme. + +* Fix sorting info bug when Buefy grid doesn't support it. + +* Make "view profile" buttons use "primary" color. + +* Add ``simple_field()`` def for base falafel template. + +* Align pseudo-columns for grid filters; let app settings define widths. + +* Tweak how we disable grid filter options. + +* Add basic Buefy form support when generating reports. + +* Add basic/generic email validator logic. + + +0.8.38 (2019-05-07) +------------------- + +* Add basic support for "quickie" search. + +* Add basic Buefy support for row grids. + +* Add basic Buefy support for merging 2 objects. + + +0.8.37 (2019-05-05) +------------------- + +* Add basic Buefy support for full "profile" view for Person. + + +0.8.36 (2019-05-03) +------------------- + +* Add basic support for "touching" a data record object. + + +0.8.35 (2019-04-30) +------------------- + +* Add filter for Vendor ID in Pricing Batch row grid. + +* Pass batch execution kwargs when doing that via subprocess. + + +0.8.34 (2019-04-25) +------------------- + +* Don't assume grid model class declares its title. + + +0.8.33 (2019-04-25) +------------------- + +* Add "most of" Buefy support for grid filters. + +* Add Buefy support for email preview buttons. + +* Improve logic used to determine if current theme supports Buefy. + +* Add basic Buefy support for App Settings page. + +* Add views for "new product" batches. + +* Fix auto-disable action for new message form. + +* Declare row fields for vendor catalog batches. + +* Add "created by" and "executed by" grid filters for all batch views. + +* Expose new code fields for pricing batch. + +* Add basic Buefy support for "find user/role with permission X". + +* Improve default people "profile" view somewhat. + +* Add support for generic "product" batch type. + +* Fix some issues with progress "socket" workaround for batches. + +* Allow config to specify grid "page size" options. + +* Add ``render_person()`` convenience method for MasterView. + + +0.8.32 (2019-04-12) +------------------- + +* Can finally assume "simple" menus by default. + +* Add custom grid filter for phone number fields. + +* Add ``raw_datetime()`` function to ``tailbone.helpers`` module. + +* Add "profile" view, for viewing *all* details of a given person at once. + +* Add "view profile" object helper for all person-related views. + +* Hopefully fix style bug when new filter is added to grid. + + 0.8.31 (2019-04-02) ------------------- @@ -1273,7 +4992,7 @@ and related technologies. 0.6.47 (2017-11-08) ------------------- -* Fix manifest to include *.pt deform templates +* Fix manifest to include ``*.pt`` deform templates 0.6.46 (2017-11-08) @@ -1606,13 +5325,13 @@ and related technologies. 0.6.13 (2017-07-26) ------------------- +------------------- * Allow master view to decide whether each grid checkbox is checked 0.6.12 (2017-07-26) ------------------- +------------------- * Add basic support for product inventory and status @@ -1620,7 +5339,7 @@ and related technologies. 0.6.11 (2017-07-18) ------------------- +------------------- * Tweak some basic styles for forms/grids @@ -1628,7 +5347,7 @@ and related technologies. 0.6.10 (2017-07-18) ------------------- +------------------- * Fix grid bug if "current page" becomes invalid diff --git a/docs/api/api/batch/core.rst b/docs/api/api/batch/core.rst new file mode 100644 index 00000000..48d34315 --- /dev/null +++ b/docs/api/api/batch/core.rst @@ -0,0 +1,15 @@ + +``tailbone.api.batch.core`` +=========================== + +.. automodule:: tailbone.api.batch.core + +.. autoclass:: APIBatchMixin + +.. autoclass:: APIBatchView + +.. autoclass:: APIBatchRowView + + .. autoattribute:: editable + + .. autoattribute:: supports_quick_entry diff --git a/docs/api/api/batch/ordering.rst b/docs/api/api/batch/ordering.rst new file mode 100644 index 00000000..4b07e1f2 --- /dev/null +++ b/docs/api/api/batch/ordering.rst @@ -0,0 +1,41 @@ + +``tailbone.api.batch.ordering`` +=============================== + +.. automodule:: tailbone.api.batch.ordering + +.. autoclass:: OrderingBatchViews + + .. autoattribute:: collection_url_prefix + + .. autoattribute:: object_url_prefix + + .. autoattribute:: model_class + + .. autoattribute:: route_prefix + + .. autoattribute:: permission_prefix + + .. autoattribute:: default_handler_spec + + .. automethod:: base_query + + .. automethod:: create_object + +.. autoclass:: OrderingBatchRowViews + + .. autoattribute:: collection_url_prefix + + .. autoattribute:: object_url_prefix + + .. autoattribute:: model_class + + .. autoattribute:: route_prefix + + .. autoattribute:: permission_prefix + + .. autoattribute:: default_handler_spec + + .. autoattribute:: supports_quick_entry + + .. automethod:: update_object diff --git a/docs/api/db.rst b/docs/api/db.rst new file mode 100644 index 00000000..ace21b68 --- /dev/null +++ b/docs/api/db.rst @@ -0,0 +1,6 @@ + +``tailbone.db`` +=============== + +.. automodule:: tailbone.db + :members: diff --git a/docs/api/diffs.rst b/docs/api/diffs.rst new file mode 100644 index 00000000..fb1bba71 --- /dev/null +++ b/docs/api/diffs.rst @@ -0,0 +1,6 @@ + +``tailbone.diffs`` +================== + +.. automodule:: tailbone.diffs + :members: diff --git a/docs/api/forms.widgets.rst b/docs/api/forms.widgets.rst new file mode 100644 index 00000000..33316903 --- /dev/null +++ b/docs/api/forms.widgets.rst @@ -0,0 +1,6 @@ + +``tailbone.forms.widgets`` +========================== + +.. automodule:: tailbone.forms.widgets + :members: diff --git a/docs/api/grids.core.rst b/docs/api/grids.core.rst new file mode 100644 index 00000000..60155cb2 --- /dev/null +++ b/docs/api/grids.core.rst @@ -0,0 +1,6 @@ + +``tailbone.grids.core`` +======================= + +.. automodule:: tailbone.grids.core + :members: diff --git a/docs/api/progress.rst b/docs/api/progress.rst new file mode 100644 index 00000000..83685d47 --- /dev/null +++ b/docs/api/progress.rst @@ -0,0 +1,6 @@ + +``tailbone.progress`` +===================== + +.. automodule:: tailbone.progress + :members: diff --git a/docs/api/subscribers.rst b/docs/api/subscribers.rst index 8b25c994..d28a1b15 100644 --- a/docs/api/subscribers.rst +++ b/docs/api/subscribers.rst @@ -3,5 +3,4 @@ ======================== .. automodule:: tailbone.subscribers - -.. autofunction:: new_request + :members: diff --git a/docs/api/util.rst b/docs/api/util.rst new file mode 100644 index 00000000..35e66ed3 --- /dev/null +++ b/docs/api/util.rst @@ -0,0 +1,6 @@ + +``tailbone.util`` +================= + +.. automodule:: tailbone.util + :members: diff --git a/docs/api/views/batch.vendorcatalog.rst b/docs/api/views/batch.vendorcatalog.rst new file mode 100644 index 00000000..4df51685 --- /dev/null +++ b/docs/api/views/batch.vendorcatalog.rst @@ -0,0 +1,10 @@ + +``tailbone.views.batch.vendorcatalog`` +====================================== + +.. automodule:: tailbone.views.batch.vendorcatalog + +.. autoclass:: VendorCatalogsView + :members: + +.. autofunction:: includeme diff --git a/docs/api/views/core.rst b/docs/api/views/core.rst new file mode 100644 index 00000000..8a68f33f --- /dev/null +++ b/docs/api/views/core.rst @@ -0,0 +1,6 @@ + +``tailbone.views.core`` +======================= + +.. automodule:: tailbone.views.core + :members: diff --git a/docs/api/views/master.rst b/docs/api/views/master.rst index bf505b6c..e7de7170 100644 --- a/docs/api/views/master.rst +++ b/docs/api/views/master.rst @@ -81,6 +81,12 @@ override when defining your subclass. override this for certain views, if so that should be done within :meth:`get_help_url()`. + .. attribute:: MasterView.version_diff_factory + + Optional factory to use for version diff objects. By default + this is *not set* but a subclass is free to set it. See also + :meth:`get_version_diff_factory()`. + Methods to Override ------------------- @@ -88,6 +94,8 @@ Methods to Override The following is a list of methods which you can override when defining your subclass. + .. automethod:: MasterView.editable_instance + .. .. automethod:: MasterView.get_settings .. automethod:: MasterView.get_csv_fields @@ -95,3 +103,24 @@ subclass. .. automethod:: MasterView.get_csv_row .. automethod:: MasterView.get_help_url + + .. automethod:: MasterView.get_model_key + + .. automethod:: MasterView.get_version_diff_enums + + .. automethod:: MasterView.get_version_diff_factory + + .. automethod:: MasterView.make_version_diff + + .. automethod:: MasterView.title_for_version + + +Support Methods +--------------- + +The following is a list of methods you should (probably) not need to +override, but may find useful: + + .. automethod:: MasterView.default_edit_url + + .. automethod:: MasterView.get_action_route_kwargs diff --git a/docs/api/views/members.rst b/docs/api/views/members.rst new file mode 100644 index 00000000..6a9e9168 --- /dev/null +++ b/docs/api/views/members.rst @@ -0,0 +1,6 @@ + +``tailbone.views.members`` +========================== + +.. automodule:: tailbone.views.members + :members: diff --git a/docs/api/views/purchasing.batch.rst b/docs/api/views/purchasing.batch.rst new file mode 100644 index 00000000..9bb62c8b --- /dev/null +++ b/docs/api/views/purchasing.batch.rst @@ -0,0 +1,9 @@ + +``tailbone.views.purchasing.batch`` +=================================== + +.. automodule:: tailbone.views.purchasing.batch + +.. autoclass:: PurchasingBatchView + + .. automethod:: save_edit_row_form diff --git a/docs/api/views/purchasing.ordering.rst b/docs/api/views/purchasing.ordering.rst new file mode 100644 index 00000000..38d46b07 --- /dev/null +++ b/docs/api/views/purchasing.ordering.rst @@ -0,0 +1,15 @@ + +``tailbone.views.purchasing.ordering`` +====================================== + +.. automodule:: tailbone.views.purchasing.ordering + +.. autoclass:: OrderingBatchView + + .. autoattribute:: model_class + + .. autoattribute:: default_handler_spec + + .. automethod:: configure_row_form + + .. automethod:: worksheet_update diff --git a/docs/api/views/vendors.catalogs.rst b/docs/api/views/vendors.catalogs.rst deleted file mode 100644 index 432966e7..00000000 --- a/docs/api/views/vendors.catalogs.rst +++ /dev/null @@ -1,10 +0,0 @@ - -``tailbone.views.vendors.catalogs`` -=================================== - -.. automodule:: tailbone.views.vendors.catalogs - -.. autoclass:: VendorCatalogsView - :members: - -.. autofunction:: includeme diff --git a/docs/changelog.rst b/docs/changelog.rst new file mode 100644 index 00000000..bbf94f4b --- /dev/null +++ b/docs/changelog.rst @@ -0,0 +1,8 @@ + +Changelog Archive +================= + +.. toctree:: + :maxdepth: 1 + + OLDCHANGES diff --git a/docs/conf.py b/docs/conf.py index 7d3e5831..ade4c92a 100644 --- a/docs/conf.py +++ b/docs/conf.py @@ -1,38 +1,21 @@ -# -*- coding: utf-8; -*- +# Configuration file for the Sphinx documentation builder. # -# Tailbone documentation build configuration file, created by -# sphinx-quickstart on Sat Feb 15 23:15:27 2014. -# -# This file is exec()d with the current directory set to its -# containing dir. -# -# Note that not all possible configuration values are present in this -# autogenerated file. -# -# All configuration values have a default; values that are commented out -# serve to show the default. +# For the full list of built-in configuration values, see the documentation: +# https://www.sphinx-doc.org/en/master/usage/configuration.html -import sys -import os +# -- Project information ----------------------------------------------------- +# https://www.sphinx-doc.org/en/master/usage/configuration.html#project-information -import sphinx_rtd_theme +from importlib.metadata import version as get_version -exec(open(os.path.join(os.pardir, 'tailbone', '_version.py')).read()) +project = 'Tailbone' +copyright = '2010 - 2024, Lance Edgar' +author = 'Lance Edgar' +release = get_version('Tailbone') +# -- General configuration --------------------------------------------------- +# https://www.sphinx-doc.org/en/master/usage/configuration.html#general-configuration -# If extensions (or modules to document with autodoc) are in another directory, -# add these directories to sys.path here. If the directory is relative to the -# documentation root, use os.path.abspath to make it absolute, like shown here. -#sys.path.insert(0, os.path.abspath('.')) - -# -- General configuration ------------------------------------------------ - -# If your documentation needs a minimal Sphinx version, state it here. -#needs_sphinx = '1.0' - -# Add any Sphinx extension module names here, as strings. They can be -# extensions coming with Sphinx (named 'sphinx.ext.*') or your custom -# ones. extensions = [ 'sphinx.ext.autodoc', 'sphinx.ext.todo', @@ -40,237 +23,30 @@ extensions = [ 'sphinx.ext.viewcode', ] +templates_path = ['_templates'] +exclude_patterns = ['_build', 'Thumbs.db', '.DS_Store'] + intersphinx_mapping = { + 'rattail': ('https://docs.wuttaproject.org/rattail/', None), 'webhelpers2': ('https://webhelpers2.readthedocs.io/en/latest/', None), + 'wuttaweb': ('https://docs.wuttaproject.org/wuttaweb/', None), + 'wuttjamaican': ('https://docs.wuttaproject.org/wuttjamaican/', None), } -# Add any paths that contain templates here, relative to this directory. -templates_path = ['_templates'] - -# The suffix of source filenames. -source_suffix = '.rst' - -# The encoding of source files. -#source_encoding = 'utf-8-sig' - -# The master toctree document. -master_doc = 'index' - -# General information about the project. -project = u'Tailbone' -copyright = u'2010 - 2018, Lance Edgar' - -# The version info for the project you're documenting, acts as replacement for -# |version| and |release|, also used in various other places throughout the -# built documents. -# -# The short X.Y version. -# version = '0.3' -version = '.'.join(__version__.split('.')[:2]) -# The full version, including alpha/beta/rc tags. -release = __version__ - -# The language for content autogenerated by Sphinx. Refer to documentation -# for a list of supported languages. -#language = None - -# There are two options for replacing |today|: either, you set today to some -# non-false value, then it is used: -#today = '' -# Else, today_fmt is used as the format for a strftime call. -#today_fmt = '%B %d, %Y' - -# List of patterns, relative to source directory, that match files and -# directories to ignore when looking for source files. -exclude_patterns = ['_build'] - -# The reST default role (used for this markup: `text`) to use for all -# documents. -#default_role = None - -# If true, '()' will be appended to :func: etc. cross-reference text. -#add_function_parentheses = True - -# If true, the current module name will be prepended to all description -# unit titles (such as .. function::). -#add_module_names = True - -# If true, sectionauthor and moduleauthor directives will be shown in the -# output. They are ignored by default. -#show_authors = False - -# The name of the Pygments (syntax highlighting) style to use. -pygments_style = 'sphinx' - -# A list of ignored prefixes for module index sorting. -#modindex_common_prefix = [] - -# If true, keep warnings as "system message" paragraphs in the built documents. -#keep_warnings = False +# allow todo entries to show up +todo_include_todos = True -# -- Options for HTML output ---------------------------------------------- +# -- Options for HTML output ------------------------------------------------- +# https://www.sphinx-doc.org/en/master/usage/configuration.html#options-for-html-output -# The theme to use for HTML and HTML Help pages. See the documentation for -# a list of builtin themes. -# html_theme = 'classic' -html_theme = 'sphinx_rtd_theme' - -# Theme options are theme-specific and customize the look and feel of a theme -# further. For a list of options available for each theme, see the -# documentation. -#html_theme_options = {} - -# Add any paths that contain custom themes here, relative to this directory. -#html_theme_path = [] -html_theme_path = [sphinx_rtd_theme.get_html_theme_path()] - -# The name for this set of Sphinx documents. If None, it defaults to -# " v documentation". -#html_title = None - -# A shorter title for the navigation bar. Default is the same as html_title. -#html_short_title = None +html_theme = 'furo' +html_static_path = ['_static'] # The name of an image file (relative to this directory) to place at the top # of the sidebar. #html_logo = None -html_logo = 'images/rattail_avatar.png' - -# The name of an image file (within the static path) to use as favicon of the -# docs. This file should be a Windows icon file (.ico) being 16x16 or 32x32 -# pixels large. -#html_favicon = None - -# Add any paths that contain custom static files (such as style sheets) here, -# relative to this directory. They are copied after the builtin static files, -# so a file named "default.css" will overwrite the builtin "default.css". -html_static_path = ['_static'] - -# Add any extra paths that contain custom files (such as robots.txt or -# .htaccess) here, relative to this directory. These files are copied -# directly to the root of the documentation. -#html_extra_path = [] - -# If not '', a 'Last updated on:' timestamp is inserted at every page bottom, -# using the given strftime format. -#html_last_updated_fmt = '%b %d, %Y' - -# If true, SmartyPants will be used to convert quotes and dashes to -# typographically correct entities. -#html_use_smartypants = True - -# Custom sidebar templates, maps document names to template names. -#html_sidebars = {} - -# Additional templates that should be rendered to pages, maps page names to -# template names. -#html_additional_pages = {} - -# If false, no module index is generated. -#html_domain_indices = True - -# If false, no index is generated. -#html_use_index = True - -# If true, the index is split into individual pages for each letter. -#html_split_index = False - -# If true, links to the reST sources are added to the pages. -#html_show_sourcelink = True - -# If true, "Created using Sphinx" is shown in the HTML footer. Default is True. -#html_show_sphinx = True - -# If true, "(C) Copyright ..." is shown in the HTML footer. Default is True. -#html_show_copyright = True - -# If true, an OpenSearch description file will be output, and all pages will -# contain a tag referring to it. The value of this option must be the -# base URL from which the finished HTML is served. -#html_use_opensearch = '' - -# This is the file name suffix for HTML files (e.g. ".xhtml"). -#html_file_suffix = None +#html_logo = 'images/rattail_avatar.png' # Output file base name for HTML help builder. -htmlhelp_basename = 'Tailbonedoc' - - -# -- Options for LaTeX output --------------------------------------------- - -latex_elements = { -# The paper size ('letterpaper' or 'a4paper'). -#'papersize': 'letterpaper', - -# The font size ('10pt', '11pt' or '12pt'). -#'pointsize': '10pt', - -# Additional stuff for the LaTeX preamble. -#'preamble': '', -} - -# Grouping the document tree into LaTeX files. List of tuples -# (source start file, target name, title, -# author, documentclass [howto, manual, or own class]). -latex_documents = [ - ('index', 'Tailbone.tex', u'Tailbone Documentation', - u'Lance Edgar', 'manual'), -] - -# The name of an image file (relative to this directory) to place at the top of -# the title page. -#latex_logo = None - -# For "manual" documents, if this is true, then toplevel headings are parts, -# not chapters. -#latex_use_parts = False - -# If true, show page references after internal links. -#latex_show_pagerefs = False - -# If true, show URL addresses after external links. -#latex_show_urls = False - -# Documents to append as an appendix to all manuals. -#latex_appendices = [] - -# If false, no module index is generated. -#latex_domain_indices = True - - -# -- Options for manual page output --------------------------------------- - -# One entry per manual page. List of tuples -# (source start file, name, description, authors, manual section). -man_pages = [ - ('index', 'tailbone', u'Tailbone Documentation', - [u'Lance Edgar'], 1) -] - -# If true, show URL addresses after external links. -#man_show_urls = False - - -# -- Options for Texinfo output ------------------------------------------- - -# Grouping the document tree into Texinfo files. List of tuples -# (source start file, target name, title, author, -# dir menu entry, description, category) -texinfo_documents = [ - ('index', 'Tailbone', u'Tailbone Documentation', - u'Lance Edgar', 'Tailbone', 'One line description of project.', - 'Miscellaneous'), -] - -# Documents to append as an appendix to all manuals. -#texinfo_appendices = [] - -# If false, no module index is generated. -#texinfo_domain_indices = True - -# How to display URL addresses: 'footnote', 'no', or 'inline'. -#texinfo_show_urls = 'footnote' - -# If true, do not generate a @detailmenu in the "Top" node's menu. -#texinfo_no_detailmenu = False +#htmlhelp_basename = 'Tailbonedoc' diff --git a/docs/index.rst b/docs/index.rst index f26d4019..d964086f 100644 --- a/docs/index.rst +++ b/docs/index.rst @@ -42,12 +42,32 @@ Package API: .. toctree:: :maxdepth: 1 + api/api/batch/core + api/api/batch/ordering + api/db + api/diffs api/forms + api/forms.widgets api/grids + api/grids.core + api/progress api/subscribers + api/util api/views/batch + api/views/batch.vendorcatalog + api/views/core api/views/master - api/views/vendors.catalogs + api/views/members + api/views/purchasing.batch + api/views/purchasing.ordering + + +Changelog: + +.. toctree:: + :maxdepth: 1 + + changelog Documentation To-Do diff --git a/docs/structure.rst b/docs/structure.rst index b741475e..5585f71a 100644 --- a/docs/structure.rst +++ b/docs/structure.rst @@ -117,7 +117,6 @@ of course supply the web app layer. │   │   │   └── foobatch/ │   │   ├── customers/ │   │   ├── menu.mako - │   │   ├── mobile/ │   │   └── products/ │   └── views/ │   ├── __init__.py diff --git a/pyproject.toml b/pyproject.toml new file mode 100644 index 00000000..a7214a8e --- /dev/null +++ b/pyproject.toml @@ -0,0 +1,103 @@ + +[build-system] +requires = ["hatchling"] +build-backend = "hatchling.build" + + +[project] +name = "Tailbone" +version = "0.22.7" +description = "Backoffice Web Application for Rattail" +readme = "README.md" +authors = [{name = "Lance Edgar", email = "lance@edbob.org"}] +license = {text = "GNU GPL v3+"} +classifiers = [ + "Development Status :: 4 - Beta", + "Environment :: Web Environment", + "Framework :: Pyramid", + "Intended Audience :: Developers", + "License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)", + "Natural Language :: English", + "Operating System :: OS Independent", + "Programming Language :: Python", + "Programming Language :: Python :: 3", + "Programming Language :: Python :: 3.8", + "Programming Language :: Python :: 3.9", + "Programming Language :: Python :: 3.10", + "Programming Language :: Python :: 3.11", + "Topic :: Internet :: WWW/HTTP", + "Topic :: Office/Business", + "Topic :: Software Development :: Libraries :: Python Modules", +] +requires-python = ">= 3.8" +dependencies = [ + "asgiref", + "colander", + "ColanderAlchemy", + "cornice", + "cornice-swagger", + "deform", + "humanize", + "Mako", + "markdown", + "openpyxl", + "paginate", + "paginate_sqlalchemy", + "passlib", + "Pillow", + "pyramid>=2", + "pyramid_beaker", + "pyramid_deform", + "pyramid_exclog", + "pyramid_fanstatic", + "pyramid_mako", + "pyramid_retry", + "pyramid_tm", + "rattail[db,bouncer]>=0.20.1", + "sa-filters", + "simplejson", + "transaction", + "waitress", + "WebHelpers2", + "WuttaWeb>=0.21.0", + "zope.sqlalchemy>=1.5", +] + + +[project.optional-dependencies] +docs = ["Sphinx", "furo"] +tests = ["coverage", "mock", "pytest", "pytest-cov"] + + +[project.entry-points."paste.app_factory"] +main = "tailbone.app:main" +webapi = "tailbone.webapi:main" + + +[project.entry-points."rattail.cleaners"] +beaker = "tailbone.cleanup:BeakerCleaner" + + +[project.entry-points."rattail.config.extensions"] +tailbone = "tailbone.config:ConfigExtension" + + +[project.urls] +Homepage = "https://rattailproject.org" +Repository = "https://forgejo.wuttaproject.org/rattail/tailbone" +Issues = "https://forgejo.wuttaproject.org/rattail/tailbone/issues" +Changelog = "https://forgejo.wuttaproject.org/rattail/tailbone/src/branch/master/CHANGELOG.md" + + +[tool.commitizen] +version_provider = "pep621" +tag_format = "v$version" +update_changelog_on_bump = true + + +[tool.nosetests] +nocapture = 1 +cover-package = "tailbone" +cover-erase = 1 +cover-html = 1 +cover-html-dir = "htmlcov" diff --git a/setup.cfg b/setup.cfg deleted file mode 100644 index 7712ec72..00000000 --- a/setup.cfg +++ /dev/null @@ -1,6 +0,0 @@ -[nosetests] -nocapture = 1 -cover-package = tailbone -cover-erase = 1 -cover-html = 1 -cover-html-dir = htmlcov diff --git a/setup.py b/setup.py deleted file mode 100644 index 9c9aa907..00000000 --- a/setup.py +++ /dev/null @@ -1,174 +0,0 @@ -# -*- coding: utf-8; -*- -################################################################################ -# -# Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar -# -# This file is part of Rattail. -# -# Rattail is free software: you can redistribute it and/or modify it under the -# terms of the GNU General Public License as published by the Free Software -# Foundation, either version 3 of the License, or (at your option) any later -# version. -# -# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY -# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS -# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more -# details. -# -# You should have received a copy of the GNU General Public License along with -# Rattail. If not, see . -# -################################################################################ -""" -Setup script for Tailbone -""" - -from __future__ import unicode_literals, absolute_import - -import os.path -from setuptools import setup, find_packages - - -here = os.path.abspath(os.path.dirname(__file__)) -exec(open(os.path.join(here, 'tailbone', '_version.py')).read()) -README = open(os.path.join(here, 'README.rst')).read() - - -requires = [ - # - # Version numbers within comments below have specific meanings. - # Basically the 'low' value is a "soft low," and 'high' a "soft high." - # In other words: - # - # If either a 'low' or 'high' value exists, the primary point to be - # made about the value is that it represents the most current (stable) - # version available for the package (assuming typical public access - # methods) whenever this project was started and/or documented. - # Therefore: - # - # If a 'low' version is present, you should know that attempts to use - # versions of the package significantly older than the 'low' version - # may not yield happy results. (A "hard" high limit may or may not be - # indicated by a true version requirement.) - # - # Similarly, if a 'high' version is present, and especially if this - # project has laid dormant for a while, you may need to refactor a bit - # when attempting to support a more recent version of the package. (A - # "hard" low limit should be indicated by a true version requirement - # when a 'high' version is present.) - # - # In any case, developers and other users are encouraged to play - # outside the lines with regard to these soft limits. If bugs are - # encountered then they should be filed as such. - # - # package # low high - - # TODO: why do we need to cap this? breaks tailbone.db zope stuff somehow - 'zope.sqlalchemy<1.0', # 0.7 0.7.7 - - # TODO: apparently they jumped from 0.1 to 0.9 and that broke us... - # (0.1 was released on 2014-09-14 and then 0.9 came out on 2018-09-27) - # (i've cached 0.1 at pypi.rattailproject.org just in case it disappears) - # (still, probably a better idea is to refactor so we can use 0.9) - 'webhelpers2_grid==0.1', # 0.1 - - 'ColanderAlchemy', # 0.3.3 - 'cornice', # 3.4.2 - 'deform', # 2.0.4 - 'humanize', # 0.5.1 - 'Mako', # 0.6.2 - 'openpyxl', # 2.4.7 - 'paginate', # 0.5.6 - 'paginate_sqlalchemy', # 0.2.0 - 'passlib', # 1.7.1 - 'Pillow', # 5.3.0 - 'pyramid', # 1.3b2 - 'pyramid_beaker>=0.6', # 0.6.1 - 'pyramid_deform', # 0.2 - 'pyramid_exclog', # 0.6 - 'pyramid_mako', # 1.0.2 - 'pyramid_tm', # 0.3 - 'rattail[db,bouncer]', # 0.5.0 - 'six', # 1.10.0 - 'sqlalchemy-filters', # 0.8.0 - 'transaction', # 1.2.0 - 'waitress', # 0.8.1 - 'WebHelpers2', # 2.0 - 'WTForms', # 2.1 -] - - -extras = { - - 'docs': [ - # - # package # low high - - 'Sphinx', # 1.2 - 'sphinx-rtd-theme', # 0.2.4 - ], - - 'tests': [ - # - # package # low high - - 'coverage', # 3.6 - 'fixture', # 1.5 - 'mock', # 1.0.1 - 'nose', # 1.3.0 - ], -} - - -setup( - name = "Tailbone", - version = __version__, - author = "Lance Edgar", - author_email = "lance@edbob.org", - url = "http://rattailproject.org/", - license = "GNU GPL v3", - description = "Backoffice Web Application for Rattail", - long_description = README, - - classifiers = [ - 'Development Status :: 4 - Beta', - 'Environment :: Web Environment', - 'Framework :: Pyramid', - 'Intended Audience :: Developers', - 'License :: OSI Approved :: GNU General Public License v3 or later (GPLv3+)', - 'Natural Language :: English', - 'Operating System :: OS Independent', - 'Programming Language :: Python', - 'Programming Language :: Python :: 2.7', - 'Programming Language :: Python :: 3', - 'Programming Language :: Python :: 3.5', - 'Topic :: Internet :: WWW/HTTP', - 'Topic :: Office/Business', - 'Topic :: Software Development :: Libraries :: Python Modules', - ], - - install_requires = requires, - extras_require = extras, - tests_require = ['Tailbone[tests]'], - test_suite = 'nose.collector', - - packages = find_packages(exclude=['tests.*', 'tests']), - include_package_data = True, - zip_safe = False, - - entry_points = { - - 'paste.app_factory': [ - 'main = tailbone.app:main', - ], - - 'rattail.config.extensions': [ - 'tailbone = tailbone.config:ConfigExtension', - ], - - 'pyramid.scaffold': [ - 'rattail = tailbone.scaffolds:RattailTemplate', - ], - }, -) diff --git a/tailbone/_version.py b/tailbone/_version.py index c2b32fbb..7095f6c8 100644 --- a/tailbone/_version.py +++ b/tailbone/_version.py @@ -1,3 +1,9 @@ # -*- coding: utf-8; -*- -__version__ = '0.8.31' +try: + from importlib.metadata import version +except ImportError: + from importlib_metadata import version + + +__version__ = version('Tailbone') diff --git a/tailbone/api/__init__.py b/tailbone/api/__init__.py index 572ff44d..1fae059f 100644 --- a/tailbone/api/__init__.py +++ b/tailbone/api/__init__.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2022 Lance Edgar # # This file is part of Rattail. # @@ -27,10 +27,13 @@ Tailbone Web API from __future__ import unicode_literals, absolute_import from .core import APIView, api -from .master import APIMasterView +from .master import APIMasterView, SortColumn +# TODO: remove this +from .master2 import APIMasterView2 def includeme(config): + config.include('tailbone.api.common') config.include('tailbone.api.auth') config.include('tailbone.api.customers') config.include('tailbone.api.upgrades') diff --git a/tailbone/api/auth.py b/tailbone/api/auth.py index 59ac2ee8..a710e30d 100644 --- a/tailbone/api/auth.py +++ b/tailbone/api/auth.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,9 +24,7 @@ Tailbone Web API - Auth Views """ -from __future__ import unicode_literals, absolute_import - -from rattail.db.auth import authenticate_user +from cornice import Service from tailbone.api import APIView, api from tailbone.db import Session @@ -35,16 +33,6 @@ from tailbone.auth import login_user, logout_user class AuthenticationView(APIView): - def user_info(self, user): - return { - 'ok': True, - 'user': { - 'uuid': user.uuid, - 'username': user.username, - 'display_name': user.display_name, - }, - } - @api def check_session(self): """ @@ -52,9 +40,29 @@ class AuthenticationView(APIView): This will establish a server-side web session for the user if none exists. Note that this also resets the user's session timer. """ + data = {'ok': True, 'permissions': []} if self.request.user: - return self.user_info(self.request.user) - return {} + data['user'] = self.get_user_info(self.request.user) + data['permissions'] = list(self.request.user_permissions) + + # background color may be set per-request, by some apps + if hasattr(self.request, 'background_color') and self.request.background_color: + data['background_color'] = self.request.background_color + else: # otherwise we use the one from config + data['background_color'] = self.rattail_config.get( + 'tailbone', 'background_color') + + # TODO: this seems the best place to return some global app + # settings, but maybe not desirable in all cases..in which + # case should caller need to ask for these explicitly? or + # make a different call altogether to get them..? + app = self.get_rattail_app() + customer_handler = app.get_clientele_handler() + data['settings'] = { + 'customer_field_dropdown': customer_handler.choice_uses_dropdown(), + } + + return data @api def login(self): @@ -69,12 +77,41 @@ class AuthenticationView(APIView): if not (username and password): return {'error': "Invalid username or password"} - user = authenticate_user(Session(), username, password) + # make sure credentials are valid + user = self.authenticate_user(username, password) if not user: return {'error': "Invalid username or password"} + # is there some reason this user should not login? + error = self.why_cant_user_login(user) + if error: + return {'error': error} + + app = self.get_rattail_app() + auth = app.get_auth_handler() + login_user(self.request, user) - return self.user_info(user) + return { + 'ok': True, + 'user': self.get_user_info(user), + 'permissions': list(auth.get_permissions(Session(), user)), + } + + def authenticate_user(self, username, password): + app = self.get_rattail_app() + auth = app.get_auth_handler() + return auth.authenticate_user(Session(), username, password) + + def why_cant_user_login(self, user): + """ + This method is given a ``User`` instance, which represents someone who + is just now trying to login, and has already cleared the basic hurdle + of providing the correct credentials for a user on file. This method + is responsible then, for further verification that this user *should* + in fact be allowed to login to this app node. If the method determines + a reason the user should *not* be allowed to login, then it should + return that reason as a simple string. + """ @api def logout(self): @@ -87,21 +124,106 @@ class AuthenticationView(APIView): logout_user(self.request) return {'ok': True} + @api + def become_root(self): + """ + Elevate the current request to 'root' for full system access. + """ + if not self.request.is_admin: + raise self.forbidden() + self.request.user.record_event(self.enum.USER_EVENT_BECOME_ROOT) + self.request.session['is_root'] = True + return { + 'ok': True, + 'user': self.get_user_info(self.request.user), + } + + @api + def stop_root(self): + """ + Lower the current request from 'root' back to normal access. + """ + if not self.request.is_admin: + raise self.forbidden() + self.request.user.record_event(self.enum.USER_EVENT_STOP_ROOT) + self.request.session['is_root'] = False + return { + 'ok': True, + 'user': self.get_user_info(self.request.user), + } + + @api + def change_password(self): + """ + View which allows a user to change their password. + """ + if self.request.method == 'OPTIONS': + return self.request.response + + if not self.request.user: + raise self.forbidden() + + if self.request.user.prevent_password_change and not self.request.is_root: + raise self.forbidden() + + data = self.request.json_body + + # first make sure "current" password is accurate + if not self.authenticate_user(self.request.user, data['current_password']): + return {'error': "The current/old password you provided is incorrect"} + + # okay then, set new password + auth = self.app.get_auth_handler() + auth.set_user_password(self.request.user, data['new_password']) + return { + 'ok': True, + 'user': self.get_user_info(self.request.user), + } + @classmethod def defaults(cls, config): + cls._auth_defaults(config) + + @classmethod + def _auth_defaults(cls, config): # session - config.add_route('api.session', '/session', request_method='GET') - config.add_view(cls, attr='check_session', route_name='api.session', renderer='json') + check_session = Service(name='check_session', path='/session') + check_session.add_view('GET', 'check_session', klass=cls) + config.add_cornice_service(check_session) # login - config.add_route('api.login', '/login', request_method=('OPTIONS', 'POST')) - config.add_view(cls, attr='login', route_name='api.login', renderer='json') + login = Service(name='login', path='/login') + login.add_view('POST', 'login', klass=cls) + config.add_cornice_service(login) # logout - config.add_route('api.logout', '/logout', request_method=('OPTIONS', 'POST')) - config.add_view(cls, attr='logout', route_name='api.logout', renderer='json') + logout = Service(name='logout', path='/logout') + logout.add_view('POST', 'logout', klass=cls) + config.add_cornice_service(logout) + + # become root + become_root = Service(name='become_root', path='/become-root') + become_root.add_view('POST', 'become_root', klass=cls) + config.add_cornice_service(become_root) + + # stop root + stop_root = Service(name='stop_root', path='/stop-root') + stop_root.add_view('POST', 'stop_root', klass=cls) + config.add_cornice_service(stop_root) + + # change password + change_password = Service(name='change_password', path='/change-password') + change_password.add_view('POST', 'change_password', klass=cls) + config.add_cornice_service(change_password) + + +def defaults(config, **kwargs): + base = globals() + + AuthenticationView = kwargs.get('AuthenticationView', base['AuthenticationView']) + AuthenticationView.defaults(config) def includeme(config): - AuthenticationView.defaults(config) + defaults(config) diff --git a/tailbone/api/batch/__init__.py b/tailbone/api/batch/__init__.py new file mode 100644 index 00000000..bdf58438 --- /dev/null +++ b/tailbone/api/batch/__init__.py @@ -0,0 +1,29 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2019 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Batches +""" + +from __future__ import unicode_literals, absolute_import + +from .core import APIBatchView, APIBatchRowView, BatchAPIMasterView diff --git a/tailbone/api/batch/core.py b/tailbone/api/batch/core.py new file mode 100644 index 00000000..f7bc9333 --- /dev/null +++ b/tailbone/api/batch/core.py @@ -0,0 +1,360 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2023 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Batch Views +""" + +import logging +import warnings + +from cornice import Service + +from tailbone.api import APIMasterView + + +log = logging.getLogger(__name__) + + +class APIBatchMixin(object): + """ + Base class for all API views which are meant to handle "batch" *and/or* + "batch row" data. + """ + + def get_batch_class(self): + model_class = self.get_model_class() + if hasattr(model_class, '__batch_class__'): + return model_class.__batch_class__ + return model_class + + def get_handler(self): + """ + Returns a `BatchHandler` instance for the view. All (?) custom batch + API views should define a default handler class; however this may in all + (?) cases be overridden by config also. The specific setting required + to do so will depend on the 'key' for the type of batch involved, e.g. + assuming the 'vendor_catalog' batch: + + .. code-block:: ini + + [rattail.batch] + vendor_catalog.handler = myapp.batch.vendorcatalog:CustomCatalogHandler + + Note that the 'key' for a batch is generally the same as its primary + table name, although technically it is whatever value returns from the + ``batch_key`` attribute of the main batch model class. + """ + app = self.get_rattail_app() + key = self.get_batch_class().batch_key + return app.get_batch_handler(key, default=self.default_handler_spec) + + +class APIBatchView(APIBatchMixin, APIMasterView): + """ + Base class for all API views which are meant to handle "batch" *and/or* + "batch row" data. + """ + supports_toggle_complete = False + supports_execute = False + + def __init__(self, request, **kwargs): + super(APIBatchView, self).__init__(request, **kwargs) + self.batch_handler = self.get_handler() + + @property + def handler(self): + warnings.warn("the `handler` property is deprecated; " + "please use `batch_handler` instead", + DeprecationWarning, stacklevel=2) + return self.batch_handler + + def normalize(self, batch): + app = self.get_rattail_app() + created = app.localtime(batch.created, from_utc=True) + + executed = None + if batch.executed: + executed = app.localtime(batch.executed, from_utc=True) + + return { + 'uuid': batch.uuid, + '_str': str(batch), + 'id': batch.id, + 'id_str': batch.id_str, + 'description': batch.description, + 'notes': batch.notes, + 'params': batch.params or {}, + 'rowcount': batch.rowcount, + 'created': str(created), + 'created_display': self.pretty_datetime(created), + 'created_by_uuid': batch.created_by.uuid, + 'created_by_display': str(batch.created_by), + 'complete': batch.complete, + 'status_code': batch.status_code, + 'status_display': batch.STATUS.get(batch.status_code, + str(batch.status_code)), + 'executed': str(executed) if executed else None, + 'executed_display': self.pretty_datetime(executed) if executed else None, + 'executed_by_uuid': batch.executed_by_uuid, + 'executed_by_display': str(batch.executed_by or ''), + 'mutable': self.batch_handler.is_mutable(batch), + } + + def create_object(self, data): + """ + Create a new object instance and populate it with the given data. + + Here we'll invoke the handler for actual batch creation, instead of + typical logic used for simple records. + """ + user = self.request.user + kwargs = dict(data) + kwargs['user'] = user + batch = self.batch_handler.make_batch(self.Session(), **kwargs) + if self.batch_handler.should_populate(batch): + self.batch_handler.do_populate(batch, user) + return batch + + def update_object(self, batch, data): + """ + Logic for updating a main object record. + + Here we want to make sure we set "created by" to the current user, when + creating a new batch. + """ + # we're only concerned with *new* batches here + if not batch.uuid: + + # assign creator; initialize row count + batch.created_by_uuid = self.request.user.uuid + if batch.rowcount is None: + batch.rowcount = 0 + + # then go ahead with usual logic + return super(APIBatchView, self).update_object(batch, data) + + def mark_complete(self): + """ + Mark the given batch as "complete". + """ + batch = self.get_object() + + if batch.executed: + return {'error': "Batch {} has already been executed: {}".format( + batch.id_str, batch.description)} + + if batch.complete: + return {'error': "Batch {} is already marked complete: {}".format( + batch.id_str, batch.description)} + + batch.complete = True + return self._get(obj=batch) + + def mark_incomplete(self): + """ + Mark the given batch as "incomplete". + """ + batch = self.get_object() + + if batch.executed: + return {'error': "Batch {} has already been executed: {}".format( + batch.id_str, batch.description)} + + if not batch.complete: + return {'error': "Batch {} is already marked incomplete: {}".format( + batch.id_str, batch.description)} + + batch.complete = False + return self._get(obj=batch) + + def execute(self): + """ + Execute the given batch. + """ + batch = self.get_object() + + if batch.executed: + return {'error': "Batch {} has already been executed: {}".format( + batch.id_str, batch.description)} + + kwargs = dict(self.request.json_body) + kwargs.pop('user', None) + kwargs.pop('progress', None) + result = self.batch_handler.do_execute(batch, self.request.user, **kwargs) + return {'ok': bool(result), 'batch': self.normalize(batch)} + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._batch_defaults(config) + + @classmethod + def _batch_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + object_url_prefix = cls.get_object_url_prefix() + + if cls.supports_toggle_complete: + + # mark complete + mark_complete = Service(name='{}.mark_complete'.format(route_prefix), + path='{}/{{uuid}}/mark-complete'.format(object_url_prefix)) + mark_complete.add_view('POST', 'mark_complete', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(mark_complete) + + # mark incomplete + mark_incomplete = Service(name='{}.mark_incomplete'.format(route_prefix), + path='{}/{{uuid}}/mark-incomplete'.format(object_url_prefix)) + mark_incomplete.add_view('POST', 'mark_incomplete', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(mark_incomplete) + + if cls.supports_execute: + + # execute batch + execute = Service(name='{}.execute'.format(route_prefix), + path='{}/{{uuid}}/execute'.format(object_url_prefix)) + execute.add_view('POST', 'execute', klass=cls, + permission='{}.execute'.format(permission_prefix)) + config.add_cornice_service(execute) + + +# TODO: deprecate / remove this +BatchAPIMasterView = APIBatchView + + +class APIBatchRowView(APIBatchMixin, APIMasterView): + """ + Base class for all API views which are meant to handle "batch rows" data. + """ + editable = False + supports_quick_entry = False + + def __init__(self, request, **kwargs): + super(APIBatchRowView, self).__init__(request, **kwargs) + self.batch_handler = self.get_handler() + + @property + def handler(self): + warnings.warn("the `handler` property is deprecated; " + "please use `batch_handler` instead", + DeprecationWarning, stacklevel=2) + return self.batch_handler + + def normalize(self, row): + batch = row.batch + return { + 'uuid': row.uuid, + '_str': str(row), + '_parent_str': str(batch), + '_parent_uuid': batch.uuid, + 'batch_uuid': batch.uuid, + 'batch_id': batch.id, + 'batch_id_str': batch.id_str, + 'batch_description': batch.description, + 'batch_complete': batch.complete, + 'batch_executed': bool(batch.executed), + 'batch_mutable': self.batch_handler.is_mutable(batch), + 'sequence': row.sequence, + 'status_code': row.status_code, + 'status_display': row.STATUS.get(row.status_code, str(row.status_code)), + } + + def update_object(self, row, data): + """ + Supplements the default logic as follows: + + Invokes the batch handler's ``refresh_row()`` method after updating the + row's field data per usual. + """ + if not self.batch_handler.is_mutable(row.batch): + return {'error': "Batch is not mutable"} + + # update row per usual + row = super(APIBatchRowView, self).update_object(row, data) + + # okay now we apply handler refresh logic + self.batch_handler.refresh_row(row) + return row + + def delete_object(self, row): + """ + Overrides the default logic as follows: + + Delegates deletion of the row to the batch handler. + """ + self.batch_handler.do_remove_row(row) + + def quick_entry(self): + """ + View for handling "quick entry" user input, for a batch. + """ + data = self.request.json_body + + uuid = data['batch_uuid'] + batch = self.Session.get(self.get_batch_class(), uuid) + if not batch: + raise self.notfound() + + entry = data['quick_entry'] + + try: + row = self.batch_handler.quick_entry(self.Session(), batch, entry) + except Exception as error: + log.warning("quick entry failed for '%s' batch %s: %s", + self.batch_handler.batch_key, batch.id_str, entry, + exc_info=True) + msg = str(error) + if not msg and isinstance(error, NotImplementedError): + msg = "Feature is not implemented" + return {'error': msg} + + if not row: + return {'error': "Could not identify product"} + + self.Session.flush() + result = self._get(obj=row) + result['ok'] = True + return result + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._batch_row_defaults(config) + + @classmethod + def _batch_row_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + + if cls.supports_quick_entry: + + # quick entry + quick_entry = Service(name='{}.quick_entry'.format(route_prefix), + path='{}/quick-entry'.format(collection_url_prefix)) + quick_entry.add_view('POST', 'quick_entry', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(quick_entry) diff --git a/tailbone/api/batch/inventory.py b/tailbone/api/batch/inventory.py new file mode 100644 index 00000000..22b67e54 --- /dev/null +++ b/tailbone/api/batch/inventory.py @@ -0,0 +1,200 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2023 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Inventory Batches +""" + +import decimal + +import sqlalchemy as sa + +from rattail import pod +from rattail.db.model import InventoryBatch, InventoryBatchRow + +from cornice import Service + +from tailbone.api.batch import APIBatchView, APIBatchRowView + + +class InventoryBatchViews(APIBatchView): + + model_class = InventoryBatch + default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler' + route_prefix = 'inventory' + permission_prefix = 'batch.inventory' + collection_url_prefix = '/inventory-batches' + object_url_prefix = '/inventory-batch' + supports_toggle_complete = True + + def normalize(self, batch): + data = super().normalize(batch) + + data['mode'] = batch.mode + data['mode_display'] = self.enum.INVENTORY_MODE.get(batch.mode) + if data['mode_display'] is None and batch.mode is not None: + data['mode_display'] = str(batch.mode) + + data['reason_code'] = batch.reason_code + + return data + + def count_modes(self): + """ + Retrieve info about the available batch count modes. + """ + permission_prefix = self.get_permission_prefix() + if self.request.is_root: + modes = self.batch_handler.get_count_modes() + else: + modes = self.batch_handler.get_allowed_count_modes( + self.Session(), self.request.user, + permission_prefix=permission_prefix) + return modes + + def adjustment_reasons(self): + """ + Retrieve info about the available "reasons" for inventory adjustment + batches. + """ + raw_reasons = self.batch_handler.get_adjustment_reasons(self.Session()) + reasons = [] + for reason in raw_reasons: + reasons.append({ + 'uuid': reason.uuid, + 'code': reason.code, + 'description': reason.description, + 'hidden': reason.hidden, + }) + return reasons + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._batch_defaults(config) + cls._inventory_defaults(config) + + @classmethod + def _inventory_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + + # get count modes + count_modes = Service(name='{}.count_modes'.format(route_prefix), + path='{}/count-modes'.format(collection_url_prefix)) + count_modes.add_view('GET', 'count_modes', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(count_modes) + + # get adjustment reasons + adjustment_reasons = Service(name='{}.adjustment_reasons'.format(route_prefix), + path='{}/adjustment-reasons'.format(collection_url_prefix)) + adjustment_reasons.add_view('GET', 'adjustment_reasons', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(adjustment_reasons) + + +class InventoryBatchRowViews(APIBatchRowView): + + model_class = InventoryBatchRow + default_handler_spec = 'rattail.batch.inventory:InventoryBatchHandler' + route_prefix = 'inventory.rows' + permission_prefix = 'batch.inventory' + collection_url_prefix = '/inventory-batch-rows' + object_url_prefix = '/inventory-batch-row' + editable = True + supports_quick_entry = True + + def normalize(self, row): + batch = row.batch + data = super().normalize(row) + app = self.get_rattail_app() + + data['item_id'] = row.item_id + data['upc'] = str(row.upc) + data['upc_pretty'] = row.upc.pretty() if row.upc else None + data['brand_name'] = row.brand_name + data['description'] = row.description + data['size'] = row.size + data['full_description'] = row.product.full_description if row.product else row.description + data['image_url'] = pod.get_image_url(self.rattail_config, row.upc) if row.upc else None + data['case_quantity'] = app.render_quantity(row.case_quantity or 1) + + data['cases'] = row.cases + data['units'] = row.units + data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA' + data['quantity_display'] = "{} {}".format( + app.render_quantity(row.cases or row.units), + 'CS' if row.cases else data['unit_uom']) + + data['allow_cases'] = self.batch_handler.allow_cases(batch) + + return data + + def update_object(self, row, data): + """ + Supplements the default logic as follows: + + Converts certain fields within the data, to proper "native" types. + """ + data = dict(data) + + # convert some data types as needed + if 'cases' in data: + if data['cases'] == '': + data['cases'] = None + elif data['cases']: + data['cases'] = decimal.Decimal(data['cases']) + if 'units' in data: + if data['units'] == '': + data['units'] = None + elif data['units']: + data['units'] = decimal.Decimal(data['units']) + + # update row per usual + try: + row = super().update_object(row, data) + except sa.exc.DataError as error: + # detect when user scans barcode for cases/units field + if hasattr(error, 'orig'): + orig = type(error.orig) + if hasattr(orig, '__name__'): + # nb. this particular error is from psycopg2 + if orig.__name__ == 'NumericValueOutOfRange': + return {'error': "Numeric value out of range"} + raise + return row + + +def defaults(config, **kwargs): + base = globals() + + InventoryBatchViews = kwargs.get('InventoryBatchViews', base['InventoryBatchViews']) + InventoryBatchViews.defaults(config) + + InventoryBatchRowViews = kwargs.get('InventoryBatchRowViews', base['InventoryBatchRowViews']) + InventoryBatchRowViews.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/batch/labels.py b/tailbone/api/batch/labels.py new file mode 100644 index 00000000..4f154b21 --- /dev/null +++ b/tailbone/api/batch/labels.py @@ -0,0 +1,78 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Label Batches +""" + +from rattail.db import model + +from tailbone.api.batch import APIBatchView, APIBatchRowView + + +class LabelBatchViews(APIBatchView): + + model_class = model.LabelBatch + default_handler_spec = 'rattail.batch.labels:LabelBatchHandler' + route_prefix = 'labelbatchviews' + permission_prefix = 'labels.batch' + collection_url_prefix = '/label-batches' + object_url_prefix = '/label-batch' + supports_toggle_complete = True + + +class LabelBatchRowViews(APIBatchRowView): + + model_class = model.LabelBatchRow + default_handler_spec = 'rattail.batch.labels:LabelBatchHandler' + route_prefix = 'api.label_batch_rows' + permission_prefix = 'labels.batch' + collection_url_prefix = '/label-batch-rows' + object_url_prefix = '/label-batch-row' + supports_quick_entry = True + + def normalize(self, row): + batch = row.batch + data = super().normalize(row) + + data['item_id'] = row.item_id + data['upc'] = str(row.upc) + data['upc_pretty'] = row.upc.pretty() if row.upc else None + data['brand_name'] = row.brand_name + data['description'] = row.description + data['size'] = row.size + data['full_description'] = row.product.full_description if row.product else row.description + return data + + +def defaults(config, **kwargs): + base = globals() + + LabelBatchViews = kwargs.get('LabelBatchViews', base['LabelBatchViews']) + LabelBatchViews.defaults(config) + + LabelBatchRowViews = kwargs.get('LabelBatchRowViews', base['LabelBatchRowViews']) + LabelBatchRowViews.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/batch/ordering.py b/tailbone/api/batch/ordering.py new file mode 100644 index 00000000..204be8ad --- /dev/null +++ b/tailbone/api/batch/ordering.py @@ -0,0 +1,318 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Ordering Batches + +These views expose the basic CRUD interface to "ordering" batches, for the web +API. +""" + +import datetime +import logging + +import sqlalchemy as sa + +from rattail.db.model import PurchaseBatch, PurchaseBatchRow + +from cornice import Service + +from tailbone.api.batch import APIBatchView, APIBatchRowView + + +log = logging.getLogger(__name__) + + +class OrderingBatchViews(APIBatchView): + + model_class = PurchaseBatch + default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' + route_prefix = 'orderingbatchviews' + permission_prefix = 'ordering' + collection_url_prefix = '/ordering-batches' + object_url_prefix = '/ordering-batch' + supports_toggle_complete = True + supports_execute = True + + def base_query(self): + """ + Modifies the default logic as follows: + + Adds a condition to the query, to ensure only purchase batches with + "ordering" mode are returned. + """ + model = self.model + query = super().base_query() + query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_ORDERING) + return query + + def normalize(self, batch): + data = super().normalize(batch) + + data['vendor_uuid'] = batch.vendor.uuid + data['vendor_display'] = str(batch.vendor) + + data['department_uuid'] = batch.department_uuid + data['department_display'] = str(batch.department) if batch.department else None + + data['po_total_calculated_display'] = "${:0.2f}".format(batch.po_total_calculated or 0) + data['ship_method'] = batch.ship_method + data['notes_to_vendor'] = batch.notes_to_vendor + return data + + def create_object(self, data): + """ + Modifies the default logic as follows: + + Sets the mode to "ordering" for the new batch. + """ + data = dict(data) + if not data.get('vendor_uuid'): + raise ValueError("You must specify the vendor") + data['mode'] = self.enum.PURCHASE_BATCH_MODE_ORDERING + batch = super().create_object(data) + return batch + + def worksheet(self): + """ + Returns primary data for the Ordering Worksheet view. + """ + batch = self.get_object() + if batch.executed: + raise self.forbidden() + + app = self.get_rattail_app() + + # TODO: much of the logic below was copied from the traditional master + # view for ordering batches. should maybe let them share it somehow? + + # organize existing batch rows by product + order_items = {} + for row in batch.active_rows(): + order_items[row.product_uuid] = row + + # organize vendor catalog costs by dept / subdept + departments = {} + costs = self.batch_handler.get_order_form_costs(self.Session(), batch.vendor) + costs = self.batch_handler.sort_order_form_costs(costs) + costs = list(costs) # we must have a stable list for the rest of this + self.batch_handler.decorate_order_form_costs(batch, costs) + for cost in costs: + + department = cost.product.department + if department: + department_dict = departments.setdefault(department.uuid, { + 'uuid': department.uuid, + 'number': department.number, + 'name': department.name, + }) + else: + if None not in departments: + departments[None] = { + 'uuid': None, + 'number': None, + 'name': "", + } + department_dict = departments[None] + + subdepartments = department_dict.setdefault('subdepartments', {}) + + subdepartment = cost.product.subdepartment + if subdepartment: + subdepartment_dict = subdepartments.setdefault(subdepartment.uuid, { + 'uuid': subdepartment.uuid, + 'number': subdepartment.number, + 'name': subdepartment.name, + }) + else: + if None not in subdepartments: + subdepartments[None] = { + 'uuid': None, + 'number': None, + 'name': "", + } + subdepartment_dict = subdepartments[None] + + subdept_costs = subdepartment_dict.setdefault('costs', []) + product = cost.product + subdept_costs.append({ + 'uuid': cost.uuid, + 'upc': str(product.upc), + 'upc_pretty': product.upc.pretty() if product.upc else None, + 'brand_name': product.brand.name if product.brand else None, + 'description': product.description, + 'size': product.size, + 'case_size': cost.case_size, + 'uom_display': "LB" if product.weighed else "EA", + 'vendor_item_code': cost.code, + 'preference': cost.preference, + 'preferred': cost.preference == 1, + 'unit_cost': cost.unit_cost, + 'unit_cost_display': "${:0.2f}".format(cost.unit_cost) if cost.unit_cost is not None else "", + # TODO + # 'cases_ordered': None, + # 'units_ordered': None, + # 'po_total': None, + # 'po_total_display': None, + }) + + # sort the (sub)department groupings + sorted_departments = [] + for dept in sorted(departments.values(), key=lambda d: d['name']): + dept['subdepartments'] = sorted(dept['subdepartments'].values(), + key=lambda s: s['name']) + sorted_departments.append(dept) + + # fetch recent purchase history, sort/pad for template convenience + history = self.batch_handler.get_order_form_history(batch, costs, 6) + for i in range(6 - len(history)): + history.append(None) + history = list(reversed(history)) + # must convert some date objects to string, for JSON sake + for h in history: + if not h: + continue + purchase = h.get('purchase') + if purchase: + dt = purchase.get('date_ordered') + if dt and isinstance(dt, datetime.date): + purchase['date_ordered'] = app.render_date(dt) + dt = purchase.get('date_received') + if dt and isinstance(dt, datetime.date): + purchase['date_received'] = app.render_date(dt) + + return { + 'batch': self.normalize(batch), + 'departments': departments, + 'sorted_departments': sorted_departments, + 'history': history, + } + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._batch_defaults(config) + cls._ordering_batch_defaults(config) + + @classmethod + def _ordering_batch_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + object_url_prefix = cls.get_object_url_prefix() + + # worksheet + worksheet = Service(name='{}.worksheet'.format(route_prefix), + path='{}/{{uuid}}/worksheet'.format(object_url_prefix)) + worksheet.add_view('GET', 'worksheet', klass=cls, + permission='{}.worksheet'.format(permission_prefix)) + config.add_cornice_service(worksheet) + + +class OrderingBatchRowViews(APIBatchRowView): + + model_class = PurchaseBatchRow + default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' + route_prefix = 'ordering.rows' + permission_prefix = 'ordering' + collection_url_prefix = '/ordering-batch-rows' + object_url_prefix = '/ordering-batch-row' + supports_quick_entry = True + editable = True + + def normalize(self, row): + data = super().normalize(row) + app = self.get_rattail_app() + batch = row.batch + + data['item_id'] = row.item_id + data['upc'] = str(row.upc) + data['upc_pretty'] = row.upc.pretty() if row.upc else None + data['brand_name'] = row.brand_name + data['description'] = row.description + data['size'] = row.size + data['full_description'] = row.product.full_description if row.product else row.description + + # # only provide image url if so configured + # if self.rattail_config.getbool('rattail.batch', 'purchase.mobile_images', default=True): + # data['image_url'] = pod.get_image_url(self.rattail_config, row.upc) if row.upc else None + + # unit_uom can vary by product + data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA' + + data['case_quantity'] = row.case_quantity + data['cases_ordered'] = row.cases_ordered + data['units_ordered'] = row.units_ordered + data['cases_ordered_display'] = app.render_quantity(row.cases_ordered or 0, empty_zero=False) + data['units_ordered_display'] = app.render_quantity(row.units_ordered or 0, empty_zero=False) + + data['po_unit_cost'] = row.po_unit_cost + data['po_unit_cost_display'] = "${:0.2f}".format(row.po_unit_cost) if row.po_unit_cost is not None else None + data['po_total_calculated'] = row.po_total_calculated + data['po_total_calculated_display'] = "${:0.2f}".format(row.po_total_calculated) if row.po_total_calculated is not None else None + data['status_code'] = row.status_code + data['status_display'] = row.STATUS.get(row.status_code, str(row.status_code)) + + return data + + def update_object(self, row, data): + """ + Overrides the default logic as follows: + + So far, we only allow updating the ``cases_ordered`` and/or + ``units_ordered`` quantities; therefore ``data`` should have one or + both of those keys. + + This data is then passed to the + :meth:`~rattail:rattail.batch.purchase.PurchaseBatchHandler.update_row_quantity()` + method of the batch handler. + + Note that the "normal" logic for this method is not invoked at all. + """ + if not self.batch_handler.is_mutable(row.batch): + return {'error': "Batch is not mutable"} + + try: + self.batch_handler.update_row_quantity(row, **data) + self.Session.flush() + except Exception as error: + log.warning("update_row_quantity failed", exc_info=True) + if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'): + error = str(error.orig) + else: + error = str(error) + return {'error': error} + + return row + + +def defaults(config, **kwargs): + base = globals() + + OrderingBatchViews = kwargs.get('OrderingBatchViews', base['OrderingBatchViews']) + OrderingBatchViews.defaults(config) + + OrderingBatchRowViews = kwargs.get('OrderingBatchRowViews', base['OrderingBatchRowViews']) + OrderingBatchRowViews.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/batch/receiving.py b/tailbone/api/batch/receiving.py new file mode 100644 index 00000000..b23bff55 --- /dev/null +++ b/tailbone/api/batch/receiving.py @@ -0,0 +1,492 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Receiving Batches +""" + +import logging + +import humanize +import sqlalchemy as sa + +from rattail.db.model import PurchaseBatch, PurchaseBatchRow + +from cornice import Service +from deform import widget as dfwidget + +from tailbone import forms +from tailbone.api.batch import APIBatchView, APIBatchRowView +from tailbone.forms.receiving import ReceiveRow + + +log = logging.getLogger(__name__) + + +class ReceivingBatchViews(APIBatchView): + + model_class = PurchaseBatch + default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' + route_prefix = 'receivingbatchviews' + permission_prefix = 'receiving' + collection_url_prefix = '/receiving-batches' + object_url_prefix = '/receiving-batch' + supports_toggle_complete = True + supports_execute = True + + def base_query(self): + model = self.app.model + query = super().base_query() + query = query.filter(model.PurchaseBatch.mode == self.enum.PURCHASE_BATCH_MODE_RECEIVING) + return query + + def normalize(self, batch): + data = super().normalize(batch) + + data['vendor_uuid'] = batch.vendor.uuid + data['vendor_display'] = str(batch.vendor) + + data['department_uuid'] = batch.department_uuid + data['department_display'] = str(batch.department) if batch.department else None + + data['po_number'] = batch.po_number + data['po_total'] = batch.po_total + data['invoice_total'] = batch.invoice_total + data['invoice_total_calculated'] = batch.invoice_total_calculated + + data['can_auto_receive'] = self.batch_handler.can_auto_receive(batch) + + return data + + def create_object(self, data): + data = dict(data) + + # all about receiving mode here + data['mode'] = self.enum.PURCHASE_BATCH_MODE_RECEIVING + + # assume "receive from PO" if given a PO key + if data.get('purchase_key'): + data['workflow'] = 'from_po' + + return super().create_object(data) + + def auto_receive(self): + """ + View which handles auto-marking as received, all items within + a pending batch. + """ + batch = self.get_object() + self.batch_handler.auto_receive_all_items(batch) + return self._get(obj=batch) + + def mark_receiving_complete(self): + """ + Mark the given batch as "receiving complete". + """ + batch = self.get_object() + + if batch.executed: + return {'error': "Batch {} has already been executed: {}".format( + batch.id_str, batch.description)} + + if batch.complete: + return {'error': "Batch {} is already marked complete: {}".format( + batch.id_str, batch.description)} + + if batch.receiving_complete: + return {'error': "Receiving is already complete for batch {}: {}".format( + batch.id_str, batch.description)} + + batch.receiving_complete = True + return self._get(obj=batch) + + def eligible_purchases(self): + model = self.app.model + uuid = self.request.params.get('vendor_uuid') + vendor = self.Session.get(model.Vendor, uuid) if uuid else None + if not vendor: + return {'error': "Vendor not found"} + + purchases = self.batch_handler.get_eligible_purchases( + vendor, self.enum.PURCHASE_BATCH_MODE_RECEIVING) + + purchases = [self.normalize_eligible_purchase(p) + for p in purchases] + + return {'purchases': purchases} + + def normalize_eligible_purchase(self, purchase): + return self.batch_handler.normalize_eligible_purchase(purchase) + + def render_eligible_purchase(self, purchase): + return self.batch_handler.render_eligible_purchase(purchase) + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._batch_defaults(config) + cls._receiving_batch_defaults(config) + + @classmethod + def _receiving_batch_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + object_url_prefix = cls.get_object_url_prefix() + + # auto_receive + auto_receive = Service(name='{}.auto_receive'.format(route_prefix), + path='{}/{{uuid}}/auto-receive'.format(object_url_prefix)) + auto_receive.add_view('GET', 'auto_receive', klass=cls, + permission='{}.auto_receive'.format(permission_prefix)) + config.add_cornice_service(auto_receive) + + # mark_receiving_complete + mark_receiving_complete = Service(name='{}.mark_receiving_complete'.format(route_prefix), + path='{}/{{uuid}}/mark-receiving-complete'.format(object_url_prefix)) + mark_receiving_complete.add_view('POST', 'mark_receiving_complete', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(mark_receiving_complete) + + # eligible purchases + eligible_purchases = Service(name='{}.eligible_purchases'.format(route_prefix), + path='{}/eligible-purchases'.format(collection_url_prefix)) + eligible_purchases.add_view('GET', 'eligible_purchases', klass=cls, + permission='{}.create'.format(permission_prefix)) + config.add_cornice_service(eligible_purchases) + + +class ReceivingBatchRowViews(APIBatchRowView): + + model_class = PurchaseBatchRow + default_handler_spec = 'rattail.batch.purchase:PurchaseBatchHandler' + route_prefix = 'receiving.rows' + permission_prefix = 'receiving' + collection_url_prefix = '/receiving-batch-rows' + object_url_prefix = '/receiving-batch-row' + supports_quick_entry = True + + def make_filter_spec(self): + model = self.app.model + filters = super().make_filter_spec() + if filters: + + # must translate certain convenience filters + orig_filters, filters = filters, [] + for filtr in orig_filters: + + # # is_received + # # NOTE: this is only relevant for truck dump or "from scratch" + # if filtr['field'] == 'is_received' and filtr['op'] == 'eq' and filtr['value'] is True: + # filters.extend([ + # {'or': [ + # {'field': 'cases_received', 'op': '!=', 'value': 0}, + # {'field': 'units_received', 'op': '!=', 'value': 0}, + # ]}, + # ]) + + # is_incomplete + if filtr['field'] == 'is_incomplete' and filtr['op'] == 'eq' and filtr['value'] is True: + # looking for any rows with "ordered" quantity, but where the + # status does *not* signify a "settled" row so to speak + # TODO: would be nice if we had a simple flag to leverage? + filters.extend([ + {'or': [ + {'field': 'cases_ordered', 'op': '!=', 'value': 0}, + {'field': 'units_ordered', 'op': '!=', 'value': 0}, + ]}, + {'field': 'status_code', 'op': 'not_in', 'value': [ + model.PurchaseBatchRow.STATUS_OK, + model.PurchaseBatchRow.STATUS_PRODUCT_NOT_FOUND, + model.PurchaseBatchRow.STATUS_CASE_QUANTITY_DIFFERS, + ]}, + ]) + + # is_invalid + elif filtr['field'] == 'is_invalid' and filtr['op'] == 'eq' and filtr['value'] is True: + filters.extend([ + {'field': 'status_code', 'op': 'in', 'value': [ + model.PurchaseBatchRow.STATUS_PRODUCT_NOT_FOUND, + model.PurchaseBatchRow.STATUS_COST_NOT_FOUND, + model.PurchaseBatchRow.STATUS_CASE_QUANTITY_UNKNOWN, + model.PurchaseBatchRow.STATUS_CASE_QUANTITY_DIFFERS, + ]}, + ]) + + # is_unexpected + elif filtr['field'] == 'is_unexpected' and filtr['op'] == 'eq' and filtr['value'] is True: + # looking for any rows which do *not* have "ordered/shipped" quantity + filters.extend([ + {'and': [ + {'or': [ + {'field': 'cases_ordered', 'op': 'is_null'}, + {'field': 'cases_ordered', 'op': '==', 'value': 0}, + ]}, + {'or': [ + {'field': 'units_ordered', 'op': 'is_null'}, + {'field': 'units_ordered', 'op': '==', 'value': 0}, + ]}, + {'or': [ + {'field': 'cases_shipped', 'op': 'is_null'}, + {'field': 'cases_shipped', 'op': '==', 'value': 0}, + ]}, + {'or': [ + {'field': 'units_shipped', 'op': 'is_null'}, + {'field': 'units_shipped', 'op': '==', 'value': 0}, + ]}, + {'or': [ + # but "unexpected" also implies we have some confirmed amount(s) + {'field': 'cases_received', 'op': '!=', 'value': 0}, + {'field': 'units_received', 'op': '!=', 'value': 0}, + {'field': 'cases_damaged', 'op': '!=', 'value': 0}, + {'field': 'units_damaged', 'op': '!=', 'value': 0}, + {'field': 'cases_expired', 'op': '!=', 'value': 0}, + {'field': 'units_expired', 'op': '!=', 'value': 0}, + ]}, + ]}, + ]) + + # is_damaged + elif filtr['field'] == 'is_damaged' and filtr['op'] == 'eq' and filtr['value'] is True: + filters.extend([ + {'or': [ + {'field': 'cases_damaged', 'op': '!=', 'value': 0}, + {'field': 'units_damaged', 'op': '!=', 'value': 0}, + ]}, + ]) + + # is_expired + elif filtr['field'] == 'is_expired' and filtr['op'] == 'eq' and filtr['value'] is True: + filters.extend([ + {'or': [ + {'field': 'cases_expired', 'op': '!=', 'value': 0}, + {'field': 'units_expired', 'op': '!=', 'value': 0}, + ]}, + ]) + + # is_missing + elif filtr['field'] == 'is_missing' and filtr['op'] == 'eq' and filtr['value'] is True: + filters.extend([ + {'or': [ + {'field': 'cases_missing', 'op': '!=', 'value': 0}, + {'field': 'units_missing', 'op': '!=', 'value': 0}, + ]}, + ]) + + else: # just some filter, use as-is + filters.append(filtr) + + return filters + + def normalize(self, row): + data = super().normalize(row) + model = self.app.model + + batch = row.batch + prodder = self.app.get_products_handler() + + data['product_uuid'] = row.product_uuid + data['item_id'] = row.item_id + data['upc'] = str(row.upc) + data['upc_pretty'] = row.upc.pretty() if row.upc else None + data['brand_name'] = row.brand_name + data['description'] = row.description + data['size'] = row.size + data['full_description'] = row.product.full_description if row.product else row.description + + # only provide image url if so configured + if self.rattail_config.getbool('rattail.batch', 'purchase.mobile_images', default=True): + data['image_url'] = prodder.get_image_url(product=row.product, upc=row.upc) + + # unit_uom can vary by product + data['unit_uom'] = 'LB' if row.product and row.product.weighed else 'EA' + + data['case_quantity'] = row.case_quantity + data['order_quantities_known'] = batch.order_quantities_known + + data['cases_ordered'] = row.cases_ordered + data['units_ordered'] = row.units_ordered + + data['cases_shipped'] = row.cases_shipped + data['units_shipped'] = row.units_shipped + + data['cases_received'] = row.cases_received + data['units_received'] = row.units_received + + data['cases_damaged'] = row.cases_damaged + data['units_damaged'] = row.units_damaged + + data['cases_expired'] = row.cases_expired + data['units_expired'] = row.units_expired + + data['cases_missing'] = row.cases_missing + data['units_missing'] = row.units_missing + + cases, units = self.batch_handler.get_unconfirmed_counts(row) + data['cases_unconfirmed'] = cases + data['units_unconfirmed'] = units + + data['po_unit_cost'] = row.po_unit_cost + data['po_total'] = row.po_total + + data['invoice_number'] = row.invoice_number + data['invoice_unit_cost'] = row.invoice_unit_cost + data['invoice_total'] = row.invoice_total + data['invoice_total_calculated'] = row.invoice_total_calculated + + data['allow_cases'] = self.batch_handler.allow_cases() + + data['quick_receive'] = self.rattail_config.getbool( + 'rattail.batch', 'purchase.mobile_quick_receive', + default=True) + + if batch.order_quantities_known: + data['quick_receive_all'] = self.rattail_config.getbool( + 'rattail.batch', 'purchase.mobile_quick_receive_all', + default=False) + + # TODO: this was copied from regular view receive_row() method; should merge + if data['quick_receive'] and data.get('quick_receive_all'): + if data['allow_cases']: + data['quick_receive_uom'] = 'CS' + raise NotImplementedError("TODO: add CS support for quick_receive_all") + else: + data['quick_receive_uom'] = data['unit_uom'] + accounted_for = self.batch_handler.get_units_accounted_for(row) + remainder = self.batch_handler.get_units_ordered(row) - accounted_for + + if accounted_for: + # some product accounted for; button should receive "remainder" only + if remainder: + remainder = self.app.render_quantity(remainder) + data['quick_receive_quantity'] = remainder + data['quick_receive_text'] = "Receive Remainder ({} {})".format( + remainder, data['unit_uom']) + else: + # unless there is no remainder, in which case disable it + data['quick_receive'] = False + + else: # nothing yet accounted for, button should receive "all" + if not remainder: + log.warning("quick receive remainder is empty for row %s", row.uuid) + remainder = self.app.render_quantity(remainder) + data['quick_receive_quantity'] = remainder + data['quick_receive_text'] = "Receive ALL ({} {})".format( + remainder, data['unit_uom']) + + data['unexpected_alert'] = None + if batch.order_quantities_known and not row.cases_ordered and not row.units_ordered: + warn = True + if batch.is_truck_dump_parent() and row.product: + uuids = [child.uuid for child in batch.truck_dump_children] + if uuids: + count = self.Session.query(model.PurchaseBatchRow)\ + .filter(model.PurchaseBatchRow.batch_uuid.in_(uuids))\ + .filter(model.PurchaseBatchRow.product == row.product)\ + .count() + if count: + warn = False + if warn: + data['unexpected_alert'] = "This item was NOT on the original purchase order." + + # TODO: surely the caller of API should determine this flag? + # maybe alert user if they've already received some of this product + alert_received = self.rattail_config.getbool('tailbone', 'receiving.alert_already_received', + default=False) + if alert_received: + data['received_alert'] = None + if self.batch_handler.get_units_confirmed(row): + msg = "You have already received some of this product; last update was {}.".format( + humanize.naturaltime(self.app.make_utc() - row.modified)) + data['received_alert'] = msg + + return data + + def receive(self): + """ + View which handles "receiving" against a particular batch row. + """ + model = self.app.model + + # first do basic input validation + schema = ReceiveRow().bind(session=self.Session()) + form = forms.Form(schema=schema, request=self.request) + # TODO: this seems hacky, but avoids "complex" date value parsing + form.set_widget('expiration_date', dfwidget.TextInputWidget()) + if not form.validate(): + log.warning("form did not validate: %s", + form.make_deform_form().error) + return {'error': "Form did not validate"} + + # fetch / validate row object + row = self.Session.get(model.PurchaseBatchRow, form.validated['row']) + if row is not self.get_object(): + return {'error': "Specified row does not match the route!"} + + # handler takes care of the row receiving logic for us + kwargs = dict(form.validated) + del kwargs['row'] + try: + self.batch_handler.receive_row(row, **kwargs) + self.Session.flush() + except Exception as error: + log.warning("receive() failed", exc_info=True) + if isinstance(error, sa.exc.DataError) and hasattr(error, 'orig'): + error = str(error.orig) + else: + error = str(error) + return {'error': error} + + return self._get(obj=row) + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._batch_row_defaults(config) + cls._receiving_batch_row_defaults(config) + + @classmethod + def _receiving_batch_row_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + object_url_prefix = cls.get_object_url_prefix() + + # receive (row) + receive = Service(name='{}.receive'.format(route_prefix), + path='{}/{{uuid}}/receive'.format(object_url_prefix)) + receive.add_view('POST', 'receive', klass=cls, + permission='{}.edit_row'.format(permission_prefix)) + config.add_cornice_service(receive) + + +def defaults(config, **kwargs): + base = globals() + + ReceivingBatchViews = kwargs.get('ReceivingBatchViews', base['ReceivingBatchViews']) + ReceivingBatchViews.defaults(config) + + ReceivingBatchRowViews = kwargs.get('ReceivingBatchRowViews', base['ReceivingBatchRowViews']) + ReceivingBatchRowViews.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/common.py b/tailbone/api/common.py new file mode 100644 index 00000000..6cacfb06 --- /dev/null +++ b/tailbone/api/common.py @@ -0,0 +1,159 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - "Common" Views +""" + +from collections import OrderedDict + +from rattail.util import get_pkg_version + +from cornice import Service +from cornice.service import get_services +from cornice_swagger import CorniceSwagger + +from tailbone import forms +from tailbone.forms.common import Feedback +from tailbone.api import APIView, api +from tailbone.db import Session + + +class CommonView(APIView): + """ + Misc. "common" views for the API. + + .. attribute:: feedback_email_key + + This is the email key which will be used when sending "user feedback" + email. Default value is ``'user_feedback'``. + """ + feedback_email_key = 'user_feedback' + + @api + def about(self): + """ + Generic view to show "about project" info page. + """ + packages = self.get_packages() + return { + 'project_title': self.get_project_title(), + 'project_version': self.get_project_version(), + 'packages': packages, + 'package_names': list(packages), + } + + def get_project_title(self): + app = self.get_rattail_app() + return app.get_title() + + def get_project_version(self): + app = self.get_rattail_app() + return app.get_version() + + def get_packages(self): + """ + Should return the full set of packages which should be displayed on the + 'about' page. + """ + return OrderedDict([ + ('rattail', get_pkg_version('rattail')), + ('Tailbone', get_pkg_version('Tailbone')), + ]) + + @api + def feedback(self): + """ + View to handle user feedback form submits. + """ + app = self.get_rattail_app() + model = self.model + # TODO: this logic was copied from tailbone.views.common and is largely + # identical; perhaps should merge somehow? + schema = Feedback().bind(session=Session()) + form = forms.Form(schema=schema, request=self.request) + if form.validate(): + data = dict(form.validated) + + # figure out who the sending user is, if any + if self.request.user: + data['user'] = self.request.user + elif data['user']: + data['user'] = Session.get(model.User, data['user']) + + # TODO: should provide URL to view user + if data['user']: + data['user_url'] = '#' # TODO: could get from config? + + data['client_ip'] = self.request.client_addr + email_key = data['email_key'] or self.feedback_email_key + app.send_email(email_key, data=data) + return {'ok': True} + + return {'error': "Form did not validate!"} + + def swagger(self): + doc = CorniceSwagger(get_services()) + app = self.get_rattail_app() + spec = doc.generate(f"{app.get_node_title()} API docs", + app.get_version(), + base_path='/api') # TODO + return spec + + @classmethod + def defaults(cls, config): + cls._common_defaults(config) + + @classmethod + def _common_defaults(cls, config): + rattail_config = config.registry.settings.get('rattail_config') + app = rattail_config.get_app() + + # about + about = Service(name='about', path='/about') + about.add_view('GET', 'about', klass=cls) + config.add_cornice_service(about) + + # feedback + feedback = Service(name='feedback', path='/feedback') + feedback.add_view('POST', 'feedback', klass=cls, + permission='common.feedback') + config.add_cornice_service(feedback) + + # swagger + swagger = Service(name='swagger', + path='/swagger.json', + description=f"OpenAPI documentation for {app.get_title()}") + swagger.add_view('GET', 'swagger', klass=cls, + permission='common.api_swagger') + config.add_cornice_service(swagger) + + +def defaults(config, **kwargs): + base = globals() + + CommonView = kwargs.get('CommonView', base['CommonView']) + CommonView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/core.py b/tailbone/api/core.py index c8855161..0d8eec32 100644 --- a/tailbone/api/core.py +++ b/tailbone/api/core.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,8 +24,6 @@ Tailbone Web API - Core Views """ -from __future__ import unicode_literals, absolute_import - from tailbone.views import View @@ -63,3 +61,65 @@ class APIView(View): """ Base class for all API views. """ + + def pretty_datetime(self, dt): + if not dt: + return "" + return dt.strftime('%Y-%m-%d @ %I:%M %p') + + def get_user_info(self, user): + """ + This method is present on *all* API views, and is meant to provide a + single means of obtaining "common" user info, for return to the caller. + Such info may be returned in several places, e.g. upon login but also + in the "check session" call, or e.g. as part of a broader return value + from any other call. + + :returns: Dictionary of user info data, ready for JSON serialization. + + Note that you should *not* (usually) override this method in any view, + but instead configure a "supplemental" function which can then add or + replace info entries. Config for that looks like e.g.: + + .. code-block:: ini + + [tailbone.api] + extra_user_info = poser.web.api.util:extra_user_info + + Note that the above config assumes a simple *function* defined in your + ``util`` module; such a function would look like e.g.:: + + def extra_user_info(request, user, **info): + # add favorite color + info['favorite_color'] = 'green' + # override display name + info['display_name'] = "TODO" + # remove short_name + info.pop('short_name', None) + return info + """ + app = self.get_rattail_app() + auth = app.get_auth_handler() + + # basic / default info + is_admin = auth.user_is_admin(user) + employee = app.get_employee(user) + info = { + 'uuid': user.uuid, + 'username': user.username, + 'display_name': user.display_name, + 'short_name': auth.get_short_display_name(user), + 'is_admin': is_admin, + 'is_root': is_admin and self.request.session.get('is_root', False), + 'employee_uuid': employee.uuid if employee else None, + 'email_address': app.get_contact_email_address(user), + } + + # maybe get/use "extra" info + extra = self.rattail_config.get('tailbone.api', 'extra_user_info', + usedb=False) + if extra: + extra = app.load_object(extra) + info = extra(self.request, user, **info) + + return info diff --git a/tailbone/api/customers.py b/tailbone/api/customers.py index da15c2e5..85d28c24 100644 --- a/tailbone/api/customers.py +++ b/tailbone/api/customers.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,34 +24,37 @@ Tailbone Web API - Customer Views """ -from __future__ import unicode_literals, absolute_import - from rattail.db import model -from cornice.resource import resource, view - from tailbone.api import APIMasterView -@resource(collection_path='/customers', path='/customer/{uuid}') class CustomerView(APIMasterView): - + """ + API views for Customer data + """ model_class = model.Customer + collection_url_prefix = '/customers' + object_url_prefix = '/customer' + supports_autocomplete = True + autocomplete_fieldname = 'name' def normalize(self, customer): return { + 'uuid': customer.uuid, + '_str': str(customer), 'id': customer.id, + 'number': customer.number, 'name': customer.name, } - @view(permission='customers.list') - def collection_get(self): - return self._collection_get() - @view(permission='customers.view') - def get(self): - return self._get() +def defaults(config, **kwargs): + base = globals() + + CustomerView = kwargs.get('CustomerView', base['CustomerView']) + CustomerView.defaults(config) def includeme(config): - config.scan(__name__) + defaults(config) diff --git a/tailbone/api/essentials.py b/tailbone/api/essentials.py new file mode 100644 index 00000000..7b151578 --- /dev/null +++ b/tailbone/api/essentials.py @@ -0,0 +1,36 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2023 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Essential views for convenient includes +""" + + +def defaults(config, **kwargs): + mod = lambda spec: kwargs.get(spec, spec) + + config.include(mod('tailbone.api.auth')) + config.include(mod('tailbone.api.common')) + + +def includeme(config): + defaults(config) diff --git a/tailbone/scaffolds.py b/tailbone/api/labels.py similarity index 57% rename from tailbone/scaffolds.py rename to tailbone/api/labels.py index 10bf9640..8bc11f8f 100644 --- a/tailbone/scaffolds.py +++ b/tailbone/api/labels.py @@ -1,8 +1,8 @@ -# -*- coding: utf-8 -*- +# -*- coding: utf-8; -*- ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -21,25 +21,31 @@ # ################################################################################ """ -Pyramid scaffold templates +Tailbone Web API - Label Views """ from __future__ import unicode_literals, absolute_import -from rattail.files import resource_path -from rattail.util import prettify +from rattail.db.model import LabelProfile -from pyramid.scaffolds import PyramidTemplate +from tailbone.api import APIMasterView -class RattailTemplate(PyramidTemplate): - _template_dir = resource_path('rattail:data/project') - summary = "Starter project based on Rattail / Tailbone" +class LabelProfileView(APIMasterView): + """ + API views for Label Profile data + """ + model_class = LabelProfile + collection_url_prefix = '/label-profiles' + object_url_prefix = '/label-profile' - def pre(self, command, output_dir, vars): - """ - Adds some more variables to the template context. - """ - vars['project_title'] = prettify(vars['project']) - vars['package_title'] = vars['package'].capitalize() - return super(RattailTemplate, self).pre(command, output_dir, vars) + +def defaults(config, **kwargs): + base = globals() + + LabelProfileView = kwargs.get('LabelProfileView', base['LabelProfileView']) + LabelProfileView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/master.py b/tailbone/api/master.py index 209fb146..551d6428 100644 --- a/tailbone/api/master.py +++ b/tailbone/api/master.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,25 +24,29 @@ Tailbone Web API - Master View """ -from __future__ import unicode_literals, absolute_import +import json -from rattail.config import parse_bool +from rattail.db.util import get_fieldnames -from tailbone.api import APIView, api +from cornice import resource, Service + +from tailbone.api import APIView from tailbone.db import Session - - -class SortColumn(object): - - def __init__(self, field_name, model_name=None): - self.field_name = field_name - self.model_name = model_name +from tailbone.util import SortColumn class APIMasterView(APIView): """ Base class for data model REST API views. """ + listable = True + creatable = True + viewable = True + editable = True + deletable = True + supports_autocomplete = False + supports_download = False + supports_rawbytes = False @property def Session(self): @@ -60,6 +64,51 @@ class APIMasterView(APIView): return cls.normalized_model_name return cls.get_model_class().__name__.lower() + @classmethod + def get_route_prefix(cls): + """ + Returns a prefix which (by default) applies to all routes provided by + this view class. + """ + prefix = getattr(cls, 'route_prefix', None) + if prefix: + return prefix + model_name = cls.get_normalized_model_name() + return '{}s'.format(model_name) + + @classmethod + def get_permission_prefix(cls): + """ + Returns a prefix which (by default) applies to all permissions + leveraged by this view class. + """ + prefix = getattr(cls, 'permission_prefix', None) + if prefix: + return prefix + return cls.get_route_prefix() + + @classmethod + def get_collection_url_prefix(cls): + """ + Returns a prefix which (by default) applies to all "collection" URLs + provided by this view class. + """ + prefix = getattr(cls, 'collection_url_prefix', None) + if prefix: + return prefix + return '/{}'.format(cls.get_route_prefix()) + + @classmethod + def get_object_url_prefix(cls): + """ + Returns a prefix which (by default) applies to all "object" URLs + provided by this view class. + """ + prefix = getattr(cls, 'object_url_prefix', None) + if prefix: + return prefix + return '/{}'.format(cls.get_route_prefix()) + @classmethod def get_object_key(cls): if hasattr(cls, 'object_key'): @@ -72,8 +121,47 @@ class APIMasterView(APIView): return cls.collection_key return '{}s'.format(cls.get_object_key()) + @classmethod + def establish_method(cls, method_name): + """ + Establish the given HTTP method for this Cornice Resource. + + Cornice will auto-register any class methods for a resource, if they + are named according to what it expects (i.e. 'get', 'collection_get' + etc.). Tailbone API tries to make things automagical for the sake of + e.g. Poser logic, but in this case if we predefine all of these methods + and then some subclass view wants to *not* allow one, it's not clear + how to "undefine" it per se. Or at least, the more straightforward + thing (I think) is to not define such a method in the first place, if + it was not wanted. + + Enter ``establish_method()``, which is what finally "defines" each + resource method according to what the subclass has declared via its + various attributes (:attr:`creatable`, :attr:`deletable` etc.). + + Note that you will not likely have any need to use this + ``establish_method()`` yourself! But we describe its purpose here, for + clarity. + """ + def method(self): + internal_method = getattr(self, '_{}'.format(method_name)) + return internal_method() + + setattr(cls, method_name, method) + + def make_filter_spec(self): + if not self.request.GET.has_key('filters'): + return [] + + filters = json.loads(self.request.GET.getone('filters')) + return filters + def make_sort_spec(self): + # we prefer a "native sort" + if self.request.GET.has_key('nativeSort'): + return json.loads(self.request.GET.getone('nativeSort')) + # these params are based on 'vuetable-2' # https://www.vuetable.com/guide/sorting.html#initial-sorting-order if 'sort' in self.request.params: @@ -96,7 +184,7 @@ class APIMasterView(APIView): if sortcol: spec = { 'field': sortcol.field_name, - 'direction': 'asc' if parse_bool(self.request.params['ascending']) else 'desc', + 'direction': 'asc' if self.config.parse_bool(self.request.params['ascending']) else 'desc', } if sortcol.model_name: spec['model'] = sortcol.model_name @@ -118,17 +206,14 @@ class APIMasterView(APIView): """ return self.sortcol(order_by) - def sortcol(self, *args): + def sortcol(self, field_name, model_name=None): """ Return a simple ``SortColumn`` object which denotes the field and optionally, the model, to be used when sorting. """ - if len(args) == 1: - return SortColumn(args[0]) - elif len(args) == 2: - return SortColumn(args[1], args[0]) - else: - raise ValueError("must pass 1 arg (field_name) or 2 args (model_name, field_name)") + if not model_name: + model_name = self.model_class.__name__ + return SortColumn(field_name, model_name) def join_for_sort_spec(self, query, sort_spec): """ @@ -170,13 +255,37 @@ class APIMasterView(APIView): if page.isdigit() and limit.isdigit(): return int(page), int(limit) - def _collection_get(self): - from sqlalchemy_filters import apply_sort, apply_pagination - + def base_query(self): cls = self.get_model_class() query = self.Session.query(cls) + return query + + def get_fieldnames(self): + if not hasattr(self, '_fieldnames'): + self._fieldnames = get_fieldnames( + self.rattail_config, self.model_class, + columns=True, proxies=True, relations=False) + return self._fieldnames + + def normalize(self, obj): + data = {'_str': str(obj)} + + for field in self.get_fieldnames(): + data[field] = getattr(obj, field) + + return data + + def _collection_get(self): + from sa_filters import apply_filters, apply_sort, apply_pagination + + query = self.base_query() context = {} + # maybe filter query + filter_spec = self.make_filter_spec() + if filter_spec: + query = apply_filters(query, filter_spec) + # maybe sort query sort_spec = self.make_sort_spec() if sort_spec: @@ -219,9 +328,291 @@ class APIMasterView(APIView): return context - def _get(self): - uuid = self.request.matchdict['uuid'] - obj = self.Session.query(self.get_model_class()).get(uuid) + def get_object(self, uuid=None): + if not uuid: + uuid = self.request.matchdict['uuid'] + + obj = self.Session.get(self.get_model_class(), uuid) + if obj: + return obj + + raise self.notfound() + + def _get(self, obj=None, uuid=None): + if not obj: + obj = self.get_object(uuid=uuid) + key = self.get_object_key() + normal = self.normalize(obj) + return {key: normal, 'data': normal} + + def _collection_post(self): + """ + Default method for actually processing a POST request for the + collection, aka. "create new object". + """ + # assume our data comes only from request JSON body + data = self.request.json_body + + # add instance to session, and return data for it + try: + obj = self.create_object(data) + except Exception as error: + return self.json_response({'error': str(error)}) + else: + self.Session.flush() + return self._get(obj) + + def create_object(self, data): + """ + Create a new object instance and populate it with the given data. + + Note that this method by default will only populate *simple* fields, so + you may need to subclass and override to add more complex field logic. + """ + # create new instance of model class + cls = self.get_model_class() + obj = cls() + + # "update" new object with given data + obj = self.update_object(obj, data) + + # that's all we can do here, subclass must override if more needed + self.Session.add(obj) + return obj + + def _post(self, uuid=None): + """ + Default method for actually processing a POST request for an object, + aka. "update existing object". + """ + if not uuid: + uuid = self.request.matchdict['uuid'] + obj = self.Session.get(self.get_model_class(), uuid) if not obj: raise self.notfound() - return {self.get_object_key(): self.normalize(obj)} + + # assume our data comes only from request JSON body + data = self.request.json_body + + # try to update data for object, returning error as necessary + obj = self.update_object(obj, data) + if isinstance(obj, dict) and 'error' in obj: + return {'error': obj['error']} + + # return data for object + self.Session.flush() + return self._get(obj) + + def update_object(self, obj, data): + """ + Update the given object instance with the given data. + + Note that this method by default will only update *simple* fields, so + you may need to subclass and override to add more complex field logic. + """ + # set values for simple fields only + for key, value in data.items(): + if hasattr(obj, key): + # TODO: what about datetime, decimal etc.? + setattr(obj, key, value) + + # that's all we can do here, subclass must override if more needed + return obj + + ############################## + # delete + ############################## + + def _delete(self): + """ + View to handle DELETE action for an existing record/object. + """ + obj = self.get_object() + self.delete_object(obj) + + def delete_object(self, obj): + """ + Delete the object, or mark it as deleted, or whatever you need to do. + """ + # flush immediately to force any pending integrity errors etc. + self.Session.delete(obj) + self.Session.flush() + + ############################## + # download + ############################## + + def download(self): + """ + GET view allowing for download of a single file, which is attached to a + given record. + """ + obj = self.get_object() + + filename = self.request.GET.get('filename', None) + if not filename: + raise self.notfound() + path = self.download_path(obj, filename) + + response = self.file_response(path) + return response + + def download_path(self, obj, filename): + """ + Should return absolute path on disk, for the given object and filename. + Result will be used to return a file response to client. + """ + raise NotImplementedError + + def rawbytes(self): + """ + GET view allowing for direct access to the raw bytes of a file, which + is attached to a given record. Basically the same as 'download' except + this does not come as an attachment. + """ + obj = self.get_object() + + # TODO: is this really needed? + # filename = self.request.GET.get('filename', None) + # if filename: + # path = self.download_path(obj, filename) + # return self.file_response(path, attachment=False) + + return self.rawbytes_response(obj) + + def rawbytes_response(self, obj): + raise NotImplementedError + + ############################## + # autocomplete + ############################## + + def autocomplete(self): + """ + View which accepts a single ``term`` param, and returns a list of + autocomplete results to match. + """ + term = self.request.params.get('term', '').strip() + term = self.prepare_autocomplete_term(term) + if not term: + return [] + + results = self.get_autocomplete_data(term) + return [{'label': self.autocomplete_display(x), + 'value': self.autocomplete_value(x)} + for x in results] + + @property + def autocomplete_fieldname(self): + raise NotImplementedError("You must define `autocomplete_fieldname` " + "attribute for API view class: {}".format( + self.__class__)) + + def autocomplete_display(self, obj): + return getattr(obj, self.autocomplete_fieldname) + + def autocomplete_value(self, obj): + return obj.uuid + + def get_autocomplete_data(self, term): + query = self.make_autocomplete_query(term) + return query.all() + + def make_autocomplete_query(self, term): + model_class = self.get_model_class() + query = self.Session.query(model_class) + query = self.filter_autocomplete_query(query) + + field = getattr(model_class, self.autocomplete_fieldname) + query = query.filter(field.ilike('%%%s%%' % term))\ + .order_by(field) + + return query + + def filter_autocomplete_query(self, query): + return query + + def prepare_autocomplete_term(self, term): + """ + If necessary, massage the incoming search term for use with the + autocomplete query. + """ + return term + + @classmethod + def defaults(cls, config): + cls._defaults(config) + + @classmethod + def _defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + object_url_prefix = cls.get_object_url_prefix() + + # first, the primary resource API + + # list/search + if cls.listable: + cls.establish_method('collection_get') + resource.add_view(cls.collection_get, permission='{}.list'.format(permission_prefix)) + + # create + if cls.creatable: + cls.establish_method('collection_post') + if hasattr(cls, 'permission_to_create'): + permission = cls.permission_to_create + else: + permission = '{}.create'.format(permission_prefix) + resource.add_view(cls.collection_post, permission=permission) + + # view + if cls.viewable: + cls.establish_method('get') + resource.add_view(cls.get, permission='{}.view'.format(permission_prefix)) + + # edit + if cls.editable: + cls.establish_method('post') + resource.add_view(cls.post, permission='{}.edit'.format(permission_prefix)) + + # delete + if cls.deletable: + cls.establish_method('delete') + resource.add_view(cls.delete, permission='{}.delete'.format(permission_prefix)) + + # register primary resource API via cornice + object_resource = resource.add_resource( + cls, + collection_path=collection_url_prefix, + # TODO: probably should allow for other (composite?) key fields + path='{}/{{uuid}}'.format(object_url_prefix)) + config.add_cornice_resource(object_resource) + + # now for some more "custom" things, which are still somewhat generic + + # autocomplete + if cls.supports_autocomplete: + autocomplete = Service(name='{}.autocomplete'.format(route_prefix), + path='{}/autocomplete'.format(collection_url_prefix)) + autocomplete.add_view('GET', 'autocomplete', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(autocomplete) + + # download + if cls.supports_download: + download = Service(name='{}.download'.format(route_prefix), + # TODO: probably should allow for other (composite?) key fields + path='{}/{{uuid}}/download'.format(object_url_prefix)) + download.add_view('GET', 'download', klass=cls, + permission='{}.download'.format(permission_prefix)) + config.add_cornice_service(download) + + # rawbytes + if cls.supports_rawbytes: + rawbytes = Service(name='{}.rawbytes'.format(route_prefix), + # TODO: probably should allow for other (composite?) key fields + path='{}/{{uuid}}/rawbytes'.format(object_url_prefix)) + rawbytes.add_view('GET', 'rawbytes', klass=cls, + permission='{}.download'.format(permission_prefix)) + config.add_cornice_service(rawbytes) diff --git a/tailbone/api/master2.py b/tailbone/api/master2.py new file mode 100644 index 00000000..4a5abb3e --- /dev/null +++ b/tailbone/api/master2.py @@ -0,0 +1,43 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2022 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Master View (v2) +""" + +from __future__ import unicode_literals, absolute_import + +import warnings + +from tailbone.api import APIMasterView + + +class APIMasterView2(APIMasterView): + """ + Base class for data model REST API views. + """ + + def __init__(self, request, context=None): + warnings.warn("APIMasterView2 class is deprecated; please use " + "APIMasterView instead", + DeprecationWarning, stacklevel=2) + super(APIMasterView2, self).__init__(request, context=context) diff --git a/tailbone/api/people.py b/tailbone/api/people.py new file mode 100644 index 00000000..f7c08dfa --- /dev/null +++ b/tailbone/api/people.py @@ -0,0 +1,59 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Person Views +""" + +from rattail.db import model + +from tailbone.api import APIMasterView + + +class PersonView(APIMasterView): + """ + API views for Person data + """ + model_class = model.Person + permission_prefix = 'people' + collection_url_prefix = '/people' + object_url_prefix = '/person' + + def normalize(self, person): + return { + 'uuid': person.uuid, + '_str': str(person), + 'first_name': person.first_name, + 'last_name': person.last_name, + 'display_name': person.display_name, + } + + +def defaults(config, **kwargs): + base = globals() + + PersonView = kwargs.get('PersonView', base['PersonView']) + PersonView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/products.py b/tailbone/api/products.py new file mode 100644 index 00000000..3f29ff54 --- /dev/null +++ b/tailbone/api/products.py @@ -0,0 +1,220 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2023 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Product Views +""" + +import logging + +import sqlalchemy as sa +from sqlalchemy import orm + +from cornice import Service + +from rattail.db import model + +from tailbone.api import APIMasterView + + +log = logging.getLogger(__name__) + + +class ProductView(APIMasterView): + """ + API views for Product data + """ + model_class = model.Product + collection_url_prefix = '/products' + object_url_prefix = '/product' + supports_autocomplete = True + + def __init__(self, request, context=None): + super(ProductView, self).__init__(request, context=context) + app = self.get_rattail_app() + self.products_handler = app.get_products_handler() + + def normalize(self, product): + + # get what we can from handler + data = self.products_handler.normalize_product(product, fields=[ + 'brand_name', + 'full_description', + 'department_name', + 'unit_price_display', + 'sale_price', + 'sale_price_display', + 'sale_ends', + 'sale_ends_display', + 'tpr_price', + 'tpr_price_display', + 'tpr_ends', + 'tpr_ends_display', + 'current_price', + 'current_price_display', + 'current_ends', + 'current_ends_display', + 'vendor_name', + 'costs', + 'image_url', + ]) + + # but must supplement + cost = product.cost + data.update({ + 'upc': str(product.upc), + 'scancode': product.scancode, + 'item_id': product.item_id, + 'item_type': product.item_type, + 'status_code': product.status_code, + 'default_unit_cost': cost.unit_cost if cost else None, + 'default_unit_cost_display': "${:0.2f}".format(cost.unit_cost) if cost and cost.unit_cost is not None else None, + }) + + return data + + def make_autocomplete_query(self, term): + query = self.Session.query(model.Product)\ + .outerjoin(model.Brand)\ + .filter(sa.or_( + model.Brand.name.ilike('%{}%'.format(term)), + model.Product.description.ilike('%{}%'.format(term)))) + + if not self.request.has_perm('products.view_deleted'): + query = query.filter(model.Product.deleted == False) + + query = query.order_by(model.Brand.name, + model.Product.description)\ + .options(orm.joinedload(model.Product.brand)) + return query + + def autocomplete_display(self, product): + return product.full_description + + def quick_lookup(self): + """ + View for handling "quick lookup" user input, for index page. + """ + data = self.request.GET + entry = data['entry'] + + product = self.products_handler.locate_product_for_entry(self.Session(), + entry) + if not product: + return {'error': "Product not found"} + + return {'ok': True, + 'product': self.normalize(product)} + + def label_profiles(self): + """ + Returns the set of label profiles available for use with + printing label for product. + """ + app = self.get_rattail_app() + label_handler = app.get_label_handler() + model = self.model + + profiles = [] + for profile in label_handler.get_label_profiles(self.Session()): + profiles.append({ + 'uuid': profile.uuid, + 'description': profile.description, + }) + + return {'label_profiles': profiles} + + def print_labels(self): + app = self.get_rattail_app() + label_handler = app.get_label_handler() + model = self.model + data = self.request.json_body + + uuid = data.get('label_profile_uuid') + profile = self.Session.get(model.LabelProfile, uuid) if uuid else None + if not profile: + return {'error': "Label profile not found"} + + uuid = data.get('product_uuid') + product = self.Session.get(model.Product, uuid) if uuid else None + if not product: + return {'error': "Product not found"} + + try: + quantity = int(data.get('quantity')) + except: + return {'error': "Quantity must be integer"} + + printer = label_handler.get_printer(profile) + if not printer: + return {'error': "Couldn't get printer from label profile"} + + try: + printer.print_labels([({'product': product}, quantity)]) + except Exception as error: + log.warning("error occurred while printing labels", exc_info=True) + return {'error': str(error)} + + return {'ok': True} + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._product_defaults(config) + + @classmethod + def _product_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + + # quick lookup + quick_lookup = Service(name='{}.quick_lookup'.format(route_prefix), + path='{}/quick-lookup'.format(collection_url_prefix)) + quick_lookup.add_view('GET', 'quick_lookup', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(quick_lookup) + + # label profiles + label_profiles = Service(name=f'{route_prefix}.label_profiles', + path=f'{collection_url_prefix}/label-profiles') + label_profiles.add_view('GET', 'label_profiles', klass=cls, + permission=f'{permission_prefix}.print_labels') + config.add_cornice_service(label_profiles) + + # print labels + print_labels = Service(name='{}.print_labels'.format(route_prefix), + path='{}/print-labels'.format(collection_url_prefix)) + print_labels.add_view('POST', 'print_labels', klass=cls, + permission='{}.print_labels'.format(permission_prefix)) + config.add_cornice_service(print_labels) + + +def defaults(config, **kwargs): + base = globals() + + ProductView = kwargs.get('ProductView', base['ProductView']) + ProductView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/upgrades.py b/tailbone/api/upgrades.py index 620ed4f8..467c8a0d 100644 --- a/tailbone/api/upgrades.py +++ b/tailbone/api/upgrades.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,23 +24,18 @@ Tailbone Web API - Upgrade Views """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model -from cornice.resource import resource, view - from tailbone.api import APIMasterView -@resource(collection_path='/upgrades', path='/upgrades/{uuid}') -class UpgradeAPIView(APIMasterView): +class UpgradeView(APIMasterView): """ REST API views for Upgrade model. """ model_class = model.Upgrade + collection_url_prefix = '/upgrades' + object_url_prefix = '/upgrades' def normalize(self, upgrade): data = { @@ -54,17 +49,16 @@ class UpgradeAPIView(APIMasterView): data['status_code'] = None else: data['status_code'] = self.enum.UPGRADE_STATUS.get(upgrade.status_code, - six.text_type(upgrade.status_code)) + str(upgrade.status_code)) return data - @view(permission='upgrades.list') - def collection_get(self): - return self._collection_get() - @view(permission='upgrades.view') - def get(self): - return self._get() +def defaults(config, **kwargs): + base = globals() + + UpgradeView = kwargs.get('UpgradeView', base['UpgradeView']) + UpgradeView.defaults(config) def includeme(config): - config.scan(__name__) + defaults(config) diff --git a/tailbone/api/users.py b/tailbone/api/users.py index a21d3a2c..a6bcad57 100644 --- a/tailbone/api/users.py +++ b/tailbone/api/users.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,21 +24,18 @@ Tailbone Web API - User Views """ -from __future__ import unicode_literals, absolute_import - -import six - from rattail.db import model -from cornice.resource import resource, view - from tailbone.api import APIMasterView -@resource(collection_path='/users', path='/users/{uuid}') class UserView(APIMasterView): - + """ + API views for User data + """ model_class = model.User + collection_url_prefix = '/users' + object_url_prefix = '/user' def normalize(self, user): return { @@ -58,14 +55,17 @@ class UserView(APIMasterView): query = query.outerjoin(model.Person) return query - @view(permission='users.list') - def collection_get(self): - return self._collection_get() + def update_object(self, user, data): + # TODO: should ensure prevent_password_change is respected + return super(UserView, self).update_object(user, data) - @view(permission='users.view') - def get(self): - return self._get() + +def defaults(config, **kwargs): + base = globals() + + UserView = kwargs.get('UserView', base['UserView']) + UserView.defaults(config) def includeme(config): - config.scan(__name__) + defaults(config) diff --git a/tailbone/api/vendors.py b/tailbone/api/vendors.py new file mode 100644 index 00000000..64311b1b --- /dev/null +++ b/tailbone/api/vendors.py @@ -0,0 +1,57 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Vendor Views +""" + +from rattail.db import model + +from tailbone.api import APIMasterView + + +class VendorView(APIMasterView): + + model_class = model.Vendor + collection_url_prefix = '/vendors' + object_url_prefix = '/vendor' + supports_autocomplete = True + autocomplete_fieldname = 'name' + + def normalize(self, vendor): + return { + 'uuid': vendor.uuid, + '_str': str(vendor), + 'id': vendor.id, + 'name': vendor.name, + } + + +def defaults(config, **kwargs): + base = globals() + + VendorView = kwargs.get('VendorView', base['VendorView']) + VendorView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/api/workorders.py b/tailbone/api/workorders.py new file mode 100644 index 00000000..19def6c4 --- /dev/null +++ b/tailbone/api/workorders.py @@ -0,0 +1,234 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Web API - Work Order Views +""" + +import datetime + +from rattail.db.model import WorkOrder + +from cornice import Service + +from tailbone.api import APIMasterView + + +class WorkOrderView(APIMasterView): + + model_class = WorkOrder + collection_url_prefix = '/workorders' + object_url_prefix = '/workorder' + + def __init__(self, *args, **kwargs): + super().__init__(*args, **kwargs) + app = self.get_rattail_app() + self.workorder_handler = app.get_workorder_handler() + + def normalize(self, workorder): + data = super().normalize(workorder) + data.update({ + 'customer_name': workorder.customer.name, + 'status_label': self.enum.WORKORDER_STATUS[workorder.status_code], + 'date_submitted': str(workorder.date_submitted or ''), + 'date_received': str(workorder.date_received or ''), + 'date_released': str(workorder.date_released or ''), + 'date_delivered': str(workorder.date_delivered or ''), + }) + return data + + def create_object(self, data): + + # invoke the handler instead of normal API CRUD logic + workorder = self.workorder_handler.make_workorder(self.Session(), **data) + return workorder + + def update_object(self, workorder, data): + date_fields = [ + 'date_submitted', + 'date_received', + 'date_released', + 'date_delivered', + ] + + # coerce date field values to proper datetime.date objects + for field in date_fields: + if field in data: + if data[field] == '': + data[field] = None + elif not isinstance(data[field], datetime.date): + date = datetime.datetime.strptime(data[field], '%Y-%m-%d').date() + data[field] = date + + # coerce status code value to proper integer + if 'status_code' in data: + data['status_code'] = int(data['status_code']) + + return super().update_object(workorder, data) + + def status_codes(self): + """ + Retrieve all info about possible work order status codes. + """ + return self.workorder_handler.status_codes() + + def receive(self): + """ + Sets work order status to "received". + """ + workorder = self.get_object() + self.workorder_handler.receive(workorder) + self.Session.flush() + return self.normalize(workorder) + + def await_estimate(self): + """ + Sets work order status to "awaiting estimate confirmation". + """ + workorder = self.get_object() + self.workorder_handler.await_estimate(workorder) + self.Session.flush() + return self.normalize(workorder) + + def await_parts(self): + """ + Sets work order status to "awaiting parts". + """ + workorder = self.get_object() + self.workorder_handler.await_parts(workorder) + self.Session.flush() + return self.normalize(workorder) + + def work_on_it(self): + """ + Sets work order status to "working on it". + """ + workorder = self.get_object() + self.workorder_handler.work_on_it(workorder) + self.Session.flush() + return self.normalize(workorder) + + def release(self): + """ + Sets work order status to "released". + """ + workorder = self.get_object() + self.workorder_handler.release(workorder) + self.Session.flush() + return self.normalize(workorder) + + def deliver(self): + """ + Sets work order status to "delivered". + """ + workorder = self.get_object() + self.workorder_handler.deliver(workorder) + self.Session.flush() + return self.normalize(workorder) + + def cancel(self): + """ + Sets work order status to "canceled". + """ + workorder = self.get_object() + self.workorder_handler.cancel(workorder) + self.Session.flush() + return self.normalize(workorder) + + @classmethod + def defaults(cls, config): + cls._defaults(config) + cls._workorder_defaults(config) + + @classmethod + def _workorder_defaults(cls, config): + route_prefix = cls.get_route_prefix() + permission_prefix = cls.get_permission_prefix() + collection_url_prefix = cls.get_collection_url_prefix() + object_url_prefix = cls.get_object_url_prefix() + + # status codes + status_codes = Service(name='{}.status_codes'.format(route_prefix), + path='{}/status-codes'.format(collection_url_prefix)) + status_codes.add_view('GET', 'status_codes', klass=cls, + permission='{}.list'.format(permission_prefix)) + config.add_cornice_service(status_codes) + + # receive + receive = Service(name='{}.receive'.format(route_prefix), + path='{}/{{uuid}}/receive'.format(object_url_prefix)) + receive.add_view('POST', 'receive', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(receive) + + # await estimate confirmation + await_estimate = Service(name='{}.await_estimate'.format(route_prefix), + path='{}/{{uuid}}/await-estimate'.format(object_url_prefix)) + await_estimate.add_view('POST', 'await_estimate', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(await_estimate) + + # await parts + await_parts = Service(name='{}.await_parts'.format(route_prefix), + path='{}/{{uuid}}/await-parts'.format(object_url_prefix)) + await_parts.add_view('POST', 'await_parts', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(await_parts) + + # work on it + work_on_it = Service(name='{}.work_on_it'.format(route_prefix), + path='{}/{{uuid}}/work-on-it'.format(object_url_prefix)) + work_on_it.add_view('POST', 'work_on_it', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(work_on_it) + + # release + release = Service(name='{}.release'.format(route_prefix), + path='{}/{{uuid}}/release'.format(object_url_prefix)) + release.add_view('POST', 'release', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(release) + + # deliver + deliver = Service(name='{}.deliver'.format(route_prefix), + path='{}/{{uuid}}/deliver'.format(object_url_prefix)) + deliver.add_view('POST', 'deliver', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(deliver) + + # cancel + cancel = Service(name='{}.cancel'.format(route_prefix), + path='{}/{{uuid}}/cancel'.format(object_url_prefix)) + cancel.add_view('POST', 'cancel', klass=cls, + permission='{}.edit'.format(permission_prefix)) + config.add_cornice_service(cancel) + + +def defaults(config, **kwargs): + base = globals() + + WorkOrderView = kwargs.get('WorkOrderView', base['WorkOrderView']) + WorkOrderView.defaults(config) + + +def includeme(config): + defaults(config) diff --git a/tailbone/app.py b/tailbone/app.py index e34c699f..d2d0c5ef 100644 --- a/tailbone/app.py +++ b/tailbone/app.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,24 +24,23 @@ Application Entry Point """ -from __future__ import unicode_literals, absolute_import - import os -import warnings -import sqlalchemy as sa +from sqlalchemy.orm import sessionmaker, scoped_session + +from wuttjamaican.util import parse_list from rattail.config import make_config from rattail.exceptions import ConfigurationError -from rattail.db.types import GPCType from pyramid.config import Configurator -from pyramid.authentication import SessionAuthenticationPolicy +from zope.sqlalchemy import register import tailbone.db -from tailbone.auth import TailboneAuthorizationPolicy - +from tailbone.auth import TailboneSecurityPolicy +from tailbone.config import csrf_token_name, csrf_header_name from tailbone.util import get_effective_theme, get_theme_template_path +from tailbone.providers import get_all_providers def make_rattail_config(settings): @@ -59,16 +58,40 @@ def make_rattail_config(settings): "to the path of your config file. Lame, but necessary.") rattail_config = make_config(path) settings['rattail_config'] = rattail_config - rattail_config.configure_logging() + + # nb. this is for compaibility with wuttaweb + settings['wutta_config'] = rattail_config + + # must import all sqlalchemy models before things get rolling, + # otherwise can have errors about continuum TransactionMeta class + # not yet mapped, when relevant pages are first requested... + # cf. https://docs.pylonsproject.org/projects/pyramid_cookbook/en/latest/database/sqlalchemy.html#importing-all-sqlalchemy-models + # hat tip to https://stackoverflow.com/a/59241485 + if getattr(rattail_config, 'tempmon_engine', None): + from rattail_tempmon.db import model as tempmon_model, Session as TempmonSession + tempmon_session = TempmonSession() + tempmon_session.query(tempmon_model.Appliance).first() + tempmon_session.close() # configure database sessions - if hasattr(rattail_config, 'rattail_engine'): - tailbone.db.Session.configure(bind=rattail_config.rattail_engine) + if hasattr(rattail_config, 'appdb_engine'): + tailbone.db.Session.configure(bind=rattail_config.appdb_engine) if hasattr(rattail_config, 'trainwreck_engine'): tailbone.db.TrainwreckSession.configure(bind=rattail_config.trainwreck_engine) if hasattr(rattail_config, 'tempmon_engine'): tailbone.db.TempmonSession.configure(bind=rattail_config.tempmon_engine) + # maybe set "future" behavior for SQLAlchemy + if rattail_config.getbool('rattail.db', 'sqlalchemy_future_mode', usedb=False): + tailbone.db.Session.configure(future=True) + + # create session wrappers for each "extra" Trainwreck engine + for key, engine in rattail_config.trainwreck_engines.items(): + if key != 'default': + Session = scoped_session(sessionmaker(bind=engine)) + register(Session) + tailbone.db.ExtraTrainwreckSessions[key] = Session + # Make sure rattail config object uses our scoped session, to avoid # unnecessary connections (and pooling limits). rattail_config._session_factory = lambda: (tailbone.db.Session(), False) @@ -105,31 +128,52 @@ def make_pyramid_config(settings, configure_csrf=True): """ Make a Pyramid config object from the given settings. """ + rattail_config = settings['rattail_config'] + config = settings.pop('pyramid_config', None) if config: config.set_root_factory(Root) else: + # declare this web app of the "classic" variety + settings.setdefault('tailbone.classic', 'true') + # we want the new themes feature! establish_theme(settings) + settings.setdefault('fanstatic.versioning', 'true') settings.setdefault('pyramid_deform.template_search_path', 'tailbone:templates/deform') config = Configurator(settings=settings, root_factory=Root) - # configure user authorization / authentication - config.set_authorization_policy(TailboneAuthorizationPolicy()) - config.set_authentication_policy(SessionAuthenticationPolicy()) + # add rattail config directly to registry, for access throughout the app + config.registry['rattail_config'] = rattail_config - # always require CSRF token protection + # configure user authorization / authentication + config.set_security_policy(TailboneSecurityPolicy()) + + # maybe require CSRF token protection if configure_csrf: - config.set_default_csrf_options(require_csrf=True, token='_csrf') + config.set_default_csrf_options(require_csrf=True, + token=csrf_token_name(rattail_config), + header=csrf_header_name(rattail_config)) # Bring in some Pyramid goodies. config.include('tailbone.beaker') config.include('pyramid_deform') + config.include('pyramid_fanstatic') config.include('pyramid_mako') config.include('pyramid_tm') + # TODO: this may be a good idea some day, if wanting to leverage + # deform resources for component JS? cf. also base.mako template + # # override default script mapping for deform + # from deform import Field + # from deform.widget import ResourceRegistry, default_resources + # registry = ResourceRegistry(use_defaults=False) + # for key in default_resources: + # registry.set_js_resources(key, None, {'js': []}) + # Field.set_default_resource_registry(registry) + # bring in the pyramid_retry logic, if available # TODO: pretty soon we can require this package, hopefully.. try: @@ -139,21 +183,140 @@ def make_pyramid_config(settings, configure_csrf=True): else: config.include('pyramid_retry') - # Add some permissions magic. - config.add_directive('add_tailbone_permission_group', 'tailbone.auth.add_permission_group') - config.add_directive('add_tailbone_permission', 'tailbone.auth.add_permission') + # fetch all tailbone providers + providers = get_all_providers(rattail_config) + for provider in providers.values(): + + # configure DB sessions associated with transaction manager + provider.configure_db_sessions(rattail_config, config) + + # add any static includes + includes = provider.get_static_includes() + if includes: + for spec in includes: + config.include(spec) + + # add some permissions magic + config.add_directive('add_wutta_permission_group', + 'wuttaweb.auth.add_permission_group') + config.add_directive('add_wutta_permission', + 'wuttaweb.auth.add_permission') + # TODO: deprecate / remove these + config.add_directive('add_tailbone_permission_group', + 'wuttaweb.auth.add_permission_group') + config.add_directive('add_tailbone_permission', + 'wuttaweb.auth.add_permission') + + # and some similar magic for certain master views + config.add_directive('add_tailbone_index_page', 'tailbone.app.add_index_page') + config.add_directive('add_tailbone_config_page', 'tailbone.app.add_config_page') + config.add_directive('add_tailbone_model_view', 'tailbone.app.add_model_view') + config.add_directive('add_tailbone_view_supplement', 'tailbone.app.add_view_supplement') + + config.add_directive('add_tailbone_websocket', 'tailbone.app.add_websocket') return config +def add_websocket(config, name, view, attr=None): + """ + Register a websocket entry point for the app. + """ + def action(): + rattail_config = config.registry.settings['rattail_config'] + rattail_app = rattail_config.get_app() + + if isinstance(view, str): + view_callable = rattail_app.load_object(view) + else: + view_callable = view + view_callable = view_callable(config) + if attr: + view_callable = getattr(view_callable, attr) + + # register route + path = '/ws/{}'.format(name) + route_name = 'ws.{}'.format(name) + config.add_route(route_name, path, static=True) + + # register view callable + websockets = config.registry.setdefault('tailbone_websockets', {}) + websockets[path] = view_callable + + config.action('tailbone-add-websocket-{}'.format(name), action, + # nb. since this action adds routes, it must happen + # sooner in the order than it normally would, hence + # we declare that + order=-20) + + +def add_index_page(config, route_name, label, permission): + """ + Register a config page for the app. + """ + def action(): + pages = config.get_settings().get('tailbone_index_pages', []) + pages.append({'label': label, 'route': route_name, + 'permission': permission}) + config.add_settings({'tailbone_index_pages': pages}) + config.action(None, action) + + +def add_config_page(config, route_name, label, permission): + """ + Register a config page for the app. + """ + def action(): + pages = config.get_settings().get('tailbone_config_pages', []) + pages.append({'label': label, 'route': route_name, + 'permission': permission}) + config.add_settings({'tailbone_config_pages': pages}) + config.action(None, action) + + +def add_model_view(config, model_name, label, route_prefix, permission_prefix): + """ + Register a model view for the app. + """ + def action(): + all_views = config.get_settings().get('tailbone_model_views', {}) + + model_views = all_views.setdefault(model_name, []) + model_views.append({ + 'label': label, + 'route_prefix': route_prefix, + 'permission_prefix': permission_prefix, + }) + + config.add_settings({'tailbone_model_views': all_views}) + + config.action(None, action) + + +def add_view_supplement(config, route_prefix, cls): + """ + Register a master view supplement for the app. + """ + def action(): + supplements = config.get_settings().get('tailbone_view_supplements', {}) + supplements.setdefault(route_prefix, []).append(cls) + config.add_settings({'tailbone_view_supplements': supplements}) + config.action(None, action) + + def establish_theme(settings): rattail_config = settings['rattail_config'] theme = get_effective_theme(rattail_config) settings['tailbone.theme'] = theme + directories = settings['mako.directories'] + if isinstance(directories, str): + directories = parse_list(directories) + path = get_theme_template_path(rattail_config) - settings['mako.directories'].insert(0, path) + directories.insert(0, path) + settings['mako.directories'] = directories def configure_postgresql(pyramid_config): @@ -169,7 +332,8 @@ def main(global_config, **settings): """ This function returns a Pyramid WSGI application. """ - settings.setdefault('mako.directories', ['tailbone:templates']) + settings.setdefault('mako.directories', ['tailbone:templates', + 'wuttaweb:templates']) rattail_config = make_rattail_config(settings) pyramid_config = make_pyramid_config(settings) pyramid_config.include('tailbone') diff --git a/tailbone/asgi.py b/tailbone/asgi.py new file mode 100644 index 00000000..1afbe12a --- /dev/null +++ b/tailbone/asgi.py @@ -0,0 +1,110 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +ASGI App Utilities +""" + +import os +import configparser +import logging + +from rattail.util import load_object + +from asgiref.wsgi import WsgiToAsgi + + +log = logging.getLogger(__name__) + + +class TailboneWsgiToAsgi(WsgiToAsgi): + """ + Custom WSGI -> ASGI wrapper, to add routing for websockets. + """ + + async def __call__(self, scope, *args, **kwargs): + protocol = scope['type'] + path = scope['path'] + + # strip off the root path, if non-empty. needed for serving + # under /poser or anything other than true site root + root_path = scope['root_path'] + if root_path and path.startswith(root_path): + path = path[len(root_path):] + + if protocol == 'websocket': + websockets = self.wsgi_application.registry.get( + 'tailbone_websockets', {}) + if path in websockets: + await websockets[path](scope, *args, **kwargs) + + try: + await super().__call__(scope, *args, **kwargs) + except ValueError as e: + # The developer may wish to improve handling of this exception. + # See https://github.com/Pylons/pyramid_cookbook/issues/225 and + # https://asgi.readthedocs.io/en/latest/specs/www.html#websocket + pass + except Exception as e: + raise e + + +def make_asgi_app(main_app=None): + """ + This function returns an ASGI application. + """ + path = os.environ.get('TAILBONE_ASGI_CONFIG') + if not path: + raise RuntimeError("You must define TAILBONE_ASGI_CONFIG env variable.") + + # make a config parser good enough to load pyramid settings + configdir = os.path.dirname(path) + parser = configparser.ConfigParser(defaults={'__file__': path, + 'here': configdir}) + + # read the config file + parser.read(path) + + # parse the settings needed for pyramid app + settings = dict(parser.items('app:main')) + + if isinstance(main_app, str): + make_wsgi_app = load_object(main_app) + elif callable(main_app): + make_wsgi_app = main_app + else: + if main_app: + log.warning("specified main app of unknown type: %s", main_app) + make_wsgi_app = load_object('tailbone.app:main') + + # construct a pyramid app "per usual" + app = make_wsgi_app({}, **settings) + + # then wrap it with ASGI + return TailboneWsgiToAsgi(app) + + +def asgi_main(): + """ + This function returns an ASGI application. + """ + return make_asgi_app() diff --git a/tailbone/auth.py b/tailbone/auth.py index 9db292ad..95bf90ba 100644 --- a/tailbone/auth.py +++ b/tailbone/auth.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,32 +24,31 @@ Authentication & Authorization """ -from __future__ import unicode_literals, absolute_import - import logging +import re -from rattail import enum -from rattail.util import prettify, NOTSET +from wuttjamaican.util import UNSPECIFIED -from zope.interface import implementer -from pyramid.interfaces import IAuthorizationPolicy -from pyramid.security import remember, forget, Everyone, Authenticated +from pyramid.security import remember, forget +from wuttaweb.auth import WuttaSecurityPolicy from tailbone.db import Session log = logging.getLogger(__name__) -def login_user(request, user, timeout=NOTSET): +def login_user(request, user, timeout=UNSPECIFIED): """ Perform the steps necessary to login the given user. Note that this returns a ``headers`` dict which you should pass to the redirect. """ - user.record_event(enum.USER_EVENT_LOGIN) + config = request.rattail_config + app = config.get_app() + user.record_event(app.enum.USER_EVENT_LOGIN) headers = remember(request, user.uuid) - if timeout is NOTSET: - timeout = session_timeout_for_user(user) + if timeout is UNSPECIFIED: + timeout = session_timeout_for_user(config, user) log.debug("setting session timeout for '{}' to {}".format(user.username, timeout)) set_session_timeout(request, timeout) return headers @@ -60,24 +59,28 @@ def logout_user(request): Perform the logout action for the given request. Note that this returns a ``headers`` dict which you should pass to the redirect. """ + app = request.rattail_config.get_app() user = request.user if user: - user.record_event(enum.USER_EVENT_LOGOUT) + user.record_event(app.enum.USER_EVENT_LOGOUT) request.session.delete() request.session.invalidate() headers = forget(request) return headers -def session_timeout_for_user(user): +def session_timeout_for_user(config, user): """ Returns the "max" session timeout for the user, according to roles """ - from rattail.db.auth import authenticated_role + app = config.get_app() + auth = app.get_auth_handler() - roles = user.roles + [authenticated_role(Session())] + authenticated = auth.get_role_authenticated(Session()) + roles = user.roles + [authenticated] timeouts = [role.session_timeout for role in roles if role.session_timeout is not None] + if timeouts and 0 not in timeouts: return max(timeouts) @@ -89,53 +92,42 @@ def set_session_timeout(request, timeout): request.session['_timeout'] = timeout or None -@implementer(IAuthorizationPolicy) -class TailboneAuthorizationPolicy(object): +class TailboneSecurityPolicy(WuttaSecurityPolicy): - def permits(self, context, principals, permission): - from rattail.db import model - from rattail.db.auth import has_permission + def __init__(self, db_session=None, api_mode=False, **kwargs): + kwargs['db_session'] = db_session or Session() + super().__init__(**kwargs) + self.api_mode = api_mode - for userid in principals: - if userid not in (Everyone, Authenticated): - if context.request.user and context.request.user.uuid == userid: - return context.request.has_perm(permission) - else: - assert False # should no longer happen..right? - user = Session.query(model.User).get(userid) - if user: - if has_permission(Session(), user, permission): - return True - if Everyone in principals: - return has_permission(Session(), None, permission) - return False + def load_identity(self, request): + config = request.registry.settings.get('rattail_config') + app = config.get_app() + user = None - def principals_allowed_by_permission(self, context, permission): - raise NotImplementedError + if self.api_mode: + # determine/load user from header token if present + credentials = request.headers.get('Authorization') + if credentials: + match = re.match(r'^Bearer (\S+)$', credentials) + if match: + token = match.group(1) + auth = app.get_auth_handler() + user = auth.authenticate_user_token(self.db_session, token) -def add_permission_group(config, key, label=None, overwrite=True): - """ - Add a permission group to the app configuration. - """ - def action(): - perms = config.get_settings().get('tailbone_permissions', {}) - if key not in perms or overwrite: - group = perms.setdefault(key, {'key': key}) - group['label'] = label or prettify(key) - config.add_settings({'tailbone_permissions': perms}) - config.action(None, action) + if not user: + # fetch user uuid from current session + uuid = self.session_helper.authenticated_userid(request) + if not uuid: + return -def add_permission(config, groupkey, key, label=None): - """ - Add a permission to the app configuration. - """ - def action(): - perms = config.get_settings().get('tailbone_permissions', {}) - group = perms.setdefault(groupkey, {'key': groupkey}) - group.setdefault('label', prettify(groupkey)) - perm = group.setdefault('perms', {}).setdefault(key, {'key': key}) - perm['label'] = label or prettify(key) - config.add_settings({'tailbone_permissions': perms}) - config.action(None, action) + # fetch user object from db + model = app.model + user = self.db_session.get(model.User, uuid) + if not user: + return + + # this user is responsible for data changes in current request + self.db_session.set_continuum_user(user) + return user diff --git a/tailbone/beaker.py b/tailbone/beaker.py index 1f7f20c5..25a450df 100644 --- a/tailbone/beaker.py +++ b/tailbone/beaker.py @@ -1,8 +1,8 @@ -# -*- coding: utf-8 -*- +# -*- coding: utf-8; -*- ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -27,10 +27,12 @@ Note that most of the code for this module was copied from the beaker and pyramid_beaker projects. """ -from __future__ import unicode_literals, absolute_import - import time +from pkg_resources import parse_version +from rattail.util import get_pkg_version + +import beaker from beaker.session import Session from beaker.util import coerce_session_params from pyramid.settings import asbool @@ -45,6 +47,10 @@ class TailboneSession(Session): def load(self): "Loads the data from this session from persistent storage" + + # are we using older version of beaker? + old_beaker = parse_version(get_pkg_version('beaker')) < parse_version('1.12') + self.namespace = self.namespace_class(self.id, data_dir=self.data_dir, digest_filenames=False, @@ -60,8 +66,12 @@ class TailboneSession(Session): try: session_data = self.namespace['session'] - if (session_data is not None and self.encrypt_key): - session_data = self._decrypt_data(session_data) + if old_beaker: + if (session_data is not None and self.encrypt_key): + session_data = self._decrypt_data(session_data) + else: # beaker >= 1.12 + if session_data is not None: + session_data = self._decrypt_data(session_data) # Memcached always returns a key, its None when its not # present @@ -90,6 +100,7 @@ class TailboneSession(Session): # for this module entirely... timeout = session_data.get('_timeout', self.timeout) if timeout is not None and \ + '_accessed_time' in session_data and \ now - session_data['_accessed_time'] > timeout: timed_out = True else: @@ -103,9 +114,6 @@ class TailboneSession(Session): # Update the current _accessed_time session_data['_accessed_time'] = now - # Set the path if applicable - if '_path' in session_data: - self._path = session_data['_path'] self.update(session_data) self.accessed_dict = session_data.copy() finally: diff --git a/tailbone/cleanup.py b/tailbone/cleanup.py new file mode 100644 index 00000000..0ed5d026 --- /dev/null +++ b/tailbone/cleanup.py @@ -0,0 +1,80 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2022 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Cleanup logic +""" + +from __future__ import unicode_literals, absolute_import + +import os +import logging +import time + +from rattail.cleanup import Cleaner + + +log = logging.getLogger(__name__) + + +class BeakerCleaner(Cleaner): + """ + Cleanup logic for old Beaker session files. + """ + + def get_session_dir(self): + session_dir = self.config.get('rattail.cleanup', 'beaker.session_dir') + if session_dir and os.path.isdir(session_dir): + return session_dir + + session_dir = os.path.join(self.config.appdir(), 'sessions') + if os.path.isdir(session_dir): + return session_dir + + def cleanup(self, session, dry_run=False, progress=None, **kwargs): + session_dir = self.get_session_dir() + if not session_dir: + return + + data_dir = os.path.join(session_dir, 'data') + lock_dir = os.path.join(session_dir, 'lock') + + # looking for files older than X days + days = self.config.getint('rattail.cleanup', + 'beaker.session_cutoff_days', + default=30) + cutoff = time.time() - 3600 * 24 * days + + for topdir in (data_dir, lock_dir): + if not os.path.isdir(topdir): + continue + + for dirpath, dirnames, filenames in os.walk(topdir): + for fname in filenames: + path = os.path.join(dirpath, fname) + ts = os.path.getmtime(path) + if ts <= cutoff: + if dry_run: + log.debug("would delete file: %s", path) + else: + os.remove(path) + log.debug("deleted file: %s", path) diff --git a/tailbone/config.py b/tailbone/config.py index 00a8a6f7..8392ba0a 100644 --- a/tailbone/config.py +++ b/tailbone/config.py @@ -1,8 +1,8 @@ -# -*- coding: utf-8 -*- +# -*- coding: utf-8; -*- ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,15 +24,16 @@ Rattail config extension for Tailbone """ -from __future__ import unicode_literals, absolute_import +import warnings + +from wuttjamaican.conf import WuttaConfigExtension -from rattail.config import ConfigExtension as BaseExtension from rattail.db.config import configure_session from tailbone.db import Session -class ConfigExtension(BaseExtension): +class ConfigExtension(WuttaConfigExtension): """ Rattail config extension for Tailbone. Does the following: @@ -48,7 +49,30 @@ class ConfigExtension(BaseExtension): Session.configure(rattail_config=config) configure_session(config, Session) + # provide default theme selection + config.setdefault('tailbone', 'themes.keys', 'default, butterball') + config.setdefault('tailbone', 'themes.expose_picker', 'true') -def expose_vuejs_experiments(config): - return config.getbool('tailbone', 'expose_vuejs_experiments', - default=False) + # override oruga detection + config.setdefault('wuttaweb.oruga_detector.spec', 'tailbone.util:should_use_oruga') + + +def csrf_token_name(config): + return config.get('tailbone', 'csrf_token_name', default='_csrf') + + +def csrf_header_name(config): + return config.get('tailbone', 'csrf_header_name', default='X-CSRF-TOKEN') + + +def global_help_url(config): + return config.get('tailbone', 'global_help_url') + + +def protected_usernames(config): + return config.getlist('tailbone', 'protected_usernames') + + +def should_expose_websockets(config): + return config.getbool('tailbone', 'expose_websockets', + usedb=False, default=False) diff --git a/tailbone/db.py b/tailbone/db.py index 041f750e..8b37f399 100644 --- a/tailbone/db.py +++ b/tailbone/db.py @@ -1,8 +1,8 @@ -# -*- coding: utf-8 -*- +# -*- coding: utf-8; -*- ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -21,11 +21,9 @@ # ################################################################################ """ -Database Stuff +Database sessions etc. """ -from __future__ import unicode_literals, absolute_import - import sqlalchemy as sa from zope.sqlalchemy import datamanager import sqlalchemy_continuum as continuum @@ -35,24 +33,37 @@ from rattail.db import SessionBase from rattail.db.continuum import versioning_manager -Session = scoped_session(sessionmaker(class_=SessionBase, rattail_config=None, rattail_record_changes=False, expire_on_commit=False)) +Session = scoped_session(sessionmaker(class_=SessionBase, rattail_config=None, expire_on_commit=False)) # not necessarily used, but here if you need it TempmonSession = scoped_session(sessionmaker()) TrainwreckSession = scoped_session(sessionmaker()) +# empty dict for now, this must populated on app startup (if needed) +ExtraTrainwreckSessions = {} + class TailboneSessionDataManager(datamanager.SessionDataManager): - """Integrate a top level sqlalchemy session transaction into a zope transaction + """ + Integrate a top level sqlalchemy session transaction into a zope + transaction One phase variant. .. note:: - This class appears to be necessary in order for the Continuum - integration to work alongside the Zope transaction integration. + + This class appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It subclasses + ``zope.sqlalchemy.datamanager.SessionDataManager`` but injects + some SQLAlchemy-Continuum logic within :meth:`tpc_vote()`, and + is sort of monkey-patched into the mix. """ def tpc_vote(self, trans): + """ """ # for a one phase data manager commit last in tpc_vote if self.tx is not None: # there may have been no work to do @@ -64,25 +75,42 @@ class TailboneSessionDataManager(datamanager.SessionDataManager): self._finish('committed') -def join_transaction(session, initial_state=datamanager.STATUS_ACTIVE, transaction_manager=datamanager.zope_transaction.manager, keep_session=False): - """Join a session to a transaction using the appropriate datamanager. +def join_transaction( + session, + initial_state=datamanager.STATUS_ACTIVE, + transaction_manager=datamanager.zope_transaction.manager, + keep_session=False, +): + """ + Join a session to a transaction using the appropriate datamanager. - It is safe to call this multiple times, if the session is already joined - then it just returns. + It is safe to call this multiple times, if the session is already + joined then it just returns. - `initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or STATUS_READONLY + `initial_state` is either STATUS_ACTIVE, STATUS_INVALIDATED or + STATUS_READONLY - If using the default initial status of STATUS_ACTIVE, you must ensure that - mark_changed(session) is called when data is written to the database. + If using the default initial status of STATUS_ACTIVE, you must + ensure that mark_changed(session) is called when data is written + to the database. - The ZopeTransactionExtesion SessionExtension can be used to ensure that this is - called automatically after session write operations. + The ZopeTransactionExtesion SessionExtension can be used to ensure + that this is called automatically after session write operations. .. note:: - This function is copied from upstream, and tweaked so that our custom - :class:`TailboneSessionDataManager` will be used. + + This function appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It overrides ``zope.sqlalchemy.datamanager.join_transaction()`` + to ensure the custom :class:`TailboneSessionDataManager` is + used, and is sort of monkey-patched into the mix. """ - if datamanager._SESSION_STATE.get(id(session), None) is None: + # the upstream internals of this function has changed a little over time. + # unfortunately for us, that means we must include each variant here. + + if datamanager._SESSION_STATE.get(session, None) is None: if session.twophase: DataManager = datamanager.TwoPhaseSessionDataManager else: @@ -90,44 +118,74 @@ def join_transaction(session, initial_state=datamanager.STATUS_ACTIVE, transacti DataManager(session, initial_state, transaction_manager, keep_session=keep_session) -class ZopeTransactionExtension(datamanager.ZopeTransactionExtension): - """Record that a flush has occurred on a session's connection. This allows - the DataManager to rollback rather than commit on read only transactions. +class ZopeTransactionEvents(datamanager.ZopeTransactionEvents): + """ + Record that a flush has occurred on a session's connection. This + allows the DataManager to rollback rather than commit on read only + transactions. .. note:: - This class is copied from upstream, and tweaked so that our custom - :func:`join_transaction()` will be used. + + This class appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It subclasses + ``zope.sqlalchemy.datamanager.ZopeTransactionEvents`` but + overrides various methods to ensure the custom + :func:`join_transaction()` is called, and is sort of + monkey-patched into the mix. """ def after_begin(self, session, transaction, connection): - join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session) + """ """ + join_transaction(session, self.initial_state, + self.transaction_manager, self.keep_session) def after_attach(self, session, instance): - join_transaction(session, self.initial_state, self.transaction_manager, self.keep_session) + """ """ + join_transaction(session, self.initial_state, + self.transaction_manager, self.keep_session) + + def join_transaction(self, session): + """ """ + join_transaction(session, self.initial_state, + self.transaction_manager, self.keep_session) -def register(session, initial_state=datamanager.STATUS_ACTIVE, - transaction_manager=datamanager.zope_transaction.manager, keep_session=False): - """Register ZopeTransaction listener events on the - given Session or Session factory/class. +def register( + session, + initial_state=datamanager.STATUS_ACTIVE, + transaction_manager=datamanager.zope_transaction.manager, + keep_session=False, +): + """ + Register ZopeTransaction listener events on the given Session or + Session factory/class. - This function requires at least SQLAlchemy 0.7 and makes use - of the newer sqlalchemy.event package in order to register event listeners - on the given Session. + This function requires at least SQLAlchemy 0.7 and makes use of + the newer sqlalchemy.event package in order to register event + listeners on the given Session. The session argument here may be a Session class or subclass, a - sessionmaker or scoped_session instance, or a specific Session instance. - Event listening will be specific to the scope of the type of argument - passed, including specificity to its subclass as well as its identity. + sessionmaker or scoped_session instance, or a specific Session + instance. Event listening will be specific to the scope of the + type of argument passed, including specificity to its subclass as + well as its identity. .. note:: - This function is copied from upstream, and tweaked so that our custom - :class:`ZopeTransactionExtension` will be used. + + This function appears to be necessary in order for the + SQLAlchemy-Continuum integration to work alongside the Zope + transaction integration. + + It overrides ``zope.sqlalchemy.datamanager.regsiter()`` to + ensure the custom :class:`ZopeTransactionEvents` is used. """ from sqlalchemy import event - ext = ZopeTransactionExtension( - initial_state=initial_state, + ext = ZopeTransactionEvents( + initial_state=initial_state, transaction_manager=transaction_manager, keep_session=keep_session, ) @@ -139,6 +197,9 @@ def register(session, initial_state=datamanager.STATUS_ACTIVE, event.listen(session, "after_bulk_delete", ext.after_bulk_delete) event.listen(session, "before_commit", ext.before_commit) + if datamanager.SA_GE_14: + event.listen(session, "do_orm_execute", ext.do_orm_execute) + register(Session) register(TempmonSession) diff --git a/tailbone/diffs.py b/tailbone/diffs.py index 595dbfc9..2e582b15 100644 --- a/tailbone/diffs.py +++ b/tailbone/diffs.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2017 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,7 +24,8 @@ Tools for displaying data diffs """ -from __future__ import unicode_literals, absolute_import +import sqlalchemy as sa +import sqlalchemy_continuum as continuum from pyramid.renderers import render from webhelpers2.html import HTML @@ -33,16 +34,43 @@ from webhelpers2.html import HTML class Diff(object): """ Core diff class. In sore need of documentation. + + You must provide the old and new data sets, and the set of + relevant fields as well, if they cannot be easily introspected. + + :param old_data: Dict of "old" data values. + + :param new_data: Dict of "old" data values. + + :param fields: Sequence of relevant field names. Note that + both data dicts are expected to have keys which match these + field names. If you do not specify the fields then they + will (hopefully) be introspected from the old or new data + sets; however this will not work if they are both empty. + + :param monospace: If true, this flag will cause the value + columns to be rendered in monospace font. This is assumed + to be helpful when comparing "raw" data values which are + shown as e.g. ``repr(val)``. + + :param enums: Optional dict of enums for use when displaying field + values. If specified, keys should be field names and values + should be enum dicts. """ - def __init__(self, old_data, new_data, columns=None, fields=None, render_field=None, render_value=None, monospace=False): + def __init__(self, old_data, new_data, columns=None, fields=None, enums=None, + render_field=None, render_value=None, nature='dirty', + monospace=False, extra_row_attrs=None): self.old_data = old_data self.new_data = new_data self.columns = columns or ["field name", "old value", "new value"] self.fields = fields or self.make_fields() + self.enums = enums or {} self._render_field = render_field or self.render_field_default self.render_value = render_value or self.render_value_default + self.nature = nature self.monospace = monospace + self.extra_row_attrs = extra_row_attrs def make_fields(self): return sorted(set(self.old_data) | set(self.new_data), key=lambda x: x.lower()) @@ -61,6 +89,32 @@ class Diff(object): context['diff'] = self return HTML.literal(render(template, context)) + def get_row_attrs(self, field): + """ + Returns a *rendered* set of extra attributes for the ```` element + for the given field. May be an empty string, or a snippet of HTML + attribute syntax, e.g.: + + .. code-block:: none + + class="diff" foo="bar" + + If you wish to supply additional attributes, please define + :attr:`extra_row_attrs`, which can be either a static dict, or a + callable returning a dict. + """ + attrs = {} + if self.values_differ(field): + attrs['class'] = 'diff' + + if self.extra_row_attrs: + if callable(self.extra_row_attrs): + attrs.update(self.extra_row_attrs(field, attrs)) + else: + attrs.update(self.extra_row_attrs) + + return HTML.render_attrs(attrs) + def render_field(self, field): return self._render_field(field, self) @@ -77,3 +131,161 @@ class Diff(object): def render_new_value(self, field): value = self.new_value(field) return self.render_value(field, value) + + +class VersionDiff(Diff): + """ + Special diff class, for use with version history views. Note that + while based on :class:`Diff`, this class uses a different + signature for the constructor. + + :param version: Reference to a Continuum version record (object). + + :param \*args: Typical usage will not require positional args + beyond the ``version`` param, in which case ``old_data`` and + ``new_data`` params will be auto-determined based on the + ``version``. But if you specify positional args then nothing + automatic is done, they are passed as-is to the parent + :class:`Diff` constructor. + + :param \*\*kwargs: Remaining kwargs are passed as-is to the + :class:`Diff` constructor. + """ + + def __init__(self, version, *args, **kwargs): + self.version = version + self.mapper = sa.inspect(continuum.parent_class(type(self.version))) + self.version_mapper = sa.inspect(type(self.version)) + self.title = kwargs.pop('title', None) + + if 'nature' not in kwargs: + if version.previous and version.operation_type == continuum.Operation.DELETE: + kwargs['nature'] = 'deleted' + elif version.previous: + kwargs['nature'] = 'dirty' + else: + kwargs['nature'] = 'new' + + if 'fields' not in kwargs: + kwargs['fields'] = self.get_default_fields() + + if not args: + old_data = {} + new_data = {} + for field in kwargs['fields']: + if version.previous: + old_data[field] = getattr(version.previous, field) + new_data[field] = getattr(version, field) + args = (old_data, new_data) + + super().__init__(*args, **kwargs) + + def get_default_fields(self): + fields = sorted(self.version_mapper.columns.keys()) + + unwanted = [ + 'transaction_id', + 'end_transaction_id', + 'operation_type', + ] + + return [field for field in fields + if field not in unwanted] + + def render_version_value(self, field, value, version): + """ + Render the cell value text for the given version/field info. + + Note that this method is used to render both sides of the diff + (before and after values). + + :param field: Name of the field, as string. + + :param value: Raw value for the field, as obtained from ``version``. + + :param version: Reference to the Continuum version object. + + :returns: Rendered text as string, or ``None``. + """ + text = HTML.tag('span', c=[repr(value)], + style='font-family: monospace;') + + # assume the enum display is all we need, if enum exists for the field + if field in self.enums: + + # but skip the enum display if None + display = self.enums[field].get(value) + if display is None and value is None: + return text + + # otherwise show enum display to the right of raw value + display = self.enums[field].get(value, str(value)) + return HTML.tag('span', c=[ + text, + HTML.tag('span', c=[display], + style='margin-left: 2rem; font-style: italic; font-weight: bold;'), + ]) + + # next we look for a relationship and may render the foreign object + for prop in self.mapper.relationships: + if prop.uselist: + continue + + for col in prop.local_columns: + if col.name != field: + continue + + if not hasattr(version, prop.key): + continue + + if col in self.mapper.primary_key: + continue + + ref = getattr(version, prop.key) + if ref: + ref = getattr(ref, 'version_parent', None) + if ref: + return HTML.tag('span', c=[ + text, + HTML.tag('span', c=[str(ref)], + style='margin-left: 2rem; font-style: italic; font-weight: bold;'), + ]) + + return text + + def render_old_value(self, field): + if self.nature == 'new': + return '' + value = self.old_value(field) + return self.render_version_value(field, value, self.version.previous) + + def render_new_value(self, field): + if self.nature == 'deleted': + return '' + value = self.new_value(field) + return self.render_version_value(field, value, self.version) + + def as_struct(self): + values = {} + for field in self.fields: + values[field] = {'before': self.render_old_value(field), + 'after': self.render_new_value(field)} + + operation = None + if self.version.operation_type == continuum.Operation.INSERT: + operation = 'INSERT' + elif self.version.operation_type == continuum.Operation.UPDATE: + operation = 'UPDATE' + elif self.version.operation_type == continuum.Operation.DELETE: + operation = 'DELETE' + else: + operation = self.version.operation_type + + return { + 'key': id(self.version), + 'model_title': self.title, + 'operation': operation, + 'diff_class': self.nature, + 'fields': self.fields, + 'values': values, + } diff --git a/tailbone/exceptions.py b/tailbone/exceptions.py new file mode 100644 index 00000000..3468562a --- /dev/null +++ b/tailbone/exceptions.py @@ -0,0 +1,49 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2024 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Tailbone Exceptions +""" + +from rattail.exceptions import RattailError + + +class TailboneError(RattailError): + """ + Base class for all Tailbone exceptions. + """ + + +class TailboneJSONFieldError(TailboneError): + """ + Error raised when JSON serialization of a form field results in an error. + This is just a simple wrapper, to make the error message more helpful for + the developer. + """ + + def __init__(self, field, error): + self.field = field + self.error = error + + def __str__(self): + return ("Failed to serialize field '{}' as JSON! " + "Original error was: {}".format(self.field, self.error)) diff --git a/tailbone/forms/__init__.py b/tailbone/forms/__init__.py index a368f2d1..34b34a6c 100644 --- a/tailbone/forms/__init__.py +++ b/tailbone/forms/__init__.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2023 Lance Edgar # # This file is part of Rattail. # @@ -24,8 +24,7 @@ Forms Library """ -from __future__ import unicode_literals, absolute_import - -from . import types +# nb. import widgets before types, b/c types may refer to widgets from . import widgets +from . import types from .core import Form, SimpleFileImport diff --git a/tailbone/forms/common.py b/tailbone/forms/common.py new file mode 100644 index 00000000..6183d17f --- /dev/null +++ b/tailbone/forms/common.py @@ -0,0 +1,62 @@ +# -*- coding: utf-8; -*- +################################################################################ +# +# Rattail -- Retail Software Framework +# Copyright © 2010-2023 Lance Edgar +# +# This file is part of Rattail. +# +# Rattail is free software: you can redistribute it and/or modify it under the +# terms of the GNU General Public License as published by the Free Software +# Foundation, either version 3 of the License, or (at your option) any later +# version. +# +# Rattail is distributed in the hope that it will be useful, but WITHOUT ANY +# WARRANTY; without even the implied warranty of MERCHANTABILITY or FITNESS +# FOR A PARTICULAR PURPOSE. See the GNU General Public License for more +# details. +# +# You should have received a copy of the GNU General Public License along with +# Rattail. If not, see . +# +################################################################################ +""" +Common Forms +""" + +from rattail.db import model + +import colander + + +@colander.deferred +def validate_user(node, kw): + session = kw['session'] + def validate(node, value): + user = session.get(model.User, value) + if not user: + raise colander.Invalid(node, "User not found") + return user.uuid + return validate + + +class Feedback(colander.Schema): + """ + Form schema for user feedback. + """ + email_key = colander.SchemaNode(colander.String(), + missing=colander.null) + + referrer = colander.SchemaNode(colander.String()) + + user = colander.SchemaNode(colander.String(), + missing=colander.null, + validator=validate_user) + + user_name = colander.SchemaNode(colander.String(), + missing=colander.null) + + please_reply_to = colander.SchemaNode(colander.String(), + missing=colander.null) + + message = colander.SchemaNode(colander.String()) diff --git a/tailbone/forms/core.py b/tailbone/forms/core.py index ceda975f..4024557b 100644 --- a/tailbone/forms/core.py +++ b/tailbone/forms/core.py @@ -2,7 +2,7 @@ ################################################################################ # # Rattail -- Retail Software Framework -# Copyright © 2010-2018 Lance Edgar +# Copyright © 2010-2024 Lance Edgar # # This file is part of Rattail. # @@ -24,18 +24,19 @@ Forms Core """ -from __future__ import unicode_literals, absolute_import - -import datetime +import hashlib +import json import logging +import warnings +from collections import OrderedDict -import six import sqlalchemy as sa from sqlalchemy import orm from sqlalchemy.ext.associationproxy import AssociationProxy, ASSOCIATION_PROXY +from wuttjamaican.util import UNSPECIFIED -from rattail.time import localtime -from rattail.util import prettify, pretty_boolean, pretty_hours, pretty_quantity +from rattail.util import pretty_boolean +from rattail.db.util import get_fieldnames import colander import deform @@ -46,9 +47,15 @@ from pyramid_deform import SessionFileUploadTempStore from pyramid.renderers import render from webhelpers2.html import tags, HTML -from tailbone.util import raw_datetime -from . import types -from .widgets import ReadonlyWidget, PlainDateWidget, JQueryDateWidget, JQueryTimeWidget +from wuttaweb.util import FieldList, get_form_data, make_json_safe + +from tailbone.db import Session +from tailbone.util import raw_datetime, render_markdown +from tailbone.forms import types +from tailbone.forms.widgets import (ReadonlyWidget, PlainDateWidget, + JQueryDateWidget, JQueryTimeWidget, + FileUploadWidget, MultiFileUploadWidget) +from tailbone.exceptions import TailboneJSONFieldError log = logging.getLogger(__name__) @@ -109,22 +116,14 @@ class CustomSchemaNode(SQLAlchemySchemaNode): for the given association proxy field name. Typically this will refer to the "extension" model class. """ - proxy = self.association_proxy(field) - if proxy: - proxy_target = self.inspector.get_property(proxy.target_collection) - if isinstance(proxy_target, orm.RelationshipProperty) and not proxy_target.uselist: - return proxy_target + return get_association_proxy_target(self.inspector, field) def association_proxy_column(self, field): """ Returns the property on the proxy target class, for the column which is reflected by the proxy. """ - proxy_target = self.association_proxy_target(field) - if proxy_target: - prop = proxy_target.mapper.get_property(field) - if isinstance(prop, orm.ColumnProperty) and isinstance(prop.columns[0], sa.Column): - return prop + return get_association_proxy_column(self.inspector, field) def supported_association_proxy(self, field): """ @@ -227,7 +226,7 @@ class CustomSchemaNode(SQLAlchemySchemaNode): if excludes: overrides['excludes'] = excludes - return super(CustomSchemaNode, self).get_schema_from_relationship(prop, overrides) + return super().get_schema_from_relationship(prop, overrides) def dictify(self, obj): """ Return a dictified version of `obj` using schema information. @@ -236,7 +235,7 @@ class CustomSchemaNode(SQLAlchemySchemaNode): This method was copied from upstream and modified to add automatic handling of "association proxy" fields. """ - dict_ = super(CustomSchemaNode, self).dictify(obj) + dict_ = super().dictify(obj) for node in self: name = node.name @@ -329,26 +328,32 @@ class Form(object): """ Base class for all forms. """ - save_label = "Save" + save_label = "Submit" update_label = "Save" show_cancel = True auto_disable = True auto_disable_save = True auto_disable_cancel = True - def __init__(self, fields=None, schema=None, request=None, mobile=False, readonly=False, readonly_fields=[], - model_instance=None, model_class=None, nodes={}, enums={}, labels={}, renderers=None, + def __init__(self, fields=None, schema=None, request=None, readonly=False, readonly_fields=[], + model_instance=None, model_class=None, appstruct=UNSPECIFIED, nodes={}, enums={}, labels={}, + assume_local_times=False, renderers=None, renderer_kwargs={}, hidden={}, widgets={}, defaults={}, validators={}, required={}, helptext={}, focus_spec=None, - action_url=None, cancel_url=None): - + action_url=None, cancel_url=None, + vue_tagname=None, + vuejs_component_kwargs=None, vuejs_field_converters={}, json_data={}, included_templates={}, + # TODO: ugh this is getting out hand! + can_edit_help=False, edit_help_url=None, route_prefix=None, + **kwargs + ): self.fields = None if fields is not None: self.set_fields(fields) self.schema = schema if self.fields is None and self.schema: self.set_fields([f.name for f in self.schema]) + self.grouping = None self.request = request - self.mobile = mobile self.readonly = readonly self.readonly_fields = set(readonly_fields or []) self.model_instance = model_instance @@ -357,23 +362,99 @@ class Form(object): self.model_class = type(self.model_instance) if self.model_class and self.fields is None: self.set_fields(self.make_fields()) + self.appstruct = appstruct self.nodes = nodes or {} self.enums = enums or {} self.labels = labels or {} + self.assume_local_times = assume_local_times if renderers is None and self.model_class: self.renderers = self.make_renderers() else: self.renderers = renderers or {} + self.renderer_kwargs = renderer_kwargs or {} self.hidden = hidden or {} self.widgets = widgets or {} self.defaults = defaults or {} self.validators = validators or {} self.required = required or {} self.helptext = helptext or {} + self.dynamic_helptext = {} self.focus_spec = focus_spec self.action_url = action_url self.cancel_url = cancel_url + # vue_tagname + self.vue_tagname = vue_tagname + if not self.vue_tagname and kwargs.get('component'): + warnings.warn("component kwarg is deprecated for Form(); " + "please use vue_tagname param instead", + DeprecationWarning, stacklevel=2) + self.vue_tagname = kwargs['component'] + if not self.vue_tagname: + self.vue_tagname = 'tailbone-form' + + self.vuejs_component_kwargs = vuejs_component_kwargs or {} + self.vuejs_field_converters = vuejs_field_converters or {} + self.json_data = json_data or {} + self.included_templates = included_templates or {} + self.can_edit_help = can_edit_help + self.edit_help_url = edit_help_url + self.route_prefix = route_prefix + + self.button_icon_submit = kwargs.get('button_icon_submit', 'save') + + def __iter__(self): + return iter(self.fields) + + @property + def vue_component(self): + """ + String name for the Vue component, e.g. ``'TailboneGrid'``. + + This is a generated value based on :attr:`vue_tagname`. + """ + words = self.vue_tagname.split('-') + return ''.join([word.capitalize() for word in words]) + + @property + def component(self): + """ + DEPRECATED - use :attr:`vue_tagname` instead. + """ + warnings.warn("Form.component is deprecated; " + "please use vue_tagname instead", + DeprecationWarning, stacklevel=2) + return self.vue_tagname + + @property + def component_studly(self): + """ + DEPRECATED - use :attr:`vue_component` instead. + """ + warnings.warn("Form.component_studly is deprecated; " + "please use vue_component instead", + DeprecationWarning, stacklevel=2) + return self.vue_component + + def get_button_label_submit(self): + """ """ + if hasattr(self, '_button_label_submit'): + return self._button_label_submit + + label = getattr(self, 'submit_label', None) + if label: + return label + + return self.save_label + + def set_button_label_submit(self, value): + """ """ + self._button_label_submit = value + + # wutta compat + button_label_submit = property(get_button_label_submit, + set_button_label_submit) + def __contains__(self, item): return item in self.fields @@ -387,19 +468,11 @@ class Form(object): if not self.model_class: raise ValueError("Must define model_class to use make_fields()") - mapper = orm.class_mapper(self.model_class) + return get_fieldnames(self.request.rattail_config, self.model_class, + columns=True, proxies=True, relations=True) - # first add primary column fields - fields = FieldList([prop.key for prop in mapper.iterate_properties - if not prop.key.startswith('_') - and prop.key != 'versions']) - - # then add association proxy fields - for key, desc in sa.inspect(self.model_class).all_orm_descriptors.items(): - if desc.extension_type == ASSOCIATION_PROXY: - fields.append(key) - - return fields + def set_grouping(self, items): + self.grouping = OrderedDict(items) def make_renderers(self): """ @@ -419,7 +492,10 @@ class Form(object): if len(prop.columns) == 1: column = prop.columns[0] if isinstance(column.type, sa.DateTime): - renderers[prop.key] = self.render_datetime + if self.assume_local_times: + renderers[prop.key] = self.render_datetime_local + else: + renderers[prop.key] = self.render_datetime elif isinstance(column.type, sa.Boolean): renderers[prop.key] = self.render_boolean @@ -439,6 +515,9 @@ class Form(object): def append(self, field): self.fields.append(field) + def insert(self, index, field): + self.fields.insert(index, field) + def insert_before(self, field, newfield): self.fields.insert_before(field, newfield) @@ -525,7 +604,10 @@ class Form(object): # apply any validators for key, validator in self.validators.items(): - if key in schema: + if key is None: + # this one is form-wide + schema.validator = validator + elif key in schema: schema[key].validator = validator # apply required flags @@ -548,7 +630,9 @@ class Form(object): self.schema[key].title = label def get_label(self, key): - return self.labels.get(key, prettify(key)) + config = self.request.rattail_config + app = config.get_app() + return self.labels.get(key, app.make_title(key)) def set_readonly(self, key, readonly=True): if readonly: @@ -565,9 +649,23 @@ class Form(object): node = colander.SchemaNode(nodeinfo, **kwargs) self.nodes[key] = node + # must explicitly replace node, if we already have a schema + if self.schema: + self.schema[key] = node + def set_type(self, key, type_, **kwargs): + if type_ == 'datetime': self.set_renderer(key, self.render_datetime) + + elif type_ == 'datetime_falafel': + self.set_renderer(key, self.render_datetime) + self.set_node(key, types.FalafelDateTime(request=self.request)) + if kwargs.get('helptext'): + app = self.request.rattail_config.get_app() + timezone = app.get_timezone() + self.set_helptext(key, f"NOTE: all times are local to {timezone}") + elif type_ == 'datetime_local': self.set_renderer(key, self.render_datetime_local) elif type_ == 'date_plain': @@ -576,9 +674,14 @@ class Form(object): # TODO: is this safe / a good idea? # self.set_node(key, colander.Date()) self.set_widget(key, JQueryDateWidget()) + elif type_ == 'time_jquery': self.set_node(key, types.JQueryTime()) self.set_widget(key, JQueryTimeWidget()) + + elif type_ == 'time_falafel': + self.set_node(key, types.FalafelTime(request=self.request)) + elif type_ == 'duration': self.set_renderer(key, self.render_duration) elif type_ == 'boolean': @@ -598,17 +701,47 @@ class Form(object): self.set_renderer(key, self.render_codeblock) self.set_widget(key, dfwidget.TextAreaWidget(cols=80, rows=8)) elif type_ == 'text': + self.set_renderer(key, self.render_pre_sans_serif) + self.set_widget(key, dfwidget.TextAreaWidget(cols=80, rows=8)) + elif type_ == 'text_wrapped': + self.set_renderer(key, self.render_pre_sans_serif_wrapped) self.set_widget(key, dfwidget.TextAreaWidget(cols=80, rows=8)) elif type_ == 'file': tmpstore = SessionFileUploadTempStore(self.request) - kw = {'widget': dfwidget.FileUploadWidget(tmpstore), + kw = {'widget': FileUploadWidget(tmpstore, request=self.request), 'title': self.get_label(key)} if 'required' in kwargs and not kwargs['required']: kw['missing'] = colander.null self.set_node(key, colander.SchemaNode(deform.FileData(), **kw)) + elif type_ == 'multi_file': + tmpstore = SessionFileUploadTempStore(self.request) + file_node = colander.SchemaNode(deform.FileData(), + name='upload') + + kw = {'name': key, + 'title': self.get_label(key), + 'widget': MultiFileUploadWidget(tmpstore)} + # if 'required' in kwargs and not kwargs['required']: + # kw['missing'] = colander.null + if kwargs.get('validate_unique'): + kw['validator'] = self.validate_multiple_files_unique + files_node = colander.SequenceSchema(file_node, **kw) + self.set_node(key, files_node) else: raise ValueError("unknown type for '{}' field: {}".format(key, type_)) + def validate_multiple_files_unique(self, node, value): + + # get SHA256 hash for each file; error if duplicates encountered + hashes = {} + for fileinfo in value: + fp = fileinfo['fp'] + fp.seek(0) + filehash = hashlib.sha256(fp.read()).hexdigest() + if filehash in hashes: + node.raise_invalid(f"Duplicate file detected: {fileinfo['filename']}") + hashes[filehash] = fileinfo + def set_enum(self, key, enum, empty=None): if enum: self.enums[key] = enum @@ -636,6 +769,22 @@ class Form(object): else: self.renderers[key] = renderer + def add_renderer_kwargs(self, key, kwargs): + self.renderer_kwargs.setdefault(key, {}).update(kwargs) + + def get_renderer_kwargs(self, key): + return self.renderer_kwargs.get(key, {}) + + def set_renderer_kwargs(self, key, kwargs): + self.renderer_kwargs[key] = kwargs + + def set_input_handler(self, key, value): + """ + Convenience method to assign "input handler" callback code for + the given field. + """ + self.add_renderer_kwargs(key, {'input_handler': value}) + def set_hidden(self, key, hidden=True): self.hidden[key] = hidden @@ -647,8 +796,26 @@ class Form(object): self.schema[key].widget = widget def set_validator(self, key, validator): + """ + Set the validator for the schema node represented by the given + key. + + :param key: Normally this the name of one of the fields + contained in the form. It can also be ``None`` in which + case the validator pertains to the form at large instead of + one of the fields. + + :param validator: Callable which accepts ``(node, value)`` + args. + """ self.validators[key] = validator + # we normally apply the validator when creating the schema, so + # if this form already has a schema, then go ahead and apply + # the validator to it + if self.schema and key in self.schema: + self.schema[key].validator = validator + def set_required(self, key, required=True): """ Set whether or not value is required for a given field. @@ -661,11 +828,16 @@ class Form(object): """ self.defaults[key] = value - def set_helptext(self, key, value): + def set_helptext(self, key, value, dynamic=False): """ Set the help text for a given field. """ - self.helptext[key] = value + # nb. must avoid newlines, they cause some weird "blank page" error?! + self.helptext[key] = value.replace('\n', ' ') + if value and dynamic: + self.dynamic_helptext[key] = True + else: + self.dynamic_helptext.pop(key, None) def has_helptext(self, key): """ @@ -678,17 +850,22 @@ class Form(object): """ Render the help text for the given field. """ - return self.helptext[key] + text = self.helptext[key] + text = text.replace('"', '"') + return HTML.literal(text) - def render(self, template=None, **kwargs): - if not template: - if self.readonly: - template = '/forms/form_readonly.mako' - else: - template = '/forms/form.mako' - context = kwargs - context['form'] = self - return render(template, context) + def set_vuejs_field_converter(self, field, converter): + self.vuejs_field_converters[field] = converter + + def render(self, **kwargs): + warnings.warn("Form.render() is deprecated (for now?); " + "please use Form.render_deform() instead", + DeprecationWarning, stacklevel=2) + return self.render_deform(**kwargs) + + def get_deform(self): + """ """ + return self.make_deform_form() def make_deform_form(self): if not hasattr(self, 'deform_form'): @@ -704,7 +881,12 @@ class Form(object): # get initial form values from model instance kwargs = {} - if self.model_instance: + # TODO: ugh, this is necessary to avoid some logic + # which assumes a ColanderAlchemy schema i think? + if self.appstruct is not UNSPECIFIED: + if self.appstruct: + kwargs['appstruct'] = self.appstruct + elif self.model_instance: if self.model_class: kwargs['appstruct'] = schema.dictify(self.model_instance) else: @@ -723,33 +905,337 @@ class Form(object): return self.deform_form - def render_deform(self, dform=None, template='/forms/deform.mako', **kwargs): + def render_vue_template(self, template='/forms/deform.mako', **context): + """ """ + output = self.render_deform(template=template, **context) + return HTML.literal(output) + + def render_deform(self, dform=None, template=None, **kwargs): + if not template: + template = '/forms/deform.mako' + if dform is None: dform = self.make_deform_form() # TODO: would perhaps be nice to leverage deform's default rendering # someday..? i.e. using Chameleon *.pt templates - # return form.render() + # return dform.render() context = kwargs context['form'] = self context['dform'] = dform + context.setdefault('can_edit_help', self.can_edit_help) + if context['can_edit_help']: + context.setdefault('edit_help_url', self.edit_help_url) + context['field_labels'] = self.get_field_labels() + context['field_markdowns'] = self.get_field_markdowns() context.setdefault('form_kwargs', {}) # TODO: deprecate / remove the latter option here if self.auto_disable_save or self.auto_disable: - context['form_kwargs']['class_'] = 'autodisable' + context['form_kwargs'].setdefault('ref', self.vue_component) + context['form_kwargs']['@submit'] = 'submit{}'.format(self.vue_component) if self.focus_spec: context['form_kwargs']['data-focus'] = self.focus_spec context['request'] = self.request context['readonly_fields'] = self.readonly_fields context['render_field_readonly'] = self.render_field_readonly - return render('/forms/deform.mako', context) + return render(template, context) + + def get_field_labels(self): + return dict([(field, self.get_label(field)) + for field in self]) + + def get_field_markdowns(self, session=None): + app = self.request.rattail_config.get_app() + model = app.model + session = session or Session() + + if not hasattr(self, 'field_markdowns'): + infos = session.query(model.TailboneFieldInfo)\ + .filter(model.TailboneFieldInfo.route_prefix == self.route_prefix)\ + .all() + self.field_markdowns = dict([(info.field_name, info.markdown_text) + for info in infos]) + + return self.field_markdowns + + def get_vue_field_value(self, key): + """ """ + if key not in self.fields: + return + + dform = self.get_deform() + if key not in dform: + return + + field = dform[key] + return make_json_safe(field.cstruct) + + def get_vuejs_model_value(self, field): + """ + This method must return "raw" JS which will be assigned as the initial + model value for the given field. This JS will be written as part of + the overall response, to be interpreted on the client side. + """ + if field.name in self.vuejs_field_converters: + convert = self.vuejs_field_converters[field.name] + value = convert(field.cstruct) + return json.dumps(value) + + if isinstance(field.schema.typ, colander.Set): + if field.cstruct is colander.null: + return '[]' + + try: + return self.jsonify_value(field.cstruct) + except Exception as error: + raise TailboneJSONFieldError(field.name, error) + + def jsonify_value(self, value): + """ + Take a Python value and convert to JSON + """ + if value is colander.null: + return 'null' + + if isinstance(value, dfwidget.filedict): + # TODO: we used to always/only return 'null' here but hopefully + # this also works, to show existing filename when present + if value and value['filename']: + return json.dumps({'name': value['filename']}) + return 'null' + + elif isinstance(value, list) and all([isinstance(f, dfwidget.filedict) + for f in value]): + return json.dumps([{'name': f['filename']} + for f in value]) + + app = self.request.rattail_config.get_app() + value = app.json_friendly(value) + return json.dumps(value) + + def get_error_messages(self, field): + if field.error: + return field.error.messages() + + error = self.make_deform_form().error + if error: + if isinstance(error, colander.Invalid): + if error.node.name == field.name: + return error.messages() + + def messages_json(self, messages): + dump = json.dumps(messages) + dump = dump.replace("'", ''') + return dump def field_visible(self, field): if self.hidden and self.hidden.get(field): return False return True + def set_vuejs_component_kwargs(self, **kwargs): + self.vuejs_component_kwargs.update(kwargs) + + def render_vue_tag(self, **kwargs): + """ """ + return self.render_vuejs_component(**kwargs) + + def render_vuejs_component(self, **kwargs): + """ + Render the Vue.js component HTML for the form. + + Most typically this is something like: + + .. code-block:: html + + + + """ + kw = dict(self.vuejs_component_kwargs) + kw.update(kwargs) + if self.can_edit_help: + kw.setdefault(':configure-fields-help', 'configureFieldsHelp') + return HTML.tag(self.vue_tagname, **kw) + + def set_json_data(self, key, value): + """ + Establish a data value for use in client-side JS. This value + will be JSON-encoded and made available to the + `` component within the client page. + """ + self.json_data[key] = value + + def include_template(self, template, context): + """ + Declare a JS template as required by the current form. This + template will then be included in the final page, so all + widgets behave correctly. + """ + self.included_templates[template] = context + + def render_included_templates(self): + templates = [] + for template, context in self.included_templates.items(): + context = dict(context) + context['form'] = self + templates.append(HTML.literal(render(template, context))) + return HTML.literal('\n').join(templates) + + def render_vue_field(self, fieldname, **kwargs): + """ """ + return self.render_field_complete(fieldname, **kwargs) + + def render_field_complete(self, fieldname, bfield_attrs={}, + session=None): + """ + Render the given field completely, i.e. with ```` + wrapper. Note that this is meant to render *editable* fields, + i.e. showing a widget, unless the field input is hidden. In + other words it's not for "readonly" fields. + """ + dform = self.make_deform_form() + field = dform[fieldname] if fieldname in dform else None + + include = bool(field) + if self.readonly or (not field and fieldname in self.readonly_fields): + include = True + if not include: + return + + if self.field_visible(fieldname): + label = self.get_label(fieldname) + markdowns = self.get_field_markdowns(session=session) + + # these attrs will be for the (*not* the widget) + attrs = { + ':horizontal': 'true', + } + + # add some magic for file input fields + if field and isinstance(field.schema.typ, deform.FileData): + attrs['class_'] = 'file' + + # next we will build array of messages to display..some + # fields always show a "helptext" msg, and some may have + # validation errors.. + field_type = None + messages = [] + + # show errors if present + error_messages = self.get_error_messages(field) if field else None + if error_messages: + field_type = 'is-danger' + messages.extend(error_messages) + + # show helptext if present + # TODO: older logic did this only if field was *not* + # readonly, perhaps should add that back.. + if self.has_helptext(fieldname): + messages.append(self.render_helptext(fieldname)) + + # ..okay now we can declare the field messages and type + if field_type: + attrs['type'] = field_type + if messages: + if len(messages) == 1: + msg = messages[0] + if msg.startswith('`') and msg.endswith('`'): + attrs[':message'] = msg + else: + attrs['message'] = msg + else: + # nb. must pass an array as JSON string + attrs[':message'] = '[{}]'.format(', '.join([ + "'{}'".format(msg.replace("'", r"\'")) + for msg in messages])) + + # merge anything caller provided + attrs.update(bfield_attrs) + + # render the field widget or whatever + if self.readonly or fieldname in self.readonly_fields: + html = self.render_field_value(fieldname) or HTML.tag('span') + if type(html) is str: + html = HTML.tag('span', c=[html]) + elif field: + html = field.serialize(**self.get_renderer_kwargs(fieldname)) + html = HTML.literal(html) + + # may need a complex label + label_contents = [label] + + # add 'help' icon/tooltip if defined + if markdowns.get(fieldname): + icon = HTML.tag('b-icon', size='is-small', pack='fas', + icon='question-circle') + tooltip = render_markdown(markdowns[fieldname]) + + # nb. must apply hack to get